⚝
One Hat Cyber Team
⚝
Your IP:
216.73.216.89
Server IP:
41.128.143.86
Server:
Linux host.raqmix.cloud 6.8.0-1025-azure #30~22.04.1-Ubuntu SMP Wed Mar 12 15:28:20 UTC 2025 x86_64
Server Software:
Apache
PHP Version:
8.3.23
Buat File
|
Buat Folder
Eksekusi
Dir :
~
/
opt
/
plesk
/
node
/
20
/
lib
/
node_modules
/
yarn
/
lib
/
View File Name :
cli.js
#!/opt/plesk/node/20/bin/node module.exports = /******/ (function(modules) { // webpackBootstrap /******/ // The module cache /******/ var installedModules = {}; /******/ /******/ // The require function /******/ function __webpack_require__(moduleId) { /******/ /******/ // Check if module is in cache /******/ if(installedModules[moduleId]) { /******/ return installedModules[moduleId].exports; /******/ } /******/ // Create a new module (and put it into the cache) /******/ var module = installedModules[moduleId] = { /******/ i: moduleId, /******/ l: false, /******/ exports: {} /******/ }; /******/ /******/ // Execute the module function /******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); /******/ /******/ // Flag the module as loaded /******/ module.l = true; /******/ /******/ // Return the exports of the module /******/ return module.exports; /******/ } /******/ /******/ /******/ // expose the modules object (__webpack_modules__) /******/ __webpack_require__.m = modules; /******/ /******/ // expose the module cache /******/ __webpack_require__.c = installedModules; /******/ /******/ // identity function for calling harmony imports with the correct context /******/ __webpack_require__.i = function(value) { return value; }; /******/ /******/ // define getter function for harmony exports /******/ __webpack_require__.d = function(exports, name, getter) { /******/ if(!__webpack_require__.o(exports, name)) { /******/ Object.defineProperty(exports, name, { /******/ configurable: false, /******/ enumerable: true, /******/ get: getter /******/ }); /******/ } /******/ }; /******/ /******/ // getDefaultExport function for compatibility with non-harmony modules /******/ __webpack_require__.n = function(module) { /******/ var getter = module && module.__esModule ? /******/ function getDefault() { return module['default']; } : /******/ function getModuleExports() { return module; }; /******/ __webpack_require__.d(getter, 'a', getter); /******/ return getter; /******/ }; /******/ /******/ // Object.prototype.hasOwnProperty.call /******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); }; /******/ /******/ // __webpack_public_path__ /******/ __webpack_require__.p = ""; /******/ /******/ // Load entry module and return exports /******/ return __webpack_require__(__webpack_require__.s = 504); /******/ }) /************************************************************************/ /******/ ([ /* 0 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (immutable) */ __webpack_exports__["a"] = __extends; /* unused harmony export __assign */ /* unused harmony export __rest */ /* unused harmony export __decorate */ /* unused harmony export __param */ /* unused harmony export __metadata */ /* unused harmony export __awaiter */ /* unused harmony export __generator */ /* unused harmony export __exportStar */ /* unused harmony export __values */ /* unused harmony export __read */ /* unused harmony export __spread */ /* unused harmony export __await */ /* unused harmony export __asyncGenerator */ /* unused harmony export __asyncDelegator */ /* unused harmony export __asyncValues */ /* unused harmony export __makeTemplateObject */ /* unused harmony export __importStar */ /* unused harmony export __importDefault */ /*! ***************************************************************************** Copyright (c) Microsoft Corporation. All rights reserved. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 THIS CODE IS PROVIDED ON AN *AS IS* BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION ANY IMPLIED WARRANTIES OR CONDITIONS OF TITLE, FITNESS FOR A PARTICULAR PURPOSE, MERCHANTABLITY OR NON-INFRINGEMENT. See the Apache Version 2.0 License for specific language governing permissions and limitations under the License. ***************************************************************************** */ /* global Reflect, Promise */ var extendStatics = function(d, b) { extendStatics = Object.setPrototypeOf || ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) || function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; }; return extendStatics(d, b); }; function __extends(d, b) { extendStatics(d, b); function __() { this.constructor = d; } d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __()); } var __assign = function() { __assign = Object.assign || function __assign(t) { for (var s, i = 1, n = arguments.length; i < n; i++) { s = arguments[i]; for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p]; } return t; } return __assign.apply(this, arguments); } function __rest(s, e) { var t = {}; for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0) t[p] = s[p]; if (s != null && typeof Object.getOwnPropertySymbols === "function") for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) if (e.indexOf(p[i]) < 0) t[p[i]] = s[p[i]]; return t; } function __decorate(decorators, target, key, desc) { var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d; if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc); else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r; return c > 3 && r && Object.defineProperty(target, key, r), r; } function __param(paramIndex, decorator) { return function (target, key) { decorator(target, key, paramIndex); } } function __metadata(metadataKey, metadataValue) { if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue); } function __awaiter(thisArg, _arguments, P, generator) { return new (P || (P = Promise))(function (resolve, reject) { function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } function step(result) { result.done ? resolve(result.value) : new P(function (resolve) { resolve(result.value); }).then(fulfilled, rejected); } step((generator = generator.apply(thisArg, _arguments || [])).next()); }); } function __generator(thisArg, body) { var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g; return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g; function verb(n) { return function (v) { return step([n, v]); }; } function step(op) { if (f) throw new TypeError("Generator is already executing."); while (_) try { if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t; if (y = 0, t) op = [op[0] & 2, t.value]; switch (op[0]) { case 0: case 1: t = op; break; case 4: _.label++; return { value: op[1], done: false }; case 5: _.label++; y = op[1]; op = [0]; continue; case 7: op = _.ops.pop(); _.trys.pop(); continue; default: if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; } if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; } if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; } if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; } if (t[2]) _.ops.pop(); _.trys.pop(); continue; } op = body.call(thisArg, _); } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; } if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true }; } } function __exportStar(m, exports) { for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; } function __values(o) { var m = typeof Symbol === "function" && o[Symbol.iterator], i = 0; if (m) return m.call(o); return { next: function () { if (o && i >= o.length) o = void 0; return { value: o && o[i++], done: !o }; } }; } function __read(o, n) { var m = typeof Symbol === "function" && o[Symbol.iterator]; if (!m) return o; var i = m.call(o), r, ar = [], e; try { while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value); } catch (error) { e = { error: error }; } finally { try { if (r && !r.done && (m = i["return"])) m.call(i); } finally { if (e) throw e.error; } } return ar; } function __spread() { for (var ar = [], i = 0; i < arguments.length; i++) ar = ar.concat(__read(arguments[i])); return ar; } function __await(v) { return this instanceof __await ? (this.v = v, this) : new __await(v); } function __asyncGenerator(thisArg, _arguments, generator) { if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); var g = generator.apply(thisArg, _arguments || []), i, q = []; return i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i; function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; } function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } } function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); } function fulfill(value) { resume("next", value); } function reject(value) { resume("throw", value); } function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); } } function __asyncDelegator(o) { var i, p; return i = {}, verb("next"), verb("throw", function (e) { throw e; }), verb("return"), i[Symbol.iterator] = function () { return this; }, i; function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === "return" } : f ? f(v) : v; } : f; } } function __asyncValues(o) { if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); var m = o[Symbol.asyncIterator], i; return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i); function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; } function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); } } function __makeTemplateObject(cooked, raw) { if (Object.defineProperty) { Object.defineProperty(cooked, "raw", { value: raw }); } else { cooked.raw = raw; } return cooked; }; function __importStar(mod) { if (mod && mod.__esModule) return mod; var result = {}; if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; result.default = mod; return result; } function __importDefault(mod) { return (mod && mod.__esModule) ? mod : { default: mod }; } /***/ }), /* 1 */ /***/ (function(module, exports) { module.exports = require("path"); /***/ }), /* 2 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; exports.__esModule = true; var _promise = __webpack_require__(7); var _promise2 = _interopRequireDefault(_promise); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } exports.default = function (fn) { return function () { var gen = fn.apply(this, arguments); return new _promise2.default(function (resolve, reject) { function step(key, arg) { try { var info = gen[key](arg); var value = info.value; } catch (error) { reject(error); return; } if (info.done) { resolve(value); } else { return _promise2.default.resolve(value).then(function (value) { step("next", value); }, function (err) { step("throw", err); }); } } return step("next"); }); }; }; /***/ }), /* 3 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; exports.__esModule = true; exports.default = function (instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }; /***/ }), /* 4 */ /***/ (function(module, exports, __webpack_require__) { module.exports = { "default": __webpack_require__(591), __esModule: true }; /***/ }), /* 5 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subscriber; }); /* unused harmony export SafeSubscriber */ /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(0); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isFunction__ = __webpack_require__(143); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Observer__ = __webpack_require__(390); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(31); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__ = __webpack_require__(262); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__config__ = __webpack_require__(176); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__util_hostReportError__ = __webpack_require__(264); /** PURE_IMPORTS_START tslib,_util_isFunction,_Observer,_Subscription,_internal_symbol_rxSubscriber,_config,_util_hostReportError PURE_IMPORTS_END */ var Subscriber = /*@__PURE__*/ (function (_super) { __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](Subscriber, _super); function Subscriber(destinationOrNext, error, complete) { var _this = _super.call(this) || this; _this.syncErrorValue = null; _this.syncErrorThrown = false; _this.syncErrorThrowable = false; _this.isStopped = false; _this._parentSubscription = null; switch (arguments.length) { case 0: _this.destination = __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */]; break; case 1: if (!destinationOrNext) { _this.destination = __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */]; break; } if (typeof destinationOrNext === 'object') { if (destinationOrNext instanceof Subscriber) { _this.syncErrorThrowable = destinationOrNext.syncErrorThrowable; _this.destination = destinationOrNext; destinationOrNext.add(_this); } else { _this.syncErrorThrowable = true; _this.destination = new SafeSubscriber(_this, destinationOrNext); } break; } default: _this.syncErrorThrowable = true; _this.destination = new SafeSubscriber(_this, destinationOrNext, error, complete); break; } return _this; } Subscriber.prototype[__WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__["a" /* rxSubscriber */]] = function () { return this; }; Subscriber.create = function (next, error, complete) { var subscriber = new Subscriber(next, error, complete); subscriber.syncErrorThrowable = false; return subscriber; }; Subscriber.prototype.next = function (value) { if (!this.isStopped) { this._next(value); } }; Subscriber.prototype.error = function (err) { if (!this.isStopped) { this.isStopped = true; this._error(err); } }; Subscriber.prototype.complete = function () { if (!this.isStopped) { this.isStopped = true; this._complete(); } }; Subscriber.prototype.unsubscribe = function () { if (this.closed) { return; } this.isStopped = true; _super.prototype.unsubscribe.call(this); }; Subscriber.prototype._next = function (value) { this.destination.next(value); }; Subscriber.prototype._error = function (err) { this.destination.error(err); this.unsubscribe(); }; Subscriber.prototype._complete = function () { this.destination.complete(); this.unsubscribe(); }; Subscriber.prototype._unsubscribeAndRecycle = function () { var _a = this, _parent = _a._parent, _parents = _a._parents; this._parent = null; this._parents = null; this.unsubscribe(); this.closed = false; this.isStopped = false; this._parent = _parent; this._parents = _parents; this._parentSubscription = null; return this; }; return Subscriber; }(__WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */])); var SafeSubscriber = /*@__PURE__*/ (function (_super) { __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](SafeSubscriber, _super); function SafeSubscriber(_parentSubscriber, observerOrNext, error, complete) { var _this = _super.call(this) || this; _this._parentSubscriber = _parentSubscriber; var next; var context = _this; if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isFunction__["a" /* isFunction */])(observerOrNext)) { next = observerOrNext; } else if (observerOrNext) { next = observerOrNext.next; error = observerOrNext.error; complete = observerOrNext.complete; if (observerOrNext !== __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */]) { context = Object.create(observerOrNext); if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isFunction__["a" /* isFunction */])(context.unsubscribe)) { _this.add(context.unsubscribe.bind(context)); } context.unsubscribe = _this.unsubscribe.bind(_this); } } _this._context = context; _this._next = next; _this._error = error; _this._complete = complete; return _this; } SafeSubscriber.prototype.next = function (value) { if (!this.isStopped && this._next) { var _parentSubscriber = this._parentSubscriber; if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) { this.__tryOrUnsub(this._next, value); } else if (this.__tryOrSetError(_parentSubscriber, this._next, value)) { this.unsubscribe(); } } }; SafeSubscriber.prototype.error = function (err) { if (!this.isStopped) { var _parentSubscriber = this._parentSubscriber; var useDeprecatedSynchronousErrorHandling = __WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling; if (this._error) { if (!useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) { this.__tryOrUnsub(this._error, err); this.unsubscribe(); } else { this.__tryOrSetError(_parentSubscriber, this._error, err); this.unsubscribe(); } } else if (!_parentSubscriber.syncErrorThrowable) { this.unsubscribe(); if (useDeprecatedSynchronousErrorHandling) { throw err; } __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err); } else { if (useDeprecatedSynchronousErrorHandling) { _parentSubscriber.syncErrorValue = err; _parentSubscriber.syncErrorThrown = true; } else { __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err); } this.unsubscribe(); } } }; SafeSubscriber.prototype.complete = function () { var _this = this; if (!this.isStopped) { var _parentSubscriber = this._parentSubscriber; if (this._complete) { var wrappedComplete = function () { return _this._complete.call(_this._context); }; if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) { this.__tryOrUnsub(wrappedComplete); this.unsubscribe(); } else { this.__tryOrSetError(_parentSubscriber, wrappedComplete); this.unsubscribe(); } } else { this.unsubscribe(); } } }; SafeSubscriber.prototype.__tryOrUnsub = function (fn, value) { try { fn.call(this._context, value); } catch (err) { this.unsubscribe(); if (__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { throw err; } else { __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err); } } }; SafeSubscriber.prototype.__tryOrSetError = function (parent, fn, value) { if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { throw new Error('bad call'); } try { fn.call(this._context, value); } catch (err) { if (__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { parent.syncErrorValue = err; parent.syncErrorThrown = true; return true; } else { __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err); return true; } } return false; }; SafeSubscriber.prototype._unsubscribe = function () { var _parentSubscriber = this._parentSubscriber; this._context = null; this._parentSubscriber = null; _parentSubscriber.unsubscribe(); }; return SafeSubscriber; }(Subscriber)); //# sourceMappingURL=Subscriber.js.map /***/ }), /* 6 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); exports.OneTimePasswordError = exports.ResponseError = exports.ProcessTermError = exports.SecurityError = exports.ProcessSpawnError = exports.MessageError = undefined; var _create; function _load_create() { return _create = _interopRequireDefault(__webpack_require__(210)); } var _getPrototypeOf; function _load_getPrototypeOf() { return _getPrototypeOf = _interopRequireDefault(__webpack_require__(550)); } var _setPrototypeOf; function _load_setPrototypeOf() { return _setPrototypeOf = _interopRequireDefault(__webpack_require__(211)); } var _from; function _load_from() { return _from = _interopRequireDefault(__webpack_require__(53)); } var _construct; function _load_construct() { return _construct = _interopRequireDefault(__webpack_require__(552)); } var _classCallCheck2; function _load_classCallCheck() { return _classCallCheck2 = _interopRequireDefault(__webpack_require__(3)); } var _possibleConstructorReturn2; function _load_possibleConstructorReturn() { return _possibleConstructorReturn2 = _interopRequireDefault(__webpack_require__(11)); } var _inherits2; function _load_inherits() { return _inherits2 = _interopRequireDefault(__webpack_require__(10)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } function _extendableBuiltin5(cls) { function ExtendableBuiltin() { var instance = (0, (_construct || _load_construct()).default)(cls, (0, (_from || _load_from()).default)(arguments)); (0, (_setPrototypeOf || _load_setPrototypeOf()).default)(instance, (0, (_getPrototypeOf || _load_getPrototypeOf()).default)(this)); return instance; } ExtendableBuiltin.prototype = (0, (_create || _load_create()).default)(cls.prototype, { constructor: { value: cls, enumerable: false, writable: true, configurable: true } }); if ((_setPrototypeOf || _load_setPrototypeOf()).default) { (0, (_setPrototypeOf || _load_setPrototypeOf()).default)(ExtendableBuiltin, cls); } else { ExtendableBuiltin.__proto__ = cls; } return ExtendableBuiltin; } function _extendableBuiltin3(cls) { function ExtendableBuiltin() { var instance = (0, (_construct || _load_construct()).default)(cls, (0, (_from || _load_from()).default)(arguments)); (0, (_setPrototypeOf || _load_setPrototypeOf()).default)(instance, (0, (_getPrototypeOf || _load_getPrototypeOf()).default)(this)); return instance; } ExtendableBuiltin.prototype = (0, (_create || _load_create()).default)(cls.prototype, { constructor: { value: cls, enumerable: false, writable: true, configurable: true } }); if ((_setPrototypeOf || _load_setPrototypeOf()).default) { (0, (_setPrototypeOf || _load_setPrototypeOf()).default)(ExtendableBuiltin, cls); } else { ExtendableBuiltin.__proto__ = cls; } return ExtendableBuiltin; } function _extendableBuiltin(cls) { function ExtendableBuiltin() { var instance = (0, (_construct || _load_construct()).default)(cls, (0, (_from || _load_from()).default)(arguments)); (0, (_setPrototypeOf || _load_setPrototypeOf()).default)(instance, (0, (_getPrototypeOf || _load_getPrototypeOf()).default)(this)); return instance; } ExtendableBuiltin.prototype = (0, (_create || _load_create()).default)(cls.prototype, { constructor: { value: cls, enumerable: false, writable: true, configurable: true } }); if ((_setPrototypeOf || _load_setPrototypeOf()).default) { (0, (_setPrototypeOf || _load_setPrototypeOf()).default)(ExtendableBuiltin, cls); } else { ExtendableBuiltin.__proto__ = cls; } return ExtendableBuiltin; } var MessageError = exports.MessageError = function (_extendableBuiltin2) { (0, (_inherits2 || _load_inherits()).default)(MessageError, _extendableBuiltin2); function MessageError(msg, code) { (0, (_classCallCheck2 || _load_classCallCheck()).default)(this, MessageError); var _this = (0, (_possibleConstructorReturn2 || _load_possibleConstructorReturn()).default)(this, _extendableBuiltin2.call(this, msg)); _this.code = code; return _this; } return MessageError; }(_extendableBuiltin(Error)); var ProcessSpawnError = exports.ProcessSpawnError = function (_MessageError) { (0, (_inherits2 || _load_inherits()).default)(ProcessSpawnError, _MessageError); function ProcessSpawnError(msg, code, process) { (0, (_classCallCheck2 || _load_classCallCheck()).default)(this, ProcessSpawnError); var _this2 = (0, (_possibleConstructorReturn2 || _load_possibleConstructorReturn()).default)(this, _MessageError.call(this, msg, code)); _this2.process = process; return _this2; } return ProcessSpawnError; }(MessageError); var SecurityError = exports.SecurityError = function (_MessageError2) { (0, (_inherits2 || _load_inherits()).default)(SecurityError, _MessageError2); function SecurityError() { (0, (_classCallCheck2 || _load_classCallCheck()).default)(this, SecurityError); return (0, (_possibleConstructorReturn2 || _load_possibleConstructorReturn()).default)(this, _MessageError2.apply(this, arguments)); } return SecurityError; }(MessageError); var ProcessTermError = exports.ProcessTermError = function (_MessageError3) { (0, (_inherits2 || _load_inherits()).default)(ProcessTermError, _MessageError3); function ProcessTermError() { (0, (_classCallCheck2 || _load_classCallCheck()).default)(this, ProcessTermError); return (0, (_possibleConstructorReturn2 || _load_possibleConstructorReturn()).default)(this, _MessageError3.apply(this, arguments)); } return ProcessTermError; }(MessageError); var ResponseError = exports.ResponseError = function (_extendableBuiltin4) { (0, (_inherits2 || _load_inherits()).default)(ResponseError, _extendableBuiltin4); function ResponseError(msg, responseCode) { (0, (_classCallCheck2 || _load_classCallCheck()).default)(this, ResponseError); var _this5 = (0, (_possibleConstructorReturn2 || _load_possibleConstructorReturn()).default)(this, _extendableBuiltin4.call(this, msg)); _this5.responseCode = responseCode; return _this5; } return ResponseError; }(_extendableBuiltin3(Error)); var OneTimePasswordError = exports.OneTimePasswordError = function (_extendableBuiltin6) { (0, (_inherits2 || _load_inherits()).default)(OneTimePasswordError, _extendableBuiltin6); function OneTimePasswordError(notice) { (0, (_classCallCheck2 || _load_classCallCheck()).default)(this, OneTimePasswordError); var _this6 = (0, (_possibleConstructorReturn2 || _load_possibleConstructorReturn()).default)(this, _extendableBuiltin6.call(this)); _this6.notice = notice; return _this6; } return OneTimePasswordError; }(_extendableBuiltin5(Error)); /***/ }), /* 7 */ /***/ (function(module, exports, __webpack_require__) { module.exports = { "default": __webpack_require__(600), __esModule: true }; /***/ }), /* 8 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); exports.getFirstSuitableFolder = exports.readFirstAvailableStream = exports.makeTempDir = exports.hardlinksWork = exports.writeFilePreservingEol = exports.getFileSizeOnDisk = exports.walk = exports.symlink = exports.find = exports.readJsonAndFile = exports.readJson = exports.readFileAny = exports.hardlinkBulk = exports.copyBulk = exports.unlink = exports.glob = exports.link = exports.chmod = exports.lstat = exports.exists = exports.mkdirp = exports.stat = exports.access = exports.rename = exports.readdir = exports.realpath = exports.readlink = exports.writeFile = exports.open = exports.readFileBuffer = exports.lockQueue = exports.constants = undefined; var _map; function _load_map() { return _map = _interopRequireDefault(__webpack_require__(42)); } var _getIterator2; function _load_getIterator() { return _getIterator2 = _interopRequireDefault(__webpack_require__(4)); } var _promise; function _load_promise() { return _promise = _interopRequireDefault(__webpack_require__(7)); } var _set; function _load_set() { return _set = _interopRequireDefault(__webpack_require__(16)); } var _asyncToGenerator2; function _load_asyncToGenerator() { return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2)); } var buildActionsForCopy = function () { var _ref = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) { // var build = function () { var _ref5 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { var src = data.src, dest = data.dest, type = data.type; var onFresh = data.onFresh || noop; var onDone = data.onDone || noop; // TODO https://github.com/yarnpkg/yarn/issues/3751 // related to bundled dependencies handling if (files.has(dest.toLowerCase())) { reporter.verbose(`The case-insensitive file ${dest} shouldn't be copied twice in one bulk copy`); } else { files.add(dest.toLowerCase()); } if (type === 'symlink') { yield mkdirp((_path2 || _load_path()).default.dirname(dest)); onFresh(); actions.symlink.push({ dest, linkname: src }); onDone(); return; } if (events.ignoreBasenames.indexOf((_path2 || _load_path()).default.basename(src)) >= 0) { // ignored file return; } var srcStat = yield lstat(src); var srcFiles = void 0; if (srcStat.isDirectory()) { srcFiles = yield readdir(src); } var destStat = void 0; try { // try accessing the destination destStat = yield lstat(dest); } catch (e) { // proceed if destination doesn't exist, otherwise error if (e.code !== 'ENOENT') { throw e; } } // if destination exists if (destStat) { var bothSymlinks = srcStat.isSymbolicLink() && destStat.isSymbolicLink(); var bothFolders = srcStat.isDirectory() && destStat.isDirectory(); var bothFiles = srcStat.isFile() && destStat.isFile(); // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving // us modes that aren't valid. investigate this, it's generally safe to proceed. /* if (srcStat.mode !== destStat.mode) { try { await access(dest, srcStat.mode); } catch (err) {} } */ if (bothFiles && artifactFiles.has(dest)) { // this file gets changed during build, likely by a custom install script. Don't bother checking it. onDone(); reporter.verbose(reporter.lang('verboseFileSkipArtifact', src)); return; } if (bothFiles && srcStat.size === destStat.size && (0, (_fsNormalized || _load_fsNormalized()).fileDatesEqual)(srcStat.mtime, destStat.mtime)) { // we can safely assume this is the same file onDone(); reporter.verbose(reporter.lang('verboseFileSkip', src, dest, srcStat.size, +srcStat.mtime)); return; } if (bothSymlinks) { var srcReallink = yield readlink(src); if (srcReallink === (yield readlink(dest))) { // if both symlinks are the same then we can continue on onDone(); reporter.verbose(reporter.lang('verboseFileSkipSymlink', src, dest, srcReallink)); return; } } if (bothFolders) { // mark files that aren't in this folder as possibly extraneous var destFiles = yield readdir(dest); invariant(srcFiles, 'src files not initialised'); for (var _iterator4 = destFiles, _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator4);;) { var _ref6; if (_isArray4) { if (_i4 >= _iterator4.length) break; _ref6 = _iterator4[_i4++]; } else { _i4 = _iterator4.next(); if (_i4.done) break; _ref6 = _i4.value; } var _file2 = _ref6; if (srcFiles.indexOf(_file2) < 0) { var _loc = (_path2 || _load_path()).default.join(dest, _file2); possibleExtraneous.add(_loc); if ((yield lstat(_loc)).isDirectory()) { for (var _iterator5 = yield readdir(_loc), _isArray5 = Array.isArray(_iterator5), _i5 = 0, _iterator5 = _isArray5 ? _iterator5 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator5);;) { var _ref7; if (_isArray5) { if (_i5 >= _iterator5.length) break; _ref7 = _iterator5[_i5++]; } else { _i5 = _iterator5.next(); if (_i5.done) break; _ref7 = _i5.value; } var _file3 = _ref7; possibleExtraneous.add((_path2 || _load_path()).default.join(_loc, _file3)); } } } } } } if (destStat && destStat.isSymbolicLink()) { yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dest); destStat = null; } if (srcStat.isSymbolicLink()) { onFresh(); var _linkname = yield readlink(src); actions.symlink.push({ dest, linkname: _linkname }); onDone(); } else if (srcStat.isDirectory()) { yield* function* () { if (!destStat) { reporter.verbose(reporter.lang('verboseFileFolder', dest)); yield mkdirp(dest); } var destParts = dest.split((_path2 || _load_path()).default.sep); while (destParts.length) { files.add(destParts.join((_path2 || _load_path()).default.sep).toLowerCase()); destParts.pop(); } // push all files to queue invariant(srcFiles, 'src files not initialised'); var remaining = srcFiles.length; if (!remaining) { onDone(); } for (var _iterator6 = srcFiles, _isArray6 = Array.isArray(_iterator6), _i6 = 0, _iterator6 = _isArray6 ? _iterator6 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator6);;) { var _ref8; if (_isArray6) { if (_i6 >= _iterator6.length) break; _ref8 = _iterator6[_i6++]; } else { _i6 = _iterator6.next(); if (_i6.done) break; _ref8 = _i6.value; } var _file4 = _ref8; queue.push({ dest: (_path2 || _load_path()).default.join(dest, _file4), onFresh, onDone: function (_onDone) { function onDone() { return _onDone.apply(this, arguments); } onDone.toString = function () { return _onDone.toString(); }; return onDone; }(function () { if (--remaining === 0) { onDone(); } }), src: (_path2 || _load_path()).default.join(src, _file4) }); } }(); } else if (srcStat.isFile()) { onFresh(); actions.file.push({ src, dest, atime: srcStat.atime, mtime: srcStat.mtime, mode: srcStat.mode }); onDone(); } else { throw new Error(`unsure how to copy this: ${src}`); } }); return function build(_x5) { return _ref5.apply(this, arguments); }; }(); var artifactFiles = new (_set || _load_set()).default(events.artifactFiles || []); var files = new (_set || _load_set()).default(); // initialise events var _loop = function _loop(item) { var onDone = item.onDone; item.onDone = function () { events.onProgress(item.dest); if (onDone) { onDone(); } }; }; for (var _iterator = queue, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : (0, (_getIterator2 || _load_getIterator()).default)(_iterator);;) { var _ref2; if (_isArray) { if (_i >= _iterator.length) break; _ref2 = _iterator[_i++]; } else { _i = _iterator.next(); if (_i.done) break; _ref2 = _i.value; } var item = _ref2; _loop(item); } events.onStart(queue.length); // start building actions var actions = { file: [], symlink: [], link: [] }; // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items // at a time due to the requirement to push items onto the queue while (queue.length) { var items = queue.splice(0, CONCURRENT_QUEUE_ITEMS); yield (_promise || _load_promise()).default.all(items.map(build)); } // simulate the existence of some files to prevent considering them extraneous for (var _iterator2 = artifactFiles, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator2);;) { var _ref3; if (_isArray2) { if (_i2 >= _iterator2.length) break; _ref3 = _iterator2[_i2++]; } else { _i2 = _iterator2.next(); if (_i2.done) break; _ref3 = _i2.value; } var _file = _ref3; if (possibleExtraneous.has(_file)) { reporter.verbose(reporter.lang('verboseFilePhantomExtraneous', _file)); possibleExtraneous.delete(_file); } } for (var _iterator3 = possibleExtraneous, _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator3);;) { var _ref4; if (_isArray3) { if (_i3 >= _iterator3.length) break; _ref4 = _iterator3[_i3++]; } else { _i3 = _iterator3.next(); if (_i3.done) break; _ref4 = _i3.value; } var loc = _ref4; if (files.has(loc.toLowerCase())) { possibleExtraneous.delete(loc); } } return actions; }); return function buildActionsForCopy(_x, _x2, _x3, _x4) { return _ref.apply(this, arguments); }; }(); var buildActionsForHardlink = function () { var _ref9 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) { // var build = function () { var _ref13 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { var src = data.src, dest = data.dest; var onFresh = data.onFresh || noop; var onDone = data.onDone || noop; if (files.has(dest.toLowerCase())) { // Fixes issue https://github.com/yarnpkg/yarn/issues/2734 // When bulk hardlinking we have A -> B structure that we want to hardlink to A1 -> B1, // package-linker passes that modules A1 and B1 need to be hardlinked, // the recursive linking algorithm of A1 ends up scheduling files in B1 to be linked twice which will case // an exception. onDone(); return; } files.add(dest.toLowerCase()); if (events.ignoreBasenames.indexOf((_path2 || _load_path()).default.basename(src)) >= 0) { // ignored file return; } var srcStat = yield lstat(src); var srcFiles = void 0; if (srcStat.isDirectory()) { srcFiles = yield readdir(src); } var destExists = yield exists(dest); if (destExists) { var destStat = yield lstat(dest); var bothSymlinks = srcStat.isSymbolicLink() && destStat.isSymbolicLink(); var bothFolders = srcStat.isDirectory() && destStat.isDirectory(); var bothFiles = srcStat.isFile() && destStat.isFile(); if (srcStat.mode !== destStat.mode) { try { yield access(dest, srcStat.mode); } catch (err) { // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving // us modes that aren't valid. investigate this, it's generally safe to proceed. reporter.verbose(err); } } if (bothFiles && artifactFiles.has(dest)) { // this file gets changed during build, likely by a custom install script. Don't bother checking it. onDone(); reporter.verbose(reporter.lang('verboseFileSkipArtifact', src)); return; } // correct hardlink if (bothFiles && srcStat.ino !== null && srcStat.ino === destStat.ino) { onDone(); reporter.verbose(reporter.lang('verboseFileSkip', src, dest, srcStat.ino)); return; } if (bothSymlinks) { var srcReallink = yield readlink(src); if (srcReallink === (yield readlink(dest))) { // if both symlinks are the same then we can continue on onDone(); reporter.verbose(reporter.lang('verboseFileSkipSymlink', src, dest, srcReallink)); return; } } if (bothFolders) { // mark files that aren't in this folder as possibly extraneous var destFiles = yield readdir(dest); invariant(srcFiles, 'src files not initialised'); for (var _iterator10 = destFiles, _isArray10 = Array.isArray(_iterator10), _i10 = 0, _iterator10 = _isArray10 ? _iterator10 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator10);;) { var _ref14; if (_isArray10) { if (_i10 >= _iterator10.length) break; _ref14 = _iterator10[_i10++]; } else { _i10 = _iterator10.next(); if (_i10.done) break; _ref14 = _i10.value; } var _file6 = _ref14; if (srcFiles.indexOf(_file6) < 0) { var _loc2 = (_path2 || _load_path()).default.join(dest, _file6); possibleExtraneous.add(_loc2); if ((yield lstat(_loc2)).isDirectory()) { for (var _iterator11 = yield readdir(_loc2), _isArray11 = Array.isArray(_iterator11), _i11 = 0, _iterator11 = _isArray11 ? _iterator11 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator11);;) { var _ref15; if (_isArray11) { if (_i11 >= _iterator11.length) break; _ref15 = _iterator11[_i11++]; } else { _i11 = _iterator11.next(); if (_i11.done) break; _ref15 = _i11.value; } var _file7 = _ref15; possibleExtraneous.add((_path2 || _load_path()).default.join(_loc2, _file7)); } } } } } } if (srcStat.isSymbolicLink()) { onFresh(); var _linkname2 = yield readlink(src); actions.symlink.push({ dest, linkname: _linkname2 }); onDone(); } else if (srcStat.isDirectory()) { yield* function* () { reporter.verbose(reporter.lang('verboseFileFolder', dest)); yield mkdirp(dest); var destParts = dest.split((_path2 || _load_path()).default.sep); while (destParts.length) { files.add(destParts.join((_path2 || _load_path()).default.sep).toLowerCase()); destParts.pop(); } // push all files to queue invariant(srcFiles, 'src files not initialised'); var remaining = srcFiles.length; if (!remaining) { onDone(); } for (var _iterator12 = srcFiles, _isArray12 = Array.isArray(_iterator12), _i12 = 0, _iterator12 = _isArray12 ? _iterator12 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator12);;) { var _ref16; if (_isArray12) { if (_i12 >= _iterator12.length) break; _ref16 = _iterator12[_i12++]; } else { _i12 = _iterator12.next(); if (_i12.done) break; _ref16 = _i12.value; } var _file8 = _ref16; queue.push({ onFresh, src: (_path2 || _load_path()).default.join(src, _file8), dest: (_path2 || _load_path()).default.join(dest, _file8), onDone: function (_onDone2) { function onDone() { return _onDone2.apply(this, arguments); } onDone.toString = function () { return _onDone2.toString(); }; return onDone; }(function () { if (--remaining === 0) { onDone(); } }) }); } }(); } else if (srcStat.isFile()) { onFresh(); actions.link.push({ src, dest, removeDest: destExists }); onDone(); } else { throw new Error(`unsure how to copy this: ${src}`); } }); return function build(_x10) { return _ref13.apply(this, arguments); }; }(); var artifactFiles = new (_set || _load_set()).default(events.artifactFiles || []); var files = new (_set || _load_set()).default(); // initialise events var _loop2 = function _loop2(item) { var onDone = item.onDone || noop; item.onDone = function () { events.onProgress(item.dest); onDone(); }; }; for (var _iterator7 = queue, _isArray7 = Array.isArray(_iterator7), _i7 = 0, _iterator7 = _isArray7 ? _iterator7 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator7);;) { var _ref10; if (_isArray7) { if (_i7 >= _iterator7.length) break; _ref10 = _iterator7[_i7++]; } else { _i7 = _iterator7.next(); if (_i7.done) break; _ref10 = _i7.value; } var item = _ref10; _loop2(item); } events.onStart(queue.length); // start building actions var actions = { file: [], symlink: [], link: [] }; // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items // at a time due to the requirement to push items onto the queue while (queue.length) { var items = queue.splice(0, CONCURRENT_QUEUE_ITEMS); yield (_promise || _load_promise()).default.all(items.map(build)); } // simulate the existence of some files to prevent considering them extraneous for (var _iterator8 = artifactFiles, _isArray8 = Array.isArray(_iterator8), _i8 = 0, _iterator8 = _isArray8 ? _iterator8 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator8);;) { var _ref11; if (_isArray8) { if (_i8 >= _iterator8.length) break; _ref11 = _iterator8[_i8++]; } else { _i8 = _iterator8.next(); if (_i8.done) break; _ref11 = _i8.value; } var _file5 = _ref11; if (possibleExtraneous.has(_file5)) { reporter.verbose(reporter.lang('verboseFilePhantomExtraneous', _file5)); possibleExtraneous.delete(_file5); } } for (var _iterator9 = possibleExtraneous, _isArray9 = Array.isArray(_iterator9), _i9 = 0, _iterator9 = _isArray9 ? _iterator9 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator9);;) { var _ref12; if (_isArray9) { if (_i9 >= _iterator9.length) break; _ref12 = _iterator9[_i9++]; } else { _i9 = _iterator9.next(); if (_i9.done) break; _ref12 = _i9.value; } var loc = _ref12; if (files.has(loc.toLowerCase())) { possibleExtraneous.delete(loc); } } return actions; }); return function buildActionsForHardlink(_x6, _x7, _x8, _x9) { return _ref9.apply(this, arguments); }; }(); var copyBulk = exports.copyBulk = function () { var _ref17 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) { var events = { onStart: _events && _events.onStart || noop, onProgress: _events && _events.onProgress || noop, possibleExtraneous: _events ? _events.possibleExtraneous : new (_set || _load_set()).default(), ignoreBasenames: _events && _events.ignoreBasenames || [], artifactFiles: _events && _events.artifactFiles || [] }; var actions = yield buildActionsForCopy(queue, events, events.possibleExtraneous, reporter); events.onStart(actions.file.length + actions.symlink.length + actions.link.length); var fileActions = actions.file; var currentlyWriting = new (_map || _load_map()).default(); yield (_promise2 || _load_promise2()).queue(fileActions, function () { var _ref18 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { var writePromise = void 0; while (writePromise = currentlyWriting.get(data.dest)) { yield writePromise; } reporter.verbose(reporter.lang('verboseFileCopy', data.src, data.dest)); var copier = (0, (_fsNormalized || _load_fsNormalized()).copyFile)(data, function () { return currentlyWriting.delete(data.dest); }); currentlyWriting.set(data.dest, copier); events.onProgress(data.dest); return copier; }); return function (_x14) { return _ref18.apply(this, arguments); }; }(), CONCURRENT_QUEUE_ITEMS); // we need to copy symlinks last as they could reference files we were copying var symlinkActions = actions.symlink; yield (_promise2 || _load_promise2()).queue(symlinkActions, function (data) { var linkname = (_path2 || _load_path()).default.resolve((_path2 || _load_path()).default.dirname(data.dest), data.linkname); reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname)); return symlink(linkname, data.dest); }); }); return function copyBulk(_x11, _x12, _x13) { return _ref17.apply(this, arguments); }; }(); var hardlinkBulk = exports.hardlinkBulk = function () { var _ref19 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) { var events = { onStart: _events && _events.onStart || noop, onProgress: _events && _events.onProgress || noop, possibleExtraneous: _events ? _events.possibleExtraneous : new (_set || _load_set()).default(), artifactFiles: _events && _events.artifactFiles || [], ignoreBasenames: [] }; var actions = yield buildActionsForHardlink(queue, events, events.possibleExtraneous, reporter); events.onStart(actions.file.length + actions.symlink.length + actions.link.length); var fileActions = actions.link; yield (_promise2 || _load_promise2()).queue(fileActions, function () { var _ref20 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { reporter.verbose(reporter.lang('verboseFileLink', data.src, data.dest)); if (data.removeDest) { yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(data.dest); } yield link(data.src, data.dest); }); return function (_x18) { return _ref20.apply(this, arguments); }; }(), CONCURRENT_QUEUE_ITEMS); // we need to copy symlinks last as they could reference files we were copying var symlinkActions = actions.symlink; yield (_promise2 || _load_promise2()).queue(symlinkActions, function (data) { var linkname = (_path2 || _load_path()).default.resolve((_path2 || _load_path()).default.dirname(data.dest), data.linkname); reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname)); return symlink(linkname, data.dest); }); }); return function hardlinkBulk(_x15, _x16, _x17) { return _ref19.apply(this, arguments); }; }(); var readFileAny = exports.readFileAny = function () { var _ref21 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (files) { for (var _iterator13 = files, _isArray13 = Array.isArray(_iterator13), _i13 = 0, _iterator13 = _isArray13 ? _iterator13 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator13);;) { var _ref22; if (_isArray13) { if (_i13 >= _iterator13.length) break; _ref22 = _iterator13[_i13++]; } else { _i13 = _iterator13.next(); if (_i13.done) break; _ref22 = _i13.value; } var _file9 = _ref22; if (yield exists(_file9)) { return readFile(_file9); } } return null; }); return function readFileAny(_x19) { return _ref21.apply(this, arguments); }; }(); var readJson = exports.readJson = function () { var _ref23 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { return (yield readJsonAndFile(loc)).object; }); return function readJson(_x20) { return _ref23.apply(this, arguments); }; }(); var readJsonAndFile = exports.readJsonAndFile = function () { var _ref24 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { var file = yield readFile(loc); try { return { object: (0, (_map2 || _load_map2()).default)(JSON.parse(stripBOM(file))), content: file }; } catch (err) { err.message = `${loc}: ${err.message}`; throw err; } }); return function readJsonAndFile(_x21) { return _ref24.apply(this, arguments); }; }(); var find = exports.find = function () { var _ref25 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (filename, dir) { var parts = dir.split((_path2 || _load_path()).default.sep); while (parts.length) { var loc = parts.concat(filename).join((_path2 || _load_path()).default.sep); if (yield exists(loc)) { return loc; } else { parts.pop(); } } return false; }); return function find(_x22, _x23) { return _ref25.apply(this, arguments); }; }(); var symlink = exports.symlink = function () { var _ref26 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (src, dest) { if (process.platform !== 'win32') { // use relative paths otherwise which will be retained if the directory is moved src = (_path2 || _load_path()).default.relative((_path2 || _load_path()).default.dirname(dest), src); // When path.relative returns an empty string for the current directory, we should instead use // '.', which is a valid fs.symlink target. src = src || '.'; } try { var stats = yield lstat(dest); if (stats.isSymbolicLink()) { var resolved = dest; if (resolved === src) { return; } } } catch (err) { if (err.code !== 'ENOENT') { throw err; } } // We use rimraf for unlink which never throws an ENOENT on missing target yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dest); if (process.platform === 'win32') { // use directory junctions if possible on win32, this requires absolute paths yield fsSymlink(src, dest, 'junction'); } else { yield fsSymlink(src, dest); } }); return function symlink(_x24, _x25) { return _ref26.apply(this, arguments); }; }(); var walk = exports.walk = function () { var _ref27 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir, relativeDir) { var ignoreBasenames = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : new (_set || _load_set()).default(); var files = []; var filenames = yield readdir(dir); if (ignoreBasenames.size) { filenames = filenames.filter(function (name) { return !ignoreBasenames.has(name); }); } for (var _iterator14 = filenames, _isArray14 = Array.isArray(_iterator14), _i14 = 0, _iterator14 = _isArray14 ? _iterator14 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator14);;) { var _ref28; if (_isArray14) { if (_i14 >= _iterator14.length) break; _ref28 = _iterator14[_i14++]; } else { _i14 = _iterator14.next(); if (_i14.done) break; _ref28 = _i14.value; } var name = _ref28; var _relative = relativeDir ? (_path2 || _load_path()).default.join(relativeDir, name) : name; var loc = (_path2 || _load_path()).default.join(dir, name); var _stat = yield lstat(loc); files.push({ relative: _relative, basename: name, absolute: loc, mtime: +_stat.mtime }); if (_stat.isDirectory()) { files = files.concat((yield walk(loc, _relative, ignoreBasenames))); } } return files; }); return function walk(_x26, _x27) { return _ref27.apply(this, arguments); }; }(); var getFileSizeOnDisk = exports.getFileSizeOnDisk = function () { var _ref29 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { var stat = yield lstat(loc); var size = stat.size, blockSize = stat.blksize; return Math.ceil(size / blockSize) * blockSize; }); return function getFileSizeOnDisk(_x29) { return _ref29.apply(this, arguments); }; }(); var getEolFromFile = function () { var _ref30 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path) { if (!(yield exists(path))) { return undefined; } var buffer = yield readFileBuffer(path); for (var i = 0; i < buffer.length; ++i) { if (buffer[i] === cr) { return '\r\n'; } if (buffer[i] === lf) { return '\n'; } } return undefined; }); return function getEolFromFile(_x30) { return _ref30.apply(this, arguments); }; }(); var writeFilePreservingEol = exports.writeFilePreservingEol = function () { var _ref31 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path, data) { var eol = (yield getEolFromFile(path)) || (_os || _load_os()).default.EOL; if (eol !== '\n') { data = data.replace(/\n/g, eol); } yield writeFile(path, data); }); return function writeFilePreservingEol(_x31, _x32) { return _ref31.apply(this, arguments); }; }(); var hardlinksWork = exports.hardlinksWork = function () { var _ref32 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir) { var filename = 'test-file' + Math.random(); var file = (_path2 || _load_path()).default.join(dir, filename); var fileLink = (_path2 || _load_path()).default.join(dir, filename + '-link'); try { yield writeFile(file, 'test'); yield link(file, fileLink); } catch (err) { return false; } finally { yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(file); yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(fileLink); } return true; }); return function hardlinksWork(_x33) { return _ref32.apply(this, arguments); }; }(); // not a strict polyfill for Node's fs.mkdtemp var makeTempDir = exports.makeTempDir = function () { var _ref33 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (prefix) { var dir = (_path2 || _load_path()).default.join((_os || _load_os()).default.tmpdir(), `yarn-${prefix || ''}-${Date.now()}-${Math.random()}`); yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dir); yield mkdirp(dir); return dir; }); return function makeTempDir(_x34) { return _ref33.apply(this, arguments); }; }(); var readFirstAvailableStream = exports.readFirstAvailableStream = function () { var _ref34 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (paths) { for (var _iterator15 = paths, _isArray15 = Array.isArray(_iterator15), _i15 = 0, _iterator15 = _isArray15 ? _iterator15 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator15);;) { var _ref35; if (_isArray15) { if (_i15 >= _iterator15.length) break; _ref35 = _iterator15[_i15++]; } else { _i15 = _iterator15.next(); if (_i15.done) break; _ref35 = _i15.value; } var _path = _ref35; try { var fd = yield open(_path, 'r'); return (_fs || _load_fs()).default.createReadStream(_path, { fd }); } catch (err) { // Try the next one } } return null; }); return function readFirstAvailableStream(_x35) { return _ref34.apply(this, arguments); }; }(); var getFirstSuitableFolder = exports.getFirstSuitableFolder = function () { var _ref36 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (paths) { var mode = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : constants.W_OK | constants.X_OK; var result = { skipped: [], folder: null }; for (var _iterator16 = paths, _isArray16 = Array.isArray(_iterator16), _i16 = 0, _iterator16 = _isArray16 ? _iterator16 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator16);;) { var _ref37; if (_isArray16) { if (_i16 >= _iterator16.length) break; _ref37 = _iterator16[_i16++]; } else { _i16 = _iterator16.next(); if (_i16.done) break; _ref37 = _i16.value; } var _folder = _ref37; try { yield mkdirp(_folder); yield access(_folder, mode); result.folder = _folder; return result; } catch (error) { result.skipped.push({ error, folder: _folder }); } } return result; }); return function getFirstSuitableFolder(_x36) { return _ref36.apply(this, arguments); }; }(); exports.copy = copy; exports.readFile = readFile; exports.readFileRaw = readFileRaw; exports.normalizeOS = normalizeOS; var _fs; function _load_fs() { return _fs = _interopRequireDefault(__webpack_require__(12)); } var _glob; function _load_glob() { return _glob = _interopRequireDefault(__webpack_require__(234)); } var _os; function _load_os() { return _os = _interopRequireDefault(__webpack_require__(66)); } var _path2; function _load_path() { return _path2 = _interopRequireDefault(__webpack_require__(1)); } var _blockingQueue; function _load_blockingQueue() { return _blockingQueue = _interopRequireDefault(__webpack_require__(157)); } var _promise2; function _load_promise2() { return _promise2 = _interopRequireWildcard(__webpack_require__(86)); } var _promise3; function _load_promise3() { return _promise3 = __webpack_require__(86); } var _map2; function _load_map2() { return _map2 = _interopRequireDefault(__webpack_require__(51)); } var _fsNormalized; function _load_fsNormalized() { return _fsNormalized = __webpack_require__(535); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } var constants = exports.constants = typeof (_fs || _load_fs()).default.constants !== 'undefined' ? (_fs || _load_fs()).default.constants : { R_OK: (_fs || _load_fs()).default.R_OK, W_OK: (_fs || _load_fs()).default.W_OK, X_OK: (_fs || _load_fs()).default.X_OK }; var lockQueue = exports.lockQueue = new (_blockingQueue || _load_blockingQueue()).default('fs lock'); var readFileBuffer = exports.readFileBuffer = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.readFile); var open = exports.open = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.open); var writeFile = exports.writeFile = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.writeFile); var readlink = exports.readlink = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.readlink); var realpath = exports.realpath = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.realpath); var readdir = exports.readdir = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.readdir); var rename = exports.rename = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.rename); var access = exports.access = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.access); var stat = exports.stat = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.stat); var mkdirp = exports.mkdirp = (0, (_promise3 || _load_promise3()).promisify)(__webpack_require__(241)); var exists = exports.exists = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.exists, true); var lstat = exports.lstat = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.lstat); var chmod = exports.chmod = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.chmod); var link = exports.link = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.link); var glob = exports.glob = (0, (_promise3 || _load_promise3()).promisify)((_glob || _load_glob()).default); exports.unlink = (_fsNormalized || _load_fsNormalized()).unlink; // fs.copyFile uses the native file copying instructions on the system, performing much better // than any JS-based solution and consumes fewer resources. Repeated testing to fine tune the // concurrency level revealed 128 as the sweet spot on a quad-core, 16 CPU Intel system with SSD. var CONCURRENT_QUEUE_ITEMS = (_fs || _load_fs()).default.copyFile ? 128 : 4; var fsSymlink = (0, (_promise3 || _load_promise3()).promisify)((_fs || _load_fs()).default.symlink); var invariant = __webpack_require__(15); var stripBOM = __webpack_require__(429); var noop = function noop() {}; function copy(src, dest, reporter) { return copyBulk([{ src, dest }], reporter); } function _readFile(loc, encoding) { return new (_promise || _load_promise()).default(function (resolve, reject) { (_fs || _load_fs()).default.readFile(loc, encoding, function (err, content) { if (err) { reject(err); } else { resolve(content); } }); }); } function readFile(loc) { return _readFile(loc, 'utf8').then(normalizeOS); } function readFileRaw(loc) { return _readFile(loc, 'binary'); } function normalizeOS(body) { return body.replace(/\r\n/g, '\n'); } var cr = '\r'.charCodeAt(0); var lf = '\n'.charCodeAt(0); /***/ }), /* 9 */ /***/ (function(module, exports) { module.exports = require("util"); /***/ }), /* 10 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; exports.__esModule = true; var _setPrototypeOf = __webpack_require__(211); var _setPrototypeOf2 = _interopRequireDefault(_setPrototypeOf); var _create = __webpack_require__(210); var _create2 = _interopRequireDefault(_create); var _typeof2 = __webpack_require__(316); var _typeof3 = _interopRequireDefault(_typeof2); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } exports.default = function (subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + (typeof superClass === "undefined" ? "undefined" : (0, _typeof3.default)(superClass))); } subClass.prototype = (0, _create2.default)(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) _setPrototypeOf2.default ? (0, _setPrototypeOf2.default)(subClass, superClass) : subClass.__proto__ = superClass; }; /***/ }), /* 11 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; exports.__esModule = true; var _typeof2 = __webpack_require__(316); var _typeof3 = _interopRequireDefault(_typeof2); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } exports.default = function (self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && ((typeof call === "undefined" ? "undefined" : (0, _typeof3.default)(call)) === "object" || typeof call === "function") ? call : self; }; /***/ }), /* 12 */ /***/ (function(module, exports) { module.exports = require("fs"); /***/ }), /* 13 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); exports.getPathKey = getPathKey; var os = __webpack_require__(66); var path = __webpack_require__(1); var userHome = __webpack_require__(101).default; var _require = __webpack_require__(549), getCacheDir = _require.getCacheDir, getConfigDir = _require.getConfigDir, getDataDir = _require.getDataDir; var isWebpackBundle = __webpack_require__(792); var DEPENDENCY_TYPES = exports.DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies', 'peerDependencies']; var OWNED_DEPENDENCY_TYPES = exports.OWNED_DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies']; var RESOLUTIONS = exports.RESOLUTIONS = 'resolutions'; var MANIFEST_FIELDS = exports.MANIFEST_FIELDS = [RESOLUTIONS].concat(DEPENDENCY_TYPES); var SUPPORTED_NODE_VERSIONS = exports.SUPPORTED_NODE_VERSIONS = '^4.8.0 || ^5.7.0 || ^6.2.2 || >=8.0.0'; var YARN_REGISTRY = exports.YARN_REGISTRY = 'https://registry.yarnpkg.com'; var NPM_REGISTRY_RE = exports.NPM_REGISTRY_RE = /https?:\/\/registry\.npmjs\.org/g; var YARN_DOCS = exports.YARN_DOCS = 'https://yarnpkg.com/en/docs/cli/'; var YARN_INSTALLER_SH = exports.YARN_INSTALLER_SH = 'https://yarnpkg.com/install.sh'; var YARN_INSTALLER_MSI = exports.YARN_INSTALLER_MSI = 'https://yarnpkg.com/latest.msi'; var SELF_UPDATE_VERSION_URL = exports.SELF_UPDATE_VERSION_URL = 'https://yarnpkg.com/latest-version'; // cache version, bump whenever we make backwards incompatible changes var CACHE_VERSION = exports.CACHE_VERSION = 6; // lockfile version, bump whenever we make backwards incompatible changes var LOCKFILE_VERSION = exports.LOCKFILE_VERSION = 1; // max amount of network requests to perform concurrently var NETWORK_CONCURRENCY = exports.NETWORK_CONCURRENCY = 8; // HTTP timeout used when downloading packages var NETWORK_TIMEOUT = exports.NETWORK_TIMEOUT = 30 * 1000; // in milliseconds // max amount of child processes to execute concurrently var CHILD_CONCURRENCY = exports.CHILD_CONCURRENCY = 5; var REQUIRED_PACKAGE_KEYS = exports.REQUIRED_PACKAGE_KEYS = ['name', 'version', '_uid']; function getPreferredCacheDirectories() { var preferredCacheDirectories = [getCacheDir()]; if (process.getuid) { // $FlowFixMe: process.getuid exists, dammit preferredCacheDirectories.push(path.join(os.tmpdir(), `.yarn-cache-${process.getuid()}`)); } preferredCacheDirectories.push(path.join(os.tmpdir(), `.yarn-cache`)); return preferredCacheDirectories; } var PREFERRED_MODULE_CACHE_DIRECTORIES = exports.PREFERRED_MODULE_CACHE_DIRECTORIES = getPreferredCacheDirectories(); var CONFIG_DIRECTORY = exports.CONFIG_DIRECTORY = getConfigDir(); var DATA_DIRECTORY = exports.DATA_DIRECTORY = getDataDir(); var LINK_REGISTRY_DIRECTORY = exports.LINK_REGISTRY_DIRECTORY = path.join(DATA_DIRECTORY, 'link'); var GLOBAL_MODULE_DIRECTORY = exports.GLOBAL_MODULE_DIRECTORY = path.join(DATA_DIRECTORY, 'global'); var NODE_BIN_PATH = exports.NODE_BIN_PATH = process.execPath; var YARN_BIN_PATH = exports.YARN_BIN_PATH = getYarnBinPath(); // Webpack needs to be configured with node.__dirname/__filename = false function getYarnBinPath() { if (isWebpackBundle) { return __filename; } else { return path.join(__dirname, '..', 'bin', 'yarn.js'); } } var NODE_MODULES_FOLDER = exports.NODE_MODULES_FOLDER = 'node_modules'; var NODE_PACKAGE_JSON = exports.NODE_PACKAGE_JSON = 'package.json'; var PNP_FILENAME = exports.PNP_FILENAME = '.pnp.js'; var POSIX_GLOBAL_PREFIX = exports.POSIX_GLOBAL_PREFIX = `${process.env.DESTDIR || ''}/usr/local`; var FALLBACK_GLOBAL_PREFIX = exports.FALLBACK_GLOBAL_PREFIX = path.join(userHome, '.yarn'); var META_FOLDER = exports.META_FOLDER = '.yarn-meta'; var INTEGRITY_FILENAME = exports.INTEGRITY_FILENAME = '.yarn-integrity'; var LOCKFILE_FILENAME = exports.LOCKFILE_FILENAME = 'yarn.lock'; var METADATA_FILENAME = exports.METADATA_FILENAME = '.yarn-metadata.json'; var TARBALL_FILENAME = exports.TARBALL_FILENAME = '.yarn-tarball.tgz'; var CLEAN_FILENAME = exports.CLEAN_FILENAME = '.yarnclean'; var NPM_LOCK_FILENAME = exports.NPM_LOCK_FILENAME = 'package-lock.json'; var NPM_SHRINKWRAP_FILENAME = exports.NPM_SHRINKWRAP_FILENAME = 'npm-shrinkwrap.json'; var DEFAULT_INDENT = exports.DEFAULT_INDENT = ' '; var SINGLE_INSTANCE_PORT = exports.SINGLE_INSTANCE_PORT = 31997; var SINGLE_INSTANCE_FILENAME = exports.SINGLE_INSTANCE_FILENAME = '.yarn-single-instance'; var ENV_PATH_KEY = exports.ENV_PATH_KEY = getPathKey(process.platform, process.env); function getPathKey(platform, env) { var pathKey = 'PATH'; // windows calls its path "Path" usually, but this is not guaranteed. if (platform === 'win32') { pathKey = 'Path'; for (var _key in env) { if (_key.toLowerCase() === 'path') { pathKey = _key; } } } return pathKey; } var VERSION_COLOR_SCHEME = exports.VERSION_COLOR_SCHEME = { major: 'red', premajor: 'red', minor: 'yellow', preminor: 'yellow', patch: 'green', prepatch: 'green', prerelease: 'red', unchanged: 'white', unknown: 'red' }; /***/ }), /* 14 */ /***/ (function(module, exports, __webpack_require__) { module.exports = { "default": __webpack_require__(597), __esModule: true }; /***/ }), /* 15 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; /** * Copyright (c) 2013-present, Facebook, Inc. * * This source code is licensed under the MIT license found in the * LICENSE file in the root directory of this source tree. */ /** * Use invariant() to assert state which your program assumes to be true. * * Provide sprintf-style format (only %s is supported) and arguments * to provide information about what broke and what you were * expecting. * * The invariant message will be stripped in production, but the invariant * will remain to ensure logic does not differ in production. */ var NODE_ENV = process.env.NODE_ENV; var invariant = function(condition, format, a, b, c, d, e, f) { if (NODE_ENV !== 'production') { if (format === undefined) { throw new Error('invariant requires an error message argument'); } } if (!condition) { var error; if (format === undefined) { error = new Error( 'Minified exception occurred; use the non-minified dev environment ' + 'for the full error message and additional helpful warnings.' ); } else { var args = [a, b, c, d, e, f]; var argIndex = 0; error = new Error( format.replace(/%s/g, function() { return args[argIndex++]; }) ); error.name = 'Invariant Violation'; } error.framesToPop = 1; // we don't care about invariant's own frame throw error; } }; module.exports = invariant; /***/ }), /* 16 */ /***/ (function(module, exports, __webpack_require__) { module.exports = { "default": __webpack_require__(602), __esModule: true }; /***/ }), /* 17 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Observable; }); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_canReportError__ = __webpack_require__(263); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__ = __webpack_require__(1005); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__ = __webpack_require__(112); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_pipe__ = __webpack_require__(265); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__config__ = __webpack_require__(176); /** PURE_IMPORTS_START _util_canReportError,_util_toSubscriber,_internal_symbol_observable,_util_pipe,_config PURE_IMPORTS_END */ var Observable = /*@__PURE__*/ (function () { function Observable(subscribe) { this._isScalar = false; if (subscribe) { this._subscribe = subscribe; } } Observable.prototype.lift = function (operator) { var observable = new Observable(); observable.source = this; observable.operator = operator; return observable; }; Observable.prototype.subscribe = function (observerOrNext, error, complete) { var operator = this.operator; var sink = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__["a" /* toSubscriber */])(observerOrNext, error, complete); if (operator) { operator.call(sink, this.source); } else { sink.add(this.source || (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling && !sink.syncErrorThrowable) ? this._subscribe(sink) : this._trySubscribe(sink)); } if (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { if (sink.syncErrorThrowable) { sink.syncErrorThrowable = false; if (sink.syncErrorThrown) { throw sink.syncErrorValue; } } } return sink; }; Observable.prototype._trySubscribe = function (sink) { try { return this._subscribe(sink); } catch (err) { if (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { sink.syncErrorThrown = true; sink.syncErrorValue = err; } if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__util_canReportError__["a" /* canReportError */])(sink)) { sink.error(err); } else { console.warn(err); } } }; Observable.prototype.forEach = function (next, promiseCtor) { var _this = this; promiseCtor = getPromiseCtor(promiseCtor); return new promiseCtor(function (resolve, reject) { var subscription; subscription = _this.subscribe(function (value) { try { next(value); } catch (err) { reject(err); if (subscription) { subscription.unsubscribe(); } } }, reject, resolve); }); }; Observable.prototype._subscribe = function (subscriber) { var source = this.source; return source && source.subscribe(subscriber); }; Observable.prototype[__WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__["a" /* observable */]] = function () { return this; }; Observable.prototype.pipe = function () { var operations = []; for (var _i = 0; _i < arguments.length; _i++) { operations[_i] = arguments[_i]; } if (operations.length === 0) { return this; } return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_pipe__["b" /* pipeFromArray */])(operations)(this); }; Observable.prototype.toPromise = function (promiseCtor) { var _this = this; promiseCtor = getPromiseCtor(promiseCtor); return new promiseCtor(function (resolve, reject) { var value; _this.subscribe(function (x) { return value = x; }, function (err) { return reject(err); }, function () { return resolve(value); }); }); }; Observable.create = function (subscribe) { return new Observable(subscribe); }; return Observable; }()); function getPromiseCtor(promiseCtor) { if (!promiseCtor) { promiseCtor = __WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].Promise || Promise; } if (!promiseCtor) { throw new Error('no Promise impl found'); } return promiseCtor; } //# sourceMappingURL=Observable.js.map /***/ }), /* 18 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return OuterSubscriber; }); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(0); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Subscriber__ = __webpack_require__(5); /** PURE_IMPORTS_START tslib,_Subscriber PURE_IMPORTS_END */ var OuterSubscriber = /*@__PURE__*/ (function (_super) { __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](OuterSubscriber, _super); function OuterSubscriber() { return _super !== null && _super.apply(this, arguments) || this; } OuterSubscriber.prototype.notifyNext = function (outerValue, innerValue, outerIndex, innerIndex, innerSub) { this.destination.next(innerValue); }; OuterSubscriber.prototype.notifyError = function (error, innerSub) { this.destination.error(error); }; OuterSubscriber.prototype.notifyComplete = function (innerSub) { this.destination.complete(); }; return OuterSubscriber; }(__WEBPACK_IMPORTED_MODULE_1__Subscriber__["a" /* Subscriber */])); //# sourceMappingURL=OuterSubscriber.js.map /***/ }), /* 19 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (immutable) */ __webpack_exports__["a"] = subscribeToResult; /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__ = __webpack_require__(80); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__subscribeTo__ = __webpack_require__(416); /** PURE_IMPORTS_START _InnerSubscriber,_subscribeTo PURE_IMPORTS_END */ function subscribeToResult(outerSubscriber, result, outerValue, outerIndex, destination) { if (destination === void 0) { destination = new __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__["a" /* InnerSubscriber */](outerSubscriber, outerValue, outerIndex); } if (destination.closed) { return; } return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__subscribeTo__["a" /* subscribeTo */])(result)(destination); } //# sourceMappingURL=subscribeToResult.js.map /***/ }), /* 20 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; /* eslint-disable node/no-deprecated-api */ var buffer = __webpack_require__(94) var Buffer = buffer.Buffer var safer = {} var key for (key in buffer) { if (!buffer.hasOwnProperty(key)) continue if (key === 'SlowBuffer' || key === 'Buffer') continue safer[key] = buffer[key] } var Safer = safer.Buffer = {} for (key in Buffer) { if (!Buffer.hasOwnProperty(key)) continue if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue Safer[key] = Buffer[key] } safer.Buffer.prototype = Buffer.prototype if (!Safer.from || Safer.from === Uint8Array.from) { Safer.from = function (value, encodingOrOffset, length) { if (typeof value === 'number') { throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value) } if (value && typeof value.length === 'undefined') { throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value) } return Buffer(value, encodingOrOffset, length) } } if (!Safer.alloc) { Safer.alloc = function (size, fill, encoding) { if (typeof size !== 'number') { throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) } if (size < 0 || size >= 2 * (1 << 30)) { throw new RangeError('The value "' + size + '" is invalid for option "size"') } var buf = Buffer(size) if (!fill || fill.length === 0) { buf.fill(0) } else if (typeof encoding === 'string') { buf.fill(fill, encoding) } else { buf.fill(fill) } return buf } } if (!safer.kStringMaxLength) { try { safer.kStringMaxLength = process.binding('buffer').kStringMaxLength } catch (e) { // we can't determine kStringMaxLength in environments where process.binding // is unsupported, so let's not set it } } if (!safer.constants) { safer.constants = { MAX_LENGTH: safer.kMaxLength } if (safer.kStringMaxLength) { safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength } } module.exports = safer /***/ }), /* 21 */ /***/ (function(module, exports) { module.exports = require("crypto"); /***/ }), /* 22 */ /***/ (function(module, exports, __webpack_require__) { // Copyright (c) 2012, Mark Cavage. All rights reserved. // Copyright 2015 Joyent, Inc. var assert = __webpack_require__(50); var Stream = __webpack_require__(36).Stream; var util = __webpack_require__(9); ///--- Globals /* JSSTYLED */ var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; ///--- Internal function _capitalize(str) { return (str.charAt(0).toUpperCase() + str.slice(1)); } function _toss(name, expected, oper, arg, actual) { throw new assert.AssertionError({ message: util.format('%s (%s) is required', name, expected), actual: (actual === undefined) ? typeof (arg) : actual(arg), expected: expected, operator: oper || '===', stackStartFunction: _toss.caller }); } function _getClass(arg) { return (Object.prototype.toString.call(arg).slice(8, -1)); } function noop() { // Why even bother with asserts? } ///--- Exports var types = { bool: { check: function (arg) { return typeof (arg) === 'boolean'; } }, func: { check: function (arg) { return typeof (arg) === 'function'; } }, string: { check: function (arg) { return typeof (arg) === 'string'; } }, object: { check: function (arg) { return typeof (arg) === 'object' && arg !== null; } }, number: { check: function (arg) { return typeof (arg) === 'number' && !isNaN(arg); } }, finite: { check: function (arg) { return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); } }, buffer: { check: function (arg) { return Buffer.isBuffer(arg); }, operator: 'Buffer.isBuffer' }, array: { check: function (arg) { return Array.isArray(arg); }, operator: 'Array.isArray' }, stream: { check: function (arg) { return arg instanceof Stream; }, operator: 'instanceof', actual: _getClass }, date: { check: function (arg) { return arg instanceof Date; }, operator: 'instanceof', actual: _getClass }, regexp: { check: function (arg) { return arg instanceof RegExp; }, operator: 'instanceof', actual: _getClass }, uuid: { check: function (arg) { return typeof (arg) === 'string' && UUID_REGEXP.test(arg); }, operator: 'isUUID' } }; function _setExports(ndebug) { var keys = Object.keys(types); var out; /* re-export standard assert */ if (process.env.NODE_NDEBUG) { out = noop; } else { out = function (arg, msg) { if (!arg) { _toss(msg, 'true', arg); } }; } /* standard checks */ keys.forEach(function (k) { if (ndebug) { out[k] = noop; return; } var type = types[k]; out[k] = function (arg, msg) { if (!type.check(arg)) { _toss(msg, k, type.operator, arg, type.actual); } }; }); /* optional checks */ keys.forEach(function (k) { var name = 'optional' + _capitalize(k); if (ndebug) { out[name] = noop; return; } var type = types[k]; out[name] = function (arg, msg) { if (arg === undefined || arg === null) { return; } if (!type.check(arg)) { _toss(msg, k, type.operator, arg, type.actual); } }; }); /* arrayOf checks */ keys.forEach(function (k) { var name = 'arrayOf' + _capitalize(k); if (ndebug) { out[name] = noop; return; } var type = types[k]; var expected = '[' + k + ']'; out[name] = function (arg, msg) { if (!Array.isArray(arg)) { _toss(msg, expected, type.operator, arg, type.actual); } var i; for (i = 0; i < arg.length; i++) { if (!type.check(arg[i])) { _toss(msg, expected, type.operator, arg, type.actual); } } }; }); /* optionalArrayOf checks */ keys.forEach(function (k) { var name = 'optionalArrayOf' + _capitalize(k); if (ndebug) { out[name] = noop; return; } var type = types[k]; var expected = '[' + k + ']'; out[name] = function (arg, msg) { if (arg === undefined || arg === null) { return; } if (!Array.isArray(arg)) { _toss(msg, expected, type.operator, arg, type.actual); } var i; for (i = 0; i < arg.length; i++) { if (!type.check(arg[i])) { _toss(msg, expected, type.operator, arg, type.actual); } } }; }); /* re-export built-in assertions */ Object.keys(assert).forEach(function (k) { if (k === 'AssertionError') { out[k] = assert[k]; return; } if (ndebug) { out[k] = noop; return; } out[k] = assert[k]; }); /* export ourselves (for unit tests _only_) */ out._setExports = _setExports; return out; } module.exports = _setExports(process.env.NODE_NDEBUG); /***/ }), /* 23 */ /***/ (function(module, exports, __webpack_require__) { module.exports = { "default": __webpack_require__(594), __esModule: true }; /***/ }), /* 24 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; exports.__esModule = true; var _assign = __webpack_require__(23); var _assign2 = _interopRequireDefault(_assign); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } exports.default = _assign2.default || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; /***/ }), /* 25 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); exports.stringify = exports.parse = undefined; var _getIterator2; function _load_getIterator() { return _getIterator2 = _interopRequireDefault(__webpack_require__(4)); } var _map; function _load_map() { return _map = _interopRequireDefault(__webpack_require__(42)); } var _asyncToGenerator2; function _load_asyncToGenerator() { return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2)); } var _classCallCheck2; function _load_classCallCheck() { return _classCallCheck2 = _interopRequireDefault(__webpack_require__(3)); } var _keys; function _load_keys() { return _keys = _interopRequireDefault(__webpack_require__(14)); } var _parse; function _load_parse() { return _parse = __webpack_require__(301); } Object.defineProperty(exports, 'parse', { enumerable: true, get: function get() { return _interopRequireDefault(_parse || _load_parse()).default; } }); var _stringify; function _load_stringify() { return _stringify = __webpack_require__(510); } Object.defineProperty(exports, 'stringify', { enumerable: true, get: function get() { return _interopRequireDefault(_stringify || _load_stringify()).default; } }); exports.implodeEntry = implodeEntry; exports.explodeEntry = explodeEntry; var _misc; function _load_misc() { return _misc = __webpack_require__(28); } var _normalizePattern; function _load_normalizePattern() { return _normalizePattern = __webpack_require__(52); } var _parse2; function _load_parse2() { return _parse2 = _interopRequireDefault(__webpack_require__(301)); } var _constants; function _load_constants() { return _constants = __webpack_require__(13); } var _fs; function _load_fs() { return _fs = _interopRequireWildcard(__webpack_require__(8)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } var invariant = __webpack_require__(15); var path = __webpack_require__(1); var ssri = __webpack_require__(93); function getName(pattern) { return (0, (_normalizePattern || _load_normalizePattern()).normalizePattern)(pattern).name; } function blankObjectUndefined(obj) { return obj && (0, (_keys || _load_keys()).default)(obj).length ? obj : undefined; } function keyForRemote(remote) { return remote.resolved || (remote.reference && remote.hash ? `${remote.reference}#${remote.hash}` : null); } function serializeIntegrity(integrity) { // We need this because `Integrity.toString()` does not use sorting to ensure a stable string output // See https://git.io/vx2Hy return integrity.toString().split(' ').sort().join(' '); } function implodeEntry(pattern, obj) { var inferredName = getName(pattern); var integrity = obj.integrity ? serializeIntegrity(obj.integrity) : ''; var imploded = { name: inferredName === obj.name ? undefined : obj.name, version: obj.version, uid: obj.uid === obj.version ? undefined : obj.uid, resolved: obj.resolved, registry: obj.registry === 'npm' ? undefined : obj.registry, dependencies: blankObjectUndefined(obj.dependencies), optionalDependencies: blankObjectUndefined(obj.optionalDependencies), permissions: blankObjectUndefined(obj.permissions), prebuiltVariants: blankObjectUndefined(obj.prebuiltVariants) }; if (integrity) { imploded.integrity = integrity; } return imploded; } function explodeEntry(pattern, obj) { obj.optionalDependencies = obj.optionalDependencies || {}; obj.dependencies = obj.dependencies || {}; obj.uid = obj.uid || obj.version; obj.permissions = obj.permissions || {}; obj.registry = obj.registry || 'npm'; obj.name = obj.name || getName(pattern); var integrity = obj.integrity; if (integrity && integrity.isIntegrity) { obj.integrity = ssri.parse(integrity); } return obj; } var Lockfile = function () { function Lockfile() { var _ref = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {}, cache = _ref.cache, source = _ref.source, parseResultType = _ref.parseResultType; (0, (_classCallCheck2 || _load_classCallCheck()).default)(this, Lockfile); this.source = source || ''; this.cache = cache; this.parseResultType = parseResultType; } // source string if the `cache` was parsed // if true, we're parsing an old yarn file and need to update integrity fields Lockfile.prototype.hasEntriesExistWithoutIntegrity = function hasEntriesExistWithoutIntegrity() { if (!this.cache) { return false; } for (var _key in this.cache) { // $FlowFixMe - `this.cache` is clearly defined at this point if (!/^.*@(file:|http)/.test(_key) && this.cache[_key] && !this.cache[_key].integrity) { return true; } } return false; }; Lockfile.fromDirectory = function () { var _ref2 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir, reporter) { // read the manifest in this directory var lockfileLoc = path.join(dir, (_constants || _load_constants()).LOCKFILE_FILENAME); var lockfile = void 0; var rawLockfile = ''; var parseResult = void 0; if (yield (_fs || _load_fs()).exists(lockfileLoc)) { rawLockfile = yield (_fs || _load_fs()).readFile(lockfileLoc); parseResult = (0, (_parse2 || _load_parse2()).default)(rawLockfile, lockfileLoc); if (reporter) { if (parseResult.type === 'merge') { reporter.info(reporter.lang('lockfileMerged')); } else if (parseResult.type === 'conflict') { reporter.warn(reporter.lang('lockfileConflict')); } } lockfile = parseResult.object; } else if (reporter) { reporter.info(reporter.lang('noLockfileFound')); } if (lockfile && lockfile.__metadata) { var lockfilev2 = lockfile; lockfile = {}; } return new Lockfile({ cache: lockfile, source: rawLockfile, parseResultType: parseResult && parseResult.type }); }); function fromDirectory(_x2, _x3) { return _ref2.apply(this, arguments); } return fromDirectory; }(); Lockfile.prototype.getLocked = function getLocked(pattern) { var cache = this.cache; if (!cache) { return undefined; } var shrunk = pattern in cache && cache[pattern]; if (typeof shrunk === 'string') { return this.getLocked(shrunk); } else if (shrunk) { explodeEntry(pattern, shrunk); return shrunk; } return undefined; }; Lockfile.prototype.removePattern = function removePattern(pattern) { var cache = this.cache; if (!cache) { return; } delete cache[pattern]; }; Lockfile.prototype.getLockfile = function getLockfile(patterns) { var lockfile = {}; var seen = new (_map || _load_map()).default(); // order by name so that lockfile manifest is assigned to the first dependency with this manifest // the others that have the same remoteKey will just refer to the first // ordering allows for consistency in lockfile when it is serialized var sortedPatternsKeys = (0, (_keys || _load_keys()).default)(patterns).sort((_misc || _load_misc()).sortAlpha); for (var _iterator = sortedPatternsKeys, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : (0, (_getIterator2 || _load_getIterator()).default)(_iterator);;) { var _ref3; if (_isArray) { if (_i >= _iterator.length) break; _ref3 = _iterator[_i++]; } else { _i = _iterator.next(); if (_i.done) break; _ref3 = _i.value; } var pattern = _ref3; var pkg = patterns[pattern]; var remote = pkg._remote, ref = pkg._reference; invariant(ref, 'Package is missing a reference'); invariant(remote, 'Package is missing a remote'); var remoteKey = keyForRemote(remote); var pkgName = getName(pattern); var seenKey = remoteKey ? `${remoteKey}#${pkgName}` : null; var seenPattern = seenKey ? seen.get(seenKey) : null; if (seenPattern) { // no point in duplicating it lockfile[pattern] = seenPattern; continue; } var obj = implodeEntry(pattern, { name: pkgName, version: pkg.version, uid: pkg._uid, resolved: remote.resolved, integrity: remote.integrity, registry: remote.registry, dependencies: pkg.dependencies, peerDependencies: pkg.peerDependencies, optionalDependencies: pkg.optionalDependencies, permissions: ref.permissions, prebuiltVariants: pkg.prebuiltVariants }); lockfile[pattern] = obj; if (seenKey) { seen.set(seenKey, obj); } } return lockfile; }; return Lockfile; }(); exports.default = Lockfile; /***/ }), /* 26 */ /***/ (function(module, exports) { var core = module.exports = { version: '2.5.7' }; if (typeof __e == 'number') __e = core; // eslint-disable-line no-undef /***/ }), /* 27 */ /***/ (function(module, exports) { exports = module.exports = SemVer; // The debug function is excluded entirely from the minified version. /* nomin */ var debug; /* nomin */ if (typeof process === 'object' && /* nomin */ process.env && /* nomin */ process.env.NODE_DEBUG && /* nomin */ /\bsemver\b/i.test(process.env.NODE_DEBUG)) /* nomin */ debug = function() { /* nomin */ var args = Array.prototype.slice.call(arguments, 0); /* nomin */ args.unshift('SEMVER'); /* nomin */ console.log.apply(console, args); /* nomin */ }; /* nomin */ else /* nomin */ debug = function() {}; // Note: this is the semver.org version of the spec that it implements // Not necessarily the package version of this code. exports.SEMVER_SPEC_VERSION = '2.0.0'; var MAX_LENGTH = 256; var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991; // Max safe segment length for coercion. var MAX_SAFE_COMPONENT_LENGTH = 16; // The actual regexps go on exports.re var re = exports.re = []; var src = exports.src = []; var R = 0; // The following Regular Expressions can be used for tokenizing, // validating, and parsing SemVer version strings. // ## Numeric Identifier // A single `0`, or a non-zero digit followed by zero or more digits. var NUMERICIDENTIFIER = R++; src[NUMERICIDENTIFIER] = '0|[1-9]\\d*'; var NUMERICIDENTIFIERLOOSE = R++; src[NUMERICIDENTIFIERLOOSE] = '[0-9]+'; // ## Non-numeric Identifier // Zero or more digits, followed by a letter or hyphen, and then zero or // more letters, digits, or hyphens. var NONNUMERICIDENTIFIER = R++; src[NONNUMERICIDENTIFIER] = '\\d*[a-zA-Z-][a-zA-Z0-9-]*'; // ## Main Version // Three dot-separated numeric identifiers. var MAINVERSION = R++; src[MAINVERSION] = '(' + src[NUMERICIDENTIFIER] + ')\\.' + '(' + src[NUMERICIDENTIFIER] + ')\\.' + '(' + src[NUMERICIDENTIFIER] + ')'; var MAINVERSIONLOOSE = R++; src[MAINVERSIONLOOSE] = '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' + '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' + '(' + src[NUMERICIDENTIFIERLOOSE] + ')'; // ## Pre-release Version Identifier // A numeric identifier, or a non-numeric identifier. var PRERELEASEIDENTIFIER = R++; src[PRERELEASEIDENTIFIER] = '(?:' + src[NUMERICIDENTIFIER] + '|' + src[NONNUMERICIDENTIFIER] + ')'; var PRERELEASEIDENTIFIERLOOSE = R++; src[PRERELEASEIDENTIFIERLOOSE] = '(?:' + src[NUMERICIDENTIFIERLOOSE] + '|' + src[NONNUMERICIDENTIFIER] + ')'; // ## Pre-release Version // Hyphen, followed by one or more dot-separated pre-release version // identifiers. var PRERELEASE = R++; src[PRERELEASE] = '(?:-(' + src[PRERELEASEIDENTIFIER] + '(?:\\.' + src[PRERELEASEIDENTIFIER] + ')*))'; var PRERELEASELOOSE = R++; src[PRERELEASELOOSE] = '(?:-?(' + src[PRERELEASEIDENTIFIERLOOSE] + '(?:\\.' + src[PRERELEASEIDENTIFIERLOOSE] + ')*))'; // ## Build Metadata Identifier // Any combination of digits, letters, or hyphens. var BUILDIDENTIFIER = R++; src[BUILDIDENTIFIER] = '[0-9A-Za-z-]+'; // ## Build Metadata // Plus sign, followed by one or more period-separated build metadata // identifiers. var BUILD = R++; src[BUILD] = '(?:\\+(' + src[BUILDIDENTIFIER] + '(?:\\.' + src[BUILDIDENTIFIER] + ')*))'; // ## Full Version String // A main version, followed optionally by a pre-release version and // build metadata. // Note that the only major, minor, patch, and pre-release sections of // the version string are capturing groups. The build metadata is not a // capturing group, because it should not ever be used in version // comparison. var FULL = R++; var FULLPLAIN = 'v?' + src[MAINVERSION] + src[PRERELEASE] + '?' + src[BUILD] + '?'; src[FULL] = '^' + FULLPLAIN + '$'; // like full, but allows v1.2.3 and =1.2.3, which people do sometimes. // also, 1.0.0alpha1 (prerelease without the hyphen) which is pretty // common in the npm registry. var LOOSEPLAIN = '[v=\\s]*' + src[MAINVERSIONLOOSE] + src[PRERELEASELOOSE] + '?' + src[BUILD] + '?'; var LOOSE = R++; src[LOOSE] = '^' + LOOSEPLAIN + '$'; var GTLT = R++; src[GTLT] = '((?:<|>)?=?)'; // Something like "2.*" or "1.2.x". // Note that "x.x" is a valid xRange identifer, meaning "any version" // Only the first item is strictly required. var XRANGEIDENTIFIERLOOSE = R++; src[XRANGEIDENTIFIERLOOSE] = src[NUMERICIDENTIFIERLOOSE] + '|x|X|\\*'; var XRANGEIDENTIFIER = R++; src[XRANGEIDENTIFIER] = src[NUMERICIDENTIFIER] + '|x|X|\\*'; var XRANGEPLAIN = R++; src[XRANGEPLAIN] = '[v=\\s]*(' + src[XRANGEIDENTIFIER] + ')' + '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' + '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' + '(?:' + src[PRERELEASE] + ')?' + src[BUILD] + '?' + ')?)?'; var XRANGEPLAINLOOSE = R++; src[XRANGEPLAINLOOSE] = '[v=\\s]*(' + src[XRANGEIDENTIFIERLOOSE] + ')' + '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' + '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' + '(?:' + src[PRERELEASELOOSE] + ')?' + src[BUILD] + '?' + ')?)?'; var XRANGE = R++; src[XRANGE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAIN] + '$'; var XRANGELOOSE = R++; src[XRANGELOOSE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAINLOOSE] + '$'; // Coercion. // Extract anything that could conceivably be a part of a valid semver var COERCE = R++; src[COERCE] = '(?:^|[^\\d])' + '(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '})' + '(?:\\.(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '}))?' + '(?:\\.(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '}))?' + '(?:$|[^\\d])'; // Tilde ranges. // Meaning is "reasonably at or greater than" var LONETILDE = R++; src[LONETILDE] = '(?:~>?)'; var TILDETRIM = R++; src[TILDETRIM] = '(\\s*)' + src[LONETILDE] + '\\s+'; re[TILDETRIM] = new RegExp(src[TILDETRIM], 'g'); var tildeTrimReplace = '$1~'; var TILDE = R++; src[TILDE] = '^' + src[LONETILDE] + src[XRANGEPLAIN] + '$'; var TILDELOOSE = R++; src[TILDELOOSE] = '^' + src[LONETILDE] + src[XRANGEPLAINLOOSE] + '$'; // Caret ranges. // Meaning is "at least and backwards compatible with" var LONECARET = R++; src[LONECARET] = '(?:\\^)'; var CARETTRIM = R++; src[CARETTRIM] = '(\\s*)' + src[LONECARET] + '\\s+'; re[CARETTRIM] = new RegExp(src[CARETTRIM], 'g'); var caretTrimReplace = '$1^'; var CARET = R++; src[CARET] = '^' + src[LONECARET] + src[XRANGEPLAIN] + '$'; var CARETLOOSE = R++; src[CARETLOOSE] = '^' + src[LONECARET] + src[XRANGEPLAINLOOSE] + '$'; // A simple gt/lt/eq thing, or just "" to indicate "any version" var COMPARATORLOOSE = R++; src[COMPARATORLOOSE] = '^' + src[GTLT] + '\\s*(' + LOOSEPLAIN + ')$|^$'; var COMPARATOR = R++; src[COMPARATOR] = '^' + src[GTLT] + '\\s*(' + FULLPLAIN + ')$|^$'; // An expression to strip any whitespace between the gtlt and the thing // it modifies, so that `> 1.2.3` ==> `>1.2.3` var COMPARATORTRIM = R++; src[COMPARATORTRIM] = '(\\s*)' + src[GTLT] + '\\s*(' + LOOSEPLAIN + '|' + src[XRANGEPLAIN] + ')'; // this one has to use the /g flag re[COMPARATORTRIM] = new RegExp(src[COMPARATORTRIM], 'g'); var comparatorTrimReplace = '$1$2$3'; // Something like `1.2.3 - 1.2.4` // Note that these all use the loose form, because they'll be // checked against either the strict or loose comparator form // later. var HYPHENRANGE = R++; src[HYPHENRANGE] = '^\\s*(' + src[XRANGEPLAIN] + ')' + '\\s+-\\s+' + '(' + src[XRANGEPLAIN] + ')' + '\\s*$'; var HYPHENRANGELOOSE = R++; src[HYPHENRANGELOOSE] = '^\\s*(' + src[XRANGEPLAINLOOSE] + ')' + '\\s+-\\s+' + '(' + src[XRANGEPLAINLOOSE] + ')' + '\\s*$'; // Star ranges basically just allow anything at all. var STAR = R++; src[STAR] = '(<|>)?=?\\s*\\*'; // Compile to actual regexp objects. // All are flag-free, unless they were created above with a flag. for (var i = 0; i < R; i++) { debug(i, src[i]); if (!re[i]) re[i] = new RegExp(src[i]); } exports.parse = parse; function parse(version, loose) { if (version instanceof SemVer) return version; if (typeof version !== 'string') return null; if (version.length > MAX_LENGTH) return null; var r = loose ? re[LOOSE] : re[FULL]; if (!r.test(version)) return null; try { return new SemVer(version, loose); } catch (er) { return null; } } exports.valid = valid; function valid(version, loose) { var v = parse(version, loose); return v ? v.version : null; } exports.clean = clean; function clean(version, loose) { var s = parse(version.trim().replace(/^[=v]+/, ''), loose); return s ? s.version : null; } exports.SemVer = SemVer; function SemVer(version, loose) { if (version instanceof SemVer) { if (version.loose === loose) return version; else version = version.version; } else if (typeof version !== 'string') { throw new TypeError('Invalid Version: ' + version); } if (version.length > MAX_LENGTH) throw new TypeError('version is longer than ' + MAX_LENGTH + ' characters') if (!(this instanceof SemVer)) return new SemVer(version, loose); debug('SemVer', version, loose); this.loose = loose; var m = version.trim().match(loose ? re[LOOSE] : re[FULL]); if (!m) throw new TypeError('Invalid Version: ' + version); this.raw = version; // these are actually numbers this.major = +m[1]; this.minor = +m[2]; this.patch = +m[3]; if (this.major > MAX_SAFE_INTEGER || this.major < 0) throw new TypeError('Invalid major version') if (this.minor > MAX_SAFE_INTEGER || this.minor < 0) throw new TypeError('Invalid minor version') if (this.patch > MAX_SAFE_INTEGER || this.patch < 0) throw new TypeError('Invalid patch version') // numberify any prerelease numeric ids if (!m[4]) this.prerelease = []; else this.prerelease = m[4].split('.').map(function(id) { if (/^[0-9]+$/.test(id)) { var num = +id; if (num >= 0 && num < MAX_SAFE_INTEGER) return num; } return id; }); this.build = m[5] ? m[5].split('.') : []; this.format(); } SemVer.prototype.format = function() { this.version = this.major + '.' + this.minor + '.' + this.patch; if (this.prerelease.length) this.version += '-' + this.prerelease.join('.'); return this.version; }; SemVer.prototype.toString = function() { return this.version; }; SemVer.prototype.compare = function(other) { debug('SemVer.compare', this.version, this.loose, other); if (!(other instanceof SemVer)) other = new SemVer(other, this.loose); return this.compareMain(other) || this.comparePre(other); }; SemVer.prototype.compareMain = function(other) { if (!(other instanceof SemVer)) other = new SemVer(other, this.loose); return compareIdentifiers(this.major, other.major) || compareIdentifiers(this.minor, other.minor) || compareIdentifiers(this.patch, other.patch); }; SemVer.prototype.comparePre = function(other) { if (!(other instanceof SemVer)) other = new SemVer(other, this.loose); // NOT having a prerelease is > having one if (this.prerelease.length && !other.prerelease.length) return -1; else if (!this.prerelease.length && other.prerelease.length) return 1; else if (!this.prerelease.length && !other.prerelease.length) return 0; var i = 0; do { var a = this.prerelease[i]; var b = other.prerelease[i]; debug('prerelease compare', i, a, b); if (a === undefined && b === undefined) return 0; else if (b === undefined) return 1; else if (a === undefined) return -1; else if (a === b) continue; else return compareIdentifiers(a, b); } while (++i); }; // preminor will bump the version up to the next minor release, and immediately // down to pre-release. premajor and prepatch work the same way. SemVer.prototype.inc = function(release, identifier) { switch (release) { case 'premajor': this.prerelease.length = 0; this.patch = 0; this.minor = 0; this.major++; this.inc('pre', identifier); break; case 'preminor': this.prerelease.length = 0; this.patch = 0; this.minor++; this.inc('pre', identifier); break; case 'prepatch': // If this is already a prerelease, it will bump to the next version // drop any prereleases that might already exist, since they are not // relevant at this point. this.prerelease.length = 0; this.inc('patch', identifier); this.inc('pre', identifier); break; // If the input is a non-prerelease version, this acts the same as // prepatch. case 'prerelease': if (this.prerelease.length === 0) this.inc('patch', identifier); this.inc('pre', identifier); break; case 'major': // If this is a pre-major version, bump up to the same major version. // Otherwise increment major. // 1.0.0-5 bumps to 1.0.0 // 1.1.0 bumps to 2.0.0 if (this.minor !== 0 || this.patch !== 0 || this.prerelease.length === 0) this.major++; this.minor = 0; this.patch = 0; this.prerelease = []; break; case 'minor': // If this is a pre-minor version, bump up to the same minor version. // Otherwise increment minor. // 1.2.0-5 bumps to 1.2.0 // 1.2.1 bumps to 1.3.0 if (this.patch !== 0 || this.prerelease.length === 0) this.minor++; this.patch = 0; this.prerelease = []; break; case 'patch': // If this is not a pre-release version, it will increment the patch. // If it is a pre-release it will bump up to the same patch version. // 1.2.0-5 patches to 1.2.0 // 1.2.0 patches to 1.2.1 if (this.prerelease.length === 0) this.patch++; this.prerelease = []; break; // This probably shouldn't be used publicly. // 1.0.0 "pre" would become 1.0.0-0 which is the wrong direction. case 'pre': if (this.prerelease.length === 0) this.prerelease = [0]; else { var i = this.prerelease.length; while (--i >= 0) { if (typeof this.prerelease[i] === 'number') { this.prerelease[i]++; i = -2; } } if (i === -1) // didn't increment anything this.prerelease.push(0); } if (identifier) { // 1.2.0-beta.1 bumps to 1.2.0-beta.2, // 1.2.0-beta.fooblz or 1.2.0-beta bumps to 1.2.0-beta.0 if (this.prerelease[0] === identifier) { if (isNaN(this.prerelease[1])) this.prerelease = [identifier, 0]; } else this.prerelease = [identifier, 0]; } break; default: throw new Error('invalid increment argument: ' + release); } this.format(); this.raw = this.version; return this; }; exports.inc = inc; function inc(version, release, loose, identifier) { if (typeof(loose) === 'string') { identifier = loose; loose = undefined; } try { return new SemVer(version, loose).inc(release, identifier).version; } catch (er) { return null; } } exports.diff = diff; function diff(version1, version2) { if (eq(version1, version2)) { return null; } else { var v1 = parse(version1); var v2 = parse(version2); if (v1.prerelease.length || v2.prerelease.length) { for (var key in v1) { if (key === 'major' || key === 'minor' || key === 'patch') { if (v1[key] !== v2[key]) { return 'pre'+key; } } } return 'prerelease'; } for (var key in v1) { if (key === 'major' || key === 'minor' || key === 'patch') { if (v1[key] !== v2[key]) { return key; } } } } } exports.compareIdentifiers = compareIdentifiers; var numeric = /^[0-9]+$/; function compareIdentifiers(a, b) { var anum = numeric.test(a); var bnum = numeric.test(b); if (anum && bnum) { a = +a; b = +b; } return (anum && !bnum) ? -1 : (bnum && !anum) ? 1 : a < b ? -1 : a > b ? 1 : 0; } exports.rcompareIdentifiers = rcompareIdentifiers; function rcompareIdentifiers(a, b) { return compareIdentifiers(b, a); } exports.major = major; function major(a, loose) { return new SemVer(a, loose).major; } exports.minor = minor; function minor(a, loose) { return new SemVer(a, loose).minor; } exports.patch = patch; function patch(a, loose) { return new SemVer(a, loose).patch; } exports.compare = compare; function compare(a, b, loose) { return new SemVer(a, loose).compare(new SemVer(b, loose)); } exports.compareLoose = compareLoose; function compareLoose(a, b) { return compare(a, b, true); } exports.rcompare = rcompare; function rcompare(a, b, loose) { return compare(b, a, loose); } exports.sort = sort; function sort(list, loose) { return list.sort(function(a, b) { return exports.compare(a, b, loose); }); } exports.rsort = rsort; function rsort(list, loose) { return list.sort(function(a, b) { return exports.rcompare(a, b, loose); }); } exports.gt = gt; function gt(a, b, loose) { return compare(a, b, loose) > 0; } exports.lt = lt; function lt(a, b, loose) { return compare(a, b, loose) < 0; } exports.eq = eq; function eq(a, b, loose) { return compare(a, b, loose) === 0; } exports.neq = neq; function neq(a, b, loose) { return compare(a, b, loose) !== 0; } exports.gte = gte; function gte(a, b, loose) { return compare(a, b, loose) >= 0; } exports.lte = lte; function lte(a, b, loose) { return compare(a, b, loose) <= 0; } exports.cmp = cmp; function cmp(a, op, b, loose) { var ret; switch (op) { case '===': if (typeof a === 'object') a = a.version; if (typeof b === 'object') b = b.version; ret = a === b; break; case '!==': if (typeof a === 'object') a = a.version; if (typeof b === 'object') b = b.version; ret = a !== b; break; case '': case '=': case '==': ret = eq(a, b, loose); break; case '!=': ret = neq(a, b, loose); break; case '>': ret = gt(a, b, loose); break; case '>=': ret = gte(a, b, loose); break; case '<': ret = lt(a, b, loose); break; case '<=': ret = lte(a, b, loose); break; default: throw new TypeError('Invalid operator: ' + op); } return ret; } exports.Comparator = Comparator; function Comparator(comp, loose) { if (comp instanceof Comparator) { if (comp.loose === loose) return comp; else comp = comp.value; } if (!(this instanceof Comparator)) return new Comparator(comp, loose); debug('comparator', comp, loose); this.loose = loose; this.parse(comp); if (this.semver === ANY) this.value = ''; else this.value = this.operator + this.semver.version; debug('comp', this); } var ANY = {}; Comparator.prototype.parse = function(comp) { var r = this.loose ? re[COMPARATORLOOSE] : re[COMPARATOR]; var m = comp.match(r); if (!m) throw new TypeError('Invalid comparator: ' + comp); this.operator = m[1]; if (this.operator === '=') this.operator = ''; // if it literally is just '>' or '' then allow anything. if (!m[2]) this.semver = ANY; else this.semver = new SemVer(m[2], this.loose); }; Comparator.prototype.toString = function() { return this.value; }; Comparator.prototype.test = function(version) { debug('Comparator.test', version, this.loose); if (this.semver === ANY) return true; if (typeof version === 'string') version = new SemVer(version, this.loose); return cmp(version, this.operator, this.semver, this.loose); }; Comparator.prototype.intersects = function(comp, loose) { if (!(comp instanceof Comparator)) { throw new TypeError('a Comparator is required'); } var rangeTmp; if (this.operator === '') { rangeTmp = new Range(comp.value, loose); return satisfies(this.value, rangeTmp, loose); } else if (comp.operator === '') { rangeTmp = new Range(this.value, loose); return satisfies(comp.semver, rangeTmp, loose); } var sameDirectionIncreasing = (this.operator === '>=' || this.operator === '>') && (comp.operator === '>=' || comp.operator === '>'); var sameDirectionDecreasing = (this.operator === '<=' || this.operator === '<') && (comp.operator === '<=' || comp.operator === '<'); var sameSemVer = this.semver.version === comp.semver.version; var differentDirectionsInclusive = (this.operator === '>=' || this.operator === '<=') && (comp.operator === '>=' || comp.operator === '<='); var oppositeDirectionsLessThan = cmp(this.semver, '<', comp.semver, loose) && ((this.operator === '>=' || this.operator === '>') && (comp.operator === '<=' || comp.operator === '<')); var oppositeDirectionsGreaterThan = cmp(this.semver, '>', comp.semver, loose) && ((this.operator === '<=' || this.operator === '<') && (comp.operator === '>=' || comp.operator === '>')); return sameDirectionIncreasing || sameDirectionDecreasing || (sameSemVer && differentDirectionsInclusive) || oppositeDirectionsLessThan || oppositeDirectionsGreaterThan; }; exports.Range = Range; function Range(range, loose) { if (range instanceof Range) { if (range.loose === loose) { return range; } else { return new Range(range.raw, loose); } } if (range instanceof Comparator) { return new Range(range.value, loose); } if (!(this instanceof Range)) return new Range(range, loose); this.loose = loose; // First, split based on boolean or || this.raw = range; this.set = range.split(/\s*\|\|\s*/).map(function(range) { return this.parseRange(range.trim()); }, this).filter(function(c) { // throw out any that are not relevant for whatever reason return c.length; }); if (!this.set.length) { throw new TypeError('Invalid SemVer Range: ' + range); } this.format(); } Range.prototype.format = function() { this.range = this.set.map(function(comps) { return comps.join(' ').trim(); }).join('||').trim(); return this.range; }; Range.prototype.toString = function() { return this.range; }; Range.prototype.parseRange = function(range) { var loose = this.loose; range = range.trim(); debug('range', range, loose); // `1.2.3 - 1.2.4` => `>=1.2.3 <=1.2.4` var hr = loose ? re[HYPHENRANGELOOSE] : re[HYPHENRANGE]; range = range.replace(hr, hyphenReplace); debug('hyphen replace', range); // `> 1.2.3 < 1.2.5` => `>1.2.3 <1.2.5` range = range.replace(re[COMPARATORTRIM], comparatorTrimReplace); debug('comparator trim', range, re[COMPARATORTRIM]); // `~ 1.2.3` => `~1.2.3` range = range.replace(re[TILDETRIM], tildeTrimReplace); // `^ 1.2.3` => `^1.2.3` range = range.replace(re[CARETTRIM], caretTrimReplace); // normalize spaces range = range.split(/\s+/).join(' '); // At this point, the range is completely trimmed and // ready to be split into comparators. var compRe = loose ? re[COMPARATORLOOSE] : re[COMPARATOR]; var set = range.split(' ').map(function(comp) { return parseComparator(comp, loose); }).join(' ').split(/\s+/); if (this.loose) { // in loose mode, throw out any that are not valid comparators set = set.filter(function(comp) { return !!comp.match(compRe); }); } set = set.map(function(comp) { return new Comparator(comp, loose); }); return set; }; Range.prototype.intersects = function(range, loose) { if (!(range instanceof Range)) { throw new TypeError('a Range is required'); } return this.set.some(function(thisComparators) { return thisComparators.every(function(thisComparator) { return range.set.some(function(rangeComparators) { return rangeComparators.every(function(rangeComparator) { return thisComparator.intersects(rangeComparator, loose); }); }); }); }); }; // Mostly just for testing and legacy API reasons exports.toComparators = toComparators; function toComparators(range, loose) { return new Range(range, loose).set.map(function(comp) { return comp.map(function(c) { return c.value; }).join(' ').trim().split(' '); }); } // comprised of xranges, tildes, stars, and gtlt's at this point. // already replaced the hyphen ranges // turn into a set of JUST comparators. function parseComparator(comp, loose) { debug('comp', comp); comp = replaceCarets(comp, loose); debug('caret', comp); comp = replaceTildes(comp, loose); debug('tildes', comp); comp = replaceXRanges(comp, loose); debug('xrange', comp); comp = replaceStars(comp, loose); debug('stars', comp); return comp; } function isX(id) { return !id || id.toLowerCase() === 'x' || id === '*'; } // ~, ~> --> * (any, kinda silly) // ~2, ~2.x, ~2.x.x, ~>2, ~>2.x ~>2.x.x --> >=2.0.0 <3.0.0 // ~2.0, ~2.0.x, ~>2.0, ~>2.0.x --> >=2.0.0 <2.1.0 // ~1.2, ~1.2.x, ~>1.2, ~>1.2.x --> >=1.2.0 <1.3.0 // ~1.2.3, ~>1.2.3 --> >=1.2.3 <1.3.0 // ~1.2.0, ~>1.2.0 --> >=1.2.0 <1.3.0 function replaceTildes(comp, loose) { return comp.trim().split(/\s+/).map(function(comp) { return replaceTilde(comp, loose); }).join(' '); } function replaceTilde(comp, loose) { var r = loose ? re[TILDELOOSE] : re[TILDE]; return comp.replace(r, function(_, M, m, p, pr) { debug('tilde', comp, _, M, m, p, pr); var ret; if (isX(M)) ret = ''; else if (isX(m)) ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; else if (isX(p)) // ~1.2 == >=1.2.0 <1.3.0 ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; else if (pr) { debug('replaceTilde pr', pr); if (pr.charAt(0) !== '-') pr = '-' + pr; ret = '>=' + M + '.' + m + '.' + p + pr + ' <' + M + '.' + (+m + 1) + '.0'; } else // ~1.2.3 == >=1.2.3 <1.3.0 ret = '>=' + M + '.' + m + '.' + p + ' <' + M + '.' + (+m + 1) + '.0'; debug('tilde return', ret); return ret; }); } // ^ --> * (any, kinda silly) // ^2, ^2.x, ^2.x.x --> >=2.0.0 <3.0.0 // ^2.0, ^2.0.x --> >=2.0.0 <3.0.0 // ^1.2, ^1.2.x --> >=1.2.0 <2.0.0 // ^1.2.3 --> >=1.2.3 <2.0.0 // ^1.2.0 --> >=1.2.0 <2.0.0 function replaceCarets(comp, loose) { return comp.trim().split(/\s+/).map(function(comp) { return replaceCaret(comp, loose); }).join(' '); } function replaceCaret(comp, loose) { debug('caret', comp, loose); var r = loose ? re[CARETLOOSE] : re[CARET]; return comp.replace(r, function(_, M, m, p, pr) { debug('caret', comp, _, M, m, p, pr); var ret; if (isX(M)) ret = ''; else if (isX(m)) ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; else if (isX(p)) { if (M === '0') ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; else ret = '>=' + M + '.' + m + '.0 <' + (+M + 1) + '.0.0'; } else if (pr) { debug('replaceCaret pr', pr); if (pr.charAt(0) !== '-') pr = '-' + pr; if (M === '0') { if (m === '0') ret = '>=' + M + '.' + m + '.' + p + pr + ' <' + M + '.' + m + '.' + (+p + 1); else ret = '>=' + M + '.' + m + '.' + p + pr + ' <' + M + '.' + (+m + 1) + '.0'; } else ret = '>=' + M + '.' + m + '.' + p + pr + ' <' + (+M + 1) + '.0.0'; } else { debug('no pr'); if (M === '0') { if (m === '0') ret = '>=' + M + '.' + m + '.' + p + ' <' + M + '.' + m + '.' + (+p + 1); else ret = '>=' + M + '.' + m + '.' + p + ' <' + M + '.' + (+m + 1) + '.0'; } else ret = '>=' + M + '.' + m + '.' + p + ' <' + (+M + 1) + '.0.0'; } debug('caret return', ret); return ret; }); } function replaceXRanges(comp, loose) { debug('replaceXRanges', comp, loose); return comp.split(/\s+/).map(function(comp) { return replaceXRange(comp, loose); }).join(' '); } function replaceXRange(comp, loose) { comp = comp.trim(); var r = loose ? re[XRANGELOOSE] : re[XRANGE]; return comp.replace(r, function(ret, gtlt, M, m, p, pr) { debug('xRange', comp, ret, gtlt, M, m, p, pr); var xM = isX(M); var xm = xM || isX(m); var xp = xm || isX(p); var anyX = xp; if (gtlt === '=' && anyX) gtlt = ''; if (xM) { if (gtlt === '>' || gtlt === '<') { // nothing is allowed ret = '<0.0.0'; } else { // nothing is forbidden ret = '*'; } } else if (gtlt && anyX) { // replace X with 0 if (xm) m = 0; if (xp) p = 0; if (gtlt === '>') { // >1 => >=2.0.0 // >1.2 => >=1.3.0 // >1.2.3 => >= 1.2.4 gtlt = '>='; if (xm) { M = +M + 1; m = 0; p = 0; } else if (xp) { m = +m + 1; p = 0; } } else if (gtlt === '<=') { // <=0.7.x is actually <0.8.0, since any 0.7.x should // pass. Similarly, <=7.x is actually <8.0.0, etc. gtlt = '<'; if (xm) M = +M + 1; else m = +m + 1; } ret = gtlt + M + '.' + m + '.' + p; } else if (xm) { ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; } else if (xp) { ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; } debug('xRange return', ret); return ret; }); } // Because * is AND-ed with everything else in the comparator, // and '' means "any version", just remove the *s entirely. function replaceStars(comp, loose) { debug('replaceStars', comp, loose); // Looseness is ignored here. star is always as loose as it gets! return comp.trim().replace(re[STAR], ''); } // This function is passed to string.replace(re[HYPHENRANGE]) // M, m, patch, prerelease, build // 1.2 - 3.4.5 => >=1.2.0 <=3.4.5 // 1.2.3 - 3.4 => >=1.2.0 <3.5.0 Any 3.4.x will do // 1.2 - 3.4 => >=1.2.0 <3.5.0 function hyphenReplace($0, from, fM, fm, fp, fpr, fb, to, tM, tm, tp, tpr, tb) { if (isX(fM)) from = ''; else if (isX(fm)) from = '>=' + fM + '.0.0'; else if (isX(fp)) from = '>=' + fM + '.' + fm + '.0'; else from = '>=' + from; if (isX(tM)) to = ''; else if (isX(tm)) to = '<' + (+tM + 1) + '.0.0'; else if (isX(tp)) to = '<' + tM + '.' + (+tm + 1) + '.0'; else if (tpr) to = '<=' + tM + '.' + tm + '.' + tp + '-' + tpr; else to = '<=' + to; return (from + ' ' + to).trim(); } // if ANY of the sets match ALL of its comparators, then pass Range.prototype.test = function(version) { if (!version) return false; if (typeof version === 'string') version = new SemVer(version, this.loose); for (var i = 0; i < this.set.length; i++) { if (testSet(this.set[i], version)) return true; } return false; }; function testSet(set, version) { for (var i = 0; i < set.length; i++) { if (!set[i].test(version)) return false; } if (version.prerelease.length) { // Find the set of versions that are allowed to have prereleases // For example, ^1.2.3-pr.1 desugars to >=1.2.3-pr.1 <2.0.0 // That should allow `1.2.3-pr.2` to pass. // However, `1.2.4-alpha.notready` should NOT be allowed, // even though it's within the range set by the comparators. for (var i = 0; i < set.length; i++) { debug(set[i].semver); if (set[i].semver === ANY) continue; if (set[i].semver.prerelease.length > 0) { var allowed = set[i].semver; if (allowed.major === version.major && allowed.minor === version.minor && allowed.patch === version.patch) return true; } } // Version has a -pre, but it's not one of the ones we like. return false; } return true; } exports.satisfies = satisfies; function satisfies(version, range, loose) { try { range = new Range(range, loose); } catch (er) { return false; } return range.test(version); } exports.maxSatisfying = maxSatisfying; function maxSatisfying(versions, range, loose) { var max = null; var maxSV = null; try { var rangeObj = new Range(range, loose); } catch (er) { return null; } versions.forEach(function (v) { if (rangeObj.test(v)) { // satisfies(v, range, loose) if (!max || maxSV.compare(v) === -1) { // compare(max, v, true) max = v; maxSV = new SemVer(max, loose); } } }) return max; } exports.minSatisfying = minSatisfying; function minSatisfying(versions, range, loose) { var min = null; var minSV = null; try { var rangeObj = new Range(range, loose); } catch (er) { return null; } versions.forEach(function (v) { if (rangeObj.test(v)) { // satisfies(v, range, loose) if (!min || minSV.compare(v) === 1) { // compare(min, v, true) min = v; minSV = new SemVer(min, loose); } } }) return min; } exports.validRange = validRange; function validRange(range, loose) { try { // Return '*' instead of '' so that truthiness works. // This will throw if it's invalid anyway return new Range(range, loose).range || '*'; } catch (er) { return null; } } // Determine if version is less than all the versions possible in the range exports.ltr = ltr; function ltr(version, range, loose) { return outside(version, range, '<', loose); } // Determine if version is greater than all the versions possible in the range. exports.gtr = gtr; function gtr(version, range, loose) { return outside(version, range, '>', loose); } exports.outside = outside; function outside(version, range, hilo, loose) { version = new SemVer(version, loose); range = new Range(range, loose); var gtfn, ltefn, ltfn, comp, ecomp; switch (hilo) { case '>': gtfn = gt; ltefn = lte; ltfn = lt; comp = '>'; ecomp = '>='; break; case '<': gtfn = lt; ltefn = gte; ltfn = gt; comp = '<'; ecomp = '<='; break; default: throw new TypeError('Must provide a hilo val of "<" or ">"'); } // If it satisifes the range it is not outside if (satisfies(version, range, loose)) { return false; } // From now on, variable terms are as if we're in "gtr" mode. // but note that everything is flipped for the "ltr" function. for (var i = 0; i < range.set.length; ++i) { var comparators = range.set[i]; var high = null; var low = null; comparators.forEach(function(comparator) { if (comparator.semver === ANY) { comparator = new Comparator('>=0.0.0') } high = high || comparator; low = low || comparator; if (gtfn(comparator.semver, high.semver, loose)) { high = comparator; } else if (ltfn(comparator.semver, low.semver, loose)) { low = comparator; } }); // If the edge version comparator has a operator then our version // isn't outside it if (high.operator === comp || high.operator === ecomp) { return false; } // If the lowest version comparator has an operator and our version // is less than it then it isn't higher than the range if ((!low.operator || low.operator === comp) && ltefn(version, low.semver)) { return false; } else if (low.operator === ecomp && ltfn(version, low.semver)) { return false; } } return true; } exports.prerelease = prerelease; function prerelease(version, loose) { var parsed = parse(version, loose); return (parsed && parsed.prerelease.length) ? parsed.prerelease : null; } exports.intersects = intersects; function intersects(r1, r2, loose) { r1 = new Range(r1, loose) r2 = new Range(r2, loose) return r1.intersects(r2) } exports.coerce = coerce; function coerce(version) { if (version instanceof SemVer) return version; if (typeof version !== 'string') return null; var match = version.match(re[COERCE]); if (match == null) return null; return parse((match[1] || '0') + '.' + (match[2] || '0') + '.' + (match[3] || '0')); } /***/ }), /* 28 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var _promise; function _load_promise() { return _promise = _interopRequireDefault(__webpack_require__(7)); } exports.sortAlpha = sortAlpha; exports.sortOptionsByFlags = sortOptionsByFlags; exports.entries = entries; exports.removePrefix = removePrefix; exports.removeSuffix = removeSuffix; exports.addSuffix = addSuffix; exports.hyphenate = hyphenate; exports.camelCase = camelCase; exports.compareSortedArrays = compareSortedArrays; exports.sleep = sleep; function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } var _camelCase = __webpack_require__(562); function sortAlpha(a, b) { // sort alphabetically in a deterministic way var shortLen = Math.min(a.length, b.length); for (var i = 0; i < shortLen; i++) { var aChar = a.charCodeAt(i); var bChar = b.charCodeAt(i); if (aChar !== bChar) { return aChar - bChar; } } return a.length - b.length; } function sortOptionsByFlags(a, b) { var aOpt = a.flags.replace(/-/g, ''); var bOpt = b.flags.replace(/-/g, ''); return sortAlpha(aOpt, bOpt); } function entries(obj) { var entries = []; if (obj) { for (var _key in obj) { entries.push([_key, obj[_key]]); } } return entries; } function removePrefix(pattern, prefix) { if (pattern.startsWith(prefix)) { pattern = pattern.slice(prefix.length); } return pattern; } function removeSuffix(pattern, suffix) { if (pattern.endsWith(suffix)) { return pattern.slice(0, -suffix.length); } return pattern; } function addSuffix(pattern, suffix) { if (!pattern.endsWith(suffix)) { return pattern + suffix; } return pattern; } function hyphenate(str) { return str.replace(/[A-Z]/g, function (match) { return '-' + match.charAt(0).toLowerCase(); }); } function camelCase(str) { if (/[A-Z]/.test(str)) { return null; } else { return _camelCase(str); } } function compareSortedArrays(array1, array2) { if (array1.length !== array2.length) { return false; } for (var i = 0, len = array1.length; i < len; i++) { if (array1[i] !== array2[i]) { return false; } } return true; } function sleep(ms) { return new (_promise || _load_promise()).default(function (resolve) { setTimeout(resolve, ms); }); } /***/ }), /* 29 */ /***/ (function(module, exports) { module.exports = require("url"); /***/ }), /* 30 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; var YAMLException = __webpack_require__(132); var TYPE_CONSTRUCTOR_OPTIONS = [ 'kind', 'resolve', 'construct', 'instanceOf', 'predicate', 'represent', 'defaultStyle', 'styleAliases' ]; var YAML_NODE_KINDS = [ 'scalar', 'sequence', 'mapping' ]; function compileStyleAliases(map) { var result = {}; if (map !== null) { Object.keys(map).forEach(function (style) { map[style].forEach(function (alias) { result[String(alias)] = style; }); }); } return result; } function Type(tag, options) { options = options || {}; Object.keys(options).forEach(function (name) { if (TYPE_CONSTRUCTOR_OPTIONS.indexOf(name) === -1) { throw new YAMLException('Unknown option "' + name + '" is met in definition of "' + tag + '" YAML type.'); } }); // TODO: Add tag format check. this.tag = tag; this.kind = options['kind'] || null; this.resolve = options['resolve'] || function () { return true; }; this.construct = options['construct'] || function (data) { return data; }; this.instanceOf = options['instanceOf'] || null; this.predicate = options['predicate'] || null; this.represent = options['represent'] || null; this.defaultStyle = options['defaultStyle'] || null; this.styleAliases = compileStyleAliases(options['styleAliases'] || null); if (YAML_NODE_KINDS.indexOf(this.kind) === -1) { throw new YAMLException('Unknown kind "' + this.kind + '" is specified for "' + tag + '" YAML type.'); } } module.exports = Type; /***/ }), /* 31 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subscription; }); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_isArray__ = __webpack_require__(48); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isObject__ = __webpack_require__(414); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__util_isFunction__ = __webpack_require__(143); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_tryCatch__ = __webpack_require__(59); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_errorObject__ = __webpack_require__(55); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__ = __webpack_require__(411); /** PURE_IMPORTS_START _util_isArray,_util_isObject,_util_isFunction,_util_tryCatch,_util_errorObject,_util_UnsubscriptionError PURE_IMPORTS_END */ var Subscription = /*@__PURE__*/ (function () { function Subscription(unsubscribe) { this.closed = false; this._parent = null; this._parents = null; this._subscriptions = null; if (unsubscribe) { this._unsubscribe = unsubscribe; } } Subscription.prototype.unsubscribe = function () { var hasErrors = false; var errors; if (this.closed) { return; } var _a = this, _parent = _a._parent, _parents = _a._parents, _unsubscribe = _a._unsubscribe, _subscriptions = _a._subscriptions; this.closed = true; this._parent = null; this._parents = null; this._subscriptions = null; var index = -1; var len = _parents ? _parents.length : 0; while (_parent) { _parent.remove(this); _parent = ++index < len && _parents[index] || null; } if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__util_isFunction__["a" /* isFunction */])(_unsubscribe)) { var trial = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_tryCatch__["a" /* tryCatch */])(_unsubscribe).call(this); if (trial === __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */]) { hasErrors = true; errors = errors || (__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */] ? flattenUnsubscriptionErrors(__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e.errors) : [__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e]); } } if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__util_isArray__["a" /* isArray */])(_subscriptions)) { index = -1; len = _subscriptions.length; while (++index < len) { var sub = _subscriptions[index]; if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isObject__["a" /* isObject */])(sub)) { var trial = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_tryCatch__["a" /* tryCatch */])(sub.unsubscribe).call(sub); if (trial === __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */]) { hasErrors = true; errors = errors || []; var err = __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e; if (err instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */]) { errors = errors.concat(flattenUnsubscriptionErrors(err.errors)); } else { errors.push(err); } } } } } if (hasErrors) { throw new __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */](errors); } }; Subscription.prototype.add = function (teardown) { if (!teardown || (teardown === Subscription.EMPTY)) { return Subscription.EMPTY; } if (teardown === this) { return this; } var subscription = teardown; switch (typeof teardown) { case 'function': subscription = new Subscription(teardown); case 'object': if (subscription.closed || typeof subscription.unsubscribe !== 'function') { return subscription; } else if (this.closed) { subscription.unsubscribe(); return subscription; } else if (typeof subscription._addParent !== 'function') { var tmp = subscription; subscription = new Subscription(); subscription._subscriptions = [tmp]; } break; default: throw new Error('unrecognized teardown ' + teardown + ' added to Subscription.'); } var subscriptions = this._subscriptions || (this._subscriptions = []); subscriptions.push(subscription); subscription._addParent(this); return subscription; }; Subscription.prototype.remove = function (subscription) { var subscriptions = this._subscriptions; if (subscriptions) { var subscriptionIndex = subscriptions.indexOf(subscription); if (subscriptionIndex !== -1) { subscriptions.splice(subscriptionIndex, 1); } } }; Subscription.prototype._addParent = function (parent) { var _a = this, _parent = _a._parent, _parents = _a._parents; if (!_parent || _parent === parent) { this._parent = parent; } else if (!_parents) { this._parents = [parent]; } else if (_parents.indexOf(parent) === -1) { _parents.push(parent); } }; Subscription.EMPTY = (function (empty) { empty.closed = true; return empty; }(new Subscription())); return Subscription; }()); function flattenUnsubscriptionErrors(errors) { return errors.reduce(function (errs, err) { return errs.concat((err instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */]) ? err.errors : err); }, []); } //# sourceMappingURL=Subscription.js.map /***/ }), /* 32 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { bufferSplit: bufferSplit, addRSAMissing: addRSAMissing, calculateDSAPublic: calculateDSAPublic, calculateED25519Public: calculateED25519Public, calculateX25519Public: calculateX25519Public, mpNormalize: mpNormalize, mpDenormalize: mpDenormalize, ecNormalize: ecNormalize, countZeros: countZeros, assertCompatible: assertCompatible, isCompatible: isCompatible, opensslKeyDeriv: opensslKeyDeriv, opensshCipherInfo: opensshCipherInfo, publicFromPrivateECDSA: publicFromPrivateECDSA, zeroPadToLength: zeroPadToLength, writeBitString: writeBitString, readBitString: readBitString }; var assert = __webpack_require__(22); var Buffer = __webpack_require__(20).Buffer; var PrivateKey = __webpack_require__(40); var Key = __webpack_require__(35); var crypto = __webpack_require__(21); var algs = __webpack_require__(39); var asn1 = __webpack_require__(67); var ec, jsbn; var nacl; var MAX_CLASS_DEPTH = 3; function isCompatible(obj, klass, needVer) { if (obj === null || typeof (obj) !== 'object') return (false); if (needVer === undefined) needVer = klass.prototype._sshpkApiVersion; if (obj instanceof klass && klass.prototype._sshpkApiVersion[0] == needVer[0]) return (true); var proto = Object.getPrototypeOf(obj); var depth = 0; while (proto.constructor.name !== klass.name) { proto = Object.getPrototypeOf(proto); if (!proto || ++depth > MAX_CLASS_DEPTH) return (false); } if (proto.constructor.name !== klass.name) return (false); var ver = proto._sshpkApiVersion; if (ver === undefined) ver = klass._oldVersionDetect(obj); if (ver[0] != needVer[0] || ver[1] < needVer[1]) return (false); return (true); } function assertCompatible(obj, klass, needVer, name) { if (name === undefined) name = 'object'; assert.ok(obj, name + ' must not be null'); assert.object(obj, name + ' must be an object'); if (needVer === undefined) needVer = klass.prototype._sshpkApiVersion; if (obj instanceof klass && klass.prototype._sshpkApiVersion[0] == needVer[0]) return; var proto = Object.getPrototypeOf(obj); var depth = 0; while (proto.constructor.name !== klass.name) { proto = Object.getPrototypeOf(proto); assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, name + ' must be a ' + klass.name + ' instance'); } assert.strictEqual(proto.constructor.name, klass.name, name + ' must be a ' + klass.name + ' instance'); var ver = proto._sshpkApiVersion; if (ver === undefined) ver = klass._oldVersionDetect(obj); assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], name + ' must be compatible with ' + klass.name + ' klass ' + 'version ' + needVer[0] + '.' + needVer[1]); } var CIPHER_LEN = { 'des-ede3-cbc': { key: 7, iv: 8 }, 'aes-128-cbc': { key: 16, iv: 16 } }; var PKCS5_SALT_LEN = 8; function opensslKeyDeriv(cipher, salt, passphrase, count) { assert.buffer(salt, 'salt'); assert.buffer(passphrase, 'passphrase'); assert.number(count, 'iteration count'); var clen = CIPHER_LEN[cipher]; assert.object(clen, 'supported cipher'); salt = salt.slice(0, PKCS5_SALT_LEN); var D, D_prev, bufs; var material = Buffer.alloc(0); while (material.length < clen.key + clen.iv) { bufs = []; if (D_prev) bufs.push(D_prev); bufs.push(passphrase); bufs.push(salt); D = Buffer.concat(bufs); for (var j = 0; j < count; ++j) D = crypto.createHash('md5').update(D).digest(); material = Buffer.concat([material, D]); D_prev = D; } return ({ key: material.slice(0, clen.key), iv: material.slice(clen.key, clen.key + clen.iv) }); } /* Count leading zero bits on a buffer */ function countZeros(buf) { var o = 0, obit = 8; while (o < buf.length) { var mask = (1 << obit); if ((buf[o] & mask) === mask) break; obit--; if (obit < 0) { o++; obit = 8; } } return (o*8 + (8 - obit) - 1); } function bufferSplit(buf, chr) { assert.buffer(buf); assert.string(chr); var parts = []; var lastPart = 0; var matches = 0; for (var i = 0; i < buf.length; ++i) { if (buf[i] === chr.charCodeAt(matches)) ++matches; else if (buf[i] === chr.charCodeAt(0)) matches = 1; else matches = 0; if (matches >= chr.length) { var newPart = i + 1; parts.push(buf.slice(lastPart, newPart - matches)); lastPart = newPart; matches = 0; } } if (lastPart <= buf.length) parts.push(buf.slice(lastPart, buf.length)); return (parts); } function ecNormalize(buf, addZero) { assert.buffer(buf); if (buf[0] === 0x00 && buf[1] === 0x04) { if (addZero) return (buf); return (buf.slice(1)); } else if (buf[0] === 0x04) { if (!addZero) return (buf); } else { while (buf[0] === 0x00) buf = buf.slice(1); if (buf[0] === 0x02 || buf[0] === 0x03) throw (new Error('Compressed elliptic curve points ' + 'are not supported')); if (buf[0] !== 0x04) throw (new Error('Not a valid elliptic curve point')); if (!addZero) return (buf); } var b = Buffer.alloc(buf.length + 1); b[0] = 0x0; buf.copy(b, 1); return (b); } function readBitString(der, tag) { if (tag === undefined) tag = asn1.Ber.BitString; var buf = der.readString(tag, true); assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + 'not supported (0x' + buf[0].toString(16) + ')'); return (buf.slice(1)); } function writeBitString(der, buf, tag) { if (tag === undefined) tag = asn1.Ber.BitString; var b = Buffer.alloc(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); der.writeBuffer(b, tag); } function mpNormalize(buf) { assert.buffer(buf); while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) buf = buf.slice(1); if ((buf[0] & 0x80) === 0x80) { var b = Buffer.alloc(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); buf = b; } return (buf); } function mpDenormalize(buf) { assert.buffer(buf); while (buf.length > 1 && buf[0] === 0x00) buf = buf.slice(1); return (buf); } function zeroPadToLength(buf, len) { assert.buffer(buf); assert.number(len); while (buf.length > len) { assert.equal(buf[0], 0x00); buf = buf.slice(1); } while (buf.length < len) { var b = Buffer.alloc(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); buf = b; } return (buf); } function bigintToMpBuf(bigint) { var buf = Buffer.from(bigint.toByteArray()); buf = mpNormalize(buf); return (buf); } function calculateDSAPublic(g, p, x) { assert.buffer(g); assert.buffer(p); assert.buffer(x); try { var bigInt = __webpack_require__(79).BigInteger; } catch (e) { throw (new Error('To load a PKCS#8 format DSA private key, ' + 'the node jsbn library is required.')); } g = new bigInt(g); p = new bigInt(p); x = new bigInt(x); var y = g.modPow(x, p); var ybuf = bigintToMpBuf(y); return (ybuf); } function calculateED25519Public(k) { assert.buffer(k); if (nacl === undefined) nacl = __webpack_require__(72); var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); return (Buffer.from(kp.publicKey)); } function calculateX25519Public(k) { assert.buffer(k); if (nacl === undefined) nacl = __webpack_require__(72); var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); return (Buffer.from(kp.publicKey)); } function addRSAMissing(key) { assert.object(key); assertCompatible(key, PrivateKey, [1, 1]); try { var bigInt = __webpack_require__(79).BigInteger; } catch (e) { throw (new Error('To write a PEM private key from ' + 'this source, the node jsbn lib is required.')); } var d = new bigInt(key.part.d.data); var buf; if (!key.part.dmodp) { var p = new bigInt(key.part.p.data); var dmodp = d.mod(p.subtract(1)); buf = bigintToMpBuf(dmodp); key.part.dmodp = {name: 'dmodp', data: buf}; key.parts.push(key.part.dmodp); } if (!key.part.dmodq) { var q = new bigInt(key.part.q.data); var dmodq = d.mod(q.subtract(1)); buf = bigintToMpBuf(dmodq); key.part.dmodq = {name: 'dmodq', data: buf}; key.parts.push(key.part.dmodq); } } function publicFromPrivateECDSA(curveName, priv) { assert.string(curveName, 'curveName'); assert.buffer(priv); if (ec === undefined) ec = __webpack_require__(130); if (jsbn === undefined) jsbn = __webpack_require__(79).BigInteger; var params = algs.curves[curveName]; var p = new jsbn(params.p); var a = new jsbn(params.a); var b = new jsbn(params.b); var curve = new ec.ECCurveFp(p, a, b); var G = curve.decodePointHex(params.G.toString('hex')); var d = new jsbn(mpNormalize(priv)); var pub = G.multiply(d); pub = Buffer.from(curve.encodePointHex(pub), 'hex'); var parts = []; parts.push({name: 'curve', data: Buffer.from(curveName)}); parts.push({name: 'Q', data: pub}); var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); return (key); } function opensshCipherInfo(cipher) { var inf = {}; switch (cipher) { case '3des-cbc': inf.keySize = 24; inf.blockSize = 8; inf.opensslName = 'des-ede3-cbc'; break; case 'blowfish-cbc': inf.keySize = 16; inf.blockSize = 8; inf.opensslName = 'bf-cbc'; break; case 'aes128-cbc': case 'aes128-ctr': case 'aes128-gcm@openssh.com': inf.keySize = 16; inf.blockSize = 16; inf.opensslName = 'aes-128-' + cipher.slice(7, 10); break; case 'aes192-cbc': case 'aes192-ctr': case 'aes192-gcm@openssh.com': inf.keySize = 24; inf.blockSize = 16; inf.opensslName = 'aes-192-' + cipher.slice(7, 10); break; case 'aes256-cbc': case 'aes256-ctr': case 'aes256-gcm@openssh.com': inf.keySize = 32; inf.blockSize = 16; inf.opensslName = 'aes-256-' + cipher.slice(7, 10); break; default: throw (new Error( 'Unsupported openssl cipher "' + cipher + '"')); } return (inf); } /***/ }), /* 33 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; const escapeStringRegexp = __webpack_require__(351); const ansiStyles = __webpack_require__(447); const stdoutColor = __webpack_require__(564).stdout; const template = __webpack_require__(565); const isSimpleWindowsTerm = process.platform === 'win32' && !(process.env.TERM || '').toLowerCase().startsWith('xterm'); // `supportsColor.level` → `ansiStyles.color[name]` mapping const levelMapping = ['ansi', 'ansi', 'ansi256', 'ansi16m']; // `color-convert` models to exclude from the Chalk API due to conflicts and such const skipModels = new Set(['gray']); const styles = Object.create(null); function applyOptions(obj, options) { options = options || {}; // Detect level if not set manually const scLevel = stdoutColor ? stdoutColor.level : 0; obj.level = options.level === undefined ? scLevel : options.level; obj.enabled = 'enabled' in options ? options.enabled : obj.level > 0; } function Chalk(options) { // We check for this.template here since calling `chalk.constructor()` // by itself will have a `this` of a previously constructed chalk object if (!this || !(this instanceof Chalk) || this.template) { const chalk = {}; applyOptions(chalk, options); chalk.template = function () { const args = [].slice.call(arguments); return chalkTag.apply(null, [chalk.template].concat(args)); }; Object.setPrototypeOf(chalk, Chalk.prototype); Object.setPrototypeOf(chalk.template, chalk); chalk.template.constructor = Chalk; return chalk.template; } applyOptions(this, options); } // Use bright blue on Windows as the normal blue color is illegible if (isSimpleWindowsTerm) { ansiStyles.blue.open = '\u001B[94m'; } for (const key of Object.keys(ansiStyles)) { ansiStyles[key].closeRe = new RegExp(escapeStringRegexp(ansiStyles[key].close), 'g'); styles[key] = { get() { const codes = ansiStyles[key]; return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, key); } }; } styles.visible = { get() { return build.call(this, this._styles || [], true, 'visible'); } }; ansiStyles.color.closeRe = new RegExp(escapeStringRegexp(ansiStyles.color.close), 'g'); for (const model of Object.keys(ansiStyles.color.ansi)) { if (skipModels.has(model)) { continue; } styles[model] = { get() { const level = this.level; return function () { const open = ansiStyles.color[levelMapping[level]][model].apply(null, arguments); const codes = { open, close: ansiStyles.color.close, closeRe: ansiStyles.color.closeRe }; return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, model); }; } }; } ansiStyles.bgColor.closeRe = new RegExp(escapeStringRegexp(ansiStyles.bgColor.close), 'g'); for (const model of Object.keys(ansiStyles.bgColor.ansi)) { if (skipModels.has(model)) { continue; } const bgModel = 'bg' + model[0].toUpperCase() + model.slice(1); styles[bgModel] = { get() { const level = this.level; return function () { const open = ansiStyles.bgColor[levelMapping[level]][model].apply(null, arguments); const codes = { open, close: ansiStyles.bgColor.close, closeRe: ansiStyles.bgColor.closeRe }; return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, model); }; } }; } const proto = Object.defineProperties(() => {}, styles); function build(_styles, _empty, key) { const builder = function () { return applyStyle.apply(builder, arguments); }; builder._styles = _styles; builder._empty = _empty; const self = this; Object.defineProperty(builder, 'level', { enumerable: true, get() { return self.level; }, set(level) { self.level = level; } }); Object.defineProperty(builder, 'enabled', { enumerable: true, get() { return self.enabled; }, set(enabled) { self.enabled = enabled; } }); // See below for fix regarding invisible grey/dim combination on Windows builder.hasGrey = this.hasGrey || key === 'gray' || key === 'grey'; // `__proto__` is used because we must return a function, but there is // no way to create a function with a different prototype builder.__proto__ = proto; // eslint-disable-line no-proto return builder; } function applyStyle() { // Support varags, but simply cast to string in case there's only one arg const args = arguments; const argsLen = args.length; let str = String(arguments[0]); if (argsLen === 0) { return ''; } if (argsLen > 1) { // Don't slice `arguments`, it prevents V8 optimizations for (let a = 1; a < argsLen; a++) { str += ' ' + args[a]; } } if (!this.enabled || this.level <= 0 || !str) { return this._empty ? '' : str; } // Turns out that on Windows dimmed gray text becomes invisible in cmd.exe, // see https://github.com/chalk/chalk/issues/58 // If we're on Windows and we're dealing with a gray color, temporarily make 'dim' a noop. const originalDim = ansiStyles.dim.open; if (isSimpleWindowsTerm && this.hasGrey) { ansiStyles.dim.open = ''; } for (const code of this._styles.slice().reverse()) { // Replace any instances already present with a re-opening code // otherwise only the part of the string until said closing code // will be colored, and the rest will simply be 'plain'. str = code.open + str.replace(code.closeRe, code.open) + code.close; // Close the styling before a linebreak and reopen // after next line to fix a bleed issue on macOS // https://github.com/chalk/chalk/pull/92 str = str.replace(/\r?\n/g, `${code.close}$&${code.open}`); } // Reset the original `dim` if we changed it to work around the Windows dimmed gray issue ansiStyles.dim.open = originalDim; return str; } function chalkTag(chalk, strings) { if (!Array.isArray(strings)) { // If chalk() was called by itself or with a string, // return the string itself as a string. return [].slice.call(arguments, 1).join(' '); } const args = [].slice.call(arguments, 2); const parts = [strings.raw[0]]; for (let i = 1; i < strings.length; i++) { parts.push(String(args[i - 1]).replace(/[{}\\]/g, '\\$&')); parts.push(String(strings.raw[i])); } return template(chalk, parts.join('')); } Object.defineProperties(Chalk.prototype, styles); module.exports = Chalk(); // eslint-disable-line new-cap module.exports.supportsColor = stdoutColor; module.exports.default = module.exports; // For TypeScript /***/ }), /* 34 */ /***/ (function(module, exports, __webpack_require__) { var global = __webpack_require__(38); var core = __webpack_require__(26); var ctx = __webpack_require__(68); var hide = __webpack_require__(77); var has = __webpack_require__(89); var PROTOTYPE = 'prototype'; var $export = function (type, name, source) { var IS_FORCED = type & $export.F; var IS_GLOBAL = type & $export.G; var IS_STATIC = type & $export.S; var IS_PROTO = type & $export.P; var IS_BIND = type & $export.B; var IS_WRAP = type & $export.W; var exports = IS_GLOBAL ? core : core[name] || (core[name] = {}); var expProto = exports[PROTOTYPE]; var target = IS_GLOBAL ? global : IS_STATIC ? global[name] : (global[name] || {})[PROTOTYPE]; var key, own, out; if (IS_GLOBAL) source = name; for (key in source) { // contains in native own = !IS_FORCED && target && target[key] !== undefined; if (own && has(exports, key)) continue; // export native or passed out = own ? target[key] : source[key]; // prevent global pollution for namespaces exports[key] = IS_GLOBAL && typeof target[key] != 'function' ? source[key] // bind timers to global for call from export context : IS_BIND && own ? ctx(out, global) // wrap global constructors for prevent change them in library : IS_WRAP && target[key] == out ? (function (C) { var F = function (a, b, c) { if (this instanceof C) { switch (arguments.length) { case 0: return new C(); case 1: return new C(a); case 2: return new C(a, b); } return new C(a, b, c); } return C.apply(this, arguments); }; F[PROTOTYPE] = C[PROTOTYPE]; return F; // make static versions for prototype methods })(out) : IS_PROTO && typeof out == 'function' ? ctx(Function.call, out) : out; // export proto methods to core.%CONSTRUCTOR%.methods.%NAME% if (IS_PROTO) { (exports.virtual || (exports.virtual = {}))[key] = out; // export proto methods to core.%CONSTRUCTOR%.prototype.%NAME% if (type & $export.R && expProto && !expProto[key]) hide(expProto, key, out); } } }; // type bitmap $export.F = 1; // forced $export.G = 2; // global $export.S = 4; // static $export.P = 8; // proto $export.B = 16; // bind $export.W = 32; // wrap $export.U = 64; // safe $export.R = 128; // real proto method for `library` module.exports = $export; /***/ }), /* 35 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = Key; var assert = __webpack_require__(22); var algs = __webpack_require__(39); var crypto = __webpack_require__(21); var Fingerprint = __webpack_require__(145); var Signature = __webpack_require__(71); var DiffieHellman = __webpack_require__(266).DiffieHellman; var errs = __webpack_require__(70); var utils = __webpack_require__(32); var PrivateKey = __webpack_require__(40); var edCompat; try { edCompat = __webpack_require__(424); } catch (e) { /* Just continue through, and bail out if we try to use it. */ } var InvalidAlgorithmError = errs.InvalidAlgorithmError; var KeyParseError = errs.KeyParseError; var formats = {}; formats['auto'] = __webpack_require__(425); formats['pem'] = __webpack_require__(82); formats['pkcs1'] = __webpack_require__(268); formats['pkcs8'] = __webpack_require__(146); formats['rfc4253'] = __webpack_require__(92); formats['ssh'] = __webpack_require__(426); formats['ssh-private'] = __webpack_require__(183); formats['openssh'] = formats['ssh-private']; formats['dnssec'] = __webpack_require__(267); function Key(opts) { assert.object(opts, 'options'); assert.arrayOfObject(opts.parts, 'options.parts'); assert.string(opts.type, 'options.type'); assert.optionalString(opts.comment, 'options.comment'); var algInfo = algs.info[opts.type]; if (typeof (algInfo) !== 'object') throw (new InvalidAlgorithmError(opts.type)); var partLookup = {}; for (var i = 0; i < opts.parts.length; ++i) { var part = opts.parts[i]; partLookup[part.name] = part; } this.type = opts.type; this.parts = opts.parts; this.part = partLookup; this.comment = undefined; this.source = opts.source; /* for speeding up hashing/fingerprint operations */ this._rfc4253Cache = opts._rfc4253Cache; this._hashCache = {}; var sz; this.curve = undefined; if (this.type === 'ecdsa') { var curve = this.part.curve.data.toString(); this.curve = curve; sz = algs.curves[curve].size; } else if (this.type === 'ed25519' || this.type === 'curve25519') { sz = 256; this.curve = 'curve25519'; } else { var szPart = this.part[algInfo.sizePart]; sz = szPart.data.length; sz = sz * 8 - utils.countZeros(szPart.data); } this.size = sz; } Key.formats = formats; Key.prototype.toBuffer = function (format, options) { if (format === undefined) format = 'ssh'; assert.string(format, 'format'); assert.object(formats[format], 'formats[format]'); assert.optionalObject(options, 'options'); if (format === 'rfc4253') { if (this._rfc4253Cache === undefined) this._rfc4253Cache = formats['rfc4253'].write(this); return (this._rfc4253Cache); } return (formats[format].write(this, options)); }; Key.prototype.toString = function (format, options) { return (this.toBuffer(format, options).toString()); }; Key.prototype.hash = function (algo) { assert.string(algo, 'algorithm'); algo = algo.toLowerCase(); if (algs.hashAlgs[algo] === undefined) throw (new InvalidAlgorithmError(algo)); if (this._hashCache[algo]) return (this._hashCache[algo]); var hash = crypto.createHash(algo). update(this.toBuffer('rfc4253')).digest(); this._hashCache[algo] = hash; return (hash); }; Key.prototype.fingerprint = function (algo) { if (algo === undefined) algo = 'sha256'; assert.string(algo, 'algorithm'); var opts = { type: 'key', hash: this.hash(algo), algorithm: algo }; return (new Fingerprint(opts)); }; Key.prototype.defaultHashAlgorithm = function () { var hashAlgo = 'sha1'; if (this.type === 'rsa') hashAlgo = 'sha256'; if (this.type === 'dsa' && this.size > 1024) hashAlgo = 'sha256'; if (this.type === 'ed25519') hashAlgo = 'sha512'; if (this.type === 'ecdsa') { if (this.size <= 256) hashAlgo = 'sha256'; else if (this.size <= 384) hashAlgo = 'sha384'; else hashAlgo = 'sha512'; } return (hashAlgo); }; Key.prototype.createVerify = function (hashAlgo) { if (hashAlgo === undefined) hashAlgo = this.defaultHashAlgorithm(); assert.string(hashAlgo, 'hash algorithm'); /* ED25519 is not supported by OpenSSL, use a javascript impl. */ if (this.type === 'ed25519' && edCompat !== undefined) return (new edCompat.Verifier(this, hashAlgo)); if (this.type === 'curve25519') throw (new Error('Curve25519 keys are not suitable for ' + 'signing or verification')); var v, nm, err; try { nm = hashAlgo.toUpperCase(); v = crypto.createVerify(nm); } catch (e) { err = e; } if (v === undefined || (err instanceof Error && err.message.match(/Unknown message digest/))) { nm = 'RSA-'; nm += hashAlgo.toUpperCase(); v = crypto.createVerify(nm); } assert.ok(v, 'failed to create verifier'); var oldVerify = v.verify.bind(v); var key = this.toBuffer('pkcs8'); var curve = this.curve; var self = this; v.verify = function (signature, fmt) { if (Signature.isSignature(signature, [2, 0])) { if (signature.type !== self.type) return (false); if (signature.hashAlgorithm && signature.hashAlgorithm !== hashAlgo) return (false); if (signature.curve && self.type === 'ecdsa' && signature.curve !== curve) return (false); return (oldVerify(key, signature.toBuffer('asn1'))); } else if (typeof (signature) === 'string' || Buffer.isBuffer(signature)) { return (oldVerify(key, signature, fmt)); /* * Avoid doing this on valid arguments, walking the prototype * chain can be quite slow. */ } else if (Signature.isSignature(signature, [1, 0])) { throw (new Error('signature was created by too old ' + 'a version of sshpk and cannot be verified')); } else { throw (new TypeError('signature must be a string, ' + 'Buffer, or Signature object')); } }; return (v); }; Key.prototype.createDiffieHellman = function () { if (this.type === 'rsa') throw (new Error('RSA keys do not support Diffie-Hellman')); return (new DiffieHellman(this)); }; Key.prototype.createDH = Key.prototype.createDiffieHellman; Key.parse = function (data, format, options) { if (typeof (data) !== 'string') assert.buffer(data, 'data'); if (format === undefined) format = 'auto'; assert.string(format, 'format'); if (typeof (options) === 'string') options = { filename: options }; assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalString(options.filename, 'options.filename'); if (options.filename === undefined) options.filename = '(unnamed)'; assert.object(formats[format], 'formats[format]'); try { var k = formats[format].read(data, options); if (k instanceof PrivateKey) k = k.toPublic(); if (!k.comment) k.comment = options.filename; return (k); } catch (e) { if (e.name === 'KeyEncryptedError') throw (e); throw (new KeyParseError(options.filename, format, e)); } }; Key.isKey = function (obj, ver) { return (utils.isCompatible(obj, Key, ver)); }; /* * API versions for Key: * [1,0] -- initial ver, may take Signature for createVerify or may not * [1,1] -- added pkcs1, pkcs8 formats * [1,2] -- added auto, ssh-private, openssh formats * [1,3] -- added defaultHashAlgorithm * [1,4] -- added ed support, createDH * [1,5] -- first explicitly tagged version * [1,6] -- changed ed25519 part names */ Key.prototype._sshpkApiVersion = [1, 6]; Key._oldVersionDetect = function (obj) { assert.func(obj.toBuffer); assert.func(obj.fingerprint); if (obj.createDH) return ([1, 4]); if (obj.defaultHashAlgorithm) return ([1, 3]); if (obj.formats['auto']) return ([1, 2]); if (obj.formats['pkcs1']) return ([1, 1]); return ([1, 0]); }; /***/ }), /* 36 */ /***/ (function(module, exports) { module.exports = require("stream"); /***/ }), /* 37 */ /***/ (function(module, exports, __webpack_require__) { module.exports = { "default": __webpack_require__(592), __esModule: true }; /***/ }), /* 38 */ /***/ (function(module, exports) { // https://github.com/zloirock/core-js/issues/86#issuecomment-115759028 var global = module.exports = typeof window != 'undefined' && window.Math == Math ? window : typeof self != 'undefined' && self.Math == Math ? self // eslint-disable-next-line no-new-func : Function('return this')(); if (typeof __g == 'number') __g = global; // eslint-disable-line no-undef /***/ }), /* 39 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. var Buffer = __webpack_require__(20).Buffer; var algInfo = { 'dsa': { parts: ['p', 'q', 'g', 'y'], sizePart: 'p' }, 'rsa': { parts: ['e', 'n'], sizePart: 'n' }, 'ecdsa': { parts: ['curve', 'Q'], sizePart: 'Q' }, 'ed25519': { parts: ['A'], sizePart: 'A' } }; algInfo['curve25519'] = algInfo['ed25519']; var algPrivInfo = { 'dsa': { parts: ['p', 'q', 'g', 'y', 'x'] }, 'rsa': { parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] }, 'ecdsa': { parts: ['curve', 'Q', 'd'] }, 'ed25519': { parts: ['A', 'k'] } }; algPrivInfo['curve25519'] = algPrivInfo['ed25519']; var hashAlgs = { 'md5': true, 'sha1': true, 'sha256': true, 'sha384': true, 'sha512': true }; /* * Taken from * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf */ var curves = { 'nistp256': { size: 256, pkcs8oid: '1.2.840.10045.3.1.7', p: Buffer.from(('00' + 'ffffffff 00000001 00000000 00000000' + '00000000 ffffffff ffffffff ffffffff'). replace(/ /g, ''), 'hex'), a: Buffer.from(('00' + 'FFFFFFFF 00000001 00000000 00000000' + '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). replace(/ /g, ''), 'hex'), b: Buffer.from(( '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). replace(/ /g, ''), 'hex'), s: Buffer.from(('00' + 'c49d3608 86e70493 6a6678e1 139d26b7' + '819f7e90'). replace(/ /g, ''), 'hex'), n: Buffer.from(('00' + 'ffffffff 00000000 ffffffff ffffffff' + 'bce6faad a7179e84 f3b9cac2 fc632551'). replace(/ /g, ''), 'hex'), G: Buffer.from(('04' + '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + '77037d81 2deb33a0 f4a13945 d898c296' + '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + '2bce3357 6b315ece cbb64068 37bf51f5'). replace(/ /g, ''), 'hex') }, 'nistp384': { size: 384, pkcs8oid: '1.3.132.0.34', p: Buffer.from(('00' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff fffffffe' + 'ffffffff 00000000 00000000 ffffffff'). replace(/ /g, ''), 'hex'), a: Buffer.from(('00' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + 'FFFFFFFF 00000000 00000000 FFFFFFFC'). replace(/ /g, ''), 'hex'), b: Buffer.from(( 'b3312fa7 e23ee7e4 988e056b e3f82d19' + '181d9c6e fe814112 0314088f 5013875a' + 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). replace(/ /g, ''), 'hex'), s: Buffer.from(('00' + 'a335926a a319a27a 1d00896a 6773a482' + '7acdac73'). replace(/ /g, ''), 'hex'), n: Buffer.from(('00' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff c7634d81 f4372ddf' + '581a0db2 48b0a77a ecec196a ccc52973'). replace(/ /g, ''), 'hex'), G: Buffer.from(('04' + 'aa87ca22 be8b0537 8eb1c71e f320ad74' + '6e1d3b62 8ba79b98 59f741e0 82542a38' + '5502f25d bf55296c 3a545e38 72760ab7' + '3617de4a 96262c6f 5d9e98bf 9292dc29' + 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). replace(/ /g, ''), 'hex') }, 'nistp521': { size: 521, pkcs8oid: '1.3.132.0.35', p: Buffer.from(( '01ffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffff').replace(/ /g, ''), 'hex'), a: Buffer.from(('01FF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). replace(/ /g, ''), 'hex'), b: Buffer.from(('51' + '953eb961 8e1c9a1f 929a21a0 b68540ee' + 'a2da725b 99b315f3 b8b48991 8ef109e1' + '56193951 ec7e937b 1652c0bd 3bb1bf07' + '3573df88 3d2c34f1 ef451fd4 6b503f00'). replace(/ /g, ''), 'hex'), s: Buffer.from(('00' + 'd09e8800 291cb853 96cc6717 393284aa' + 'a0da64ba').replace(/ /g, ''), 'hex'), n: Buffer.from(('01ff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff fffffffa' + '51868783 bf2f966b 7fcc0148 f709a5d0' + '3bb5c9b8 899c47ae bb6fb71e 91386409'). replace(/ /g, ''), 'hex'), G: Buffer.from(('04' + '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + '9c648139 053fb521 f828af60 6b4d3dba' + 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + '3348b3c1 856a429b f97e7e31 c2e5bd66' + '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + '98f54449 579b4468 17afbd17 273e662c' + '97ee7299 5ef42640 c550b901 3fad0761' + '353c7086 a272c240 88be9476 9fd16650'). replace(/ /g, ''), 'hex') } }; module.exports = { info: algInfo, privInfo: algPrivInfo, hashAlgs: hashAlgs, curves: curves }; /***/ }), /* 40 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = PrivateKey; var assert = __webpack_require__(22); var Buffer = __webpack_require__(20).Buffer; var algs = __webpack_require__(39); var crypto = __webpack_require__(21); var Fingerprint = __webpack_require__(145); var Signature = __webpack_require__(71); var errs = __webpack_require__(70); var util = __webpack_require__(9); var utils = __webpack_require__(32); var dhe = __webpack_require__(266); var generateECDSA = dhe.generateECDSA; var generateED25519 = dhe.generateED25519; var edCompat; var nacl; try { edCompat = __webpack_require__(424); } catch (e) { /* Just continue through, and bail out if we try to use it. */ } var Key = __webpack_require__(35); var InvalidAlgorithmError = errs.InvalidAlgorithmError; var KeyParseError = errs.KeyParseError; var KeyEncryptedError = errs.KeyEncryptedError; var formats = {}; formats['auto'] = __webpack_require__(425); formats['pem'] = __webpack_require__(82); formats['pkcs1'] = __webpack_require__(268); formats['pkcs8'] = __webpack_require__(146); formats['rfc4253'] = __webpack_require__(92); formats['ssh-private'] = __webpack_require__(183); formats['openssh'] = formats['ssh-private']; formats['ssh'] = formats['ssh-private']; formats['dnssec'] = __webpack_require__(267); function PrivateKey(opts) { assert.object(opts, 'options'); Key.call(this, opts); this._pubCache = undefined; } util.inherits(PrivateKey, Key); PrivateKey.formats = formats; PrivateKey.prototype.toBuffer = function (format, options) { if (format === undefined) format = 'pkcs1'; assert.string(format, 'format'); assert.object(formats[format], 'formats[format]'); assert.optionalObject(options, 'options'); return (formats[format].write(this, options)); }; PrivateKey.prototype.hash = function (algo) { return (this.toPublic().hash(algo)); }; PrivateKey.prototype.toPublic = function () { if (this._pubCache) return (this._pubCache); var algInfo = algs.info[this.type]; var pubParts = []; for (var i = 0; i < algInfo.parts.length; ++i) { var p = algInfo.parts[i]; pubParts.push(this.part[p]); } this._pubCache = new Key({ type: this.type, source: this, parts: pubParts }); if (this.comment) this._pubCache.comment = this.comment; return (this._pubCache); }; PrivateKey.prototype.derive = function (newType) { assert.string(newType, 'type'); var priv, pub, pair; if (this.type === 'ed25519' && newType === 'curve25519') { if (nacl === undefined) nacl = __webpack_require__(72); priv = this.part.k.data; if (priv[0] === 0x00) priv = priv.slice(1); pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); pub = Buffer.from(pair.publicKey); return (new PrivateKey({ type: 'curve25519', parts: [ { name: 'A', data: utils.mpNormalize(pub) }, { name: 'k', data: utils.mpNormalize(priv) } ] })); } else if (this.type === 'curve25519' && newType === 'ed25519') { if (nacl === undefined) nacl = __webpack_require__(72); priv = this.part.k.data; if (priv[0] === 0x00) priv = priv.slice(1); pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); pub = Buffer.from(pair.publicKey); return (new PrivateKey({ type: 'ed25519', parts: [ { name: 'A', data: utils.mpNormalize(pub) }, { name: 'k', data: utils.mpNormalize(priv) } ] })); } throw (new Error('Key derivation not supported from ' + this.type + ' to ' + newType)); }; PrivateKey.prototype.createVerify = function (hashAlgo) { return (this.toPublic().createVerify(hashAlgo)); }; PrivateKey.prototype.createSign = function (hashAlgo) { if (hashAlgo === undefined) hashAlgo = this.defaultHashAlgorithm(); assert.string(hashAlgo, 'hash algorithm'); /* ED25519 is not supported by OpenSSL, use a javascript impl. */ if (this.type === 'ed25519' && edCompat !== undefined) return (new edCompat.Signer(this, hashAlgo)); if (this.type === 'curve25519') throw (new Error('Curve25519 keys are not suitable for ' + 'signing or verification')); var v, nm, err; try { nm = hashAlgo.toUpperCase(); v = crypto.createSign(nm); } catch (e) { err = e; } if (v === undefined || (err instanceof Error && err.message.match(/Unknown message digest/))) { nm = 'RSA-'; nm += hashAlgo.toUpperCase(); v = crypto.createSign(nm); } assert.ok(v, 'failed to create verifier'); var oldSign = v.sign.bind(v); var key = this.toBuffer('pkcs1'); var type = this.type; var curve = this.curve; v.sign = function () { var sig = oldSign(key); if (typeof (sig) === 'string') sig = Buffer.from(sig, 'binary'); sig = Signature.parse(sig, type, 'asn1'); sig.hashAlgorithm = hashAlgo; sig.curve = curve; return (sig); }; return (v); }; PrivateKey.parse = function (data, format, options) { if (typeof (data) !== 'string') assert.buffer(data, 'data'); if (format === undefined) format = 'auto'; assert.string(format, 'format'); if (typeof (options) === 'string') options = { filename: options }; assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalString(options.filename, 'options.filename'); if (options.filename === undefined) options.filename = '(unnamed)'; assert.object(formats[format], 'formats[format]'); try { var k = formats[format].read(data, options); assert.ok(k instanceof PrivateKey, 'key is not a private key'); if (!k.comment) k.comment = options.filename; return (k); } catch (e) { if (e.name === 'KeyEncryptedError') throw (e); throw (new KeyParseError(options.filename, format, e)); } }; PrivateKey.isPrivateKey = function (obj, ver) { return (utils.isCompatible(obj, PrivateKey, ver)); }; PrivateKey.generate = function (type, options) { if (options === undefined) options = {}; assert.object(options, 'options'); switch (type) { case 'ecdsa': if (options.curve === undefined) options.curve = 'nistp256'; assert.string(options.curve, 'options.curve'); return (generateECDSA(options.curve)); case 'ed25519': return (generateED25519()); default: throw (new Error('Key generation not supported with key ' + 'type "' + type + '"')); } }; /* * API versions for PrivateKey: * [1,0] -- initial ver * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats * [1,2] -- added defaultHashAlgorithm * [1,3] -- added derive, ed, createDH * [1,4] -- first tagged version * [1,5] -- changed ed25519 part names and format */ PrivateKey.prototype._sshpkApiVersion = [1, 5]; PrivateKey._oldVersionDetect = function (obj) { assert.func(obj.toPublic); assert.func(obj.createSign); if (obj.derive) return ([1, 3]); if (obj.defaultHashAlgorithm) return ([1, 2]); if (obj.formats['auto']) return ([1, 1]); return ([1, 0]); }; /***/ }), /* 41 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); exports.wrapLifecycle = exports.run = exports.install = exports.Install = undefined; var _set; function _load_set() { return _set = _interopRequireDefault(__webpack_require__(16)); } var _promise; function _load_promise() { return _promise = _interopRequireDefault(__webpack_require__(7)); } var _values; function _load_values() { return _values = _interopRequireDefault(__webpack_require__(551)); } var _extends2; function _load_extends() { return _extends2 = _interopRequireDefault(__webpack_require__(24)); } var _assign; function _load_assign() { return _assign = _interopRequireDefault(__webpack_require__(23)); } var _keys; function _load_keys() { return _keys = _interopRequireDefault(__webpack_require__(14)); } var _getIterator2; function _load_getIterator() { return _getIterator2 = _interopRequireDefault(__webpack_require__(4)); } var _asyncToGenerator2; function _load_asyncToGenerator() { return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2)); } var _classCallCheck2; function _load_classCallCheck() { return _classCallCheck2 = _interopRequireDefault(__webpack_require__(3)); } var install = exports.install = function () { var _ref43 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, reporter, flags, lockfile) { yield wrapLifecycle(config, flags, (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { var install = new Install(flags, config, reporter, lockfile); yield install.init(); })); }); return function install(_x16, _x17, _x18, _x19) { return _ref43.apply(this, arguments); }; }(); var run = exports.run = function () { var _ref45 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, reporter, flags, args) { var lockfile = void 0; var error = 'installCommandRenamed'; if (flags.lockfile === false) { lockfile = new (_lockfile || _load_lockfile()).default(); } else { lockfile = yield (_lockfile || _load_lockfile()).default.fromDirectory(config.lockfileFolder, reporter); } if (args.length) { var exampleArgs = args.slice(); if (flags.saveDev) { exampleArgs.push('--dev'); } if (flags.savePeer) { exampleArgs.push('--peer'); } if (flags.saveOptional) { exampleArgs.push('--optional'); } if (flags.saveExact) { exampleArgs.push('--exact'); } if (flags.saveTilde) { exampleArgs.push('--tilde'); } var command = 'add'; if (flags.global) { error = 'globalFlagRemoved'; command = 'global add'; } throw new (_errors || _load_errors()).MessageError(reporter.lang(error, `yarn ${command} ${exampleArgs.join(' ')}`)); } yield install(config, reporter, flags, lockfile); }); return function run(_x20, _x21, _x22, _x23) { return _ref45.apply(this, arguments); }; }(); var wrapLifecycle = exports.wrapLifecycle = function () { var _ref46 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, flags, factory) { yield config.executeLifecycleScript('preinstall'); yield factory(); // npm behaviour, seems kinda funky but yay compatibility yield config.executeLifecycleScript('install'); yield config.executeLifecycleScript('postinstall'); if (!config.production) { if (!config.disablePrepublish) { yield config.executeLifecycleScript('prepublish'); } yield config.executeLifecycleScript('prepare'); } }); return function wrapLifecycle(_x24, _x25, _x26) { return _ref46.apply(this, arguments); }; }(); exports.hasWrapper = hasWrapper; exports.setFlags = setFlags; var _objectPath; function _load_objectPath() { return _objectPath = _interopRequireDefault(__webpack_require__(244)); } var _hooks; function _load_hooks() { return _hooks = __webpack_require__(311); } var _index; function _load_index() { return _index = _interopRequireDefault(__webpack_require__(206)); } var _errors; function _load_errors() { return _errors = __webpack_require__(6); } var _integrityChecker; function _load_integrityChecker() { return _integrityChecker = _interopRequireDefault(__webpack_require__(195)); } var _lockfile; function _load_lockfile() { return _lockfile = _interopRequireDefault(__webpack_require__(25)); } var _lockfile2; function _load_lockfile2() { return _lockfile2 = __webpack_require__(25); } var _packageFetcher; function _load_packageFetcher() { return _packageFetcher = _interopRequireWildcard(__webpack_require__(197)); } var _packageInstallScripts; function _load_packageInstallScripts() { return _packageInstallScripts = _interopRequireDefault(__webpack_require__(513)); } var _packageCompatibility; function _load_packageCompatibility() { return _packageCompatibility = _interopRequireWildcard(__webpack_require__(196)); } var _packageResolver; function _load_packageResolver() { return _packageResolver = _interopRequireDefault(__webpack_require__(303)); } var _packageLinker; function _load_packageLinker() { return _packageLinker = _interopRequireDefault(__webpack_require__(198)); } var _index2; function _load_index2() { return _index2 = __webpack_require__(61); } var _index3; function _load_index3() { return _index3 = __webpack_require__(75); } var _autoclean; function _load_autoclean() { return _autoclean = __webpack_require__(290); } var _constants; function _load_constants() { return _constants = _interopRequireWildcard(__webpack_require__(13)); } var _normalizePattern; function _load_normalizePattern() { return _normalizePattern = __webpack_require__(52); } var _fs; function _load_fs() { return _fs = _interopRequireWildcard(__webpack_require__(8)); } var _map; function _load_map() { return _map = _interopRequireDefault(__webpack_require__(51)); } var _yarnVersion; function _load_yarnVersion() { return _yarnVersion = __webpack_require__(96); } var _generatePnpMap; function _load_generatePnpMap() { return _generatePnpMap = __webpack_require__(536); } var _workspaceLayout; function _load_workspaceLayout() { return _workspaceLayout = _interopRequireDefault(__webpack_require__(87)); } var _resolutionMap; function _load_resolutionMap() { return _resolutionMap = _interopRequireDefault(__webpack_require__(201)); } var _guessName; function _load_guessName() { return _guessName = _interopRequireDefault(__webpack_require__(159)); } var _audit; function _load_audit() { return _audit = _interopRequireDefault(__webpack_require__(289)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } var deepEqual = __webpack_require__(654); var emoji = __webpack_require__(242); var invariant = __webpack_require__(15); var path = __webpack_require__(1); var semver = __webpack_require__(27); var uuid = __webpack_require__(114); var ssri = __webpack_require__(93); var ONE_DAY = 1000 * 60 * 60 * 24; /** * Try and detect the installation method for Yarn and provide a command to update it with. */ function getUpdateCommand(installationMethod) { if (installationMethod === 'tar') { return `curl --compressed -o- -L ${(_constants || _load_constants()).YARN_INSTALLER_SH} | bash`; } if (installationMethod === 'homebrew') { return 'brew upgrade yarn'; } if (installationMethod === 'deb') { return 'sudo apt-get update && sudo apt-get install yarn'; } if (installationMethod === 'rpm') { return 'sudo yum install yarn'; } if (installationMethod === 'npm') { return 'npm install --global yarn'; } if (installationMethod === 'chocolatey') { return 'choco upgrade yarn'; } if (installationMethod === 'apk') { return 'apk update && apk add -u yarn'; } if (installationMethod === 'portage') { return 'sudo emerge --sync && sudo emerge -au sys-apps/yarn'; } return null; } function getUpdateInstaller(installationMethod) { // Windows if (installationMethod === 'msi') { return (_constants || _load_constants()).YARN_INSTALLER_MSI; } return null; } function normalizeFlags(config, rawFlags) { var flags = { // install har: !!rawFlags.har, ignorePlatform: !!rawFlags.ignorePlatform, ignoreEngines: !!rawFlags.ignoreEngines, ignoreScripts: !!rawFlags.ignoreScripts, ignoreOptional: !!rawFlags.ignoreOptional, force: !!rawFlags.force, flat: !!rawFlags.flat, lockfile: rawFlags.lockfile !== false, pureLockfile: !!rawFlags.pureLockfile, updateChecksums: !!rawFlags.updateChecksums, skipIntegrityCheck: !!rawFlags.skipIntegrityCheck, frozenLockfile: !!rawFlags.frozenLockfile, linkDuplicates: !!rawFlags.linkDuplicates, checkFiles: !!rawFlags.checkFiles, audit: !!rawFlags.audit, // add peer: !!rawFlags.peer, dev: !!rawFlags.dev, optional: !!rawFlags.optional, exact: !!rawFlags.exact, tilde: !!rawFlags.tilde, ignoreWorkspaceRootCheck: !!rawFlags.ignoreWorkspaceRootCheck, // outdated, update-interactive includeWorkspaceDeps: !!rawFlags.includeWorkspaceDeps, // add, remove, update workspaceRootIsCwd: rawFlags.workspaceRootIsCwd !== false }; if (config.getOption('ignore-scripts')) { flags.ignoreScripts = true; } if (config.getOption('ignore-platform')) { flags.ignorePlatform = true; } if (config.getOption('ignore-engines')) { flags.ignoreEngines = true; } if (config.getOption('ignore-optional')) { flags.ignoreOptional = true; } if (config.getOption('force')) { flags.force = true; } return flags; } var Install = exports.Install = function () { function Install(flags, config, reporter, lockfile) { (0, (_classCallCheck2 || _load_classCallCheck()).default)(this, Install); this.rootManifestRegistries = []; this.rootPatternsToOrigin = (0, (_map || _load_map()).default)(); this.lockfile = lockfile; this.reporter = reporter; this.config = config; this.flags = normalizeFlags(config, flags); this.resolutions = (0, (_map || _load_map()).default)(); // Legacy resolutions field used for flat install mode this.resolutionMap = new (_resolutionMap || _load_resolutionMap()).default(config); // Selective resolutions for nested dependencies this.resolver = new (_packageResolver || _load_packageResolver()).default(config, lockfile, this.resolutionMap); this.integrityChecker = new (_integrityChecker || _load_integrityChecker()).default(config); this.linker = new (_packageLinker || _load_packageLinker()).default(config, this.resolver); this.scripts = new (_packageInstallScripts || _load_packageInstallScripts()).default(config, this.resolver, this.flags.force); } /** * Create a list of dependency requests from the current directories manifests. */ Install.prototype.fetchRequestFromCwd = function () { var _ref = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { var _this = this; var excludePatterns = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : []; var ignoreUnusedPatterns = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; var patterns = []; var deps = []; var resolutionDeps = []; var manifest = {}; var ignorePatterns = []; var usedPatterns = []; var workspaceLayout = void 0; // some commands should always run in the context of the entire workspace var cwd = this.flags.includeWorkspaceDeps || this.flags.workspaceRootIsCwd ? this.config.lockfileFolder : this.config.cwd; // non-workspaces are always root, otherwise check for workspace root var cwdIsRoot = !this.config.workspaceRootFolder || this.config.lockfileFolder === cwd; // exclude package names that are in install args var excludeNames = []; for (var _iterator = excludePatterns, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : (0, (_getIterator2 || _load_getIterator()).default)(_iterator);;) { var _ref2; if (_isArray) { if (_i >= _iterator.length) break; _ref2 = _iterator[_i++]; } else { _i = _iterator.next(); if (_i.done) break; _ref2 = _i.value; } var _pattern = _ref2; if ((0, (_index3 || _load_index3()).getExoticResolver)(_pattern)) { excludeNames.push((0, (_guessName || _load_guessName()).default)(_pattern)); } else { // extract the name var parts = (0, (_normalizePattern || _load_normalizePattern()).normalizePattern)(_pattern); excludeNames.push(parts.name); } } var stripExcluded = function stripExcluded(manifest) { for (var _iterator2 = excludeNames, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator2);;) { var _ref3; if (_isArray2) { if (_i2 >= _iterator2.length) break; _ref3 = _iterator2[_i2++]; } else { _i2 = _iterator2.next(); if (_i2.done) break; _ref3 = _i2.value; } var exclude = _ref3; if (manifest.dependencies && manifest.dependencies[exclude]) { delete manifest.dependencies[exclude]; } if (manifest.devDependencies && manifest.devDependencies[exclude]) { delete manifest.devDependencies[exclude]; } if (manifest.optionalDependencies && manifest.optionalDependencies[exclude]) { delete manifest.optionalDependencies[exclude]; } } }; var _loop = function* _loop(registry) { var filename = (_index2 || _load_index2()).registries[registry].filename; var loc = path.join(cwd, filename); if (!(yield (_fs || _load_fs()).exists(loc))) { return 'continue'; } _this.rootManifestRegistries.push(registry); var projectManifestJson = yield _this.config.readJson(loc); yield (0, (_index || _load_index()).default)(projectManifestJson, cwd, _this.config, cwdIsRoot); (0, (_assign || _load_assign()).default)(_this.resolutions, projectManifestJson.resolutions); (0, (_assign || _load_assign()).default)(manifest, projectManifestJson); _this.resolutionMap.init(_this.resolutions); for (var _iterator4 = (0, (_keys || _load_keys()).default)(_this.resolutionMap.resolutionsByPackage), _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator4);;) { var _ref5; if (_isArray4) { if (_i4 >= _iterator4.length) break; _ref5 = _iterator4[_i4++]; } else { _i4 = _iterator4.next(); if (_i4.done) break; _ref5 = _i4.value; } var _packageName = _ref5; var _optional = (_objectPath || _load_objectPath()).default.has(manifest.optionalDependencies, _packageName) && _this.flags.ignoreOptional; for (var _iterator8 = _this.resolutionMap.resolutionsByPackage[_packageName], _isArray8 = Array.isArray(_iterator8), _i8 = 0, _iterator8 = _isArray8 ? _iterator8 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator8);;) { var _ref11; if (_isArray8) { if (_i8 >= _iterator8.length) break; _ref11 = _iterator8[_i8++]; } else { _i8 = _iterator8.next(); if (_i8.done) break; _ref11 = _i8.value; } var _ref10 = _ref11; var _pattern3 = _ref10.pattern; resolutionDeps = [].concat(resolutionDeps, [{ registry, pattern: _pattern3, optional: _optional, hint: 'resolution' }]); } } var pushDeps = function pushDeps(depType, manifest, _ref6, isUsed) { var hint = _ref6.hint, optional = _ref6.optional; if (ignoreUnusedPatterns && !isUsed) { return; } // We only take unused dependencies into consideration to get deterministic hoisting. // Since flat mode doesn't care about hoisting and everything is top level and specified then we can safely // leave these out. if (_this.flags.flat && !isUsed) { return; } var depMap = manifest[depType]; for (var name in depMap) { if (excludeNames.indexOf(name) >= 0) { continue; } var _pattern2 = name; if (!_this.lockfile.getLocked(_pattern2)) { // when we use --save we save the dependency to the lockfile with just the name rather than the // version combo _pattern2 += '@' + depMap[name]; } // normalization made sure packages are mentioned only once if (isUsed) { usedPatterns.push(_pattern2); } else { ignorePatterns.push(_pattern2); } _this.rootPatternsToOrigin[_pattern2] = depType; patterns.push(_pattern2); deps.push({ pattern: _pattern2, registry, hint, optional, workspaceName: manifest.name, workspaceLoc: manifest._loc }); } }; if (cwdIsRoot) { pushDeps('dependencies', projectManifestJson, { hint: null, optional: false }, true); pushDeps('devDependencies', projectManifestJson, { hint: 'dev', optional: false }, !_this.config.production); pushDeps('optionalDependencies', projectManifestJson, { hint: 'optional', optional: true }, true); } if (_this.config.workspaceRootFolder) { var workspaceLoc = cwdIsRoot ? loc : path.join(_this.config.lockfileFolder, filename); var workspacesRoot = path.dirname(workspaceLoc); var workspaceManifestJson = projectManifestJson; if (!cwdIsRoot) { // the manifest we read before was a child workspace, so get the root workspaceManifestJson = yield _this.config.readJson(workspaceLoc); yield (0, (_index || _load_index()).default)(workspaceManifestJson, workspacesRoot, _this.config, true); } var workspaces = yield _this.config.resolveWorkspaces(workspacesRoot, workspaceManifestJson); workspaceLayout = new (_workspaceLayout || _load_workspaceLayout()).default(workspaces, _this.config); // add virtual manifest that depends on all workspaces, this way package hoisters and resolvers will work fine var workspaceDependencies = (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.dependencies); for (var _iterator5 = (0, (_keys || _load_keys()).default)(workspaces), _isArray5 = Array.isArray(_iterator5), _i5 = 0, _iterator5 = _isArray5 ? _iterator5 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator5);;) { var _ref7; if (_isArray5) { if (_i5 >= _iterator5.length) break; _ref7 = _iterator5[_i5++]; } else { _i5 = _iterator5.next(); if (_i5.done) break; _ref7 = _i5.value; } var workspaceName = _ref7; var workspaceManifest = workspaces[workspaceName].manifest; workspaceDependencies[workspaceName] = workspaceManifest.version; // include dependencies from all workspaces if (_this.flags.includeWorkspaceDeps) { pushDeps('dependencies', workspaceManifest, { hint: null, optional: false }, true); pushDeps('devDependencies', workspaceManifest, { hint: 'dev', optional: false }, !_this.config.production); pushDeps('optionalDependencies', workspaceManifest, { hint: 'optional', optional: true }, true); } } var virtualDependencyManifest = { _uid: '', name: `workspace-aggregator-${uuid.v4()}`, version: '1.0.0', _registry: 'npm', _loc: workspacesRoot, dependencies: workspaceDependencies, devDependencies: (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.devDependencies), optionalDependencies: (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.optionalDependencies), private: workspaceManifestJson.private, workspaces: workspaceManifestJson.workspaces }; workspaceLayout.virtualManifestName = virtualDependencyManifest.name; var virtualDep = {}; virtualDep[virtualDependencyManifest.name] = virtualDependencyManifest.version; workspaces[virtualDependencyManifest.name] = { loc: workspacesRoot, manifest: virtualDependencyManifest }; // ensure dependencies that should be excluded are stripped from the correct manifest stripExcluded(cwdIsRoot ? virtualDependencyManifest : workspaces[projectManifestJson.name].manifest); pushDeps('workspaces', { workspaces: virtualDep }, { hint: 'workspaces', optional: false }, true); var implicitWorkspaceDependencies = (0, (_extends2 || _load_extends()).default)({}, workspaceDependencies); for (var _iterator6 = (_constants || _load_constants()).OWNED_DEPENDENCY_TYPES, _isArray6 = Array.isArray(_iterator6), _i6 = 0, _iterator6 = _isArray6 ? _iterator6 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator6);;) { var _ref8; if (_isArray6) { if (_i6 >= _iterator6.length) break; _ref8 = _iterator6[_i6++]; } else { _i6 = _iterator6.next(); if (_i6.done) break; _ref8 = _i6.value; } var type = _ref8; for (var _iterator7 = (0, (_keys || _load_keys()).default)(projectManifestJson[type] || {}), _isArray7 = Array.isArray(_iterator7), _i7 = 0, _iterator7 = _isArray7 ? _iterator7 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator7);;) { var _ref9; if (_isArray7) { if (_i7 >= _iterator7.length) break; _ref9 = _iterator7[_i7++]; } else { _i7 = _iterator7.next(); if (_i7.done) break; _ref9 = _i7.value; } var dependencyName = _ref9; delete implicitWorkspaceDependencies[dependencyName]; } } pushDeps('dependencies', { dependencies: implicitWorkspaceDependencies }, { hint: 'workspaces', optional: false }, true); } return 'break'; }; _loop2: for (var _iterator3 = (0, (_keys || _load_keys()).default)((_index2 || _load_index2()).registries), _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator3);;) { var _ref4; if (_isArray3) { if (_i3 >= _iterator3.length) break; _ref4 = _iterator3[_i3++]; } else { _i3 = _iterator3.next(); if (_i3.done) break; _ref4 = _i3.value; } var registry = _ref4; var _ret = yield* _loop(registry); switch (_ret) { case 'continue': continue; case 'break': break _loop2;} } // inherit root flat flag if (manifest.flat) { this.flags.flat = true; } return { requests: [].concat(resolutionDeps, deps), patterns, manifest, usedPatterns, ignorePatterns, workspaceLayout }; }); function fetchRequestFromCwd() { return _ref.apply(this, arguments); } return fetchRequestFromCwd; }(); /** * TODO description */ Install.prototype.prepareRequests = function prepareRequests(requests) { return requests; }; Install.prototype.preparePatterns = function preparePatterns(patterns) { return patterns; }; Install.prototype.preparePatternsForLinking = function preparePatternsForLinking(patterns, cwdManifest, cwdIsRoot) { return patterns; }; Install.prototype.prepareManifests = function () { var _ref12 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { var manifests = yield this.config.getRootManifests(); return manifests; }); function prepareManifests() { return _ref12.apply(this, arguments); } return prepareManifests; }(); Install.prototype.bailout = function () { var _ref13 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (patterns, workspaceLayout) { // We don't want to skip the audit - it could yield important errors if (this.flags.audit) { return false; } // PNP is so fast that the integrity check isn't pertinent if (this.config.plugnplayEnabled) { return false; } if (this.flags.skipIntegrityCheck || this.flags.force) { return false; } var lockfileCache = this.lockfile.cache; if (!lockfileCache) { return false; } var lockfileClean = this.lockfile.parseResultType === 'success'; var match = yield this.integrityChecker.check(patterns, lockfileCache, this.flags, workspaceLayout); if (this.flags.frozenLockfile && (!lockfileClean || match.missingPatterns.length > 0)) { throw new (_errors || _load_errors()).MessageError(this.reporter.lang('frozenLockfileError')); } var haveLockfile = yield (_fs || _load_fs()).exists(path.join(this.config.lockfileFolder, (_constants || _load_constants()).LOCKFILE_FILENAME)); var lockfileIntegrityPresent = !this.lockfile.hasEntriesExistWithoutIntegrity(); var integrityBailout = lockfileIntegrityPresent || !this.config.autoAddIntegrity; if (match.integrityMatches && haveLockfile && lockfileClean && integrityBailout) { this.reporter.success(this.reporter.lang('upToDate')); return true; } if (match.integrityFileMissing && haveLockfile) { // Integrity file missing, force script installations this.scripts.setForce(true); return false; } if (match.hardRefreshRequired) { // e.g. node version doesn't match, force script installations this.scripts.setForce(true); return false; } if (!patterns.length && !match.integrityFileMissing) { this.reporter.success(this.reporter.lang('nothingToInstall')); yield this.createEmptyManifestFolders(); yield this.saveLockfileAndIntegrity(patterns, workspaceLayout); return true; } return false; }); function bailout(_x3, _x4) { return _ref13.apply(this, arguments); } return bailout; }(); /** * Produce empty folders for all used root manifests. */ Install.prototype.createEmptyManifestFolders = function () { var _ref14 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { if (this.config.modulesFolder) { // already created return; } for (var _iterator9 = this.rootManifestRegistries, _isArray9 = Array.isArray(_iterator9), _i9 = 0, _iterator9 = _isArray9 ? _iterator9 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator9);;) { var _ref15; if (_isArray9) { if (_i9 >= _iterator9.length) break; _ref15 = _iterator9[_i9++]; } else { _i9 = _iterator9.next(); if (_i9.done) break; _ref15 = _i9.value; } var registryName = _ref15; var folder = this.config.registries[registryName].folder; yield (_fs || _load_fs()).mkdirp(path.join(this.config.lockfileFolder, folder)); } }); function createEmptyManifestFolders() { return _ref14.apply(this, arguments); } return createEmptyManifestFolders; }(); /** * TODO description */ Install.prototype.markIgnored = function markIgnored(patterns) { for (var _iterator10 = patterns, _isArray10 = Array.isArray(_iterator10), _i10 = 0, _iterator10 = _isArray10 ? _iterator10 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator10);;) { var _ref16; if (_isArray10) { if (_i10 >= _iterator10.length) break; _ref16 = _iterator10[_i10++]; } else { _i10 = _iterator10.next(); if (_i10.done) break; _ref16 = _i10.value; } var _pattern4 = _ref16; var _manifest = this.resolver.getStrictResolvedPattern(_pattern4); var ref = _manifest._reference; invariant(ref, 'expected package reference'); // just mark the package as ignored. if the package is used by a required package, the hoister // will take care of that. ref.ignore = true; } }; /** * helper method that gets only recent manifests * used by global.ls command */ Install.prototype.getFlattenedDeps = function () { var _ref17 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { var _ref18 = yield this.fetchRequestFromCwd(), depRequests = _ref18.requests, rawPatterns = _ref18.patterns; yield this.resolver.init(depRequests, {}); var manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(this.resolver.getManifests(), this.config); this.resolver.updateManifests(manifests); return this.flatten(rawPatterns); }); function getFlattenedDeps() { return _ref17.apply(this, arguments); } return getFlattenedDeps; }(); /** * TODO description */ Install.prototype.init = function () { var _ref19 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { var _this2 = this; this.checkUpdate(); // warn if we have a shrinkwrap if (yield (_fs || _load_fs()).exists(path.join(this.config.lockfileFolder, (_constants || _load_constants()).NPM_SHRINKWRAP_FILENAME))) { this.reporter.warn(this.reporter.lang('shrinkwrapWarning')); } // warn if we have an npm lockfile if (yield (_fs || _load_fs()).exists(path.join(this.config.lockfileFolder, (_constants || _load_constants()).NPM_LOCK_FILENAME))) { this.reporter.warn(this.reporter.lang('npmLockfileWarning')); } if (this.config.plugnplayEnabled) { this.reporter.info(this.reporter.lang('plugnplaySuggestV2L1')); this.reporter.info(this.reporter.lang('plugnplaySuggestV2L2')); } var flattenedTopLevelPatterns = []; var steps = []; var _ref20 = yield this.fetchRequestFromCwd(), depRequests = _ref20.requests, rawPatterns = _ref20.patterns, ignorePatterns = _ref20.ignorePatterns, workspaceLayout = _ref20.workspaceLayout, manifest = _ref20.manifest; var topLevelPatterns = []; var artifacts = yield this.integrityChecker.getArtifacts(); if (artifacts) { this.linker.setArtifacts(artifacts); this.scripts.setArtifacts(artifacts); } if ((_packageCompatibility || _load_packageCompatibility()).shouldCheck(manifest, this.flags)) { steps.push(function () { var _ref21 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) { _this2.reporter.step(curr, total, _this2.reporter.lang('checkingManifest'), emoji.get('mag')); yield _this2.checkCompatibility(); }); return function (_x5, _x6) { return _ref21.apply(this, arguments); }; }()); } var audit = new (_audit || _load_audit()).default(this.config, this.reporter, { groups: (_constants || _load_constants()).OWNED_DEPENDENCY_TYPES }); var auditFoundProblems = false; steps.push(function (curr, total) { return (0, (_hooks || _load_hooks()).callThroughHook)('resolveStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { _this2.reporter.step(curr, total, _this2.reporter.lang('resolvingPackages'), emoji.get('mag')); yield _this2.resolver.init(_this2.prepareRequests(depRequests), { isFlat: _this2.flags.flat, isFrozen: _this2.flags.frozenLockfile, workspaceLayout }); topLevelPatterns = _this2.preparePatterns(rawPatterns); flattenedTopLevelPatterns = yield _this2.flatten(topLevelPatterns); return { bailout: !_this2.flags.audit && (yield _this2.bailout(topLevelPatterns, workspaceLayout)) }; })); }); if (this.flags.audit) { steps.push(function (curr, total) { return (0, (_hooks || _load_hooks()).callThroughHook)('auditStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { _this2.reporter.step(curr, total, _this2.reporter.lang('auditRunning'), emoji.get('mag')); if (_this2.flags.offline) { _this2.reporter.warn(_this2.reporter.lang('auditOffline')); return { bailout: false }; } var preparedManifests = yield _this2.prepareManifests(); // $FlowFixMe - Flow considers `m` in the map operation to be "mixed", so does not recognize `m.object` var mergedManifest = (_assign || _load_assign()).default.apply(Object, [{}].concat((0, (_values || _load_values()).default)(preparedManifests).map(function (m) { return m.object; }))); var auditVulnerabilityCounts = yield audit.performAudit(mergedManifest, _this2.lockfile, _this2.resolver, _this2.linker, topLevelPatterns); auditFoundProblems = auditVulnerabilityCounts.info || auditVulnerabilityCounts.low || auditVulnerabilityCounts.moderate || auditVulnerabilityCounts.high || auditVulnerabilityCounts.critical; return { bailout: yield _this2.bailout(topLevelPatterns, workspaceLayout) }; })); }); } steps.push(function (curr, total) { return (0, (_hooks || _load_hooks()).callThroughHook)('fetchStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { _this2.markIgnored(ignorePatterns); _this2.reporter.step(curr, total, _this2.reporter.lang('fetchingPackages'), emoji.get('truck')); var manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(_this2.resolver.getManifests(), _this2.config); _this2.resolver.updateManifests(manifests); yield (_packageCompatibility || _load_packageCompatibility()).check(_this2.resolver.getManifests(), _this2.config, _this2.flags.ignoreEngines); })); }); steps.push(function (curr, total) { return (0, (_hooks || _load_hooks()).callThroughHook)('linkStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { // remove integrity hash to make this operation atomic yield _this2.integrityChecker.removeIntegrityFile(); _this2.reporter.step(curr, total, _this2.reporter.lang('linkingDependencies'), emoji.get('link')); flattenedTopLevelPatterns = _this2.preparePatternsForLinking(flattenedTopLevelPatterns, manifest, _this2.config.lockfileFolder === _this2.config.cwd); yield _this2.linker.init(flattenedTopLevelPatterns, workspaceLayout, { linkDuplicates: _this2.flags.linkDuplicates, ignoreOptional: _this2.flags.ignoreOptional }); })); }); if (this.config.plugnplayEnabled) { steps.push(function (curr, total) { return (0, (_hooks || _load_hooks()).callThroughHook)('pnpStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { var pnpPath = `${_this2.config.lockfileFolder}/${(_constants || _load_constants()).PNP_FILENAME}`; var code = yield (0, (_generatePnpMap || _load_generatePnpMap()).generatePnpMap)(_this2.config, flattenedTopLevelPatterns, { resolver: _this2.resolver, reporter: _this2.reporter, targetPath: pnpPath, workspaceLayout }); try { var file = yield (_fs || _load_fs()).readFile(pnpPath); if (file === code) { return; } } catch (error) {} yield (_fs || _load_fs()).writeFile(pnpPath, code); yield (_fs || _load_fs()).chmod(pnpPath, 0o755); })); }); } steps.push(function (curr, total) { return (0, (_hooks || _load_hooks()).callThroughHook)('buildStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { _this2.reporter.step(curr, total, _this2.flags.force ? _this2.reporter.lang('rebuildingPackages') : _this2.reporter.lang('buildingFreshPackages'), emoji.get('hammer')); if (_this2.config.ignoreScripts) { _this2.reporter.warn(_this2.reporter.lang('ignoredScripts')); } else { yield _this2.scripts.init(flattenedTopLevelPatterns); } })); }); if (this.flags.har) { steps.push(function () { var _ref28 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) { var formattedDate = new Date().toISOString().replace(/:/g, '-'); var filename = `yarn-install_${formattedDate}.har`; _this2.reporter.step(curr, total, _this2.reporter.lang('savingHar', filename), emoji.get('black_circle_for_record')); yield _this2.config.requestManager.saveHar(filename); }); return function (_x7, _x8) { return _ref28.apply(this, arguments); }; }()); } if (yield this.shouldClean()) { steps.push(function () { var _ref29 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) { _this2.reporter.step(curr, total, _this2.reporter.lang('cleaningModules'), emoji.get('recycle')); yield (0, (_autoclean || _load_autoclean()).clean)(_this2.config, _this2.reporter); }); return function (_x9, _x10) { return _ref29.apply(this, arguments); }; }()); } var currentStep = 0; for (var _iterator11 = steps, _isArray11 = Array.isArray(_iterator11), _i11 = 0, _iterator11 = _isArray11 ? _iterator11 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator11);;) { var _ref30; if (_isArray11) { if (_i11 >= _iterator11.length) break; _ref30 = _iterator11[_i11++]; } else { _i11 = _iterator11.next(); if (_i11.done) break; _ref30 = _i11.value; } var step = _ref30; var stepResult = yield step(++currentStep, steps.length); if (stepResult && stepResult.bailout) { if (this.flags.audit) { audit.summary(); } if (auditFoundProblems) { this.reporter.warn(this.reporter.lang('auditRunAuditForDetails')); } this.maybeOutputUpdate(); return flattenedTopLevelPatterns; } } // fin! if (this.flags.audit) { audit.summary(); } if (auditFoundProblems) { this.reporter.warn(this.reporter.lang('auditRunAuditForDetails')); } yield this.saveLockfileAndIntegrity(topLevelPatterns, workspaceLayout); yield this.persistChanges(); this.maybeOutputUpdate(); this.config.requestManager.clearCache(); return flattenedTopLevelPatterns; }); function init() { return _ref19.apply(this, arguments); } return init; }(); Install.prototype.checkCompatibility = function () { var _ref31 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { var _ref32 = yield this.fetchRequestFromCwd(), manifest = _ref32.manifest; yield (_packageCompatibility || _load_packageCompatibility()).checkOne(manifest, this.config, this.flags.ignoreEngines); }); function checkCompatibility() { return _ref31.apply(this, arguments); } return checkCompatibility; }(); Install.prototype.persistChanges = function () { var _ref33 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { // get all the different registry manifests in this folder var manifests = yield this.config.getRootManifests(); if (yield this.applyChanges(manifests)) { yield this.config.saveRootManifests(manifests); } }); function persistChanges() { return _ref33.apply(this, arguments); } return persistChanges; }(); Install.prototype.applyChanges = function applyChanges(manifests) { var hasChanged = false; if (this.config.plugnplayPersist) { var object = manifests.npm.object; if (typeof object.installConfig !== 'object') { object.installConfig = {}; } if (this.config.plugnplayEnabled && object.installConfig.pnp !== true) { object.installConfig.pnp = true; hasChanged = true; } else if (!this.config.plugnplayEnabled && typeof object.installConfig.pnp !== 'undefined') { delete object.installConfig.pnp; hasChanged = true; } if ((0, (_keys || _load_keys()).default)(object.installConfig).length === 0) { delete object.installConfig; } } return (_promise || _load_promise()).default.resolve(hasChanged); }; /** * Check if we should run the cleaning step. */ Install.prototype.shouldClean = function shouldClean() { return (_fs || _load_fs()).exists(path.join(this.config.lockfileFolder, (_constants || _load_constants()).CLEAN_FILENAME)); }; /** * TODO */ Install.prototype.flatten = function () { var _ref34 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (patterns) { var _this3 = this; if (!this.flags.flat) { return patterns; } var flattenedPatterns = []; for (var _iterator12 = this.resolver.getAllDependencyNamesByLevelOrder(patterns), _isArray12 = Array.isArray(_iterator12), _i12 = 0, _iterator12 = _isArray12 ? _iterator12 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator12);;) { var _ref35; if (_isArray12) { if (_i12 >= _iterator12.length) break; _ref35 = _iterator12[_i12++]; } else { _i12 = _iterator12.next(); if (_i12.done) break; _ref35 = _i12.value; } var name = _ref35; var infos = this.resolver.getAllInfoForPackageName(name).filter(function (manifest) { var ref = manifest._reference; invariant(ref, 'expected package reference'); return !ref.ignore; }); if (infos.length === 0) { continue; } if (infos.length === 1) { // single version of this package // take out a single pattern as multiple patterns may have resolved to this package flattenedPatterns.push(this.resolver.patternsByPackage[name][0]); continue; } var options = infos.map(function (info) { var ref = info._reference; invariant(ref, 'expected reference'); return { // TODO `and is required by {PARENT}`, name: _this3.reporter.lang('manualVersionResolutionOption', ref.patterns.join(', '), info.version), value: info.version }; }); var versions = infos.map(function (info) { return info.version; }); var version = void 0; var resolutionVersion = this.resolutions[name]; if (resolutionVersion && versions.indexOf(resolutionVersion) >= 0) { // use json `resolution` version version = resolutionVersion; } else { version = yield this.reporter.select(this.reporter.lang('manualVersionResolution', name), this.reporter.lang('answer'), options); this.resolutions[name] = version; } flattenedPatterns.push(this.resolver.collapseAllVersionsOfPackage(name, version)); } // save resolutions to their appropriate root manifest if ((0, (_keys || _load_keys()).default)(this.resolutions).length) { var manifests = yield this.config.getRootManifests(); for (var _name in this.resolutions) { var version = this.resolutions[_name]; var _patterns = this.resolver.patternsByPackage[_name]; if (!_patterns) { continue; } var _manifest2 = void 0; for (var _iterator13 = _patterns, _isArray13 = Array.isArray(_iterator13), _i13 = 0, _iterator13 = _isArray13 ? _iterator13 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator13);;) { var _ref36; if (_isArray13) { if (_i13 >= _iterator13.length) break; _ref36 = _iterator13[_i13++]; } else { _i13 = _iterator13.next(); if (_i13.done) break; _ref36 = _i13.value; } var _pattern5 = _ref36; _manifest2 = this.resolver.getResolvedPattern(_pattern5); if (_manifest2) { break; } } invariant(_manifest2, 'expected manifest'); var ref = _manifest2._reference; invariant(ref, 'expected reference'); var object = manifests[ref.registry].object; object.resolutions = object.resolutions || {}; object.resolutions[_name] = version; } yield this.config.saveRootManifests(manifests); } return flattenedPatterns; }); function flatten(_x11) { return _ref34.apply(this, arguments); } return flatten; }(); /** * Remove offline tarballs that are no longer required */ Install.prototype.pruneOfflineMirror = function () { var _ref37 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (lockfile) { var mirror = this.config.getOfflineMirrorPath(); if (!mirror) { return; } var requiredTarballs = new (_set || _load_set()).default(); for (var dependency in lockfile) { var resolved = lockfile[dependency].resolved; if (resolved) { var basename = path.basename(resolved.split('#')[0]); if (dependency[0] === '@' && basename[0] !== '@') { requiredTarballs.add(`${dependency.split('/')[0]}-${basename}`); } requiredTarballs.add(basename); } } var mirrorFiles = yield (_fs || _load_fs()).walk(mirror); for (var _iterator14 = mirrorFiles, _isArray14 = Array.isArray(_iterator14), _i14 = 0, _iterator14 = _isArray14 ? _iterator14 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator14);;) { var _ref38; if (_isArray14) { if (_i14 >= _iterator14.length) break; _ref38 = _iterator14[_i14++]; } else { _i14 = _iterator14.next(); if (_i14.done) break; _ref38 = _i14.value; } var file = _ref38; var isTarball = path.extname(file.basename) === '.tgz'; // if using experimental-pack-script-packages-in-mirror flag, don't unlink prebuilt packages var hasPrebuiltPackage = file.relative.startsWith('prebuilt/'); if (isTarball && !hasPrebuiltPackage && !requiredTarballs.has(file.basename)) { yield (_fs || _load_fs()).unlink(file.absolute); } } }); function pruneOfflineMirror(_x12) { return _ref37.apply(this, arguments); } return pruneOfflineMirror; }(); /** * Save updated integrity and lockfiles. */ Install.prototype.saveLockfileAndIntegrity = function () { var _ref39 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (patterns, workspaceLayout) { var _this4 = this; var resolvedPatterns = {}; (0, (_keys || _load_keys()).default)(this.resolver.patterns).forEach(function (pattern) { if (!workspaceLayout || !workspaceLayout.getManifestByPattern(pattern)) { resolvedPatterns[pattern] = _this4.resolver.patterns[pattern]; } }); // TODO this code is duplicated in a few places, need a common way to filter out workspace patterns from lockfile patterns = patterns.filter(function (p) { return !workspaceLayout || !workspaceLayout.getManifestByPattern(p); }); var lockfileBasedOnResolver = this.lockfile.getLockfile(resolvedPatterns); if (this.config.pruneOfflineMirror) { yield this.pruneOfflineMirror(lockfileBasedOnResolver); } // write integrity hash if (!this.config.plugnplayEnabled) { yield this.integrityChecker.save(patterns, lockfileBasedOnResolver, this.flags, workspaceLayout, this.scripts.getArtifacts()); } // --no-lockfile or --pure-lockfile or --frozen-lockfile if (this.flags.lockfile === false || this.flags.pureLockfile || this.flags.frozenLockfile) { return; } var lockFileHasAllPatterns = patterns.every(function (p) { return _this4.lockfile.getLocked(p); }); var lockfilePatternsMatch = (0, (_keys || _load_keys()).default)(this.lockfile.cache || {}).every(function (p) { return lockfileBasedOnResolver[p]; }); var resolverPatternsAreSameAsInLockfile = (0, (_keys || _load_keys()).default)(lockfileBasedOnResolver).every(function (pattern) { var manifest = _this4.lockfile.getLocked(pattern); return manifest && manifest.resolved === lockfileBasedOnResolver[pattern].resolved && deepEqual(manifest.prebuiltVariants, lockfileBasedOnResolver[pattern].prebuiltVariants); }); var integrityPatternsAreSameAsInLockfile = (0, (_keys || _load_keys()).default)(lockfileBasedOnResolver).every(function (pattern) { var existingIntegrityInfo = lockfileBasedOnResolver[pattern].integrity; if (!existingIntegrityInfo) { // if this entry does not have an integrity, no need to re-write the lockfile because of it return true; } var manifest = _this4.lockfile.getLocked(pattern); if (manifest && manifest.integrity) { var manifestIntegrity = ssri.stringify(manifest.integrity); return manifestIntegrity === existingIntegrityInfo; } return false; }); // remove command is followed by install with force, lockfile will be rewritten in any case then if (!this.flags.force && this.lockfile.parseResultType === 'success' && lockFileHasAllPatterns && lockfilePatternsMatch && resolverPatternsAreSameAsInLockfile && integrityPatternsAreSameAsInLockfile && patterns.length) { return; } // build lockfile location var loc = path.join(this.config.lockfileFolder, (_constants || _load_constants()).LOCKFILE_FILENAME); // write lockfile var lockSource = (0, (_lockfile2 || _load_lockfile2()).stringify)(lockfileBasedOnResolver, false, this.config.enableLockfileVersions); yield (_fs || _load_fs()).writeFilePreservingEol(loc, lockSource); this._logSuccessSaveLockfile(); }); function saveLockfileAndIntegrity(_x13, _x14) { return _ref39.apply(this, arguments); } return saveLockfileAndIntegrity; }(); Install.prototype._logSuccessSaveLockfile = function _logSuccessSaveLockfile() { this.reporter.success(this.reporter.lang('savedLockfile')); }; /** * Load the dependency graph of the current install. Only does package resolving and wont write to the cwd. */ Install.prototype.hydrate = function () { var _ref40 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (ignoreUnusedPatterns) { var request = yield this.fetchRequestFromCwd([], ignoreUnusedPatterns); var depRequests = request.requests, rawPatterns = request.patterns, ignorePatterns = request.ignorePatterns, workspaceLayout = request.workspaceLayout; yield this.resolver.init(depRequests, { isFlat: this.flags.flat, isFrozen: this.flags.frozenLockfile, workspaceLayout }); yield this.flatten(rawPatterns); this.markIgnored(ignorePatterns); // fetch packages, should hit cache most of the time var manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(this.resolver.getManifests(), this.config); this.resolver.updateManifests(manifests); yield (_packageCompatibility || _load_packageCompatibility()).check(this.resolver.getManifests(), this.config, this.flags.ignoreEngines); // expand minimal manifests for (var _iterator15 = this.resolver.getManifests(), _isArray15 = Array.isArray(_iterator15), _i15 = 0, _iterator15 = _isArray15 ? _iterator15 : (0, (_getIterator2 || _load_getIterator()).default)(_iterator15);;) { var _ref41; if (_isArray15) { if (_i15 >= _iterator15.length) break; _ref41 = _iterator15[_i15++]; } else { _i15 = _iterator15.next(); if (_i15.done) break; _ref41 = _i15.value; } var _manifest3 = _ref41; var ref = _manifest3._reference; invariant(ref, 'expected reference'); var type = ref.remote.type; // link specifier won't ever hit cache var _loc = ''; if (type === 'link') { continue; } else if (type === 'workspace') { if (!ref.remote.reference) { continue; } _loc = ref.remote.reference; } else { _loc = this.config.generateModuleCachePath(ref); } var newPkg = yield this.config.readManifest(_loc); yield this.resolver.updateManifest(ref, newPkg); } return request; }); function hydrate(_x15) { return _ref40.apply(this, arguments); } return hydrate; }(); /** * Check for updates every day and output a nag message if there's a newer version. */ Install.prototype.checkUpdate = function checkUpdate() { if (this.config.nonInteractive) { // don't show upgrade dialog on CI or non-TTY terminals return; } // don't check if disabled if (this.config.getOption('disable-self-update-check')) { return; } // only check for updates once a day var lastUpdateCheck = Number(this.config.getOption('lastUpdateCheck')) || 0; if (lastUpdateCheck && Date.now() - lastUpdateCheck < ONE_DAY) { return; } // don't bug for updates on tagged releases if ((_yarnVersion || _load_yarnVersion()).version.indexOf('-') >= 0) { return; } this._checkUpdate().catch(function () { // swallow errors }); }; Install.prototype._checkUpdate = function () { var _ref42 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { var _this5 = this; var latestVersion = yield this.config.requestManager.request({ url: (_constants || _load_constants()).SELF_UPDATE_VERSION_URL }); invariant(typeof latestVersion === 'string', 'expected string'); latestVersion = latestVersion.trim(); if (!semver.valid(latestVersion)) { return; } // ensure we only check for updates periodically this.config.registries.yarn.saveHomeConfig({ lastUpdateCheck: Date.now() }); if (semver.gt(latestVersion, (_yarnVersion || _load_yarnVersion()).version)) { var installationMethod = yield (0, (_yarnVersion || _load_yarnVersion()).getInstallationMethod)(); this.maybeOutputUpdate = function () { _this5.reporter.warn(_this5.reporter.lang('yarnOutdated', latestVersion, (_yarnVersion || _load_yarnVersion()).version)); var command = getUpdateCommand(installationMethod); if (command) { _this5.reporter.info(_this5.reporter.lang('yarnOutdatedCommand')); _this5.reporter.command(command); } else { var installer = getUpdateInstaller(installationMethod); if (installer) { _this5.reporter.info(_this5.reporter.lang('yarnOutdatedInstaller', installer)); } } }; } }); function _checkUpdate() { return _ref42.apply(this, arguments); } return _checkUpdate; }(); /** * Method to override with a possible upgrade message. */ Install.prototype.maybeOutputUpdate = function maybeOutputUpdate() {}; return Install; }(); function hasWrapper(commander, args) { return true; } function setFlags(commander) { commander.description('Yarn install is used to install all dependencies for a project.'); commander.usage('install [flags]'); commander.option('-A, --audit', 'Run vulnerability audit on installed packages'); commander.option('-g, --global', 'DEPRECATED'); commander.option('-S, --save', 'DEPRECATED - save package to your `dependencies`'); commander.option('-D, --save-dev', 'DEPRECATED - save package to your `devDependencies`'); commander.option('-P, --save-peer', 'DEPRECATED - save package to your `peerDependencies`'); commander.option('-O, --save-optional', 'DEPRECATED - save package to your `optionalDependencies`'); commander.option('-E, --save-exact', 'DEPRECATED'); commander.option('-T, --save-tilde', 'DEPRECATED'); } /***/ }), /* 42 */ /***/ (function(module, exports, __webpack_require__) { module.exports = { "default": __webpack_require__(593), __esModule: true }; /***/ }), /* 43 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return SubjectSubscriber; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subject; }); /* unused harmony export AnonymousSubject */ /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(0); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Observable__ = __webpack_require__(17); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Subscriber__ = __webpack_require__(5); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(31); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__ = __webpack_require__(180); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__ = __webpack_require__(392); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__ = __webpack_require__(262); /** PURE_IMPORTS_START tslib,_Observable,_Subscriber,_Subscription,_util_ObjectUnsubscribedError,_SubjectSubscription,_internal_symbol_rxSubscriber PURE_IMPORTS_END */ var SubjectSubscriber = /*@__PURE__*/ (function (_super) { __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](SubjectSubscriber, _super); function SubjectSubscriber(destination) { var _this = _super.call(this, destination) || this; _this.destination = destination; return _this; } return SubjectSubscriber; }(__WEBPACK_IMPORTED_MODULE_2__Subscriber__["a" /* Subscriber */])); var Subject = /*@__PURE__*/ (function (_super) { __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](Subject, _super); function Subject() { var _this = _super.call(this) || this; _this.observers = []; _this.closed = false; _this.isStopped = false; _this.hasError = false; _this.thrownError = null; return _this; } Subject.prototype[__WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__["a" /* rxSubscriber */]] = function () { return new SubjectSubscriber(this); }; Subject.prototype.lift = function (operator) { var subject = new AnonymousSubject(this, this); subject.operator = operator; return subject; }; Subject.prototype.next = function (value) { if (this.closed) { throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); } if (!this.isStopped) { var observers = this.observers; var len = observers.length; var copy = observers.slice(); for (var i = 0; i < len; i++) { copy[i].next(value); } } }; Subject.prototype.error = function (err) { if (this.closed) { throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); } this.hasError = true; this.thrownError = err; this.isStopped = true; var observers = this.observers; var len = observers.length; var copy = observers.slice(); for (var i = 0; i < len; i++) { copy[i].error(err); } this.observers.length = 0; }; Subject.prototype.complete = function () { if (this.closed) { throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); } this.isStopped = true; var observers = this.observers; var len = observers.length; var copy = observers.slice(); for (var i = 0; i < len; i++) { copy[i].complete(); } this.observers.length = 0; }; Subject.prototype.unsubscribe = function () { this.isStopped = true; this.closed = true; this.observers = null; }; Subject.prototype._trySubscribe = function (subscriber) { if (this.closed) { throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); } else { return _super.prototype._trySubscribe.call(this, subscriber); } }; Subject.prototype._subscribe = function (subscriber) { if (this.closed) { throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); } else if (this.hasError) { subscriber.error(this.thrownError); return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY; } else if (this.isStopped) { subscriber.complete(); return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY; } else { this.observers.push(subscriber); return new __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__["a" /* SubjectSubscription */](this, subscriber); } }; Subject.prototype.asObservable = function () { var observable = new __WEBPACK_IMPORTED_MODULE_1__Observable__["a" /* Observable */](); observable.source = this; return observable; }; Subject.create = function (destination, source) { return new AnonymousSubject(destination, source); }; return Subject; }(__WEBPACK_IMPORTED_MODULE_1__Observable__["a" /* Observable */])); var AnonymousSubject = /*@__PURE__*/ (function (_super) { __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](AnonymousSubject, _super); function AnonymousSubject(destination, source) { var _this = _super.call(this) || this; _this.destination = destination; _this.source = source; return _this; } AnonymousSubject.prototype.next = function (value) { var destination = this.destination; if (destination && destination.next) { destination.next(value); } }; AnonymousSubject.prototype.error = function (err) { var destination = this.destination; if (destination && destination.error) { this.destination.error(err); } }; AnonymousSubject.prototype.complete = function () { var destination = this.destination; if (destination && destination.complete) { this.destination.complete(); } }; AnonymousSubject.prototype._subscribe = function (subscriber) { var source = this.source; if (source) { return this.source.subscribe(subscriber); } else { return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY; } }; return AnonymousSubject; }(Subject)); //# sourceMappingURL=Subject.js.map /***/ }), /* 44 */ /***/ (function(module, exports, __webpack_require__) { var store = __webpack_require__(225)('wks'); var uid = __webpack_require__(162); var Symbol = __webpack_require__(38).Symbol; var USE_SYMBOL = typeof Symbol == 'function'; var $exports = module.exports = function (name) { return store[name] || (store[name] = USE_SYMBOL && Symbol[name] || (USE_SYMBOL ? Symbol : uid)('Symbol.' + name)); }; $exports.store = store; /***/ }), /* 45 */ /***/ (function(module, exports, __webpack_require__) { /* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/** * @license * Lodash
* Copyright JS Foundation and other contributors
* Released under MIT license
* Based on Underscore.js 1.8.3
* Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors */ ;(function() { /** Used as a safe reference for `undefined` in pre-ES5 environments. */ var undefined; /** Used as the semantic version number. */ var VERSION = '4.17.10'; /** Used as the size to enable large array optimizations. */ var LARGE_ARRAY_SIZE = 200; /** Error message constants. */ var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', FUNC_ERROR_TEXT = 'Expected a function'; /** Used to stand-in for `undefined` hash values. */ var HASH_UNDEFINED = '__lodash_hash_undefined__'; /** Used as the maximum memoize cache size. */ var MAX_MEMOIZE_SIZE = 500; /** Used as the internal argument placeholder. */ var PLACEHOLDER = '__lodash_placeholder__'; /** Used to compose bitmasks for cloning. */ var CLONE_DEEP_FLAG = 1, CLONE_FLAT_FLAG = 2, CLONE_SYMBOLS_FLAG = 4; /** Used to compose bitmasks for value comparisons. */ var COMPARE_PARTIAL_FLAG = 1, COMPARE_UNORDERED_FLAG = 2; /** Used to compose bitmasks for function metadata. */ var WRAP_BIND_FLAG = 1, WRAP_BIND_KEY_FLAG = 2, WRAP_CURRY_BOUND_FLAG = 4, WRAP_CURRY_FLAG = 8, WRAP_CURRY_RIGHT_FLAG = 16, WRAP_PARTIAL_FLAG = 32, WRAP_PARTIAL_RIGHT_FLAG = 64, WRAP_ARY_FLAG = 128, WRAP_REARG_FLAG = 256, WRAP_FLIP_FLAG = 512; /** Used as default options for `_.truncate`. */ var DEFAULT_TRUNC_LENGTH = 30, DEFAULT_TRUNC_OMISSION = '...'; /** Used to detect hot functions by number of calls within a span of milliseconds. */ var HOT_COUNT = 800, HOT_SPAN = 16; /** Used to indicate the type of lazy iteratees. */ var LAZY_FILTER_FLAG = 1, LAZY_MAP_FLAG = 2, LAZY_WHILE_FLAG = 3; /** Used as references for various `Number` constants. */ var INFINITY = 1 / 0, MAX_SAFE_INTEGER = 9007199254740991, MAX_INTEGER = 1.7976931348623157e+308, NAN = 0 / 0; /** Used as references for the maximum length and index of an array. */ var MAX_ARRAY_LENGTH = 4294967295, MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; /** Used to associate wrap methods with their bit flags. */ var wrapFlags = [ ['ary', WRAP_ARY_FLAG], ['bind', WRAP_BIND_FLAG], ['bindKey', WRAP_BIND_KEY_FLAG], ['curry', WRAP_CURRY_FLAG], ['curryRight', WRAP_CURRY_RIGHT_FLAG], ['flip', WRAP_FLIP_FLAG], ['partial', WRAP_PARTIAL_FLAG], ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], ['rearg', WRAP_REARG_FLAG] ]; /** `Object#toString` result references. */ var argsTag = '[object Arguments]', arrayTag = '[object Array]', asyncTag = '[object AsyncFunction]', boolTag = '[object Boolean]', dateTag = '[object Date]', domExcTag = '[object DOMException]', errorTag = '[object Error]', funcTag = '[object Function]', genTag = '[object GeneratorFunction]', mapTag = '[object Map]', numberTag = '[object Number]', nullTag = '[object Null]', objectTag = '[object Object]', promiseTag = '[object Promise]', proxyTag = '[object Proxy]', regexpTag = '[object RegExp]', setTag = '[object Set]', stringTag = '[object String]', symbolTag = '[object Symbol]', undefinedTag = '[object Undefined]', weakMapTag = '[object WeakMap]', weakSetTag = '[object WeakSet]'; var arrayBufferTag = '[object ArrayBuffer]', dataViewTag = '[object DataView]', float32Tag = '[object Float32Array]', float64Tag = '[object Float64Array]', int8Tag = '[object Int8Array]', int16Tag = '[object Int16Array]', int32Tag = '[object Int32Array]', uint8Tag = '[object Uint8Array]', uint8ClampedTag = '[object Uint8ClampedArray]', uint16Tag = '[object Uint16Array]', uint32Tag = '[object Uint32Array]'; /** Used to match empty string literals in compiled template source. */ var reEmptyStringLeading = /\b__p \+= '';/g, reEmptyStringMiddle = /\b(__p \+=) '' \+/g, reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; /** Used to match HTML entities and HTML characters. */ var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, reUnescapedHtml = /[&<>"']/g, reHasEscapedHtml = RegExp(reEscapedHtml.source), reHasUnescapedHtml = RegExp(reUnescapedHtml.source); /** Used to match template delimiters. */ var reEscape = /<%-([\s\S]+?)%>/g, reEvaluate = /<%([\s\S]+?)%>/g, reInterpolate = /<%=([\s\S]+?)%>/g; /** Used to match property names within property paths. */ var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, reIsPlainProp = /^\w*$/, rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; /** * Used to match `RegExp` * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). */ var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, reHasRegExpChar = RegExp(reRegExpChar.source); /** Used to match leading and trailing whitespace. */ var reTrim = /^\s+|\s+$/g, reTrimStart = /^\s+/, reTrimEnd = /\s+$/; /** Used to match wrap detail comments. */ var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, reSplitDetails = /,? & /; /** Used to match words composed of alphanumeric characters. */ var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; /** Used to match backslashes in property paths. */ var reEscapeChar = /\\(\\)?/g; /** * Used to match * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). */ var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; /** Used to match `RegExp` flags from their coerced string values. */ var reFlags = /\w*$/; /** Used to detect bad signed hexadecimal string values. */ var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; /** Used to detect binary string values. */ var reIsBinary = /^0b[01]+$/i; /** Used to detect host constructors (Safari). */ var reIsHostCtor = /^\[object .+?Constructor\]$/; /** Used to detect octal string values. */ var reIsOctal = /^0o[0-7]+$/i; /** Used to detect unsigned integer values. */ var reIsUint = /^(?:0|[1-9]\d*)$/; /** Used to match Latin Unicode letters (excluding mathematical operators). */ var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; /** Used to ensure capturing order of template delimiters. */ var reNoMatch = /($^)/; /** Used to match unescaped characters in compiled string literals. */ var reUnescapedString = /['\n\r\u2028\u2029\\]/g; /** Used to compose unicode character classes. */ var rsAstralRange = '\\ud800-\\udfff', rsComboMarksRange = '\\u0300-\\u036f', reComboHalfMarksRange = '\\ufe20-\\ufe2f', rsComboSymbolsRange = '\\u20d0-\\u20ff', rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, rsDingbatRange = '\\u2700-\\u27bf', rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', rsPunctuationRange = '\\u2000-\\u206f', rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', rsVarRange = '\\ufe0e\\ufe0f', rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; /** Used to compose unicode capture groups. */ var rsApos = "['\u2019]", rsAstral = '[' + rsAstralRange + ']', rsBreak = '[' + rsBreakRange + ']', rsCombo = '[' + rsComboRange + ']', rsDigits = '\\d+', rsDingbat = '[' + rsDingbatRange + ']', rsLower = '[' + rsLowerRange + ']', rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', rsFitz = '\\ud83c[\\udffb-\\udfff]', rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', rsNonAstral = '[^' + rsAstralRange + ']', rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', rsUpper = '[' + rsUpperRange + ']', rsZWJ = '\\u200d'; /** Used to compose unicode regexes. */ var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', reOptMod = rsModifier + '?', rsOptVar = '[' + rsVarRange + ']?', rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])', rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])', rsSeq = rsOptVar + reOptMod + rsOptJoin, rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; /** Used to match apostrophes. */ var reApos = RegExp(rsApos, 'g'); /** * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). */ var reComboMark = RegExp(rsCombo, 'g'); /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); /** Used to match complex or compound words. */ var reUnicodeWord = RegExp([ rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, rsUpper + '+' + rsOptContrUpper, rsOrdUpper, rsOrdLower, rsDigits, rsEmoji ].join('|'), 'g'); /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); /** Used to detect strings that need a more robust regexp to match words. */ var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; /** Used to assign default `context` object properties. */ var contextProps = [ 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' ]; /** Used to make template sourceURLs easier to identify. */ var templateCounter = -1; /** Used to identify `toStringTag` values of typed arrays. */ var typedArrayTags = {}; typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = typedArrayTags[uint32Tag] = true; typedArrayTags[argsTag] = typedArrayTags[arrayTag] = typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = typedArrayTags[errorTag] = typedArrayTags[funcTag] = typedArrayTags[mapTag] = typedArrayTags[numberTag] = typedArrayTags[objectTag] = typedArrayTags[regexpTag] = typedArrayTags[setTag] = typedArrayTags[stringTag] = typedArrayTags[weakMapTag] = false; /** Used to identify `toStringTag` values supported by `_.clone`. */ var cloneableTags = {}; cloneableTags[argsTag] = cloneableTags[arrayTag] = cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = cloneableTags[boolTag] = cloneableTags[dateTag] = cloneableTags[float32Tag] = cloneableTags[float64Tag] = cloneableTags[int8Tag] = cloneableTags[int16Tag] = cloneableTags[int32Tag] = cloneableTags[mapTag] = cloneableTags[numberTag] = cloneableTags[objectTag] = cloneableTags[regexpTag] = cloneableTags[setTag] = cloneableTags[stringTag] = cloneableTags[symbolTag] = cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; cloneableTags[errorTag] = cloneableTags[funcTag] = cloneableTags[weakMapTag] = false; /** Used to map Latin Unicode letters to basic Latin letters. */ var deburredLetters = { // Latin-1 Supplement block. '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', '\xc7': 'C', '\xe7': 'c', '\xd0': 'D', '\xf0': 'd', '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', '\xd1': 'N', '\xf1': 'n', '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', '\xc6': 'Ae', '\xe6': 'ae', '\xde': 'Th', '\xfe': 'th', '\xdf': 'ss', // Latin Extended-A block. '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', '\u0134': 'J', '\u0135': 'j', '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', '\u0163': 't', '\u0165': 't', '\u0167': 't', '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', '\u0174': 'W', '\u0175': 'w', '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', '\u0132': 'IJ', '\u0133': 'ij', '\u0152': 'Oe', '\u0153': 'oe', '\u0149': "'n", '\u017f': 's' }; /** Used to map characters to HTML entities. */ var htmlEscapes = { '&': '&', '<': '<', '>': '>', '"': '"', "'": ''' }; /** Used to map HTML entities to characters. */ var htmlUnescapes = { '&': '&', '<': '<', '>': '>', '"': '"', ''': "'" }; /** Used to escape characters for inclusion in compiled string literals. */ var stringEscapes = { '\\': '\\', "'": "'", '\n': 'n', '\r': 'r', '\u2028': 'u2028', '\u2029': 'u2029' }; /** Built-in method references without a dependency on `root`. */ var freeParseFloat = parseFloat, freeParseInt = parseInt; /** Detect free variable `global` from Node.js. */ var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; /** Detect free variable `self`. */ var freeSelf = typeof self == 'object' && self && self.Object === Object && self; /** Used as a reference to the global object. */ var root = freeGlobal || freeSelf || Function('return this')(); /** Detect free variable `exports`. */ var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports; /** Detect free variable `module`. */ var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module; /** Detect the popular CommonJS extension `module.exports`. */ var moduleExports = freeModule && freeModule.exports === freeExports; /** Detect free variable `process` from Node.js. */ var freeProcess = moduleExports && freeGlobal.process; /** Used to access faster Node.js helpers. */ var nodeUtil = (function() { try { // Use `util.types` for Node.js 10+. var types = freeModule && freeModule.require && freeModule.require('util').types; if (types) { return types; } // Legacy `process.binding('util')` for Node.js < 10. return freeProcess && freeProcess.binding && freeProcess.binding('util'); } catch (e) {} }()); /* Node.js helper references. */ var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, nodeIsDate = nodeUtil && nodeUtil.isDate, nodeIsMap = nodeUtil && nodeUtil.isMap, nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, nodeIsSet = nodeUtil && nodeUtil.isSet, nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; /*--------------------------------------------------------------------------*/ /** * A faster alternative to `Function#apply`, this function invokes `func` * with the `this` binding of `thisArg` and the arguments of `args`. * * @private * @param {Function} func The function to invoke. * @param {*} thisArg The `this` binding of `func`. * @param {Array} args The arguments to invoke `func` with. * @returns {*} Returns the result of `func`. */ function apply(func, thisArg, args) { switch (args.length) { case 0: return func.call(thisArg); case 1: return func.call(thisArg, args[0]); case 2: return func.call(thisArg, args[0], args[1]); case 3: return func.call(thisArg, args[0], args[1], args[2]); } return func.apply(thisArg, args); } /** * A specialized version of `baseAggregator` for arrays. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} setter The function to set `accumulator` values. * @param {Function} iteratee The iteratee to transform keys. * @param {Object} accumulator The initial aggregated object. * @returns {Function} Returns `accumulator`. */ function arrayAggregator(array, setter, iteratee, accumulator) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { var value = array[index]; setter(accumulator, value, iteratee(value), array); } return accumulator; } /** * A specialized version of `_.forEach` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns `array`. */ function arrayEach(array, iteratee) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (iteratee(array[index], index, array) === false) { break; } } return array; } /** * A specialized version of `_.forEachRight` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns `array`. */ function arrayEachRight(array, iteratee) { var length = array == null ? 0 : array.length; while (length--) { if (iteratee(array[length], length, array) === false) { break; } } return array; } /** * A specialized version of `_.every` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {boolean} Returns `true` if all elements pass the predicate check, * else `false`. */ function arrayEvery(array, predicate) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (!predicate(array[index], index, array)) { return false; } } return true; } /** * A specialized version of `_.filter` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {Array} Returns the new filtered array. */ function arrayFilter(array, predicate) { var index = -1, length = array == null ? 0 : array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index]; if (predicate(value, index, array)) { result[resIndex++] = value; } } return result; } /** * A specialized version of `_.includes` for arrays without support for * specifying an index to search from. * * @private * @param {Array} [array] The array to inspect. * @param {*} target The value to search for. * @returns {boolean} Returns `true` if `target` is found, else `false`. */ function arrayIncludes(array, value) { var length = array == null ? 0 : array.length; return !!length && baseIndexOf(array, value, 0) > -1; } /** * This function is like `arrayIncludes` except that it accepts a comparator. * * @private * @param {Array} [array] The array to inspect. * @param {*} target The value to search for. * @param {Function} comparator The comparator invoked per element. * @returns {boolean} Returns `true` if `target` is found, else `false`. */ function arrayIncludesWith(array, value, comparator) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (comparator(value, array[index])) { return true; } } return false; } /** * A specialized version of `_.map` for arrays without support for iteratee * shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns the new mapped array. */ function arrayMap(array, iteratee) { var index = -1, length = array == null ? 0 : array.length, result = Array(length); while (++index < length) { result[index] = iteratee(array[index], index, array); } return result; } /** * Appends the elements of `values` to `array`. * * @private * @param {Array} array The array to modify. * @param {Array} values The values to append. * @returns {Array} Returns `array`. */ function arrayPush(array, values) { var index = -1, length = values.length, offset = array.length; while (++index < length) { array[offset + index] = values[index]; } return array; } /** * A specialized version of `_.reduce` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {*} [accumulator] The initial value. * @param {boolean} [initAccum] Specify using the first element of `array` as * the initial value. * @returns {*} Returns the accumulated value. */ function arrayReduce(array, iteratee, accumulator, initAccum) { var index = -1, length = array == null ? 0 : array.length; if (initAccum && length) { accumulator = array[++index]; } while (++index < length) { accumulator = iteratee(accumulator, array[index], index, array); } return accumulator; } /** * A specialized version of `_.reduceRight` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {*} [accumulator] The initial value. * @param {boolean} [initAccum] Specify using the last element of `array` as * the initial value. * @returns {*} Returns the accumulated value. */ function arrayReduceRight(array, iteratee, accumulator, initAccum) { var length = array == null ? 0 : array.length; if (initAccum && length) { accumulator = array[--length]; } while (length--) { accumulator = iteratee(accumulator, array[length], length, array); } return accumulator; } /** * A specialized version of `_.some` for arrays without support for iteratee * shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {boolean} Returns `true` if any element passes the predicate check, * else `false`. */ function arraySome(array, predicate) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (predicate(array[index], index, array)) { return true; } } return false; } /** * Gets the size of an ASCII `string`. * * @private * @param {string} string The string inspect. * @returns {number} Returns the string size. */ var asciiSize = baseProperty('length'); /** * Converts an ASCII `string` to an array. * * @private * @param {string} string The string to convert. * @returns {Array} Returns the converted array. */ function asciiToArray(string) { return string.split(''); } /** * Splits an ASCII `string` into an array of its words. * * @private * @param {string} The string to inspect. * @returns {Array} Returns the words of `string`. */ function asciiWords(string) { return string.match(reAsciiWord) || []; } /** * The base implementation of methods like `_.findKey` and `_.findLastKey`, * without support for iteratee shorthands, which iterates over `collection` * using `eachFunc`. * * @private * @param {Array|Object} collection The collection to inspect. * @param {Function} predicate The function invoked per iteration. * @param {Function} eachFunc The function to iterate over `collection`. * @returns {*} Returns the found element or its key, else `undefined`. */ function baseFindKey(collection, predicate, eachFunc) { var result; eachFunc(collection, function(value, key, collection) { if (predicate(value, key, collection)) { result = key; return false; } }); return result; } /** * The base implementation of `_.findIndex` and `_.findLastIndex` without * support for iteratee shorthands. * * @private * @param {Array} array The array to inspect. * @param {Function} predicate The function invoked per iteration. * @param {number} fromIndex The index to search from. * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {number} Returns the index of the matched value, else `-1`. */ function baseFindIndex(array, predicate, fromIndex, fromRight) { var length = array.length, index = fromIndex + (fromRight ? 1 : -1); while ((fromRight ? index-- : ++index < length)) { if (predicate(array[index], index, array)) { return index; } } return -1; } /** * The base implementation of `_.indexOf` without `fromIndex` bounds checks. * * @private * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} fromIndex The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. */ function baseIndexOf(array, value, fromIndex) { return value === value ? strictIndexOf(array, value, fromIndex) : baseFindIndex(array, baseIsNaN, fromIndex); } /** * This function is like `baseIndexOf` except that it accepts a comparator. * * @private * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} fromIndex The index to search from. * @param {Function} comparator The comparator invoked per element. * @returns {number} Returns the index of the matched value, else `-1`. */ function baseIndexOfWith(array, value, fromIndex, comparator) { var index = fromIndex - 1, length = array.length; while (++index < length) { if (comparator(array[index], value)) { return index; } } return -1; } /** * The base implementation of `_.isNaN` without support for number objects. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. */ function baseIsNaN(value) { return value !== value; } /** * The base implementation of `_.mean` and `_.meanBy` without support for * iteratee shorthands. * * @private * @param {Array} array The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {number} Returns the mean. */ function baseMean(array, iteratee) { var length = array == null ? 0 : array.length; return length ? (baseSum(array, iteratee) / length) : NAN; } /** * The base implementation of `_.property` without support for deep paths. * * @private * @param {string} key The key of the property to get. * @returns {Function} Returns the new accessor function. */ function baseProperty(key) { return function(object) { return object == null ? undefined : object[key]; }; } /** * The base implementation of `_.propertyOf` without support for deep paths. * * @private * @param {Object} object The object to query. * @returns {Function} Returns the new accessor function. */ function basePropertyOf(object) { return function(key) { return object == null ? undefined : object[key]; }; } /** * The base implementation of `_.reduce` and `_.reduceRight`, without support * for iteratee shorthands, which iterates over `collection` using `eachFunc`. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {*} accumulator The initial value. * @param {boolean} initAccum Specify using the first or last element of * `collection` as the initial value. * @param {Function} eachFunc The function to iterate over `collection`. * @returns {*} Returns the accumulated value. */ function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { eachFunc(collection, function(value, index, collection) { accumulator = initAccum ? (initAccum = false, value) : iteratee(accumulator, value, index, collection); }); return accumulator; } /** * The base implementation of `_.sortBy` which uses `comparer` to define the * sort order of `array` and replaces criteria objects with their corresponding * values. * * @private * @param {Array} array The array to sort. * @param {Function} comparer The function to define sort order. * @returns {Array} Returns `array`. */ function baseSortBy(array, comparer) { var length = array.length; array.sort(comparer); while (length--) { array[length] = array[length].value; } return array; } /** * The base implementation of `_.sum` and `_.sumBy` without support for * iteratee shorthands. * * @private * @param {Array} array The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {number} Returns the sum. */ function baseSum(array, iteratee) { var result, index = -1, length = array.length; while (++index < length) { var current = iteratee(array[index]); if (current !== undefined) { result = result === undefined ? current : (result + current); } } return result; } /** * The base implementation of `_.times` without support for iteratee shorthands * or max array length checks. * * @private * @param {number} n The number of times to invoke `iteratee`. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns the array of results. */ function baseTimes(n, iteratee) { var index = -1, result = Array(n); while (++index < n) { result[index] = iteratee(index); } return result; } /** * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array * of key-value pairs for `object` corresponding to the property names of `props`. * * @private * @param {Object} object The object to query. * @param {Array} props The property names to get values for. * @returns {Object} Returns the key-value pairs. */ function baseToPairs(object, props) { return arrayMap(props, function(key) { return [key, object[key]]; }); } /** * The base implementation of `_.unary` without support for storing metadata. * * @private * @param {Function} func The function to cap arguments for. * @returns {Function} Returns the new capped function. */ function baseUnary(func) { return function(value) { return func(value); }; } /** * The base implementation of `_.values` and `_.valuesIn` which creates an * array of `object` property values corresponding to the property names * of `props`. * * @private * @param {Object} object The object to query. * @param {Array} props The property names to get values for. * @returns {Object} Returns the array of property values. */ function baseValues(object, props) { return arrayMap(props, function(key) { return object[key]; }); } /** * Checks if a `cache` value for `key` exists. * * @private * @param {Object} cache The cache to query. * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function cacheHas(cache, key) { return cache.has(key); } /** * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol * that is not found in the character symbols. * * @private * @param {Array} strSymbols The string symbols to inspect. * @param {Array} chrSymbols The character symbols to find. * @returns {number} Returns the index of the first unmatched string symbol. */ function charsStartIndex(strSymbols, chrSymbols) { var index = -1, length = strSymbols.length; while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} return index; } /** * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol * that is not found in the character symbols. * * @private * @param {Array} strSymbols The string symbols to inspect. * @param {Array} chrSymbols The character symbols to find. * @returns {number} Returns the index of the last unmatched string symbol. */ function charsEndIndex(strSymbols, chrSymbols) { var index = strSymbols.length; while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} return index; } /** * Gets the number of `placeholder` occurrences in `array`. * * @private * @param {Array} array The array to inspect. * @param {*} placeholder The placeholder to search for. * @returns {number} Returns the placeholder count. */ function countHolders(array, placeholder) { var length = array.length, result = 0; while (length--) { if (array[length] === placeholder) { ++result; } } return result; } /** * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A * letters to basic Latin letters. * * @private * @param {string} letter The matched letter to deburr. * @returns {string} Returns the deburred letter. */ var deburrLetter = basePropertyOf(deburredLetters); /** * Used by `_.escape` to convert characters to HTML entities. * * @private * @param {string} chr The matched character to escape. * @returns {string} Returns the escaped character. */ var escapeHtmlChar = basePropertyOf(htmlEscapes); /** * Used by `_.template` to escape characters for inclusion in compiled string literals. * * @private * @param {string} chr The matched character to escape. * @returns {string} Returns the escaped character. */ function escapeStringChar(chr) { return '\\' + stringEscapes[chr]; } /** * Gets the value at `key` of `object`. * * @private * @param {Object} [object] The object to query. * @param {string} key The key of the property to get. * @returns {*} Returns the property value. */ function getValue(object, key) { return object == null ? undefined : object[key]; } /** * Checks if `string` contains Unicode symbols. * * @private * @param {string} string The string to inspect. * @returns {boolean} Returns `true` if a symbol is found, else `false`. */ function hasUnicode(string) { return reHasUnicode.test(string); } /** * Checks if `string` contains a word composed of Unicode symbols. * * @private * @param {string} string The string to inspect. * @returns {boolean} Returns `true` if a word is found, else `false`. */ function hasUnicodeWord(string) { return reHasUnicodeWord.test(string); } /** * Converts `iterator` to an array. * * @private * @param {Object} iterator The iterator to convert. * @returns {Array} Returns the converted array. */ function iteratorToArray(iterator) { var data, result = []; while (!(data = iterator.next()).done) { result.push(data.value); } return result; } /** * Converts `map` to its key-value pairs. * * @private * @param {Object} map The map to convert. * @returns {Array} Returns the key-value pairs. */ function mapToArray(map) { var index = -1, result = Array(map.size); map.forEach(function(value, key) { result[++index] = [key, value]; }); return result; } /** * Creates a unary function that invokes `func` with its argument transformed. * * @private * @param {Function} func The function to wrap. * @param {Function} transform The argument transform. * @returns {Function} Returns the new function. */ function overArg(func, transform) { return function(arg) { return func(transform(arg)); }; } /** * Replaces all `placeholder` elements in `array` with an internal placeholder * and returns an array of their indexes. * * @private * @param {Array} array The array to modify. * @param {*} placeholder The placeholder to replace. * @returns {Array} Returns the new array of placeholder indexes. */ function replaceHolders(array, placeholder) { var index = -1, length = array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index]; if (value === placeholder || value === PLACEHOLDER) { array[index] = PLACEHOLDER; result[resIndex++] = index; } } return result; } /** * Gets the value at `key`, unless `key` is "__proto__". * * @private * @param {Object} object The object to query. * @param {string} key The key of the property to get. * @returns {*} Returns the property value. */ function safeGet(object, key) { return key == '__proto__' ? undefined : object[key]; } /** * Converts `set` to an array of its values. * * @private * @param {Object} set The set to convert. * @returns {Array} Returns the values. */ function setToArray(set) { var index = -1, result = Array(set.size); set.forEach(function(value) { result[++index] = value; }); return result; } /** * Converts `set` to its value-value pairs. * * @private * @param {Object} set The set to convert. * @returns {Array} Returns the value-value pairs. */ function setToPairs(set) { var index = -1, result = Array(set.size); set.forEach(function(value) { result[++index] = [value, value]; }); return result; } /** * A specialized version of `_.indexOf` which performs strict equality * comparisons of values, i.e. `===`. * * @private * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} fromIndex The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. */ function strictIndexOf(array, value, fromIndex) { var index = fromIndex - 1, length = array.length; while (++index < length) { if (array[index] === value) { return index; } } return -1; } /** * A specialized version of `_.lastIndexOf` which performs strict equality * comparisons of values, i.e. `===`. * * @private * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} fromIndex The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. */ function strictLastIndexOf(array, value, fromIndex) { var index = fromIndex + 1; while (index--) { if (array[index] === value) { return index; } } return index; } /** * Gets the number of symbols in `string`. * * @private * @param {string} string The string to inspect. * @returns {number} Returns the string size. */ function stringSize(string) { return hasUnicode(string) ? unicodeSize(string) : asciiSize(string); } /** * Converts `string` to an array. * * @private * @param {string} string The string to convert. * @returns {Array} Returns the converted array. */ function stringToArray(string) { return hasUnicode(string) ? unicodeToArray(string) : asciiToArray(string); } /** * Used by `_.unescape` to convert HTML entities to characters. * * @private * @param {string} chr The matched character to unescape. * @returns {string} Returns the unescaped character. */ var unescapeHtmlChar = basePropertyOf(htmlUnescapes); /** * Gets the size of a Unicode `string`. * * @private * @param {string} string The string inspect. * @returns {number} Returns the string size. */ function unicodeSize(string) { var result = reUnicode.lastIndex = 0; while (reUnicode.test(string)) { ++result; } return result; } /** * Converts a Unicode `string` to an array. * * @private * @param {string} string The string to convert. * @returns {Array} Returns the converted array. */ function unicodeToArray(string) { return string.match(reUnicode) || []; } /** * Splits a Unicode `string` into an array of its words. * * @private * @param {string} The string to inspect. * @returns {Array} Returns the words of `string`. */ function unicodeWords(string) { return string.match(reUnicodeWord) || []; } /*--------------------------------------------------------------------------*/ /** * Create a new pristine `lodash` function using the `context` object. * * @static * @memberOf _ * @since 1.1.0 * @category Util * @param {Object} [context=root] The context object. * @returns {Function} Returns a new `lodash` function. * @example * * _.mixin({ 'foo': _.constant('foo') }); * * var lodash = _.runInContext(); * lodash.mixin({ 'bar': lodash.constant('bar') }); * * _.isFunction(_.foo); * // => true * _.isFunction(_.bar); * // => false * * lodash.isFunction(lodash.foo); * // => false * lodash.isFunction(lodash.bar); * // => true * * // Create a suped-up `defer` in Node.js. * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; */ var runInContext = (function runInContext(context) { context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); /** Built-in constructor references. */ var Array = context.Array, Date = context.Date, Error = context.Error, Function = context.Function, Math = context.Math, Object = context.Object, RegExp = context.RegExp, String = context.String, TypeError = context.TypeError; /** Used for built-in method references. */ var arrayProto = Array.prototype, funcProto = Function.prototype, objectProto = Object.prototype; /** Used to detect overreaching core-js shims. */ var coreJsData = context['__core-js_shared__']; /** Used to resolve the decompiled source of functions. */ var funcToString = funcProto.toString; /** Used to check objects for own properties. */ var hasOwnProperty = objectProto.hasOwnProperty; /** Used to generate unique IDs. */ var idCounter = 0; /** Used to detect methods masquerading as native. */ var maskSrcKey = (function() { var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); return uid ? ('Symbol(src)_1.' + uid) : ''; }()); /** * Used to resolve the * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) * of values. */ var nativeObjectToString = objectProto.toString; /** Used to infer the `Object` constructor. */ var objectCtorString = funcToString.call(Object); /** Used to restore the original `_` reference in `_.noConflict`. */ var oldDash = root._; /** Used to detect if a method is native. */ var reIsNative = RegExp('^' + funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' ); /** Built-in value references. */ var Buffer = moduleExports ? context.Buffer : undefined, Symbol = context.Symbol, Uint8Array = context.Uint8Array, allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, getPrototype = overArg(Object.getPrototypeOf, Object), objectCreate = Object.create, propertyIsEnumerable = objectProto.propertyIsEnumerable, splice = arrayProto.splice, spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, symIterator = Symbol ? Symbol.iterator : undefined, symToStringTag = Symbol ? Symbol.toStringTag : undefined; var defineProperty = (function() { try { var func = getNative(Object, 'defineProperty'); func({}, '', {}); return func; } catch (e) {} }()); /** Mocked built-ins. */ var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, ctxNow = Date && Date.now !== root.Date.now && Date.now, ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; /* Built-in method references for those with the same name as other `lodash` methods. */ var nativeCeil = Math.ceil, nativeFloor = Math.floor, nativeGetSymbols = Object.getOwnPropertySymbols, nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, nativeIsFinite = context.isFinite, nativeJoin = arrayProto.join, nativeKeys = overArg(Object.keys, Object), nativeMax = Math.max, nativeMin = Math.min, nativeNow = Date.now, nativeParseInt = context.parseInt, nativeRandom = Math.random, nativeReverse = arrayProto.reverse; /* Built-in method references that are verified to be native. */ var DataView = getNative(context, 'DataView'), Map = getNative(context, 'Map'), Promise = getNative(context, 'Promise'), Set = getNative(context, 'Set'), WeakMap = getNative(context, 'WeakMap'), nativeCreate = getNative(Object, 'create'); /** Used to store function metadata. */ var metaMap = WeakMap && new WeakMap; /** Used to lookup unminified function names. */ var realNames = {}; /** Used to detect maps, sets, and weakmaps. */ var dataViewCtorString = toSource(DataView), mapCtorString = toSource(Map), promiseCtorString = toSource(Promise), setCtorString = toSource(Set), weakMapCtorString = toSource(WeakMap); /** Used to convert symbols to primitives and strings. */ var symbolProto = Symbol ? Symbol.prototype : undefined, symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, symbolToString = symbolProto ? symbolProto.toString : undefined; /*------------------------------------------------------------------------*/ /** * Creates a `lodash` object which wraps `value` to enable implicit method * chain sequences. Methods that operate on and return arrays, collections, * and functions can be chained together. Methods that retrieve a single value * or may return a primitive value will automatically end the chain sequence * and return the unwrapped value. Otherwise, the value must be unwrapped * with `_#value`. * * Explicit chain sequences, which must be unwrapped with `_#value`, may be * enabled using `_.chain`. * * The execution of chained methods is lazy, that is, it's deferred until * `_#value` is implicitly or explicitly called. * * Lazy evaluation allows several methods to support shortcut fusion. * Shortcut fusion is an optimization to merge iteratee calls; this avoids * the creation of intermediate arrays and can greatly reduce the number of * iteratee executions. Sections of a chain sequence qualify for shortcut * fusion if the section is applied to an array and iteratees accept only * one argument. The heuristic for whether a section qualifies for shortcut * fusion is subject to change. * * Chaining is supported in custom builds as long as the `_#value` method is * directly or indirectly included in the build. * * In addition to lodash methods, wrappers have `Array` and `String` methods. * * The wrapper `Array` methods are: * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` * * The wrapper `String` methods are: * `replace` and `split` * * The wrapper methods that support shortcut fusion are: * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` * * The chainable wrapper methods are: * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, * `zipObject`, `zipObjectDeep`, and `zipWith` * * The wrapper methods that are **not** chainable by default are: * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, * `upperFirst`, `value`, and `words` * * @name _ * @constructor * @category Seq * @param {*} value The value to wrap in a `lodash` instance. * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * function square(n) { * return n * n; * } * * var wrapped = _([1, 2, 3]); * * // Returns an unwrapped value. * wrapped.reduce(_.add); * // => 6 * * // Returns a wrapped value. * var squares = wrapped.map(square); * * _.isArray(squares); * // => false * * _.isArray(squares.value()); * // => true */ function lodash(value) { if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { if (value instanceof LodashWrapper) { return value; } if (hasOwnProperty.call(value, '__wrapped__')) { return wrapperClone(value); } } return new LodashWrapper(value); } /** * The base implementation of `_.create` without support for assigning * properties to the created object. * * @private * @param {Object} proto The object to inherit from. * @returns {Object} Returns the new object. */ var baseCreate = (function() { function object() {} return function(proto) { if (!isObject(proto)) { return {}; } if (objectCreate) { return objectCreate(proto); } object.prototype = proto; var result = new object; object.prototype = undefined; return result; }; }()); /** * The function whose prototype chain sequence wrappers inherit from. * * @private */ function baseLodash() { // No operation performed. } /** * The base constructor for creating `lodash` wrapper objects. * * @private * @param {*} value The value to wrap. * @param {boolean} [chainAll] Enable explicit method chain sequences. */ function LodashWrapper(value, chainAll) { this.__wrapped__ = value; this.__actions__ = []; this.__chain__ = !!chainAll; this.__index__ = 0; this.__values__ = undefined; } /** * By default, the template delimiters used by lodash are like those in * embedded Ruby (ERB) as well as ES2015 template strings. Change the * following template settings to use alternative delimiters. * * @static * @memberOf _ * @type {Object} */ lodash.templateSettings = { /** * Used to detect `data` property values to be HTML-escaped. * * @memberOf _.templateSettings * @type {RegExp} */ 'escape': reEscape, /** * Used to detect code to be evaluated. * * @memberOf _.templateSettings * @type {RegExp} */ 'evaluate': reEvaluate, /** * Used to detect `data` property values to inject. * * @memberOf _.templateSettings * @type {RegExp} */ 'interpolate': reInterpolate, /** * Used to reference the data object in the template text. * * @memberOf _.templateSettings * @type {string} */ 'variable': '', /** * Used to import variables into the compiled template. * * @memberOf _.templateSettings * @type {Object} */ 'imports': { /** * A reference to the `lodash` function. * * @memberOf _.templateSettings.imports * @type {Function} */ '_': lodash } }; // Ensure wrappers are instances of `baseLodash`. lodash.prototype = baseLodash.prototype; lodash.prototype.constructor = lodash; LodashWrapper.prototype = baseCreate(baseLodash.prototype); LodashWrapper.prototype.constructor = LodashWrapper; /*------------------------------------------------------------------------*/ /** * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. * * @private * @constructor * @param {*} value The value to wrap. */ function LazyWrapper(value) { this.__wrapped__ = value; this.__actions__ = []; this.__dir__ = 1; this.__filtered__ = false; this.__iteratees__ = []; this.__takeCount__ = MAX_ARRAY_LENGTH; this.__views__ = []; } /** * Creates a clone of the lazy wrapper object. * * @private * @name clone * @memberOf LazyWrapper * @returns {Object} Returns the cloned `LazyWrapper` object. */ function lazyClone() { var result = new LazyWrapper(this.__wrapped__); result.__actions__ = copyArray(this.__actions__); result.__dir__ = this.__dir__; result.__filtered__ = this.__filtered__; result.__iteratees__ = copyArray(this.__iteratees__); result.__takeCount__ = this.__takeCount__; result.__views__ = copyArray(this.__views__); return result; } /** * Reverses the direction of lazy iteration. * * @private * @name reverse * @memberOf LazyWrapper * @returns {Object} Returns the new reversed `LazyWrapper` object. */ function lazyReverse() { if (this.__filtered__) { var result = new LazyWrapper(this); result.__dir__ = -1; result.__filtered__ = true; } else { result = this.clone(); result.__dir__ *= -1; } return result; } /** * Extracts the unwrapped value from its lazy wrapper. * * @private * @name value * @memberOf LazyWrapper * @returns {*} Returns the unwrapped value. */ function lazyValue() { var array = this.__wrapped__.value(), dir = this.__dir__, isArr = isArray(array), isRight = dir < 0, arrLength = isArr ? array.length : 0, view = getView(0, arrLength, this.__views__), start = view.start, end = view.end, length = end - start, index = isRight ? end : (start - 1), iteratees = this.__iteratees__, iterLength = iteratees.length, resIndex = 0, takeCount = nativeMin(length, this.__takeCount__); if (!isArr || (!isRight && arrLength == length && takeCount == length)) { return baseWrapperValue(array, this.__actions__); } var result = []; outer: while (length-- && resIndex < takeCount) { index += dir; var iterIndex = -1, value = array[index]; while (++iterIndex < iterLength) { var data = iteratees[iterIndex], iteratee = data.iteratee, type = data.type, computed = iteratee(value); if (type == LAZY_MAP_FLAG) { value = computed; } else if (!computed) { if (type == LAZY_FILTER_FLAG) { continue outer; } else { break outer; } } } result[resIndex++] = value; } return result; } // Ensure `LazyWrapper` is an instance of `baseLodash`. LazyWrapper.prototype = baseCreate(baseLodash.prototype); LazyWrapper.prototype.constructor = LazyWrapper; /*------------------------------------------------------------------------*/ /** * Creates a hash object. * * @private * @constructor * @param {Array} [entries] The key-value pairs to cache. */ function Hash(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } /** * Removes all key-value entries from the hash. * * @private * @name clear * @memberOf Hash */ function hashClear() { this.__data__ = nativeCreate ? nativeCreate(null) : {}; this.size = 0; } /** * Removes `key` and its value from the hash. * * @private * @name delete * @memberOf Hash * @param {Object} hash The hash to modify. * @param {string} key The key of the value to remove. * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ function hashDelete(key) { var result = this.has(key) && delete this.__data__[key]; this.size -= result ? 1 : 0; return result; } /** * Gets the hash value for `key`. * * @private * @name get * @memberOf Hash * @param {string} key The key of the value to get. * @returns {*} Returns the entry value. */ function hashGet(key) { var data = this.__data__; if (nativeCreate) { var result = data[key]; return result === HASH_UNDEFINED ? undefined : result; } return hasOwnProperty.call(data, key) ? data[key] : undefined; } /** * Checks if a hash value for `key` exists. * * @private * @name has * @memberOf Hash * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function hashHas(key) { var data = this.__data__; return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); } /** * Sets the hash `key` to `value`. * * @private * @name set * @memberOf Hash * @param {string} key The key of the value to set. * @param {*} value The value to set. * @returns {Object} Returns the hash instance. */ function hashSet(key, value) { var data = this.__data__; this.size += this.has(key) ? 0 : 1; data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; return this; } // Add methods to `Hash`. Hash.prototype.clear = hashClear; Hash.prototype['delete'] = hashDelete; Hash.prototype.get = hashGet; Hash.prototype.has = hashHas; Hash.prototype.set = hashSet; /*------------------------------------------------------------------------*/ /** * Creates an list cache object. * * @private * @constructor * @param {Array} [entries] The key-value pairs to cache. */ function ListCache(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } /** * Removes all key-value entries from the list cache. * * @private * @name clear * @memberOf ListCache */ function listCacheClear() { this.__data__ = []; this.size = 0; } /** * Removes `key` and its value from the list cache. * * @private * @name delete * @memberOf ListCache * @param {string} key The key of the value to remove. * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ function listCacheDelete(key) { var data = this.__data__, index = assocIndexOf(data, key); if (index < 0) { return false; } var lastIndex = data.length - 1; if (index == lastIndex) { data.pop(); } else { splice.call(data, index, 1); } --this.size; return true; } /** * Gets the list cache value for `key`. * * @private * @name get * @memberOf ListCache * @param {string} key The key of the value to get. * @returns {*} Returns the entry value. */ function listCacheGet(key) { var data = this.__data__, index = assocIndexOf(data, key); return index < 0 ? undefined : data[index][1]; } /** * Checks if a list cache value for `key` exists. * * @private * @name has * @memberOf ListCache * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function listCacheHas(key) { return assocIndexOf(this.__data__, key) > -1; } /** * Sets the list cache `key` to `value`. * * @private * @name set * @memberOf ListCache * @param {string} key The key of the value to set. * @param {*} value The value to set. * @returns {Object} Returns the list cache instance. */ function listCacheSet(key, value) { var data = this.__data__, index = assocIndexOf(data, key); if (index < 0) { ++this.size; data.push([key, value]); } else { data[index][1] = value; } return this; } // Add methods to `ListCache`. ListCache.prototype.clear = listCacheClear; ListCache.prototype['delete'] = listCacheDelete; ListCache.prototype.get = listCacheGet; ListCache.prototype.has = listCacheHas; ListCache.prototype.set = listCacheSet; /*------------------------------------------------------------------------*/ /** * Creates a map cache object to store key-value pairs. * * @private * @constructor * @param {Array} [entries] The key-value pairs to cache. */ function MapCache(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } /** * Removes all key-value entries from the map. * * @private * @name clear * @memberOf MapCache */ function mapCacheClear() { this.size = 0; this.__data__ = { 'hash': new Hash, 'map': new (Map || ListCache), 'string': new Hash }; } /** * Removes `key` and its value from the map. * * @private * @name delete * @memberOf MapCache * @param {string} key The key of the value to remove. * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ function mapCacheDelete(key) { var result = getMapData(this, key)['delete'](key); this.size -= result ? 1 : 0; return result; } /** * Gets the map value for `key`. * * @private * @name get * @memberOf MapCache * @param {string} key The key of the value to get. * @returns {*} Returns the entry value. */ function mapCacheGet(key) { return getMapData(this, key).get(key); } /** * Checks if a map value for `key` exists. * * @private * @name has * @memberOf MapCache * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function mapCacheHas(key) { return getMapData(this, key).has(key); } /** * Sets the map `key` to `value`. * * @private * @name set * @memberOf MapCache * @param {string} key The key of the value to set. * @param {*} value The value to set. * @returns {Object} Returns the map cache instance. */ function mapCacheSet(key, value) { var data = getMapData(this, key), size = data.size; data.set(key, value); this.size += data.size == size ? 0 : 1; return this; } // Add methods to `MapCache`. MapCache.prototype.clear = mapCacheClear; MapCache.prototype['delete'] = mapCacheDelete; MapCache.prototype.get = mapCacheGet; MapCache.prototype.has = mapCacheHas; MapCache.prototype.set = mapCacheSet; /*------------------------------------------------------------------------*/ /** * * Creates an array cache object to store unique values. * * @private * @constructor * @param {Array} [values] The values to cache. */ function SetCache(values) { var index = -1, length = values == null ? 0 : values.length; this.__data__ = new MapCache; while (++index < length) { this.add(values[index]); } } /** * Adds `value` to the array cache. * * @private * @name add * @memberOf SetCache * @alias push * @param {*} value The value to cache. * @returns {Object} Returns the cache instance. */ function setCacheAdd(value) { this.__data__.set(value, HASH_UNDEFINED); return this; } /** * Checks if `value` is in the array cache. * * @private * @name has * @memberOf SetCache * @param {*} value The value to search for. * @returns {number} Returns `true` if `value` is found, else `false`. */ function setCacheHas(value) { return this.__data__.has(value); } // Add methods to `SetCache`. SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; SetCache.prototype.has = setCacheHas; /*------------------------------------------------------------------------*/ /** * Creates a stack cache object to store key-value pairs. * * @private * @constructor * @param {Array} [entries] The key-value pairs to cache. */ function Stack(entries) { var data = this.__data__ = new ListCache(entries); this.size = data.size; } /** * Removes all key-value entries from the stack. * * @private * @name clear * @memberOf Stack */ function stackClear() { this.__data__ = new ListCache; this.size = 0; } /** * Removes `key` and its value from the stack. * * @private * @name delete * @memberOf Stack * @param {string} key The key of the value to remove. * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ function stackDelete(key) { var data = this.__data__, result = data['delete'](key); this.size = data.size; return result; } /** * Gets the stack value for `key`. * * @private * @name get * @memberOf Stack * @param {string} key The key of the value to get. * @returns {*} Returns the entry value. */ function stackGet(key) { return this.__data__.get(key); } /** * Checks if a stack value for `key` exists. * * @private * @name has * @memberOf Stack * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function stackHas(key) { return this.__data__.has(key); } /** * Sets the stack `key` to `value`. * * @private * @name set * @memberOf Stack * @param {string} key The key of the value to set. * @param {*} value The value to set. * @returns {Object} Returns the stack cache instance. */ function stackSet(key, value) { var data = this.__data__; if (data instanceof ListCache) { var pairs = data.__data__; if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { pairs.push([key, value]); this.size = ++data.size; return this; } data = this.__data__ = new MapCache(pairs); } data.set(key, value); this.size = data.size; return this; } // Add methods to `Stack`. Stack.prototype.clear = stackClear; Stack.prototype['delete'] = stackDelete; Stack.prototype.get = stackGet; Stack.prototype.has = stackHas; Stack.prototype.set = stackSet; /*------------------------------------------------------------------------*/ /** * Creates an array of the enumerable property names of the array-like `value`. * * @private * @param {*} value The value to query. * @param {boolean} inherited Specify returning inherited property names. * @returns {Array} Returns the array of property names. */ function arrayLikeKeys(value, inherited) { var isArr = isArray(value), isArg = !isArr && isArguments(value), isBuff = !isArr && !isArg && isBuffer(value), isType = !isArr && !isArg && !isBuff && isTypedArray(value), skipIndexes = isArr || isArg || isBuff || isType, result = skipIndexes ? baseTimes(value.length, String) : [], length = result.length; for (var key in value) { if ((inherited || hasOwnProperty.call(value, key)) && !(skipIndexes && ( // Safari 9 has enumerable `arguments.length` in strict mode. key == 'length' || // Node.js 0.10 has enumerable non-index properties on buffers. (isBuff && (key == 'offset' || key == 'parent')) || // PhantomJS 2 has enumerable non-index properties on typed arrays. (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || // Skip index properties. isIndex(key, length) ))) { result.push(key); } } return result; } /** * A specialized version of `_.sample` for arrays. * * @private * @param {Array} array The array to sample. * @returns {*} Returns the random element. */ function arraySample(array) { var length = array.length; return length ? array[baseRandom(0, length - 1)] : undefined; } /** * A specialized version of `_.sampleSize` for arrays. * * @private * @param {Array} array The array to sample. * @param {number} n The number of elements to sample. * @returns {Array} Returns the random elements. */ function arraySampleSize(array, n) { return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); } /** * A specialized version of `_.shuffle` for arrays. * * @private * @param {Array} array The array to shuffle. * @returns {Array} Returns the new shuffled array. */ function arrayShuffle(array) { return shuffleSelf(copyArray(array)); } /** * This function is like `assignValue` except that it doesn't assign * `undefined` values. * * @private * @param {Object} object The object to modify. * @param {string} key The key of the property to assign. * @param {*} value The value to assign. */ function assignMergeValue(object, key, value) { if ((value !== undefined && !eq(object[key], value)) || (value === undefined && !(key in object))) { baseAssignValue(object, key, value); } } /** * Assigns `value` to `key` of `object` if the existing value is not equivalent * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. * * @private * @param {Object} object The object to modify. * @param {string} key The key of the property to assign. * @param {*} value The value to assign. */ function assignValue(object, key, value) { var objValue = object[key]; if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || (value === undefined && !(key in object))) { baseAssignValue(object, key, value); } } /** * Gets the index at which the `key` is found in `array` of key-value pairs. * * @private * @param {Array} array The array to inspect. * @param {*} key The key to search for. * @returns {number} Returns the index of the matched value, else `-1`. */ function assocIndexOf(array, key) { var length = array.length; while (length--) { if (eq(array[length][0], key)) { return length; } } return -1; } /** * Aggregates elements of `collection` on `accumulator` with keys transformed * by `iteratee` and values set by `setter`. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} setter The function to set `accumulator` values. * @param {Function} iteratee The iteratee to transform keys. * @param {Object} accumulator The initial aggregated object. * @returns {Function} Returns `accumulator`. */ function baseAggregator(collection, setter, iteratee, accumulator) { baseEach(collection, function(value, key, collection) { setter(accumulator, value, iteratee(value), collection); }); return accumulator; } /** * The base implementation of `_.assign` without support for multiple sources * or `customizer` functions. * * @private * @param {Object} object The destination object. * @param {Object} source The source object. * @returns {Object} Returns `object`. */ function baseAssign(object, source) { return object && copyObject(source, keys(source), object); } /** * The base implementation of `_.assignIn` without support for multiple sources * or `customizer` functions. * * @private * @param {Object} object The destination object. * @param {Object} source The source object. * @returns {Object} Returns `object`. */ function baseAssignIn(object, source) { return object && copyObject(source, keysIn(source), object); } /** * The base implementation of `assignValue` and `assignMergeValue` without * value checks. * * @private * @param {Object} object The object to modify. * @param {string} key The key of the property to assign. * @param {*} value The value to assign. */ function baseAssignValue(object, key, value) { if (key == '__proto__' && defineProperty) { defineProperty(object, key, { 'configurable': true, 'enumerable': true, 'value': value, 'writable': true }); } else { object[key] = value; } } /** * The base implementation of `_.at` without support for individual paths. * * @private * @param {Object} object The object to iterate over. * @param {string[]} paths The property paths to pick. * @returns {Array} Returns the picked elements. */ function baseAt(object, paths) { var index = -1, length = paths.length, result = Array(length), skip = object == null; while (++index < length) { result[index] = skip ? undefined : get(object, paths[index]); } return result; } /** * The base implementation of `_.clamp` which doesn't coerce arguments. * * @private * @param {number} number The number to clamp. * @param {number} [lower] The lower bound. * @param {number} upper The upper bound. * @returns {number} Returns the clamped number. */ function baseClamp(number, lower, upper) { if (number === number) { if (upper !== undefined) { number = number <= upper ? number : upper; } if (lower !== undefined) { number = number >= lower ? number : lower; } } return number; } /** * The base implementation of `_.clone` and `_.cloneDeep` which tracks * traversed objects. * * @private * @param {*} value The value to clone. * @param {boolean} bitmask The bitmask flags. * 1 - Deep clone * 2 - Flatten inherited properties * 4 - Clone symbols * @param {Function} [customizer] The function to customize cloning. * @param {string} [key] The key of `value`. * @param {Object} [object] The parent object of `value`. * @param {Object} [stack] Tracks traversed objects and their clone counterparts. * @returns {*} Returns the cloned value. */ function baseClone(value, bitmask, customizer, key, object, stack) { var result, isDeep = bitmask & CLONE_DEEP_FLAG, isFlat = bitmask & CLONE_FLAT_FLAG, isFull = bitmask & CLONE_SYMBOLS_FLAG; if (customizer) { result = object ? customizer(value, key, object, stack) : customizer(value); } if (result !== undefined) { return result; } if (!isObject(value)) { return value; } var isArr = isArray(value); if (isArr) { result = initCloneArray(value); if (!isDeep) { return copyArray(value, result); } } else { var tag = getTag(value), isFunc = tag == funcTag || tag == genTag; if (isBuffer(value)) { return cloneBuffer(value, isDeep); } if (tag == objectTag || tag == argsTag || (isFunc && !object)) { result = (isFlat || isFunc) ? {} : initCloneObject(value); if (!isDeep) { return isFlat ? copySymbolsIn(value, baseAssignIn(result, value)) : copySymbols(value, baseAssign(result, value)); } } else { if (!cloneableTags[tag]) { return object ? value : {}; } result = initCloneByTag(value, tag, isDeep); } } // Check for circular references and return its corresponding clone. stack || (stack = new Stack); var stacked = stack.get(value); if (stacked) { return stacked; } stack.set(value, result); if (isSet(value)) { value.forEach(function(subValue) { result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack)); }); return result; } if (isMap(value)) { value.forEach(function(subValue, key) { result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack)); }); return result; } var keysFunc = isFull ? (isFlat ? getAllKeysIn : getAllKeys) : (isFlat ? keysIn : keys); var props = isArr ? undefined : keysFunc(value); arrayEach(props || value, function(subValue, key) { if (props) { key = subValue; subValue = value[key]; } // Recursively populate clone (susceptible to call stack limits). assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); }); return result; } /** * The base implementation of `_.conforms` which doesn't clone `source`. * * @private * @param {Object} source The object of property predicates to conform to. * @returns {Function} Returns the new spec function. */ function baseConforms(source) { var props = keys(source); return function(object) { return baseConformsTo(object, source, props); }; } /** * The base implementation of `_.conformsTo` which accepts `props` to check. * * @private * @param {Object} object The object to inspect. * @param {Object} source The object of property predicates to conform to. * @returns {boolean} Returns `true` if `object` conforms, else `false`. */ function baseConformsTo(object, source, props) { var length = props.length; if (object == null) { return !length; } object = Object(object); while (length--) { var key = props[length], predicate = source[key], value = object[key]; if ((value === undefined && !(key in object)) || !predicate(value)) { return false; } } return true; } /** * The base implementation of `_.delay` and `_.defer` which accepts `args` * to provide to `func`. * * @private * @param {Function} func The function to delay. * @param {number} wait The number of milliseconds to delay invocation. * @param {Array} args The arguments to provide to `func`. * @returns {number|Object} Returns the timer id or timeout object. */ function baseDelay(func, wait, args) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } return setTimeout(function() { func.apply(undefined, args); }, wait); } /** * The base implementation of methods like `_.difference` without support * for excluding multiple arrays or iteratee shorthands. * * @private * @param {Array} array The array to inspect. * @param {Array} values The values to exclude. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of filtered values. */ function baseDifference(array, values, iteratee, comparator) { var index = -1, includes = arrayIncludes, isCommon = true, length = array.length, result = [], valuesLength = values.length; if (!length) { return result; } if (iteratee) { values = arrayMap(values, baseUnary(iteratee)); } if (comparator) { includes = arrayIncludesWith; isCommon = false; } else if (values.length >= LARGE_ARRAY_SIZE) { includes = cacheHas; isCommon = false; values = new SetCache(values); } outer: while (++index < length) { var value = array[index], computed = iteratee == null ? value : iteratee(value); value = (comparator || value !== 0) ? value : 0; if (isCommon && computed === computed) { var valuesIndex = valuesLength; while (valuesIndex--) { if (values[valuesIndex] === computed) { continue outer; } } result.push(value); } else if (!includes(values, computed, comparator)) { result.push(value); } } return result; } /** * The base implementation of `_.forEach` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array|Object} Returns `collection`. */ var baseEach = createBaseEach(baseForOwn); /** * The base implementation of `_.forEachRight` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array|Object} Returns `collection`. */ var baseEachRight = createBaseEach(baseForOwnRight, true); /** * The base implementation of `_.every` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {boolean} Returns `true` if all elements pass the predicate check, * else `false` */ function baseEvery(collection, predicate) { var result = true; baseEach(collection, function(value, index, collection) { result = !!predicate(value, index, collection); return result; }); return result; } /** * The base implementation of methods like `_.max` and `_.min` which accepts a * `comparator` to determine the extremum value. * * @private * @param {Array} array The array to iterate over. * @param {Function} iteratee The iteratee invoked per iteration. * @param {Function} comparator The comparator used to compare values. * @returns {*} Returns the extremum value. */ function baseExtremum(array, iteratee, comparator) { var index = -1, length = array.length; while (++index < length) { var value = array[index], current = iteratee(value); if (current != null && (computed === undefined ? (current === current && !isSymbol(current)) : comparator(current, computed) )) { var computed = current, result = value; } } return result; } /** * The base implementation of `_.fill` without an iteratee call guard. * * @private * @param {Array} array The array to fill. * @param {*} value The value to fill `array` with. * @param {number} [start=0] The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns `array`. */ function baseFill(array, value, start, end) { var length = array.length; start = toInteger(start); if (start < 0) { start = -start > length ? 0 : (length + start); } end = (end === undefined || end > length) ? length : toInteger(end); if (end < 0) { end += length; } end = start > end ? 0 : toLength(end); while (start < end) { array[start++] = value; } return array; } /** * The base implementation of `_.filter` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {Array} Returns the new filtered array. */ function baseFilter(collection, predicate) { var result = []; baseEach(collection, function(value, index, collection) { if (predicate(value, index, collection)) { result.push(value); } }); return result; } /** * The base implementation of `_.flatten` with support for restricting flattening. * * @private * @param {Array} array The array to flatten. * @param {number} depth The maximum recursion depth. * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. * @param {Array} [result=[]] The initial result value. * @returns {Array} Returns the new flattened array. */ function baseFlatten(array, depth, predicate, isStrict, result) { var index = -1, length = array.length; predicate || (predicate = isFlattenable); result || (result = []); while (++index < length) { var value = array[index]; if (depth > 0 && predicate(value)) { if (depth > 1) { // Recursively flatten arrays (susceptible to call stack limits). baseFlatten(value, depth - 1, predicate, isStrict, result); } else { arrayPush(result, value); } } else if (!isStrict) { result[result.length] = value; } } return result; } /** * The base implementation of `baseForOwn` which iterates over `object` * properties returned by `keysFunc` and invokes `iteratee` for each property. * Iteratee functions may exit iteration early by explicitly returning `false`. * * @private * @param {Object} object The object to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {Function} keysFunc The function to get the keys of `object`. * @returns {Object} Returns `object`. */ var baseFor = createBaseFor(); /** * This function is like `baseFor` except that it iterates over properties * in the opposite order. * * @private * @param {Object} object The object to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {Function} keysFunc The function to get the keys of `object`. * @returns {Object} Returns `object`. */ var baseForRight = createBaseFor(true); /** * The base implementation of `_.forOwn` without support for iteratee shorthands. * * @private * @param {Object} object The object to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Object} Returns `object`. */ function baseForOwn(object, iteratee) { return object && baseFor(object, iteratee, keys); } /** * The base implementation of `_.forOwnRight` without support for iteratee shorthands. * * @private * @param {Object} object The object to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Object} Returns `object`. */ function baseForOwnRight(object, iteratee) { return object && baseForRight(object, iteratee, keys); } /** * The base implementation of `_.functions` which creates an array of * `object` function property names filtered from `props`. * * @private * @param {Object} object The object to inspect. * @param {Array} props The property names to filter. * @returns {Array} Returns the function names. */ function baseFunctions(object, props) { return arrayFilter(props, function(key) { return isFunction(object[key]); }); } /** * The base implementation of `_.get` without support for default values. * * @private * @param {Object} object The object to query. * @param {Array|string} path The path of the property to get. * @returns {*} Returns the resolved value. */ function baseGet(object, path) { path = castPath(path, object); var index = 0, length = path.length; while (object != null && index < length) { object = object[toKey(path[index++])]; } return (index && index == length) ? object : undefined; } /** * The base implementation of `getAllKeys` and `getAllKeysIn` which uses * `keysFunc` and `symbolsFunc` to get the enumerable property names and * symbols of `object`. * * @private * @param {Object} object The object to query. * @param {Function} keysFunc The function to get the keys of `object`. * @param {Function} symbolsFunc The function to get the symbols of `object`. * @returns {Array} Returns the array of property names and symbols. */ function baseGetAllKeys(object, keysFunc, symbolsFunc) { var result = keysFunc(object); return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); } /** * The base implementation of `getTag` without fallbacks for buggy environments. * * @private * @param {*} value The value to query. * @returns {string} Returns the `toStringTag`. */ function baseGetTag(value) { if (value == null) { return value === undefined ? undefinedTag : nullTag; } return (symToStringTag && symToStringTag in Object(value)) ? getRawTag(value) : objectToString(value); } /** * The base implementation of `_.gt` which doesn't coerce arguments. * * @private * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is greater than `other`, * else `false`. */ function baseGt(value, other) { return value > other; } /** * The base implementation of `_.has` without support for deep paths. * * @private * @param {Object} [object] The object to query. * @param {Array|string} key The key to check. * @returns {boolean} Returns `true` if `key` exists, else `false`. */ function baseHas(object, key) { return object != null && hasOwnProperty.call(object, key); } /** * The base implementation of `_.hasIn` without support for deep paths. * * @private * @param {Object} [object] The object to query. * @param {Array|string} key The key to check. * @returns {boolean} Returns `true` if `key` exists, else `false`. */ function baseHasIn(object, key) { return object != null && key in Object(object); } /** * The base implementation of `_.inRange` which doesn't coerce arguments. * * @private * @param {number} number The number to check. * @param {number} start The start of the range. * @param {number} end The end of the range. * @returns {boolean} Returns `true` if `number` is in the range, else `false`. */ function baseInRange(number, start, end) { return number >= nativeMin(start, end) && number < nativeMax(start, end); } /** * The base implementation of methods like `_.intersection`, without support * for iteratee shorthands, that accepts an array of arrays to inspect. * * @private * @param {Array} arrays The arrays to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of shared values. */ function baseIntersection(arrays, iteratee, comparator) { var includes = comparator ? arrayIncludesWith : arrayIncludes, length = arrays[0].length, othLength = arrays.length, othIndex = othLength, caches = Array(othLength), maxLength = Infinity, result = []; while (othIndex--) { var array = arrays[othIndex]; if (othIndex && iteratee) { array = arrayMap(array, baseUnary(iteratee)); } maxLength = nativeMin(array.length, maxLength); caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) ? new SetCache(othIndex && array) : undefined; } array = arrays[0]; var index = -1, seen = caches[0]; outer: while (++index < length && result.length < maxLength) { var value = array[index], computed = iteratee ? iteratee(value) : value; value = (comparator || value !== 0) ? value : 0; if (!(seen ? cacheHas(seen, computed) : includes(result, computed, comparator) )) { othIndex = othLength; while (--othIndex) { var cache = caches[othIndex]; if (!(cache ? cacheHas(cache, computed) : includes(arrays[othIndex], computed, comparator)) ) { continue outer; } } if (seen) { seen.push(computed); } result.push(value); } } return result; } /** * The base implementation of `_.invert` and `_.invertBy` which inverts * `object` with values transformed by `iteratee` and set by `setter`. * * @private * @param {Object} object The object to iterate over. * @param {Function} setter The function to set `accumulator` values. * @param {Function} iteratee The iteratee to transform values. * @param {Object} accumulator The initial inverted object. * @returns {Function} Returns `accumulator`. */ function baseInverter(object, setter, iteratee, accumulator) { baseForOwn(object, function(value, key, object) { setter(accumulator, iteratee(value), key, object); }); return accumulator; } /** * The base implementation of `_.invoke` without support for individual * method arguments. * * @private * @param {Object} object The object to query. * @param {Array|string} path The path of the method to invoke. * @param {Array} args The arguments to invoke the method with. * @returns {*} Returns the result of the invoked method. */ function baseInvoke(object, path, args) { path = castPath(path, object); object = parent(object, path); var func = object == null ? object : object[toKey(last(path))]; return func == null ? undefined : apply(func, object, args); } /** * The base implementation of `_.isArguments`. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an `arguments` object, */ function baseIsArguments(value) { return isObjectLike(value) && baseGetTag(value) == argsTag; } /** * The base implementation of `_.isArrayBuffer` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. */ function baseIsArrayBuffer(value) { return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; } /** * The base implementation of `_.isDate` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a date object, else `false`. */ function baseIsDate(value) { return isObjectLike(value) && baseGetTag(value) == dateTag; } /** * The base implementation of `_.isEqual` which supports partial comparisons * and tracks traversed objects. * * @private * @param {*} value The value to compare. * @param {*} other The other value to compare. * @param {boolean} bitmask The bitmask flags. * 1 - Unordered comparison * 2 - Partial comparison * @param {Function} [customizer] The function to customize comparisons. * @param {Object} [stack] Tracks traversed `value` and `other` objects. * @returns {boolean} Returns `true` if the values are equivalent, else `false`. */ function baseIsEqual(value, other, bitmask, customizer, stack) { if (value === other) { return true; } if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { return value !== value && other !== other; } return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); } /** * A specialized version of `baseIsEqual` for arrays and objects which performs * deep comparisons and tracks traversed objects enabling objects with circular * references to be compared. * * @private * @param {Object} object The object to compare. * @param {Object} other The other object to compare. * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. * @param {Function} customizer The function to customize comparisons. * @param {Function} equalFunc The function to determine equivalents of values. * @param {Object} [stack] Tracks traversed `object` and `other` objects. * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { var objIsArr = isArray(object), othIsArr = isArray(other), objTag = objIsArr ? arrayTag : getTag(object), othTag = othIsArr ? arrayTag : getTag(other); objTag = objTag == argsTag ? objectTag : objTag; othTag = othTag == argsTag ? objectTag : othTag; var objIsObj = objTag == objectTag, othIsObj = othTag == objectTag, isSameTag = objTag == othTag; if (isSameTag && isBuffer(object)) { if (!isBuffer(other)) { return false; } objIsArr = true; objIsObj = false; } if (isSameTag && !objIsObj) { stack || (stack = new Stack); return (objIsArr || isTypedArray(object)) ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); } if (!(bitmask & COMPARE_PARTIAL_FLAG)) { var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); if (objIsWrapped || othIsWrapped) { var objUnwrapped = objIsWrapped ? object.value() : object, othUnwrapped = othIsWrapped ? other.value() : other; stack || (stack = new Stack); return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); } } if (!isSameTag) { return false; } stack || (stack = new Stack); return equalObjects(object, other, bitmask, customizer, equalFunc, stack); } /** * The base implementation of `_.isMap` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a map, else `false`. */ function baseIsMap(value) { return isObjectLike(value) && getTag(value) == mapTag; } /** * The base implementation of `_.isMatch` without support for iteratee shorthands. * * @private * @param {Object} object The object to inspect. * @param {Object} source The object of property values to match. * @param {Array} matchData The property names, values, and compare flags to match. * @param {Function} [customizer] The function to customize comparisons. * @returns {boolean} Returns `true` if `object` is a match, else `false`. */ function baseIsMatch(object, source, matchData, customizer) { var index = matchData.length, length = index, noCustomizer = !customizer; if (object == null) { return !length; } object = Object(object); while (index--) { var data = matchData[index]; if ((noCustomizer && data[2]) ? data[1] !== object[data[0]] : !(data[0] in object) ) { return false; } } while (++index < length) { data = matchData[index]; var key = data[0], objValue = object[key], srcValue = data[1]; if (noCustomizer && data[2]) { if (objValue === undefined && !(key in object)) { return false; } } else { var stack = new Stack; if (customizer) { var result = customizer(objValue, srcValue, key, object, source, stack); } if (!(result === undefined ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) : result )) { return false; } } } return true; } /** * The base implementation of `_.isNative` without bad shim checks. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a native function, * else `false`. */ function baseIsNative(value) { if (!isObject(value) || isMasked(value)) { return false; } var pattern = isFunction(value) ? reIsNative : reIsHostCtor; return pattern.test(toSource(value)); } /** * The base implementation of `_.isRegExp` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. */ function baseIsRegExp(value) { return isObjectLike(value) && baseGetTag(value) == regexpTag; } /** * The base implementation of `_.isSet` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a set, else `false`. */ function baseIsSet(value) { return isObjectLike(value) && getTag(value) == setTag; } /** * The base implementation of `_.isTypedArray` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. */ function baseIsTypedArray(value) { return isObjectLike(value) && isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; } /** * The base implementation of `_.iteratee`. * * @private * @param {*} [value=_.identity] The value to convert to an iteratee. * @returns {Function} Returns the iteratee. */ function baseIteratee(value) { // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. if (typeof value == 'function') { return value; } if (value == null) { return identity; } if (typeof value == 'object') { return isArray(value) ? baseMatchesProperty(value[0], value[1]) : baseMatches(value); } return property(value); } /** * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. */ function baseKeys(object) { if (!isPrototype(object)) { return nativeKeys(object); } var result = []; for (var key in Object(object)) { if (hasOwnProperty.call(object, key) && key != 'constructor') { result.push(key); } } return result; } /** * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. */ function baseKeysIn(object) { if (!isObject(object)) { return nativeKeysIn(object); } var isProto = isPrototype(object), result = []; for (var key in object) { if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { result.push(key); } } return result; } /** * The base implementation of `_.lt` which doesn't coerce arguments. * * @private * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is less than `other`, * else `false`. */ function baseLt(value, other) { return value < other; } /** * The base implementation of `_.map` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns the new mapped array. */ function baseMap(collection, iteratee) { var index = -1, result = isArrayLike(collection) ? Array(collection.length) : []; baseEach(collection, function(value, key, collection) { result[++index] = iteratee(value, key, collection); }); return result; } /** * The base implementation of `_.matches` which doesn't clone `source`. * * @private * @param {Object} source The object of property values to match. * @returns {Function} Returns the new spec function. */ function baseMatches(source) { var matchData = getMatchData(source); if (matchData.length == 1 && matchData[0][2]) { return matchesStrictComparable(matchData[0][0], matchData[0][1]); } return function(object) { return object === source || baseIsMatch(object, source, matchData); }; } /** * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. * * @private * @param {string} path The path of the property to get. * @param {*} srcValue The value to match. * @returns {Function} Returns the new spec function. */ function baseMatchesProperty(path, srcValue) { if (isKey(path) && isStrictComparable(srcValue)) { return matchesStrictComparable(toKey(path), srcValue); } return function(object) { var objValue = get(object, path); return (objValue === undefined && objValue === srcValue) ? hasIn(object, path) : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); }; } /** * The base implementation of `_.merge` without support for multiple sources. * * @private * @param {Object} object The destination object. * @param {Object} source The source object. * @param {number} srcIndex The index of `source`. * @param {Function} [customizer] The function to customize merged values. * @param {Object} [stack] Tracks traversed source values and their merged * counterparts. */ function baseMerge(object, source, srcIndex, customizer, stack) { if (object === source) { return; } baseFor(source, function(srcValue, key) { if (isObject(srcValue)) { stack || (stack = new Stack); baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); } else { var newValue = customizer ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack) : undefined; if (newValue === undefined) { newValue = srcValue; } assignMergeValue(object, key, newValue); } }, keysIn); } /** * A specialized version of `baseMerge` for arrays and objects which performs * deep merges and tracks traversed objects enabling objects with circular * references to be merged. * * @private * @param {Object} object The destination object. * @param {Object} source The source object. * @param {string} key The key of the value to merge. * @param {number} srcIndex The index of `source`. * @param {Function} mergeFunc The function to merge values. * @param {Function} [customizer] The function to customize assigned values. * @param {Object} [stack] Tracks traversed source values and their merged * counterparts. */ function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { var objValue = safeGet(object, key), srcValue = safeGet(source, key), stacked = stack.get(srcValue); if (stacked) { assignMergeValue(object, key, stacked); return; } var newValue = customizer ? customizer(objValue, srcValue, (key + ''), object, source, stack) : undefined; var isCommon = newValue === undefined; if (isCommon) { var isArr = isArray(srcValue), isBuff = !isArr && isBuffer(srcValue), isTyped = !isArr && !isBuff && isTypedArray(srcValue); newValue = srcValue; if (isArr || isBuff || isTyped) { if (isArray(objValue)) { newValue = objValue; } else if (isArrayLikeObject(objValue)) { newValue = copyArray(objValue); } else if (isBuff) { isCommon = false; newValue = cloneBuffer(srcValue, true); } else if (isTyped) { isCommon = false; newValue = cloneTypedArray(srcValue, true); } else { newValue = []; } } else if (isPlainObject(srcValue) || isArguments(srcValue)) { newValue = objValue; if (isArguments(objValue)) { newValue = toPlainObject(objValue); } else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) { newValue = initCloneObject(srcValue); } } else { isCommon = false; } } if (isCommon) { // Recursively merge objects and arrays (susceptible to call stack limits). stack.set(srcValue, newValue); mergeFunc(newValue, srcValue, srcIndex, customizer, stack); stack['delete'](srcValue); } assignMergeValue(object, key, newValue); } /** * The base implementation of `_.nth` which doesn't coerce arguments. * * @private * @param {Array} array The array to query. * @param {number} n The index of the element to return. * @returns {*} Returns the nth element of `array`. */ function baseNth(array, n) { var length = array.length; if (!length) { return; } n += n < 0 ? length : 0; return isIndex(n, length) ? array[n] : undefined; } /** * The base implementation of `_.orderBy` without param guards. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. * @param {string[]} orders The sort orders of `iteratees`. * @returns {Array} Returns the new sorted array. */ function baseOrderBy(collection, iteratees, orders) { var index = -1; iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee())); var result = baseMap(collection, function(value, key, collection) { var criteria = arrayMap(iteratees, function(iteratee) { return iteratee(value); }); return { 'criteria': criteria, 'index': ++index, 'value': value }; }); return baseSortBy(result, function(object, other) { return compareMultiple(object, other, orders); }); } /** * The base implementation of `_.pick` without support for individual * property identifiers. * * @private * @param {Object} object The source object. * @param {string[]} paths The property paths to pick. * @returns {Object} Returns the new object. */ function basePick(object, paths) { return basePickBy(object, paths, function(value, path) { return hasIn(object, path); }); } /** * The base implementation of `_.pickBy` without support for iteratee shorthands. * * @private * @param {Object} object The source object. * @param {string[]} paths The property paths to pick. * @param {Function} predicate The function invoked per property. * @returns {Object} Returns the new object. */ function basePickBy(object, paths, predicate) { var index = -1, length = paths.length, result = {}; while (++index < length) { var path = paths[index], value = baseGet(object, path); if (predicate(value, path)) { baseSet(result, castPath(path, object), value); } } return result; } /** * A specialized version of `baseProperty` which supports deep paths. * * @private * @param {Array|string} path The path of the property to get. * @returns {Function} Returns the new accessor function. */ function basePropertyDeep(path) { return function(object) { return baseGet(object, path); }; } /** * The base implementation of `_.pullAllBy` without support for iteratee * shorthands. * * @private * @param {Array} array The array to modify. * @param {Array} values The values to remove. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns `array`. */ function basePullAll(array, values, iteratee, comparator) { var indexOf = comparator ? baseIndexOfWith : baseIndexOf, index = -1, length = values.length, seen = array; if (array === values) { values = copyArray(values); } if (iteratee) { seen = arrayMap(array, baseUnary(iteratee)); } while (++index < length) { var fromIndex = 0, value = values[index], computed = iteratee ? iteratee(value) : value; while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { if (seen !== array) { splice.call(seen, fromIndex, 1); } splice.call(array, fromIndex, 1); } } return array; } /** * The base implementation of `_.pullAt` without support for individual * indexes or capturing the removed elements. * * @private * @param {Array} array The array to modify. * @param {number[]} indexes The indexes of elements to remove. * @returns {Array} Returns `array`. */ function basePullAt(array, indexes) { var length = array ? indexes.length : 0, lastIndex = length - 1; while (length--) { var index = indexes[length]; if (length == lastIndex || index !== previous) { var previous = index; if (isIndex(index)) { splice.call(array, index, 1); } else { baseUnset(array, index); } } } return array; } /** * The base implementation of `_.random` without support for returning * floating-point numbers. * * @private * @param {number} lower The lower bound. * @param {number} upper The upper bound. * @returns {number} Returns the random number. */ function baseRandom(lower, upper) { return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); } /** * The base implementation of `_.range` and `_.rangeRight` which doesn't * coerce arguments. * * @private * @param {number} start The start of the range. * @param {number} end The end of the range. * @param {number} step The value to increment or decrement by. * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Array} Returns the range of numbers. */ function baseRange(start, end, step, fromRight) { var index = -1, length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), result = Array(length); while (length--) { result[fromRight ? length : ++index] = start; start += step; } return result; } /** * The base implementation of `_.repeat` which doesn't coerce arguments. * * @private * @param {string} string The string to repeat. * @param {number} n The number of times to repeat the string. * @returns {string} Returns the repeated string. */ function baseRepeat(string, n) { var result = ''; if (!string || n < 1 || n > MAX_SAFE_INTEGER) { return result; } // Leverage the exponentiation by squaring algorithm for a faster repeat. // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. do { if (n % 2) { result += string; } n = nativeFloor(n / 2); if (n) { string += string; } } while (n); return result; } /** * The base implementation of `_.rest` which doesn't validate or coerce arguments. * * @private * @param {Function} func The function to apply a rest parameter to. * @param {number} [start=func.length-1] The start position of the rest parameter. * @returns {Function} Returns the new function. */ function baseRest(func, start) { return setToString(overRest(func, start, identity), func + ''); } /** * The base implementation of `_.sample`. * * @private * @param {Array|Object} collection The collection to sample. * @returns {*} Returns the random element. */ function baseSample(collection) { return arraySample(values(collection)); } /** * The base implementation of `_.sampleSize` without param guards. * * @private * @param {Array|Object} collection The collection to sample. * @param {number} n The number of elements to sample. * @returns {Array} Returns the random elements. */ function baseSampleSize(collection, n) { var array = values(collection); return shuffleSelf(array, baseClamp(n, 0, array.length)); } /** * The base implementation of `_.set`. * * @private * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {*} value The value to set. * @param {Function} [customizer] The function to customize path creation. * @returns {Object} Returns `object`. */ function baseSet(object, path, value, customizer) { if (!isObject(object)) { return object; } path = castPath(path, object); var index = -1, length = path.length, lastIndex = length - 1, nested = object; while (nested != null && ++index < length) { var key = toKey(path[index]), newValue = value; if (index != lastIndex) { var objValue = nested[key]; newValue = customizer ? customizer(objValue, key, nested) : undefined; if (newValue === undefined) { newValue = isObject(objValue) ? objValue : (isIndex(path[index + 1]) ? [] : {}); } } assignValue(nested, key, newValue); nested = nested[key]; } return object; } /** * The base implementation of `setData` without support for hot loop shorting. * * @private * @param {Function} func The function to associate metadata with. * @param {*} data The metadata. * @returns {Function} Returns `func`. */ var baseSetData = !metaMap ? identity : function(func, data) { metaMap.set(func, data); return func; }; /** * The base implementation of `setToString` without support for hot loop shorting. * * @private * @param {Function} func The function to modify. * @param {Function} string The `toString` result. * @returns {Function} Returns `func`. */ var baseSetToString = !defineProperty ? identity : function(func, string) { return defineProperty(func, 'toString', { 'configurable': true, 'enumerable': false, 'value': constant(string), 'writable': true }); }; /** * The base implementation of `_.shuffle`. * * @private * @param {Array|Object} collection The collection to shuffle. * @returns {Array} Returns the new shuffled array. */ function baseShuffle(collection) { return shuffleSelf(values(collection)); } /** * The base implementation of `_.slice` without an iteratee call guard. * * @private * @param {Array} array The array to slice. * @param {number} [start=0] The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns the slice of `array`. */ function baseSlice(array, start, end) { var index = -1, length = array.length; if (start < 0) { start = -start > length ? 0 : (length + start); } end = end > length ? length : end; if (end < 0) { end += length; } length = start > end ? 0 : ((end - start) >>> 0); start >>>= 0; var result = Array(length); while (++index < length) { result[index] = array[index + start]; } return result; } /** * The base implementation of `_.some` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {boolean} Returns `true` if any element passes the predicate check, * else `false`. */ function baseSome(collection, predicate) { var result; baseEach(collection, function(value, index, collection) { result = predicate(value, index, collection); return !result; }); return !!result; } /** * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which * performs a binary search of `array` to determine the index at which `value` * should be inserted into `array` in order to maintain its sort order. * * @private * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @param {boolean} [retHighest] Specify returning the highest qualified index. * @returns {number} Returns the index at which `value` should be inserted * into `array`. */ function baseSortedIndex(array, value, retHighest) { var low = 0, high = array == null ? low : array.length; if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { while (low < high) { var mid = (low + high) >>> 1, computed = array[mid]; if (computed !== null && !isSymbol(computed) && (retHighest ? (computed <= value) : (computed < value))) { low = mid + 1; } else { high = mid; } } return high; } return baseSortedIndexBy(array, value, identity, retHighest); } /** * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` * which invokes `iteratee` for `value` and each element of `array` to compute * their sort ranking. The iteratee is invoked with one argument; (value). * * @private * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @param {Function} iteratee The iteratee invoked per element. * @param {boolean} [retHighest] Specify returning the highest qualified index. * @returns {number} Returns the index at which `value` should be inserted * into `array`. */ function baseSortedIndexBy(array, value, iteratee, retHighest) { value = iteratee(value); var low = 0, high = array == null ? 0 : array.length, valIsNaN = value !== value, valIsNull = value === null, valIsSymbol = isSymbol(value), valIsUndefined = value === undefined; while (low < high) { var mid = nativeFloor((low + high) / 2), computed = iteratee(array[mid]), othIsDefined = computed !== undefined, othIsNull = computed === null, othIsReflexive = computed === computed, othIsSymbol = isSymbol(computed); if (valIsNaN) { var setLow = retHighest || othIsReflexive; } else if (valIsUndefined) { setLow = othIsReflexive && (retHighest || othIsDefined); } else if (valIsNull) { setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); } else if (valIsSymbol) { setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); } else if (othIsNull || othIsSymbol) { setLow = false; } else { setLow = retHighest ? (computed <= value) : (computed < value); } if (setLow) { low = mid + 1; } else { high = mid; } } return nativeMin(high, MAX_ARRAY_INDEX); } /** * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without * support for iteratee shorthands. * * @private * @param {Array} array The array to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @returns {Array} Returns the new duplicate free array. */ function baseSortedUniq(array, iteratee) { var index = -1, length = array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index], computed = iteratee ? iteratee(value) : value; if (!index || !eq(computed, seen)) { var seen = computed; result[resIndex++] = value === 0 ? 0 : value; } } return result; } /** * The base implementation of `_.toNumber` which doesn't ensure correct * conversions of binary, hexadecimal, or octal string values. * * @private * @param {*} value The value to process. * @returns {number} Returns the number. */ function baseToNumber(value) { if (typeof value == 'number') { return value; } if (isSymbol(value)) { return NAN; } return +value; } /** * The base implementation of `_.toString` which doesn't convert nullish * values to empty strings. * * @private * @param {*} value The value to process. * @returns {string} Returns the string. */ function baseToString(value) { // Exit early for strings to avoid a performance hit in some environments. if (typeof value == 'string') { return value; } if (isArray(value)) { // Recursively convert values (susceptible to call stack limits). return arrayMap(value, baseToString) + ''; } if (isSymbol(value)) { return symbolToString ? symbolToString.call(value) : ''; } var result = (value + ''); return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; } /** * The base implementation of `_.uniqBy` without support for iteratee shorthands. * * @private * @param {Array} array The array to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new duplicate free array. */ function baseUniq(array, iteratee, comparator) { var index = -1, includes = arrayIncludes, length = array.length, isCommon = true, result = [], seen = result; if (comparator) { isCommon = false; includes = arrayIncludesWith; } else if (length >= LARGE_ARRAY_SIZE) { var set = iteratee ? null : createSet(array); if (set) { return setToArray(set); } isCommon = false; includes = cacheHas; seen = new SetCache; } else { seen = iteratee ? [] : result; } outer: while (++index < length) { var value = array[index], computed = iteratee ? iteratee(value) : value; value = (comparator || value !== 0) ? value : 0; if (isCommon && computed === computed) { var seenIndex = seen.length; while (seenIndex--) { if (seen[seenIndex] === computed) { continue outer; } } if (iteratee) { seen.push(computed); } result.push(value); } else if (!includes(seen, computed, comparator)) { if (seen !== result) { seen.push(computed); } result.push(value); } } return result; } /** * The base implementation of `_.unset`. * * @private * @param {Object} object The object to modify. * @param {Array|string} path The property path to unset. * @returns {boolean} Returns `true` if the property is deleted, else `false`. */ function baseUnset(object, path) { path = castPath(path, object); object = parent(object, path); return object == null || delete object[toKey(last(path))]; } /** * The base implementation of `_.update`. * * @private * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to update. * @param {Function} updater The function to produce the updated value. * @param {Function} [customizer] The function to customize path creation. * @returns {Object} Returns `object`. */ function baseUpdate(object, path, updater, customizer) { return baseSet(object, path, updater(baseGet(object, path)), customizer); } /** * The base implementation of methods like `_.dropWhile` and `_.takeWhile` * without support for iteratee shorthands. * * @private * @param {Array} array The array to query. * @param {Function} predicate The function invoked per iteration. * @param {boolean} [isDrop] Specify dropping elements instead of taking them. * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Array} Returns the slice of `array`. */ function baseWhile(array, predicate, isDrop, fromRight) { var length = array.length, index = fromRight ? length : -1; while ((fromRight ? index-- : ++index < length) && predicate(array[index], index, array)) {} return isDrop ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); } /** * The base implementation of `wrapperValue` which returns the result of * performing a sequence of actions on the unwrapped `value`, where each * successive action is supplied the return value of the previous. * * @private * @param {*} value The unwrapped value. * @param {Array} actions Actions to perform to resolve the unwrapped value. * @returns {*} Returns the resolved value. */ function baseWrapperValue(value, actions) { var result = value; if (result instanceof LazyWrapper) { result = result.value(); } return arrayReduce(actions, function(result, action) { return action.func.apply(action.thisArg, arrayPush([result], action.args)); }, result); } /** * The base implementation of methods like `_.xor`, without support for * iteratee shorthands, that accepts an array of arrays to inspect. * * @private * @param {Array} arrays The arrays to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of values. */ function baseXor(arrays, iteratee, comparator) { var length = arrays.length; if (length < 2) { return length ? baseUniq(arrays[0]) : []; } var index = -1, result = Array(length); while (++index < length) { var array = arrays[index], othIndex = -1; while (++othIndex < length) { if (othIndex != index) { result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); } } } return baseUniq(baseFlatten(result, 1), iteratee, comparator); } /** * This base implementation of `_.zipObject` which assigns values using `assignFunc`. * * @private * @param {Array} props The property identifiers. * @param {Array} values The property values. * @param {Function} assignFunc The function to assign values. * @returns {Object} Returns the new object. */ function baseZipObject(props, values, assignFunc) { var index = -1, length = props.length, valsLength = values.length, result = {}; while (++index < length) { var value = index < valsLength ? values[index] : undefined; assignFunc(result, props[index], value); } return result; } /** * Casts `value` to an empty array if it's not an array like object. * * @private * @param {*} value The value to inspect. * @returns {Array|Object} Returns the cast array-like object. */ function castArrayLikeObject(value) { return isArrayLikeObject(value) ? value : []; } /** * Casts `value` to `identity` if it's not a function. * * @private * @param {*} value The value to inspect. * @returns {Function} Returns cast function. */ function castFunction(value) { return typeof value == 'function' ? value : identity; } /** * Casts `value` to a path array if it's not one. * * @private * @param {*} value The value to inspect. * @param {Object} [object] The object to query keys on. * @returns {Array} Returns the cast property path array. */ function castPath(value, object) { if (isArray(value)) { return value; } return isKey(value, object) ? [value] : stringToPath(toString(value)); } /** * A `baseRest` alias which can be replaced with `identity` by module * replacement plugins. * * @private * @type {Function} * @param {Function} func The function to apply a rest parameter to. * @returns {Function} Returns the new function. */ var castRest = baseRest; /** * Casts `array` to a slice if it's needed. * * @private * @param {Array} array The array to inspect. * @param {number} start The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns the cast slice. */ function castSlice(array, start, end) { var length = array.length; end = end === undefined ? length : end; return (!start && end >= length) ? array : baseSlice(array, start, end); } /** * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). * * @private * @param {number|Object} id The timer id or timeout object of the timer to clear. */ var clearTimeout = ctxClearTimeout || function(id) { return root.clearTimeout(id); }; /** * Creates a clone of `buffer`. * * @private * @param {Buffer} buffer The buffer to clone. * @param {boolean} [isDeep] Specify a deep clone. * @returns {Buffer} Returns the cloned buffer. */ function cloneBuffer(buffer, isDeep) { if (isDeep) { return buffer.slice(); } var length = buffer.length, result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); buffer.copy(result); return result; } /** * Creates a clone of `arrayBuffer`. * * @private * @param {ArrayBuffer} arrayBuffer The array buffer to clone. * @returns {ArrayBuffer} Returns the cloned array buffer. */ function cloneArrayBuffer(arrayBuffer) { var result = new arrayBuffer.constructor(arrayBuffer.byteLength); new Uint8Array(result).set(new Uint8Array(arrayBuffer)); return result; } /** * Creates a clone of `dataView`. * * @private * @param {Object} dataView The data view to clone. * @param {boolean} [isDeep] Specify a deep clone. * @returns {Object} Returns the cloned data view. */ function cloneDataView(dataView, isDeep) { var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); } /** * Creates a clone of `regexp`. * * @private * @param {Object} regexp The regexp to clone. * @returns {Object} Returns the cloned regexp. */ function cloneRegExp(regexp) { var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); result.lastIndex = regexp.lastIndex; return result; } /** * Creates a clone of the `symbol` object. * * @private * @param {Object} symbol The symbol object to clone. * @returns {Object} Returns the cloned symbol object. */ function cloneSymbol(symbol) { return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; } /** * Creates a clone of `typedArray`. * * @private * @param {Object} typedArray The typed array to clone. * @param {boolean} [isDeep] Specify a deep clone. * @returns {Object} Returns the cloned typed array. */ function cloneTypedArray(typedArray, isDeep) { var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); } /** * Compares values to sort them in ascending order. * * @private * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {number} Returns the sort order indicator for `value`. */ function compareAscending(value, other) { if (value !== other) { var valIsDefined = value !== undefined, valIsNull = value === null, valIsReflexive = value === value, valIsSymbol = isSymbol(value); var othIsDefined = other !== undefined, othIsNull = other === null, othIsReflexive = other === other, othIsSymbol = isSymbol(other); if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || (valIsNull && othIsDefined && othIsReflexive) || (!valIsDefined && othIsReflexive) || !valIsReflexive) { return 1; } if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || (othIsNull && valIsDefined && valIsReflexive) || (!othIsDefined && valIsReflexive) || !othIsReflexive) { return -1; } } return 0; } /** * Used by `_.orderBy` to compare multiple properties of a value to another * and stable sort them. * * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, * specify an order of "desc" for descending or "asc" for ascending sort order * of corresponding values. * * @private * @param {Object} object The object to compare. * @param {Object} other The other object to compare. * @param {boolean[]|string[]} orders The order to sort by for each property. * @returns {number} Returns the sort order indicator for `object`. */ function compareMultiple(object, other, orders) { var index = -1, objCriteria = object.criteria, othCriteria = other.criteria, length = objCriteria.length, ordersLength = orders.length; while (++index < length) { var result = compareAscending(objCriteria[index], othCriteria[index]); if (result) { if (index >= ordersLength) { return result; } var order = orders[index]; return result * (order == 'desc' ? -1 : 1); } } // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications // that causes it, under certain circumstances, to provide the same value for // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 // for more details. // // This also ensures a stable sort in V8 and other engines. // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. return object.index - other.index; } /** * Creates an array that is the composition of partially applied arguments, * placeholders, and provided arguments into a single array of arguments. * * @private * @param {Array} args The provided arguments. * @param {Array} partials The arguments to prepend to those provided. * @param {Array} holders The `partials` placeholder indexes. * @params {boolean} [isCurried] Specify composing for a curried function. * @returns {Array} Returns the new array of composed arguments. */ function composeArgs(args, partials, holders, isCurried) { var argsIndex = -1, argsLength = args.length, holdersLength = holders.length, leftIndex = -1, leftLength = partials.length, rangeLength = nativeMax(argsLength - holdersLength, 0), result = Array(leftLength + rangeLength), isUncurried = !isCurried; while (++leftIndex < leftLength) { result[leftIndex] = partials[leftIndex]; } while (++argsIndex < holdersLength) { if (isUncurried || argsIndex < argsLength) { result[holders[argsIndex]] = args[argsIndex]; } } while (rangeLength--) { result[leftIndex++] = args[argsIndex++]; } return result; } /** * This function is like `composeArgs` except that the arguments composition * is tailored for `_.partialRight`. * * @private * @param {Array} args The provided arguments. * @param {Array} partials The arguments to append to those provided. * @param {Array} holders The `partials` placeholder indexes. * @params {boolean} [isCurried] Specify composing for a curried function. * @returns {Array} Returns the new array of composed arguments. */ function composeArgsRight(args, partials, holders, isCurried) { var argsIndex = -1, argsLength = args.length, holdersIndex = -1, holdersLength = holders.length, rightIndex = -1, rightLength = partials.length, rangeLength = nativeMax(argsLength - holdersLength, 0), result = Array(rangeLength + rightLength), isUncurried = !isCurried; while (++argsIndex < rangeLength) { result[argsIndex] = args[argsIndex]; } var offset = argsIndex; while (++rightIndex < rightLength) { result[offset + rightIndex] = partials[rightIndex]; } while (++holdersIndex < holdersLength) { if (isUncurried || argsIndex < argsLength) { result[offset + holders[holdersIndex]] = args[argsIndex++]; } } return result; } /** * Copies the values of `source` to `array`. * * @private * @param {Array} source The array to copy values from. * @param {Array} [array=[]] The array to copy values to. * @returns {Array} Returns `array`. */ function copyArray(source, array) { var index = -1, length = source.length; array || (array = Array(length)); while (++index < length) { array[index] = source[index]; } return array; } /** * Copies properties of `source` to `object`. * * @private * @param {Object} source The object to copy properties from. * @param {Array} props The property identifiers to copy. * @param {Object} [object={}] The object to copy properties to. * @param {Function} [customizer] The function to customize copied values. * @returns {Object} Returns `object`. */ function copyObject(source, props, object, customizer) { var isNew = !object; object || (object = {}); var index = -1, length = props.length; while (++index < length) { var key = props[index]; var newValue = customizer ? customizer(object[key], source[key], key, object, source) : undefined; if (newValue === undefined) { newValue = source[key]; } if (isNew) { baseAssignValue(object, key, newValue); } else { assignValue(object, key, newValue); } } return object; } /** * Copies own symbols of `source` to `object`. * * @private * @param {Object} source The object to copy symbols from. * @param {Object} [object={}] The object to copy symbols to. * @returns {Object} Returns `object`. */ function copySymbols(source, object) { return copyObject(source, getSymbols(source), object); } /** * Copies own and inherited symbols of `source` to `object`. * * @private * @param {Object} source The object to copy symbols from. * @param {Object} [object={}] The object to copy symbols to. * @returns {Object} Returns `object`. */ function copySymbolsIn(source, object) { return copyObject(source, getSymbolsIn(source), object); } /** * Creates a function like `_.groupBy`. * * @private * @param {Function} setter The function to set accumulator values. * @param {Function} [initializer] The accumulator object initializer. * @returns {Function} Returns the new aggregator function. */ function createAggregator(setter, initializer) { return function(collection, iteratee) { var func = isArray(collection) ? arrayAggregator : baseAggregator, accumulator = initializer ? initializer() : {}; return func(collection, setter, getIteratee(iteratee, 2), accumulator); }; } /** * Creates a function like `_.assign`. * * @private * @param {Function} assigner The function to assign values. * @returns {Function} Returns the new assigner function. */ function createAssigner(assigner) { return baseRest(function(object, sources) { var index = -1, length = sources.length, customizer = length > 1 ? sources[length - 1] : undefined, guard = length > 2 ? sources[2] : undefined; customizer = (assigner.length > 3 && typeof customizer == 'function') ? (length--, customizer) : undefined; if (guard && isIterateeCall(sources[0], sources[1], guard)) { customizer = length < 3 ? undefined : customizer; length = 1; } object = Object(object); while (++index < length) { var source = sources[index]; if (source) { assigner(object, source, index, customizer); } } return object; }); } /** * Creates a `baseEach` or `baseEachRight` function. * * @private * @param {Function} eachFunc The function to iterate over a collection. * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Function} Returns the new base function. */ function createBaseEach(eachFunc, fromRight) { return function(collection, iteratee) { if (collection == null) { return collection; } if (!isArrayLike(collection)) { return eachFunc(collection, iteratee); } var length = collection.length, index = fromRight ? length : -1, iterable = Object(collection); while ((fromRight ? index-- : ++index < length)) { if (iteratee(iterable[index], index, iterable) === false) { break; } } return collection; }; } /** * Creates a base function for methods like `_.forIn` and `_.forOwn`. * * @private * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Function} Returns the new base function. */ function createBaseFor(fromRight) { return function(object, iteratee, keysFunc) { var index = -1, iterable = Object(object), props = keysFunc(object), length = props.length; while (length--) { var key = props[fromRight ? length : ++index]; if (iteratee(iterable[key], key, iterable) === false) { break; } } return object; }; } /** * Creates a function that wraps `func` to invoke it with the optional `this` * binding of `thisArg`. * * @private * @param {Function} func The function to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {*} [thisArg] The `this` binding of `func`. * @returns {Function} Returns the new wrapped function. */ function createBind(func, bitmask, thisArg) { var isBind = bitmask & WRAP_BIND_FLAG, Ctor = createCtor(func); function wrapper() { var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; return fn.apply(isBind ? thisArg : this, arguments); } return wrapper; } /** * Creates a function like `_.lowerFirst`. * * @private * @param {string} methodName The name of the `String` case method to use. * @returns {Function} Returns the new case function. */ function createCaseFirst(methodName) { return function(string) { string = toString(string); var strSymbols = hasUnicode(string) ? stringToArray(string) : undefined; var chr = strSymbols ? strSymbols[0] : string.charAt(0); var trailing = strSymbols ? castSlice(strSymbols, 1).join('') : string.slice(1); return chr[methodName]() + trailing; }; } /** * Creates a function like `_.camelCase`. * * @private * @param {Function} callback The function to combine each word. * @returns {Function} Returns the new compounder function. */ function createCompounder(callback) { return function(string) { return arrayReduce(words(deburr(string).replace(reApos, '')), callback, ''); }; } /** * Creates a function that produces an instance of `Ctor` regardless of * whether it was invoked as part of a `new` expression or by `call` or `apply`. * * @private * @param {Function} Ctor The constructor to wrap. * @returns {Function} Returns the new wrapped function. */ function createCtor(Ctor) { return function() { // Use a `switch` statement to work with class constructors. See // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist // for more details. var args = arguments; switch (args.length) { case 0: return new Ctor; case 1: return new Ctor(args[0]); case 2: return new Ctor(args[0], args[1]); case 3: return new Ctor(args[0], args[1], args[2]); case 4: return new Ctor(args[0], args[1], args[2], args[3]); case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); } var thisBinding = baseCreate(Ctor.prototype), result = Ctor.apply(thisBinding, args); // Mimic the constructor's `return` behavior. // See https://es5.github.io/#x13.2.2 for more details. return isObject(result) ? result : thisBinding; }; } /** * Creates a function that wraps `func` to enable currying. * * @private * @param {Function} func The function to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {number} arity The arity of `func`. * @returns {Function} Returns the new wrapped function. */ function createCurry(func, bitmask, arity) { var Ctor = createCtor(func); function wrapper() { var length = arguments.length, args = Array(length), index = length, placeholder = getHolder(wrapper); while (index--) { args[index] = arguments[index]; } var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) ? [] : replaceHolders(args, placeholder); length -= holders.length; if (length < arity) { return createRecurry( func, bitmask, createHybrid, wrapper.placeholder, undefined, args, holders, undefined, undefined, arity - length); } var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; return apply(fn, this, args); } return wrapper; } /** * Creates a `_.find` or `_.findLast` function. * * @private * @param {Function} findIndexFunc The function to find the collection index. * @returns {Function} Returns the new find function. */ function createFind(findIndexFunc) { return function(collection, predicate, fromIndex) { var iterable = Object(collection); if (!isArrayLike(collection)) { var iteratee = getIteratee(predicate, 3); collection = keys(collection); predicate = function(key) { return iteratee(iterable[key], key, iterable); }; } var index = findIndexFunc(collection, predicate, fromIndex); return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; }; } /** * Creates a `_.flow` or `_.flowRight` function. * * @private * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Function} Returns the new flow function. */ function createFlow(fromRight) { return flatRest(function(funcs) { var length = funcs.length, index = length, prereq = LodashWrapper.prototype.thru; if (fromRight) { funcs.reverse(); } while (index--) { var func = funcs[index]; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } if (prereq && !wrapper && getFuncName(func) == 'wrapper') { var wrapper = new LodashWrapper([], true); } } index = wrapper ? index : length; while (++index < length) { func = funcs[index]; var funcName = getFuncName(func), data = funcName == 'wrapper' ? getData(func) : undefined; if (data && isLaziable(data[0]) && data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && !data[4].length && data[9] == 1 ) { wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); } else { wrapper = (func.length == 1 && isLaziable(func)) ? wrapper[funcName]() : wrapper.thru(func); } } return function() { var args = arguments, value = args[0]; if (wrapper && args.length == 1 && isArray(value)) { return wrapper.plant(value).value(); } var index = 0, result = length ? funcs[index].apply(this, args) : value; while (++index < length) { result = funcs[index].call(this, result); } return result; }; }); } /** * Creates a function that wraps `func` to invoke it with optional `this` * binding of `thisArg`, partial application, and currying. * * @private * @param {Function|string} func The function or method name to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {*} [thisArg] The `this` binding of `func`. * @param {Array} [partials] The arguments to prepend to those provided to * the new function. * @param {Array} [holders] The `partials` placeholder indexes. * @param {Array} [partialsRight] The arguments to append to those provided * to the new function. * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. * @param {Array} [argPos] The argument positions of the new function. * @param {number} [ary] The arity cap of `func`. * @param {number} [arity] The arity of `func`. * @returns {Function} Returns the new wrapped function. */ function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { var isAry = bitmask & WRAP_ARY_FLAG, isBind = bitmask & WRAP_BIND_FLAG, isBindKey = bitmask & WRAP_BIND_KEY_FLAG, isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), isFlip = bitmask & WRAP_FLIP_FLAG, Ctor = isBindKey ? undefined : createCtor(func); function wrapper() { var length = arguments.length, args = Array(length), index = length; while (index--) { args[index] = arguments[index]; } if (isCurried) { var placeholder = getHolder(wrapper), holdersCount = countHolders(args, placeholder); } if (partials) { args = composeArgs(args, partials, holders, isCurried); } if (partialsRight) { args = composeArgsRight(args, partialsRight, holdersRight, isCurried); } length -= holdersCount; if (isCurried && length < arity) { var newHolders = replaceHolders(args, placeholder); return createRecurry( func, bitmask, createHybrid, wrapper.placeholder, thisArg, args, newHolders, argPos, ary, arity - length ); } var thisBinding = isBind ? thisArg : this, fn = isBindKey ? thisBinding[func] : func; length = args.length; if (argPos) { args = reorder(args, argPos); } else if (isFlip && length > 1) { args.reverse(); } if (isAry && ary < length) { args.length = ary; } if (this && this !== root && this instanceof wrapper) { fn = Ctor || createCtor(fn); } return fn.apply(thisBinding, args); } return wrapper; } /** * Creates a function like `_.invertBy`. * * @private * @param {Function} setter The function to set accumulator values. * @param {Function} toIteratee The function to resolve iteratees. * @returns {Function} Returns the new inverter function. */ function createInverter(setter, toIteratee) { return function(object, iteratee) { return baseInverter(object, setter, toIteratee(iteratee), {}); }; } /** * Creates a function that performs a mathematical operation on two values. * * @private * @param {Function} operator The function to perform the operation. * @param {number} [defaultValue] The value used for `undefined` arguments. * @returns {Function} Returns the new mathematical operation function. */ function createMathOperation(operator, defaultValue) { return function(value, other) { var result; if (value === undefined && other === undefined) { return defaultValue; } if (value !== undefined) { result = value; } if (other !== undefined) { if (result === undefined) { return other; } if (typeof value == 'string' || typeof other == 'string') { value = baseToString(value); other = baseToString(other); } else { value = baseToNumber(value); other = baseToNumber(other); } result = operator(value, other); } return result; }; } /** * Creates a function like `_.over`. * * @private * @param {Function} arrayFunc The function to iterate over iteratees. * @returns {Function} Returns the new over function. */ function createOver(arrayFunc) { return flatRest(function(iteratees) { iteratees = arrayMap(iteratees, baseUnary(getIteratee())); return baseRest(function(args) { var thisArg = this; return arrayFunc(iteratees, function(iteratee) { return apply(iteratee, thisArg, args); }); }); }); } /** * Creates the padding for `string` based on `length`. The `chars` string * is truncated if the number of characters exceeds `length`. * * @private * @param {number} length The padding length. * @param {string} [chars=' '] The string used as padding. * @returns {string} Returns the padding for `string`. */ function createPadding(length, chars) { chars = chars === undefined ? ' ' : baseToString(chars); var charsLength = chars.length; if (charsLength < 2) { return charsLength ? baseRepeat(chars, length) : chars; } var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); return hasUnicode(chars) ? castSlice(stringToArray(result), 0, length).join('') : result.slice(0, length); } /** * Creates a function that wraps `func` to invoke it with the `this` binding * of `thisArg` and `partials` prepended to the arguments it receives. * * @private * @param {Function} func The function to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {*} thisArg The `this` binding of `func`. * @param {Array} partials The arguments to prepend to those provided to * the new function. * @returns {Function} Returns the new wrapped function. */ function createPartial(func, bitmask, thisArg, partials) { var isBind = bitmask & WRAP_BIND_FLAG, Ctor = createCtor(func); function wrapper() { var argsIndex = -1, argsLength = arguments.length, leftIndex = -1, leftLength = partials.length, args = Array(leftLength + argsLength), fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; while (++leftIndex < leftLength) { args[leftIndex] = partials[leftIndex]; } while (argsLength--) { args[leftIndex++] = arguments[++argsIndex]; } return apply(fn, isBind ? thisArg : this, args); } return wrapper; } /** * Creates a `_.range` or `_.rangeRight` function. * * @private * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Function} Returns the new range function. */ function createRange(fromRight) { return function(start, end, step) { if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { end = step = undefined; } // Ensure the sign of `-0` is preserved. start = toFinite(start); if (end === undefined) { end = start; start = 0; } else { end = toFinite(end); } step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); return baseRange(start, end, step, fromRight); }; } /** * Creates a function that performs a relational operation on two values. * * @private * @param {Function} operator The function to perform the operation. * @returns {Function} Returns the new relational operation function. */ function createRelationalOperation(operator) { return function(value, other) { if (!(typeof value == 'string' && typeof other == 'string')) { value = toNumber(value); other = toNumber(other); } return operator(value, other); }; } /** * Creates a function that wraps `func` to continue currying. * * @private * @param {Function} func The function to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {Function} wrapFunc The function to create the `func` wrapper. * @param {*} placeholder The placeholder value. * @param {*} [thisArg] The `this` binding of `func`. * @param {Array} [partials] The arguments to prepend to those provided to * the new function. * @param {Array} [holders] The `partials` placeholder indexes. * @param {Array} [argPos] The argument positions of the new function. * @param {number} [ary] The arity cap of `func`. * @param {number} [arity] The arity of `func`. * @returns {Function} Returns the new wrapped function. */ function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { var isCurry = bitmask & WRAP_CURRY_FLAG, newHolders = isCurry ? holders : undefined, newHoldersRight = isCurry ? undefined : holders, newPartials = isCurry ? partials : undefined, newPartialsRight = isCurry ? undefined : partials; bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); } var newData = [ func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, newHoldersRight, argPos, ary, arity ]; var result = wrapFunc.apply(undefined, newData); if (isLaziable(func)) { setData(result, newData); } result.placeholder = placeholder; return setWrapToString(result, func, bitmask); } /** * Creates a function like `_.round`. * * @private * @param {string} methodName The name of the `Math` method to use when rounding. * @returns {Function} Returns the new round function. */ function createRound(methodName) { var func = Math[methodName]; return function(number, precision) { number = toNumber(number); precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); if (precision) { // Shift with exponential notation to avoid floating-point issues. // See [MDN](https://mdn.io/round#Examples) for more details. var pair = (toString(number) + 'e').split('e'), value = func(pair[0] + 'e' + (+pair[1] + precision)); pair = (toString(value) + 'e').split('e'); return +(pair[0] + 'e' + (+pair[1] - precision)); } return func(number); }; } /** * Creates a set object of `values`. * * @private * @param {Array} values The values to add to the set. * @returns {Object} Returns the new set. */ var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) { return new Set(values); }; /** * Creates a `_.toPairs` or `_.toPairsIn` function. * * @private * @param {Function} keysFunc The function to get the keys of a given object. * @returns {Function} Returns the new pairs function. */ function createToPairs(keysFunc) { return function(object) { var tag = getTag(object); if (tag == mapTag) { return mapToArray(object); } if (tag == setTag) { return setToPairs(object); } return baseToPairs(object, keysFunc(object)); }; } /** * Creates a function that either curries or invokes `func` with optional * `this` binding and partially applied arguments. * * @private * @param {Function|string} func The function or method name to wrap. * @param {number} bitmask The bitmask flags. * 1 - `_.bind` * 2 - `_.bindKey` * 4 - `_.curry` or `_.curryRight` of a bound function * 8 - `_.curry` * 16 - `_.curryRight` * 32 - `_.partial` * 64 - `_.partialRight` * 128 - `_.rearg` * 256 - `_.ary` * 512 - `_.flip` * @param {*} [thisArg] The `this` binding of `func`. * @param {Array} [partials] The arguments to be partially applied. * @param {Array} [holders] The `partials` placeholder indexes. * @param {Array} [argPos] The argument positions of the new function. * @param {number} [ary] The arity cap of `func`. * @param {number} [arity] The arity of `func`. * @returns {Function} Returns the new wrapped function. */ function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; if (!isBindKey && typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } var length = partials ? partials.length : 0; if (!length) { bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); partials = holders = undefined; } ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); arity = arity === undefined ? arity : toInteger(arity); length -= holders ? holders.length : 0; if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { var partialsRight = partials, holdersRight = holders; partials = holders = undefined; } var data = isBindKey ? undefined : getData(func); var newData = [ func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity ]; if (data) { mergeData(newData, data); } func = newData[0]; bitmask = newData[1]; thisArg = newData[2]; partials = newData[3]; holders = newData[4]; arity = newData[9] = newData[9] === undefined ? (isBindKey ? 0 : func.length) : nativeMax(newData[9] - length, 0); if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); } if (!bitmask || bitmask == WRAP_BIND_FLAG) { var result = createBind(func, bitmask, thisArg); } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { result = createCurry(func, bitmask, arity); } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { result = createPartial(func, bitmask, thisArg, partials); } else { result = createHybrid.apply(undefined, newData); } var setter = data ? baseSetData : setData; return setWrapToString(setter(result, newData), func, bitmask); } /** * Used by `_.defaults` to customize its `_.assignIn` use to assign properties * of source objects to the destination object for all destination properties * that resolve to `undefined`. * * @private * @param {*} objValue The destination value. * @param {*} srcValue The source value. * @param {string} key The key of the property to assign. * @param {Object} object The parent object of `objValue`. * @returns {*} Returns the value to assign. */ function customDefaultsAssignIn(objValue, srcValue, key, object) { if (objValue === undefined || (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { return srcValue; } return objValue; } /** * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source * objects into destination objects that are passed thru. * * @private * @param {*} objValue The destination value. * @param {*} srcValue The source value. * @param {string} key The key of the property to merge. * @param {Object} object The parent object of `objValue`. * @param {Object} source The parent object of `srcValue`. * @param {Object} [stack] Tracks traversed source values and their merged * counterparts. * @returns {*} Returns the value to assign. */ function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { if (isObject(objValue) && isObject(srcValue)) { // Recursively merge objects and arrays (susceptible to call stack limits). stack.set(srcValue, objValue); baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); stack['delete'](srcValue); } return objValue; } /** * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain * objects. * * @private * @param {*} value The value to inspect. * @param {string} key The key of the property to inspect. * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. */ function customOmitClone(value) { return isPlainObject(value) ? undefined : value; } /** * A specialized version of `baseIsEqualDeep` for arrays with support for * partial deep comparisons. * * @private * @param {Array} array The array to compare. * @param {Array} other The other array to compare. * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. * @param {Function} customizer The function to customize comparisons. * @param {Function} equalFunc The function to determine equivalents of values. * @param {Object} stack Tracks traversed `array` and `other` objects. * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. */ function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { var isPartial = bitmask & COMPARE_PARTIAL_FLAG, arrLength = array.length, othLength = other.length; if (arrLength != othLength && !(isPartial && othLength > arrLength)) { return false; } // Assume cyclic values are equal. var stacked = stack.get(array); if (stacked && stack.get(other)) { return stacked == other; } var index = -1, result = true, seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; stack.set(array, other); stack.set(other, array); // Ignore non-index properties. while (++index < arrLength) { var arrValue = array[index], othValue = other[index]; if (customizer) { var compared = isPartial ? customizer(othValue, arrValue, index, other, array, stack) : customizer(arrValue, othValue, index, array, other, stack); } if (compared !== undefined) { if (compared) { continue; } result = false; break; } // Recursively compare arrays (susceptible to call stack limits). if (seen) { if (!arraySome(other, function(othValue, othIndex) { if (!cacheHas(seen, othIndex) && (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { return seen.push(othIndex); } })) { result = false; break; } } else if (!( arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack) )) { result = false; break; } } stack['delete'](array); stack['delete'](other); return result; } /** * A specialized version of `baseIsEqualDeep` for comparing objects of * the same `toStringTag`. * * **Note:** This function only supports comparing values with tags of * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. * * @private * @param {Object} object The object to compare. * @param {Object} other The other object to compare. * @param {string} tag The `toStringTag` of the objects to compare. * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. * @param {Function} customizer The function to customize comparisons. * @param {Function} equalFunc The function to determine equivalents of values. * @param {Object} stack Tracks traversed `object` and `other` objects. * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { switch (tag) { case dataViewTag: if ((object.byteLength != other.byteLength) || (object.byteOffset != other.byteOffset)) { return false; } object = object.buffer; other = other.buffer; case arrayBufferTag: if ((object.byteLength != other.byteLength) || !equalFunc(new Uint8Array(object), new Uint8Array(other))) { return false; } return true; case boolTag: case dateTag: case numberTag: // Coerce booleans to `1` or `0` and dates to milliseconds. // Invalid dates are coerced to `NaN`. return eq(+object, +other); case errorTag: return object.name == other.name && object.message == other.message; case regexpTag: case stringTag: // Coerce regexes to strings and treat strings, primitives and objects, // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring // for more details. return object == (other + ''); case mapTag: var convert = mapToArray; case setTag: var isPartial = bitmask & COMPARE_PARTIAL_FLAG; convert || (convert = setToArray); if (object.size != other.size && !isPartial) { return false; } // Assume cyclic values are equal. var stacked = stack.get(object); if (stacked) { return stacked == other; } bitmask |= COMPARE_UNORDERED_FLAG; // Recursively compare objects (susceptible to call stack limits). stack.set(object, other); var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); stack['delete'](object); return result; case symbolTag: if (symbolValueOf) { return symbolValueOf.call(object) == symbolValueOf.call(other); } } return false; } /** * A specialized version of `baseIsEqualDeep` for objects with support for * partial deep comparisons. * * @private * @param {Object} object The object to compare. * @param {Object} other The other object to compare. * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. * @param {Function} customizer The function to customize comparisons. * @param {Function} equalFunc The function to determine equivalents of values. * @param {Object} stack Tracks traversed `object` and `other` objects. * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { var isPartial = bitmask & COMPARE_PARTIAL_FLAG, objProps = getAllKeys(object), objLength = objProps.length, othProps = getAllKeys(other), othLength = othProps.length; if (objLength != othLength && !isPartial) { return false; } var index = objLength; while (index--) { var key = objProps[index]; if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { return false; } } // Assume cyclic values are equal. var stacked = stack.get(object); if (stacked && stack.get(other)) { return stacked == other; } var result = true; stack.set(object, other); stack.set(other, object); var skipCtor = isPartial; while (++index < objLength) { key = objProps[index]; var objValue = object[key], othValue = other[key]; if (customizer) { var compared = isPartial ? customizer(othValue, objValue, key, other, object, stack) : customizer(objValue, othValue, key, object, other, stack); } // Recursively compare objects (susceptible to call stack limits). if (!(compared === undefined ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) : compared )) { result = false; break; } skipCtor || (skipCtor = key == 'constructor'); } if (result && !skipCtor) { var objCtor = object.constructor, othCtor = other.constructor; // Non `Object` object instances with different constructors are not equal. if (objCtor != othCtor && ('constructor' in object && 'constructor' in other) && !(typeof objCtor == 'function' && objCtor instanceof objCtor && typeof othCtor == 'function' && othCtor instanceof othCtor)) { result = false; } } stack['delete'](object); stack['delete'](other); return result; } /** * A specialized version of `baseRest` which flattens the rest array. * * @private * @param {Function} func The function to apply a rest parameter to. * @returns {Function} Returns the new function. */ function flatRest(func) { return setToString(overRest(func, undefined, flatten), func + ''); } /** * Creates an array of own enumerable property names and symbols of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names and symbols. */ function getAllKeys(object) { return baseGetAllKeys(object, keys, getSymbols); } /** * Creates an array of own and inherited enumerable property names and * symbols of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names and symbols. */ function getAllKeysIn(object) { return baseGetAllKeys(object, keysIn, getSymbolsIn); } /** * Gets metadata for `func`. * * @private * @param {Function} func The function to query. * @returns {*} Returns the metadata for `func`. */ var getData = !metaMap ? noop : function(func) { return metaMap.get(func); }; /** * Gets the name of `func`. * * @private * @param {Function} func The function to query. * @returns {string} Returns the function name. */ function getFuncName(func) { var result = (func.name + ''), array = realNames[result], length = hasOwnProperty.call(realNames, result) ? array.length : 0; while (length--) { var data = array[length], otherFunc = data.func; if (otherFunc == null || otherFunc == func) { return data.name; } } return result; } /** * Gets the argument placeholder value for `func`. * * @private * @param {Function} func The function to inspect. * @returns {*} Returns the placeholder value. */ function getHolder(func) { var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; return object.placeholder; } /** * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, * this function returns the custom method, otherwise it returns `baseIteratee`. * If arguments are provided, the chosen function is invoked with them and * its result is returned. * * @private * @param {*} [value] The value to convert to an iteratee. * @param {number} [arity] The arity of the created iteratee. * @returns {Function} Returns the chosen function or its result. */ function getIteratee() { var result = lodash.iteratee || iteratee; result = result === iteratee ? baseIteratee : result; return arguments.length ? result(arguments[0], arguments[1]) : result; } /** * Gets the data for `map`. * * @private * @param {Object} map The map to query. * @param {string} key The reference key. * @returns {*} Returns the map data. */ function getMapData(map, key) { var data = map.__data__; return isKeyable(key) ? data[typeof key == 'string' ? 'string' : 'hash'] : data.map; } /** * Gets the property names, values, and compare flags of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the match data of `object`. */ function getMatchData(object) { var result = keys(object), length = result.length; while (length--) { var key = result[length], value = object[key]; result[length] = [key, value, isStrictComparable(value)]; } return result; } /** * Gets the native function at `key` of `object`. * * @private * @param {Object} object The object to query. * @param {string} key The key of the method to get. * @returns {*} Returns the function if it's native, else `undefined`. */ function getNative(object, key) { var value = getValue(object, key); return baseIsNative(value) ? value : undefined; } /** * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. * * @private * @param {*} value The value to query. * @returns {string} Returns the raw `toStringTag`. */ function getRawTag(value) { var isOwn = hasOwnProperty.call(value, symToStringTag), tag = value[symToStringTag]; try { value[symToStringTag] = undefined; var unmasked = true; } catch (e) {} var result = nativeObjectToString.call(value); if (unmasked) { if (isOwn) { value[symToStringTag] = tag; } else { delete value[symToStringTag]; } } return result; } /** * Creates an array of the own enumerable symbols of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of symbols. */ var getSymbols = !nativeGetSymbols ? stubArray : function(object) { if (object == null) { return []; } object = Object(object); return arrayFilter(nativeGetSymbols(object), function(symbol) { return propertyIsEnumerable.call(object, symbol); }); }; /** * Creates an array of the own and inherited enumerable symbols of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of symbols. */ var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) { var result = []; while (object) { arrayPush(result, getSymbols(object)); object = getPrototype(object); } return result; }; /** * Gets the `toStringTag` of `value`. * * @private * @param {*} value The value to query. * @returns {string} Returns the `toStringTag`. */ var getTag = baseGetTag; // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || (Map && getTag(new Map) != mapTag) || (Promise && getTag(Promise.resolve()) != promiseTag) || (Set && getTag(new Set) != setTag) || (WeakMap && getTag(new WeakMap) != weakMapTag)) { getTag = function(value) { var result = baseGetTag(value), Ctor = result == objectTag ? value.constructor : undefined, ctorString = Ctor ? toSource(Ctor) : ''; if (ctorString) { switch (ctorString) { case dataViewCtorString: return dataViewTag; case mapCtorString: return mapTag; case promiseCtorString: return promiseTag; case setCtorString: return setTag; case weakMapCtorString: return weakMapTag; } } return result; }; } /** * Gets the view, applying any `transforms` to the `start` and `end` positions. * * @private * @param {number} start The start of the view. * @param {number} end The end of the view. * @param {Array} transforms The transformations to apply to the view. * @returns {Object} Returns an object containing the `start` and `end` * positions of the view. */ function getView(start, end, transforms) { var index = -1, length = transforms.length; while (++index < length) { var data = transforms[index], size = data.size; switch (data.type) { case 'drop': start += size; break; case 'dropRight': end -= size; break; case 'take': end = nativeMin(end, start + size); break; case 'takeRight': start = nativeMax(start, end - size); break; } } return { 'start': start, 'end': end }; } /** * Extracts wrapper details from the `source` body comment. * * @private * @param {string} source The source to inspect. * @returns {Array} Returns the wrapper details. */ function getWrapDetails(source) { var match = source.match(reWrapDetails); return match ? match[1].split(reSplitDetails) : []; } /** * Checks if `path` exists on `object`. * * @private * @param {Object} object The object to query. * @param {Array|string} path The path to check. * @param {Function} hasFunc The function to check properties. * @returns {boolean} Returns `true` if `path` exists, else `false`. */ function hasPath(object, path, hasFunc) { path = castPath(path, object); var index = -1, length = path.length, result = false; while (++index < length) { var key = toKey(path[index]); if (!(result = object != null && hasFunc(object, key))) { break; } object = object[key]; } if (result || ++index != length) { return result; } length = object == null ? 0 : object.length; return !!length && isLength(length) && isIndex(key, length) && (isArray(object) || isArguments(object)); } /** * Initializes an array clone. * * @private * @param {Array} array The array to clone. * @returns {Array} Returns the initialized clone. */ function initCloneArray(array) { var length = array.length, result = new array.constructor(length); // Add properties assigned by `RegExp#exec`. if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { result.index = array.index; result.input = array.input; } return result; } /** * Initializes an object clone. * * @private * @param {Object} object The object to clone. * @returns {Object} Returns the initialized clone. */ function initCloneObject(object) { return (typeof object.constructor == 'function' && !isPrototype(object)) ? baseCreate(getPrototype(object)) : {}; } /** * Initializes an object clone based on its `toStringTag`. * * **Note:** This function only supports cloning values with tags of * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`. * * @private * @param {Object} object The object to clone. * @param {string} tag The `toStringTag` of the object to clone. * @param {boolean} [isDeep] Specify a deep clone. * @returns {Object} Returns the initialized clone. */ function initCloneByTag(object, tag, isDeep) { var Ctor = object.constructor; switch (tag) { case arrayBufferTag: return cloneArrayBuffer(object); case boolTag: case dateTag: return new Ctor(+object); case dataViewTag: return cloneDataView(object, isDeep); case float32Tag: case float64Tag: case int8Tag: case int16Tag: case int32Tag: case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: return cloneTypedArray(object, isDeep); case mapTag: return new Ctor; case numberTag: case stringTag: return new Ctor(object); case regexpTag: return cloneRegExp(object); case setTag: return new Ctor; case symbolTag: return cloneSymbol(object); } } /** * Inserts wrapper `details` in a comment at the top of the `source` body. * * @private * @param {string} source The source to modify. * @returns {Array} details The details to insert. * @returns {string} Returns the modified source. */ function insertWrapDetails(source, details) { var length = details.length; if (!length) { return source; } var lastIndex = length - 1; details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex]; details = details.join(length > 2 ? ', ' : ' '); return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); } /** * Checks if `value` is a flattenable `arguments` object or array. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. */ function isFlattenable(value) { return isArray(value) || isArguments(value) || !!(spreadableSymbol && value && value[spreadableSymbol]); } /** * Checks if `value` is a valid array-like index. * * @private * @param {*} value The value to check. * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. */ function isIndex(value, length) { var type = typeof value; length = length == null ? MAX_SAFE_INTEGER : length; return !!length && (type == 'number' || (type != 'symbol' && reIsUint.test(value))) && (value > -1 && value % 1 == 0 && value < length); } /** * Checks if the given arguments are from an iteratee call. * * @private * @param {*} value The potential iteratee value argument. * @param {*} index The potential iteratee index or key argument. * @param {*} object The potential iteratee object argument. * @returns {boolean} Returns `true` if the arguments are from an iteratee call, * else `false`. */ function isIterateeCall(value, index, object) { if (!isObject(object)) { return false; } var type = typeof index; if (type == 'number' ? (isArrayLike(object) && isIndex(index, object.length)) : (type == 'string' && index in object) ) { return eq(object[index], value); } return false; } /** * Checks if `value` is a property name and not a property path. * * @private * @param {*} value The value to check. * @param {Object} [object] The object to query keys on. * @returns {boolean} Returns `true` if `value` is a property name, else `false`. */ function isKey(value, object) { if (isArray(value)) { return false; } var type = typeof value; if (type == 'number' || type == 'symbol' || type == 'boolean' || value == null || isSymbol(value)) { return true; } return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || (object != null && value in Object(object)); } /** * Checks if `value` is suitable for use as unique object key. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is suitable, else `false`. */ function isKeyable(value) { var type = typeof value; return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') ? (value !== '__proto__') : (value === null); } /** * Checks if `func` has a lazy counterpart. * * @private * @param {Function} func The function to check. * @returns {boolean} Returns `true` if `func` has a lazy counterpart, * else `false`. */ function isLaziable(func) { var funcName = getFuncName(func), other = lodash[funcName]; if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { return false; } if (func === other) { return true; } var data = getData(other); return !!data && func === data[0]; } /** * Checks if `func` has its source masked. * * @private * @param {Function} func The function to check. * @returns {boolean} Returns `true` if `func` is masked, else `false`. */ function isMasked(func) { return !!maskSrcKey && (maskSrcKey in func); } /** * Checks if `func` is capable of being masked. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `func` is maskable, else `false`. */ var isMaskable = coreJsData ? isFunction : stubFalse; /** * Checks if `value` is likely a prototype object. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. */ function isPrototype(value) { var Ctor = value && value.constructor, proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; return value === proto; } /** * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` if suitable for strict * equality comparisons, else `false`. */ function isStrictComparable(value) { return value === value && !isObject(value); } /** * A specialized version of `matchesProperty` for source values suitable * for strict equality comparisons, i.e. `===`. * * @private * @param {string} key The key of the property to get. * @param {*} srcValue The value to match. * @returns {Function} Returns the new spec function. */ function matchesStrictComparable(key, srcValue) { return function(object) { if (object == null) { return false; } return object[key] === srcValue && (srcValue !== undefined || (key in Object(object))); }; } /** * A specialized version of `_.memoize` which clears the memoized function's * cache when it exceeds `MAX_MEMOIZE_SIZE`. * * @private * @param {Function} func The function to have its output memoized. * @returns {Function} Returns the new memoized function. */ function memoizeCapped(func) { var result = memoize(func, function(key) { if (cache.size === MAX_MEMOIZE_SIZE) { cache.clear(); } return key; }); var cache = result.cache; return result; } /** * Merges the function metadata of `source` into `data`. * * Merging metadata reduces the number of wrappers used to invoke a function. * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` * may be applied regardless of execution order. Methods like `_.ary` and * `_.rearg` modify function arguments, making the order in which they are * executed important, preventing the merging of metadata. However, we make * an exception for a safe combined case where curried functions have `_.ary` * and or `_.rearg` applied. * * @private * @param {Array} data The destination metadata. * @param {Array} source The source metadata. * @returns {Array} Returns `data`. */ function mergeData(data, source) { var bitmask = data[1], srcBitmask = source[1], newBitmask = bitmask | srcBitmask, isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); var isCombo = ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); // Exit early if metadata can't be merged. if (!(isCommon || isCombo)) { return data; } // Use source `thisArg` if available. if (srcBitmask & WRAP_BIND_FLAG) { data[2] = source[2]; // Set when currying a bound function. newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; } // Compose partial arguments. var value = source[3]; if (value) { var partials = data[3]; data[3] = partials ? composeArgs(partials, value, source[4]) : value; data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; } // Compose partial right arguments. value = source[5]; if (value) { partials = data[5]; data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; } // Use source `argPos` if available. value = source[7]; if (value) { data[7] = value; } // Use source `ary` if it's smaller. if (srcBitmask & WRAP_ARY_FLAG) { data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); } // Use source `arity` if one is not provided. if (data[9] == null) { data[9] = source[9]; } // Use source `func` and merge bitmasks. data[0] = source[0]; data[1] = newBitmask; return data; } /** * This function is like * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) * except that it includes inherited enumerable properties. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. */ function nativeKeysIn(object) { var result = []; if (object != null) { for (var key in Object(object)) { result.push(key); } } return result; } /** * Converts `value` to a string using `Object.prototype.toString`. * * @private * @param {*} value The value to convert. * @returns {string} Returns the converted string. */ function objectToString(value) { return nativeObjectToString.call(value); } /** * A specialized version of `baseRest` which transforms the rest array. * * @private * @param {Function} func The function to apply a rest parameter to. * @param {number} [start=func.length-1] The start position of the rest parameter. * @param {Function} transform The rest array transform. * @returns {Function} Returns the new function. */ function overRest(func, start, transform) { start = nativeMax(start === undefined ? (func.length - 1) : start, 0); return function() { var args = arguments, index = -1, length = nativeMax(args.length - start, 0), array = Array(length); while (++index < length) { array[index] = args[start + index]; } index = -1; var otherArgs = Array(start + 1); while (++index < start) { otherArgs[index] = args[index]; } otherArgs[start] = transform(array); return apply(func, this, otherArgs); }; } /** * Gets the parent value at `path` of `object`. * * @private * @param {Object} object The object to query. * @param {Array} path The path to get the parent value of. * @returns {*} Returns the parent value. */ function parent(object, path) { return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); } /** * Reorder `array` according to the specified indexes where the element at * the first index is assigned as the first element, the element at * the second index is assigned as the second element, and so on. * * @private * @param {Array} array The array to reorder. * @param {Array} indexes The arranged array indexes. * @returns {Array} Returns `array`. */ function reorder(array, indexes) { var arrLength = array.length, length = nativeMin(indexes.length, arrLength), oldArray = copyArray(array); while (length--) { var index = indexes[length]; array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; } return array; } /** * Sets metadata for `func`. * * **Note:** If this function becomes hot, i.e. is invoked a lot in a short * period of time, it will trip its breaker and transition to an identity * function to avoid garbage collection pauses in V8. See * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) * for more details. * * @private * @param {Function} func The function to associate metadata with. * @param {*} data The metadata. * @returns {Function} Returns `func`. */ var setData = shortOut(baseSetData); /** * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). * * @private * @param {Function} func The function to delay. * @param {number} wait The number of milliseconds to delay invocation. * @returns {number|Object} Returns the timer id or timeout object. */ var setTimeout = ctxSetTimeout || function(func, wait) { return root.setTimeout(func, wait); }; /** * Sets the `toString` method of `func` to return `string`. * * @private * @param {Function} func The function to modify. * @param {Function} string The `toString` result. * @returns {Function} Returns `func`. */ var setToString = shortOut(baseSetToString); /** * Sets the `toString` method of `wrapper` to mimic the source of `reference` * with wrapper details in a comment at the top of the source body. * * @private * @param {Function} wrapper The function to modify. * @param {Function} reference The reference function. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @returns {Function} Returns `wrapper`. */ function setWrapToString(wrapper, reference, bitmask) { var source = (reference + ''); return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); } /** * Creates a function that'll short out and invoke `identity` instead * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` * milliseconds. * * @private * @param {Function} func The function to restrict. * @returns {Function} Returns the new shortable function. */ function shortOut(func) { var count = 0, lastCalled = 0; return function() { var stamp = nativeNow(), remaining = HOT_SPAN - (stamp - lastCalled); lastCalled = stamp; if (remaining > 0) { if (++count >= HOT_COUNT) { return arguments[0]; } } else { count = 0; } return func.apply(undefined, arguments); }; } /** * A specialized version of `_.shuffle` which mutates and sets the size of `array`. * * @private * @param {Array} array The array to shuffle. * @param {number} [size=array.length] The size of `array`. * @returns {Array} Returns `array`. */ function shuffleSelf(array, size) { var index = -1, length = array.length, lastIndex = length - 1; size = size === undefined ? length : size; while (++index < size) { var rand = baseRandom(index, lastIndex), value = array[rand]; array[rand] = array[index]; array[index] = value; } array.length = size; return array; } /** * Converts `string` to a property path array. * * @private * @param {string} string The string to convert. * @returns {Array} Returns the property path array. */ var stringToPath = memoizeCapped(function(string) { var result = []; if (string.charCodeAt(0) === 46 /* . */) { result.push(''); } string.replace(rePropName, function(match, number, quote, subString) { result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match)); }); return result; }); /** * Converts `value` to a string key if it's not a string or symbol. * * @private * @param {*} value The value to inspect. * @returns {string|symbol} Returns the key. */ function toKey(value) { if (typeof value == 'string' || isSymbol(value)) { return value; } var result = (value + ''); return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; } /** * Converts `func` to its source code. * * @private * @param {Function} func The function to convert. * @returns {string} Returns the source code. */ function toSource(func) { if (func != null) { try { return funcToString.call(func); } catch (e) {} try { return (func + ''); } catch (e) {} } return ''; } /** * Updates wrapper `details` based on `bitmask` flags. * * @private * @returns {Array} details The details to modify. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @returns {Array} Returns `details`. */ function updateWrapDetails(details, bitmask) { arrayEach(wrapFlags, function(pair) { var value = '_.' + pair[0]; if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { details.push(value); } }); return details.sort(); } /** * Creates a clone of `wrapper`. * * @private * @param {Object} wrapper The wrapper to clone. * @returns {Object} Returns the cloned wrapper. */ function wrapperClone(wrapper) { if (wrapper instanceof LazyWrapper) { return wrapper.clone(); } var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); result.__actions__ = copyArray(wrapper.__actions__); result.__index__ = wrapper.__index__; result.__values__ = wrapper.__values__; return result; } /*------------------------------------------------------------------------*/ /** * Creates an array of elements split into groups the length of `size`. * If `array` can't be split evenly, the final chunk will be the remaining * elements. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to process. * @param {number} [size=1] The length of each chunk * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the new array of chunks. * @example * * _.chunk(['a', 'b', 'c', 'd'], 2); * // => [['a', 'b'], ['c', 'd']] * * _.chunk(['a', 'b', 'c', 'd'], 3); * // => [['a', 'b', 'c'], ['d']] */ function chunk(array, size, guard) { if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { size = 1; } else { size = nativeMax(toInteger(size), 0); } var length = array == null ? 0 : array.length; if (!length || size < 1) { return []; } var index = 0, resIndex = 0, result = Array(nativeCeil(length / size)); while (index < length) { result[resIndex++] = baseSlice(array, index, (index += size)); } return result; } /** * Creates an array with all falsey values removed. The values `false`, `null`, * `0`, `""`, `undefined`, and `NaN` are falsey. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to compact. * @returns {Array} Returns the new array of filtered values. * @example * * _.compact([0, 1, false, 2, '', 3]); * // => [1, 2, 3] */ function compact(array) { var index = -1, length = array == null ? 0 : array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index]; if (value) { result[resIndex++] = value; } } return result; } /** * Creates a new array concatenating `array` with any additional arrays * and/or values. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to concatenate. * @param {...*} [values] The values to concatenate. * @returns {Array} Returns the new concatenated array. * @example * * var array = [1]; * var other = _.concat(array, 2, [3], [[4]]); * * console.log(other); * // => [1, 2, 3, [4]] * * console.log(array); * // => [1] */ function concat() { var length = arguments.length; if (!length) { return []; } var args = Array(length - 1), array = arguments[0], index = length; while (index--) { args[index - 1] = arguments[index]; } return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); } /** * Creates an array of `array` values not included in the other given arrays * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. The order and references of result values are * determined by the first array. * * **Note:** Unlike `_.pullAll`, this method returns a new array. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @param {...Array} [values] The values to exclude. * @returns {Array} Returns the new array of filtered values. * @see _.without, _.xor * @example * * _.difference([2, 1], [2, 3]); * // => [1] */ var difference = baseRest(function(array, values) { return isArrayLikeObject(array) ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) : []; }); /** * This method is like `_.difference` except that it accepts `iteratee` which * is invoked for each element of `array` and `values` to generate the criterion * by which they're compared. The order and references of result values are * determined by the first array. The iteratee is invoked with one argument: * (value). * * **Note:** Unlike `_.pullAllBy`, this method returns a new array. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {...Array} [values] The values to exclude. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new array of filtered values. * @example * * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); * // => [1.2] * * // The `_.property` iteratee shorthand. * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); * // => [{ 'x': 2 }] */ var differenceBy = baseRest(function(array, values) { var iteratee = last(values); if (isArrayLikeObject(iteratee)) { iteratee = undefined; } return isArrayLikeObject(array) ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) : []; }); /** * This method is like `_.difference` except that it accepts `comparator` * which is invoked to compare elements of `array` to `values`. The order and * references of result values are determined by the first array. The comparator * is invoked with two arguments: (arrVal, othVal). * * **Note:** Unlike `_.pullAllWith`, this method returns a new array. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {...Array} [values] The values to exclude. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of filtered values. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); * // => [{ 'x': 2, 'y': 1 }] */ var differenceWith = baseRest(function(array, values) { var comparator = last(values); if (isArrayLikeObject(comparator)) { comparator = undefined; } return isArrayLikeObject(array) ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) : []; }); /** * Creates a slice of `array` with `n` elements dropped from the beginning. * * @static * @memberOf _ * @since 0.5.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=1] The number of elements to drop. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the slice of `array`. * @example * * _.drop([1, 2, 3]); * // => [2, 3] * * _.drop([1, 2, 3], 2); * // => [3] * * _.drop([1, 2, 3], 5); * // => [] * * _.drop([1, 2, 3], 0); * // => [1, 2, 3] */ function drop(array, n, guard) { var length = array == null ? 0 : array.length; if (!length) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); return baseSlice(array, n < 0 ? 0 : n, length); } /** * Creates a slice of `array` with `n` elements dropped from the end. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=1] The number of elements to drop. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the slice of `array`. * @example * * _.dropRight([1, 2, 3]); * // => [1, 2] * * _.dropRight([1, 2, 3], 2); * // => [1] * * _.dropRight([1, 2, 3], 5); * // => [] * * _.dropRight([1, 2, 3], 0); * // => [1, 2, 3] */ function dropRight(array, n, guard) { var length = array == null ? 0 : array.length; if (!length) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); n = length - n; return baseSlice(array, 0, n < 0 ? 0 : n); } /** * Creates a slice of `array` excluding elements dropped from the end. * Elements are dropped until `predicate` returns falsey. The predicate is * invoked with three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the slice of `array`. * @example * * var users = [ * { 'user': 'barney', 'active': true }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': false } * ]; * * _.dropRightWhile(users, function(o) { return !o.active; }); * // => objects for ['barney'] * * // The `_.matches` iteratee shorthand. * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); * // => objects for ['barney', 'fred'] * * // The `_.matchesProperty` iteratee shorthand. * _.dropRightWhile(users, ['active', false]); * // => objects for ['barney'] * * // The `_.property` iteratee shorthand. * _.dropRightWhile(users, 'active'); * // => objects for ['barney', 'fred', 'pebbles'] */ function dropRightWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3), true, true) : []; } /** * Creates a slice of `array` excluding elements dropped from the beginning. * Elements are dropped until `predicate` returns falsey. The predicate is * invoked with three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the slice of `array`. * @example * * var users = [ * { 'user': 'barney', 'active': false }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': true } * ]; * * _.dropWhile(users, function(o) { return !o.active; }); * // => objects for ['pebbles'] * * // The `_.matches` iteratee shorthand. * _.dropWhile(users, { 'user': 'barney', 'active': false }); * // => objects for ['fred', 'pebbles'] * * // The `_.matchesProperty` iteratee shorthand. * _.dropWhile(users, ['active', false]); * // => objects for ['pebbles'] * * // The `_.property` iteratee shorthand. * _.dropWhile(users, 'active'); * // => objects for ['barney', 'fred', 'pebbles'] */ function dropWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3), true) : []; } /** * Fills elements of `array` with `value` from `start` up to, but not * including, `end`. * * **Note:** This method mutates `array`. * * @static * @memberOf _ * @since 3.2.0 * @category Array * @param {Array} array The array to fill. * @param {*} value The value to fill `array` with. * @param {number} [start=0] The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns `array`. * @example * * var array = [1, 2, 3]; * * _.fill(array, 'a'); * console.log(array); * // => ['a', 'a', 'a'] * * _.fill(Array(3), 2); * // => [2, 2, 2] * * _.fill([4, 6, 8, 10], '*', 1, 3); * // => [4, '*', '*', 10] */ function fill(array, value, start, end) { var length = array == null ? 0 : array.length; if (!length) { return []; } if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { start = 0; end = length; } return baseFill(array, value, start, end); } /** * This method is like `_.find` except that it returns the index of the first * element `predicate` returns truthy for instead of the element itself. * * @static * @memberOf _ * @since 1.1.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param {number} [fromIndex=0] The index to search from. * @returns {number} Returns the index of the found element, else `-1`. * @example * * var users = [ * { 'user': 'barney', 'active': false }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': true } * ]; * * _.findIndex(users, function(o) { return o.user == 'barney'; }); * // => 0 * * // The `_.matches` iteratee shorthand. * _.findIndex(users, { 'user': 'fred', 'active': false }); * // => 1 * * // The `_.matchesProperty` iteratee shorthand. * _.findIndex(users, ['active', false]); * // => 0 * * // The `_.property` iteratee shorthand. * _.findIndex(users, 'active'); * // => 2 */ function findIndex(array, predicate, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = fromIndex == null ? 0 : toInteger(fromIndex); if (index < 0) { index = nativeMax(length + index, 0); } return baseFindIndex(array, getIteratee(predicate, 3), index); } /** * This method is like `_.findIndex` except that it iterates over elements * of `collection` from right to left. * * @static * @memberOf _ * @since 2.0.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param {number} [fromIndex=array.length-1] The index to search from. * @returns {number} Returns the index of the found element, else `-1`. * @example * * var users = [ * { 'user': 'barney', 'active': true }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': false } * ]; * * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); * // => 2 * * // The `_.matches` iteratee shorthand. * _.findLastIndex(users, { 'user': 'barney', 'active': true }); * // => 0 * * // The `_.matchesProperty` iteratee shorthand. * _.findLastIndex(users, ['active', false]); * // => 2 * * // The `_.property` iteratee shorthand. * _.findLastIndex(users, 'active'); * // => 0 */ function findLastIndex(array, predicate, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = length - 1; if (fromIndex !== undefined) { index = toInteger(fromIndex); index = fromIndex < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); } return baseFindIndex(array, getIteratee(predicate, 3), index, true); } /** * Flattens `array` a single level deep. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to flatten. * @returns {Array} Returns the new flattened array. * @example * * _.flatten([1, [2, [3, [4]], 5]]); * // => [1, 2, [3, [4]], 5] */ function flatten(array) { var length = array == null ? 0 : array.length; return length ? baseFlatten(array, 1) : []; } /** * Recursively flattens `array`. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to flatten. * @returns {Array} Returns the new flattened array. * @example * * _.flattenDeep([1, [2, [3, [4]], 5]]); * // => [1, 2, 3, 4, 5] */ function flattenDeep(array) { var length = array == null ? 0 : array.length; return length ? baseFlatten(array, INFINITY) : []; } /** * Recursively flatten `array` up to `depth` times. * * @static * @memberOf _ * @since 4.4.0 * @category Array * @param {Array} array The array to flatten. * @param {number} [depth=1] The maximum recursion depth. * @returns {Array} Returns the new flattened array. * @example * * var array = [1, [2, [3, [4]], 5]]; * * _.flattenDepth(array, 1); * // => [1, 2, [3, [4]], 5] * * _.flattenDepth(array, 2); * // => [1, 2, 3, [4], 5] */ function flattenDepth(array, depth) { var length = array == null ? 0 : array.length; if (!length) { return []; } depth = depth === undefined ? 1 : toInteger(depth); return baseFlatten(array, depth); } /** * The inverse of `_.toPairs`; this method returns an object composed * from key-value `pairs`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} pairs The key-value pairs. * @returns {Object} Returns the new object. * @example * * _.fromPairs([['a', 1], ['b', 2]]); * // => { 'a': 1, 'b': 2 } */ function fromPairs(pairs) { var index = -1, length = pairs == null ? 0 : pairs.length, result = {}; while (++index < length) { var pair = pairs[index]; result[pair[0]] = pair[1]; } return result; } /** * Gets the first element of `array`. * * @static * @memberOf _ * @since 0.1.0 * @alias first * @category Array * @param {Array} array The array to query. * @returns {*} Returns the first element of `array`. * @example * * _.head([1, 2, 3]); * // => 1 * * _.head([]); * // => undefined */ function head(array) { return (array && array.length) ? array[0] : undefined; } /** * Gets the index at which the first occurrence of `value` is found in `array` * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. If `fromIndex` is negative, it's used as the * offset from the end of `array`. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} [fromIndex=0] The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. * @example * * _.indexOf([1, 2, 1, 2], 2); * // => 1 * * // Search from the `fromIndex`. * _.indexOf([1, 2, 1, 2], 2, 2); * // => 3 */ function indexOf(array, value, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = fromIndex == null ? 0 : toInteger(fromIndex); if (index < 0) { index = nativeMax(length + index, 0); } return baseIndexOf(array, value, index); } /** * Gets all but the last element of `array`. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to query. * @returns {Array} Returns the slice of `array`. * @example * * _.initial([1, 2, 3]); * // => [1, 2] */ function initial(array) { var length = array == null ? 0 : array.length; return length ? baseSlice(array, 0, -1) : []; } /** * Creates an array of unique values that are included in all given arrays * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. The order and references of result values are * determined by the first array. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @returns {Array} Returns the new array of intersecting values. * @example * * _.intersection([2, 1], [2, 3]); * // => [2] */ var intersection = baseRest(function(arrays) { var mapped = arrayMap(arrays, castArrayLikeObject); return (mapped.length && mapped[0] === arrays[0]) ? baseIntersection(mapped) : []; }); /** * This method is like `_.intersection` except that it accepts `iteratee` * which is invoked for each element of each `arrays` to generate the criterion * by which they're compared. The order and references of result values are * determined by the first array. The iteratee is invoked with one argument: * (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new array of intersecting values. * @example * * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); * // => [2.1] * * // The `_.property` iteratee shorthand. * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); * // => [{ 'x': 1 }] */ var intersectionBy = baseRest(function(arrays) { var iteratee = last(arrays), mapped = arrayMap(arrays, castArrayLikeObject); if (iteratee === last(mapped)) { iteratee = undefined; } else { mapped.pop(); } return (mapped.length && mapped[0] === arrays[0]) ? baseIntersection(mapped, getIteratee(iteratee, 2)) : []; }); /** * This method is like `_.intersection` except that it accepts `comparator` * which is invoked to compare elements of `arrays`. The order and references * of result values are determined by the first array. The comparator is * invoked with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of intersecting values. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * * _.intersectionWith(objects, others, _.isEqual); * // => [{ 'x': 1, 'y': 2 }] */ var intersectionWith = baseRest(function(arrays) { var comparator = last(arrays), mapped = arrayMap(arrays, castArrayLikeObject); comparator = typeof comparator == 'function' ? comparator : undefined; if (comparator) { mapped.pop(); } return (mapped.length && mapped[0] === arrays[0]) ? baseIntersection(mapped, undefined, comparator) : []; }); /** * Converts all elements in `array` into a string separated by `separator`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to convert. * @param {string} [separator=','] The element separator. * @returns {string} Returns the joined string. * @example * * _.join(['a', 'b', 'c'], '~'); * // => 'a~b~c' */ function join(array, separator) { return array == null ? '' : nativeJoin.call(array, separator); } /** * Gets the last element of `array`. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to query. * @returns {*} Returns the last element of `array`. * @example * * _.last([1, 2, 3]); * // => 3 */ function last(array) { var length = array == null ? 0 : array.length; return length ? array[length - 1] : undefined; } /** * This method is like `_.indexOf` except that it iterates over elements of * `array` from right to left. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} [fromIndex=array.length-1] The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. * @example * * _.lastIndexOf([1, 2, 1, 2], 2); * // => 3 * * // Search from the `fromIndex`. * _.lastIndexOf([1, 2, 1, 2], 2, 2); * // => 1 */ function lastIndexOf(array, value, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = length; if (fromIndex !== undefined) { index = toInteger(fromIndex); index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); } return value === value ? strictLastIndexOf(array, value, index) : baseFindIndex(array, baseIsNaN, index, true); } /** * Gets the element at index `n` of `array`. If `n` is negative, the nth * element from the end is returned. * * @static * @memberOf _ * @since 4.11.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=0] The index of the element to return. * @returns {*} Returns the nth element of `array`. * @example * * var array = ['a', 'b', 'c', 'd']; * * _.nth(array, 1); * // => 'b' * * _.nth(array, -2); * // => 'c'; */ function nth(array, n) { return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; } /** * Removes all given values from `array` using * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. * * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` * to remove elements from an array by predicate. * * @static * @memberOf _ * @since 2.0.0 * @category Array * @param {Array} array The array to modify. * @param {...*} [values] The values to remove. * @returns {Array} Returns `array`. * @example * * var array = ['a', 'b', 'c', 'a', 'b', 'c']; * * _.pull(array, 'a', 'c'); * console.log(array); * // => ['b', 'b'] */ var pull = baseRest(pullAll); /** * This method is like `_.pull` except that it accepts an array of values to remove. * * **Note:** Unlike `_.difference`, this method mutates `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to modify. * @param {Array} values The values to remove. * @returns {Array} Returns `array`. * @example * * var array = ['a', 'b', 'c', 'a', 'b', 'c']; * * _.pullAll(array, ['a', 'c']); * console.log(array); * // => ['b', 'b'] */ function pullAll(array, values) { return (array && array.length && values && values.length) ? basePullAll(array, values) : array; } /** * This method is like `_.pullAll` except that it accepts `iteratee` which is * invoked for each element of `array` and `values` to generate the criterion * by which they're compared. The iteratee is invoked with one argument: (value). * * **Note:** Unlike `_.differenceBy`, this method mutates `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to modify. * @param {Array} values The values to remove. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns `array`. * @example * * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; * * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); * console.log(array); * // => [{ 'x': 2 }] */ function pullAllBy(array, values, iteratee) { return (array && array.length && values && values.length) ? basePullAll(array, values, getIteratee(iteratee, 2)) : array; } /** * This method is like `_.pullAll` except that it accepts `comparator` which * is invoked to compare elements of `array` to `values`. The comparator is * invoked with two arguments: (arrVal, othVal). * * **Note:** Unlike `_.differenceWith`, this method mutates `array`. * * @static * @memberOf _ * @since 4.6.0 * @category Array * @param {Array} array The array to modify. * @param {Array} values The values to remove. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns `array`. * @example * * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; * * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); * console.log(array); * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] */ function pullAllWith(array, values, comparator) { return (array && array.length && values && values.length) ? basePullAll(array, values, undefined, comparator) : array; } /** * Removes elements from `array` corresponding to `indexes` and returns an * array of removed elements. * * **Note:** Unlike `_.at`, this method mutates `array`. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to modify. * @param {...(number|number[])} [indexes] The indexes of elements to remove. * @returns {Array} Returns the new array of removed elements. * @example * * var array = ['a', 'b', 'c', 'd']; * var pulled = _.pullAt(array, [1, 3]); * * console.log(array); * // => ['a', 'c'] * * console.log(pulled); * // => ['b', 'd'] */ var pullAt = flatRest(function(array, indexes) { var length = array == null ? 0 : array.length, result = baseAt(array, indexes); basePullAt(array, arrayMap(indexes, function(index) { return isIndex(index, length) ? +index : index; }).sort(compareAscending)); return result; }); /** * Removes all elements from `array` that `predicate` returns truthy for * and returns an array of the removed elements. The predicate is invoked * with three arguments: (value, index, array). * * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` * to pull elements from an array by value. * * @static * @memberOf _ * @since 2.0.0 * @category Array * @param {Array} array The array to modify. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the new array of removed elements. * @example * * var array = [1, 2, 3, 4]; * var evens = _.remove(array, function(n) { * return n % 2 == 0; * }); * * console.log(array); * // => [1, 3] * * console.log(evens); * // => [2, 4] */ function remove(array, predicate) { var result = []; if (!(array && array.length)) { return result; } var index = -1, indexes = [], length = array.length; predicate = getIteratee(predicate, 3); while (++index < length) { var value = array[index]; if (predicate(value, index, array)) { result.push(value); indexes.push(index); } } basePullAt(array, indexes); return result; } /** * Reverses `array` so that the first element becomes the last, the second * element becomes the second to last, and so on. * * **Note:** This method mutates `array` and is based on * [`Array#reverse`](https://mdn.io/Array/reverse). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to modify. * @returns {Array} Returns `array`. * @example * * var array = [1, 2, 3]; * * _.reverse(array); * // => [3, 2, 1] * * console.log(array); * // => [3, 2, 1] */ function reverse(array) { return array == null ? array : nativeReverse.call(array); } /** * Creates a slice of `array` from `start` up to, but not including, `end`. * * **Note:** This method is used instead of * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are * returned. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to slice. * @param {number} [start=0] The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns the slice of `array`. */ function slice(array, start, end) { var length = array == null ? 0 : array.length; if (!length) { return []; } if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { start = 0; end = length; } else { start = start == null ? 0 : toInteger(start); end = end === undefined ? length : toInteger(end); } return baseSlice(array, start, end); } /** * Uses a binary search to determine the lowest index at which `value` * should be inserted into `array` in order to maintain its sort order. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @returns {number} Returns the index at which `value` should be inserted * into `array`. * @example * * _.sortedIndex([30, 50], 40); * // => 1 */ function sortedIndex(array, value) { return baseSortedIndex(array, value); } /** * This method is like `_.sortedIndex` except that it accepts `iteratee` * which is invoked for `value` and each element of `array` to compute their * sort ranking. The iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {number} Returns the index at which `value` should be inserted * into `array`. * @example * * var objects = [{ 'x': 4 }, { 'x': 5 }]; * * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); * // => 0 * * // The `_.property` iteratee shorthand. * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); * // => 0 */ function sortedIndexBy(array, value, iteratee) { return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); } /** * This method is like `_.indexOf` except that it performs a binary * search on a sorted `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @returns {number} Returns the index of the matched value, else `-1`. * @example * * _.sortedIndexOf([4, 5, 5, 5, 6], 5); * // => 1 */ function sortedIndexOf(array, value) { var length = array == null ? 0 : array.length; if (length) { var index = baseSortedIndex(array, value); if (index < length && eq(array[index], value)) { return index; } } return -1; } /** * This method is like `_.sortedIndex` except that it returns the highest * index at which `value` should be inserted into `array` in order to * maintain its sort order. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @returns {number} Returns the index at which `value` should be inserted * into `array`. * @example * * _.sortedLastIndex([4, 5, 5, 5, 6], 5); * // => 4 */ function sortedLastIndex(array, value) { return baseSortedIndex(array, value, true); } /** * This method is like `_.sortedLastIndex` except that it accepts `iteratee` * which is invoked for `value` and each element of `array` to compute their * sort ranking. The iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {number} Returns the index at which `value` should be inserted * into `array`. * @example * * var objects = [{ 'x': 4 }, { 'x': 5 }]; * * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); * // => 1 * * // The `_.property` iteratee shorthand. * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); * // => 1 */ function sortedLastIndexBy(array, value, iteratee) { return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); } /** * This method is like `_.lastIndexOf` except that it performs a binary * search on a sorted `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @returns {number} Returns the index of the matched value, else `-1`. * @example * * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); * // => 3 */ function sortedLastIndexOf(array, value) { var length = array == null ? 0 : array.length; if (length) { var index = baseSortedIndex(array, value, true) - 1; if (eq(array[index], value)) { return index; } } return -1; } /** * This method is like `_.uniq` except that it's designed and optimized * for sorted arrays. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @returns {Array} Returns the new duplicate free array. * @example * * _.sortedUniq([1, 1, 2]); * // => [1, 2] */ function sortedUniq(array) { return (array && array.length) ? baseSortedUniq(array) : []; } /** * This method is like `_.uniqBy` except that it's designed and optimized * for sorted arrays. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @returns {Array} Returns the new duplicate free array. * @example * * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); * // => [1.1, 2.3] */ function sortedUniqBy(array, iteratee) { return (array && array.length) ? baseSortedUniq(array, getIteratee(iteratee, 2)) : []; } /** * Gets all but the first element of `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to query. * @returns {Array} Returns the slice of `array`. * @example * * _.tail([1, 2, 3]); * // => [2, 3] */ function tail(array) { var length = array == null ? 0 : array.length; return length ? baseSlice(array, 1, length) : []; } /** * Creates a slice of `array` with `n` elements taken from the beginning. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=1] The number of elements to take. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the slice of `array`. * @example * * _.take([1, 2, 3]); * // => [1] * * _.take([1, 2, 3], 2); * // => [1, 2] * * _.take([1, 2, 3], 5); * // => [1, 2, 3] * * _.take([1, 2, 3], 0); * // => [] */ function take(array, n, guard) { if (!(array && array.length)) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); return baseSlice(array, 0, n < 0 ? 0 : n); } /** * Creates a slice of `array` with `n` elements taken from the end. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=1] The number of elements to take. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the slice of `array`. * @example * * _.takeRight([1, 2, 3]); * // => [3] * * _.takeRight([1, 2, 3], 2); * // => [2, 3] * * _.takeRight([1, 2, 3], 5); * // => [1, 2, 3] * * _.takeRight([1, 2, 3], 0); * // => [] */ function takeRight(array, n, guard) { var length = array == null ? 0 : array.length; if (!length) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); n = length - n; return baseSlice(array, n < 0 ? 0 : n, length); } /** * Creates a slice of `array` with elements taken from the end. Elements are * taken until `predicate` returns falsey. The predicate is invoked with * three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the slice of `array`. * @example * * var users = [ * { 'user': 'barney', 'active': true }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': false } * ]; * * _.takeRightWhile(users, function(o) { return !o.active; }); * // => objects for ['fred', 'pebbles'] * * // The `_.matches` iteratee shorthand. * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); * // => objects for ['pebbles'] * * // The `_.matchesProperty` iteratee shorthand. * _.takeRightWhile(users, ['active', false]); * // => objects for ['fred', 'pebbles'] * * // The `_.property` iteratee shorthand. * _.takeRightWhile(users, 'active'); * // => [] */ function takeRightWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3), false, true) : []; } /** * Creates a slice of `array` with elements taken from the beginning. Elements * are taken until `predicate` returns falsey. The predicate is invoked with * three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the slice of `array`. * @example * * var users = [ * { 'user': 'barney', 'active': false }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': true } * ]; * * _.takeWhile(users, function(o) { return !o.active; }); * // => objects for ['barney', 'fred'] * * // The `_.matches` iteratee shorthand. * _.takeWhile(users, { 'user': 'barney', 'active': false }); * // => objects for ['barney'] * * // The `_.matchesProperty` iteratee shorthand. * _.takeWhile(users, ['active', false]); * // => objects for ['barney', 'fred'] * * // The `_.property` iteratee shorthand. * _.takeWhile(users, 'active'); * // => [] */ function takeWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3)) : []; } /** * Creates an array of unique values, in order, from all given arrays using * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @returns {Array} Returns the new array of combined values. * @example * * _.union([2], [1, 2]); * // => [2, 1] */ var union = baseRest(function(arrays) { return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); }); /** * This method is like `_.union` except that it accepts `iteratee` which is * invoked for each element of each `arrays` to generate the criterion by * which uniqueness is computed. Result values are chosen from the first * array in which the value occurs. The iteratee is invoked with one argument: * (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new array of combined values. * @example * * _.unionBy([2.1], [1.2, 2.3], Math.floor); * // => [2.1, 1.2] * * // The `_.property` iteratee shorthand. * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); * // => [{ 'x': 1 }, { 'x': 2 }] */ var unionBy = baseRest(function(arrays) { var iteratee = last(arrays); if (isArrayLikeObject(iteratee)) { iteratee = undefined; } return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); }); /** * This method is like `_.union` except that it accepts `comparator` which * is invoked to compare elements of `arrays`. Result values are chosen from * the first array in which the value occurs. The comparator is invoked * with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of combined values. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * * _.unionWith(objects, others, _.isEqual); * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] */ var unionWith = baseRest(function(arrays) { var comparator = last(arrays); comparator = typeof comparator == 'function' ? comparator : undefined; return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); }); /** * Creates a duplicate-free version of an array, using * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons, in which only the first occurrence of each element * is kept. The order of result values is determined by the order they occur * in the array. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @returns {Array} Returns the new duplicate free array. * @example * * _.uniq([2, 1, 2]); * // => [2, 1] */ function uniq(array) { return (array && array.length) ? baseUniq(array) : []; } /** * This method is like `_.uniq` except that it accepts `iteratee` which is * invoked for each element in `array` to generate the criterion by which * uniqueness is computed. The order of result values is determined by the * order they occur in the array. The iteratee is invoked with one argument: * (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new duplicate free array. * @example * * _.uniqBy([2.1, 1.2, 2.3], Math.floor); * // => [2.1, 1.2] * * // The `_.property` iteratee shorthand. * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); * // => [{ 'x': 1 }, { 'x': 2 }] */ function uniqBy(array, iteratee) { return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; } /** * This method is like `_.uniq` except that it accepts `comparator` which * is invoked to compare elements of `array`. The order of result values is * determined by the order they occur in the array.The comparator is invoked * with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new duplicate free array. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; * * _.uniqWith(objects, _.isEqual); * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] */ function uniqWith(array, comparator) { comparator = typeof comparator == 'function' ? comparator : undefined; return (array && array.length) ? baseUniq(array, undefined, comparator) : []; } /** * This method is like `_.zip` except that it accepts an array of grouped * elements and creates an array regrouping the elements to their pre-zip * configuration. * * @static * @memberOf _ * @since 1.2.0 * @category Array * @param {Array} array The array of grouped elements to process. * @returns {Array} Returns the new array of regrouped elements. * @example * * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); * // => [['a', 1, true], ['b', 2, false]] * * _.unzip(zipped); * // => [['a', 'b'], [1, 2], [true, false]] */ function unzip(array) { if (!(array && array.length)) { return []; } var length = 0; array = arrayFilter(array, function(group) { if (isArrayLikeObject(group)) { length = nativeMax(group.length, length); return true; } }); return baseTimes(length, function(index) { return arrayMap(array, baseProperty(index)); }); } /** * This method is like `_.unzip` except that it accepts `iteratee` to specify * how regrouped values should be combined. The iteratee is invoked with the * elements of each group: (...group). * * @static * @memberOf _ * @since 3.8.0 * @category Array * @param {Array} array The array of grouped elements to process. * @param {Function} [iteratee=_.identity] The function to combine * regrouped values. * @returns {Array} Returns the new array of regrouped elements. * @example * * var zipped = _.zip([1, 2], [10, 20], [100, 200]); * // => [[1, 10, 100], [2, 20, 200]] * * _.unzipWith(zipped, _.add); * // => [3, 30, 300] */ function unzipWith(array, iteratee) { if (!(array && array.length)) { return []; } var result = unzip(array); if (iteratee == null) { return result; } return arrayMap(result, function(group) { return apply(iteratee, undefined, group); }); } /** * Creates an array excluding all given values using * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. * * **Note:** Unlike `_.pull`, this method returns a new array. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @param {...*} [values] The values to exclude. * @returns {Array} Returns the new array of filtered values. * @see _.difference, _.xor * @example * * _.without([2, 1, 2, 3], 1, 2); * // => [3] */ var without = baseRest(function(array, values) { return isArrayLikeObject(array) ? baseDifference(array, values) : []; }); /** * Creates an array of unique values that is the * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) * of the given arrays. The order of result values is determined by the order * they occur in the arrays. * * @static * @memberOf _ * @since 2.4.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @returns {Array} Returns the new array of filtered values. * @see _.difference, _.without * @example * * _.xor([2, 1], [2, 3]); * // => [1, 3] */ var xor = baseRest(function(arrays) { return baseXor(arrayFilter(arrays, isArrayLikeObject)); }); /** * This method is like `_.xor` except that it accepts `iteratee` which is * invoked for each element of each `arrays` to generate the criterion by * which by which they're compared. The order of result values is determined * by the order they occur in the arrays. The iteratee is invoked with one * argument: (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new array of filtered values. * @example * * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); * // => [1.2, 3.4] * * // The `_.property` iteratee shorthand. * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); * // => [{ 'x': 2 }] */ var xorBy = baseRest(function(arrays) { var iteratee = last(arrays); if (isArrayLikeObject(iteratee)) { iteratee = undefined; } return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); }); /** * This method is like `_.xor` except that it accepts `comparator` which is * invoked to compare elements of `arrays`. The order of result values is * determined by the order they occur in the arrays. The comparator is invoked * with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of filtered values. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * * _.xorWith(objects, others, _.isEqual); * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] */ var xorWith = baseRest(function(arrays) { var comparator = last(arrays); comparator = typeof comparator == 'function' ? comparator : undefined; return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); }); /** * Creates an array of grouped elements, the first of which contains the * first elements of the given arrays, the second of which contains the * second elements of the given arrays, and so on. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {...Array} [arrays] The arrays to process. * @returns {Array} Returns the new array of grouped elements. * @example * * _.zip(['a', 'b'], [1, 2], [true, false]); * // => [['a', 1, true], ['b', 2, false]] */ var zip = baseRest(unzip); /** * This method is like `_.fromPairs` except that it accepts two arrays, * one of property identifiers and one of corresponding values. * * @static * @memberOf _ * @since 0.4.0 * @category Array * @param {Array} [props=[]] The property identifiers. * @param {Array} [values=[]] The property values. * @returns {Object} Returns the new object. * @example * * _.zipObject(['a', 'b'], [1, 2]); * // => { 'a': 1, 'b': 2 } */ function zipObject(props, values) { return baseZipObject(props || [], values || [], assignValue); } /** * This method is like `_.zipObject` except that it supports property paths. * * @static * @memberOf _ * @since 4.1.0 * @category Array * @param {Array} [props=[]] The property identifiers. * @param {Array} [values=[]] The property values. * @returns {Object} Returns the new object. * @example * * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]); * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } } */ function zipObjectDeep(props, values) { return baseZipObject(props || [], values || [], baseSet); } /** * This method is like `_.zip` except that it accepts `iteratee` to specify * how grouped values should be combined. The iteratee is invoked with the * elements of each group: (...group). * * @static * @memberOf _ * @since 3.8.0 * @category Array * @param {...Array} [arrays] The arrays to process. * @param {Function} [iteratee=_.identity] The function to combine * grouped values. * @returns {Array} Returns the new array of grouped elements. * @example * * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) { * return a + b + c; * }); * // => [111, 222] */ var zipWith = baseRest(function(arrays) { var length = arrays.length, iteratee = length > 1 ? arrays[length - 1] : undefined; iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined; return unzipWith(arrays, iteratee); }); /*------------------------------------------------------------------------*/ /** * Creates a `lodash` wrapper instance that wraps `value` with explicit method * chain sequences enabled. The result of such sequences must be unwrapped * with `_#value`. * * @static * @memberOf _ * @since 1.3.0 * @category Seq * @param {*} value The value to wrap. * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var users = [ * { 'user': 'barney', 'age': 36 }, * { 'user': 'fred', 'age': 40 }, * { 'user': 'pebbles', 'age': 1 } * ]; * * var youngest = _ * .chain(users) * .sortBy('age') * .map(function(o) { * return o.user + ' is ' + o.age; * }) * .head() * .value(); * // => 'pebbles is 1' */ function chain(value) { var result = lodash(value); result.__chain__ = true; return result; } /** * This method invokes `interceptor` and returns `value`. The interceptor * is invoked with one argument; (value). The purpose of this method is to * "tap into" a method chain sequence in order to modify intermediate results. * * @static * @memberOf _ * @since 0.1.0 * @category Seq * @param {*} value The value to provide to `interceptor`. * @param {Function} interceptor The function to invoke. * @returns {*} Returns `value`. * @example * * _([1, 2, 3]) * .tap(function(array) { * // Mutate input array. * array.pop(); * }) * .reverse() * .value(); * // => [2, 1] */ function tap(value, interceptor) { interceptor(value); return value; } /** * This method is like `_.tap` except that it returns the result of `interceptor`. * The purpose of this method is to "pass thru" values replacing intermediate * results in a method chain sequence. * * @static * @memberOf _ * @since 3.0.0 * @category Seq * @param {*} value The value to provide to `interceptor`. * @param {Function} interceptor The function to invoke. * @returns {*} Returns the result of `interceptor`. * @example * * _(' abc ') * .chain() * .trim() * .thru(function(value) { * return [value]; * }) * .value(); * // => ['abc'] */ function thru(value, interceptor) { return interceptor(value); } /** * This method is the wrapper version of `_.at`. * * @name at * @memberOf _ * @since 1.0.0 * @category Seq * @param {...(string|string[])} [paths] The property paths to pick. * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; * * _(object).at(['a[0].b.c', 'a[1]']).value(); * // => [3, 4] */ var wrapperAt = flatRest(function(paths) { var length = paths.length, start = length ? paths[0] : 0, value = this.__wrapped__, interceptor = function(object) { return baseAt(object, paths); }; if (length > 1 || this.__actions__.length || !(value instanceof LazyWrapper) || !isIndex(start)) { return this.thru(interceptor); } value = value.slice(start, +start + (length ? 1 : 0)); value.__actions__.push({ 'func': thru, 'args': [interceptor], 'thisArg': undefined }); return new LodashWrapper(value, this.__chain__).thru(function(array) { if (length && !array.length) { array.push(undefined); } return array; }); }); /** * Creates a `lodash` wrapper instance with explicit method chain sequences enabled. * * @name chain * @memberOf _ * @since 0.1.0 * @category Seq * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var users = [ * { 'user': 'barney', 'age': 36 }, * { 'user': 'fred', 'age': 40 } * ]; * * // A sequence without explicit chaining. * _(users).head(); * // => { 'user': 'barney', 'age': 36 } * * // A sequence with explicit chaining. * _(users) * .chain() * .head() * .pick('user') * .value(); * // => { 'user': 'barney' } */ function wrapperChain() { return chain(this); } /** * Executes the chain sequence and returns the wrapped result. * * @name commit * @memberOf _ * @since 3.2.0 * @category Seq * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var array = [1, 2]; * var wrapped = _(array).push(3); * * console.log(array); * // => [1, 2] * * wrapped = wrapped.commit(); * console.log(array); * // => [1, 2, 3] * * wrapped.last(); * // => 3 * * console.log(array); * // => [1, 2, 3] */ function wrapperCommit() { return new LodashWrapper(this.value(), this.__chain__); } /** * Gets the next value on a wrapped object following the * [iterator protocol](https://mdn.io/iteration_protocols#iterator). * * @name next * @memberOf _ * @since 4.0.0 * @category Seq * @returns {Object} Returns the next iterator value. * @example * * var wrapped = _([1, 2]); * * wrapped.next(); * // => { 'done': false, 'value': 1 } * * wrapped.next(); * // => { 'done': false, 'value': 2 } * * wrapped.next(); * // => { 'done': true, 'value': undefined } */ function wrapperNext() { if (this.__values__ === undefined) { this.__values__ = toArray(this.value()); } var done = this.__index__ >= this.__values__.length, value = done ? undefined : this.__values__[this.__index__++]; return { 'done': done, 'value': value }; } /** * Enables the wrapper to be iterable. * * @name Symbol.iterator * @memberOf _ * @since 4.0.0 * @category Seq * @returns {Object} Returns the wrapper object. * @example * * var wrapped = _([1, 2]); * * wrapped[Symbol.iterator]() === wrapped; * // => true * * Array.from(wrapped); * // => [1, 2] */ function wrapperToIterator() { return this; } /** * Creates a clone of the chain sequence planting `value` as the wrapped value. * * @name plant * @memberOf _ * @since 3.2.0 * @category Seq * @param {*} value The value to plant. * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * function square(n) { * return n * n; * } * * var wrapped = _([1, 2]).map(square); * var other = wrapped.plant([3, 4]); * * other.value(); * // => [9, 16] * * wrapped.value(); * // => [1, 4] */ function wrapperPlant(value) { var result, parent = this; while (parent instanceof baseLodash) { var clone = wrapperClone(parent); clone.__index__ = 0; clone.__values__ = undefined; if (result) { previous.__wrapped__ = clone; } else { result = clone; } var previous = clone; parent = parent.__wrapped__; } previous.__wrapped__ = value; return result; } /** * This method is the wrapper version of `_.reverse`. * * **Note:** This method mutates the wrapped array. * * @name reverse * @memberOf _ * @since 0.1.0 * @category Seq * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var array = [1, 2, 3]; * * _(array).reverse().value() * // => [3, 2, 1] * * console.log(array); * // => [3, 2, 1] */ function wrapperReverse() { var value = this.__wrapped__; if (value instanceof LazyWrapper) { var wrapped = value; if (this.__actions__.length) { wrapped = new LazyWrapper(this); } wrapped = wrapped.reverse(); wrapped.__actions__.push({ 'func': thru, 'args': [reverse], 'thisArg': undefined }); return new LodashWrapper(wrapped, this.__chain__); } return this.thru(reverse); } /** * Executes the chain sequence to resolve the unwrapped value. * * @name value * @memberOf _ * @since 0.1.0 * @alias toJSON, valueOf * @category Seq * @returns {*} Returns the resolved unwrapped value. * @example * * _([1, 2, 3]).value(); * // => [1, 2, 3] */ function wrapperValue() { return baseWrapperValue(this.__wrapped__, this.__actions__); } /*------------------------------------------------------------------------*/ /** * Creates an object composed of keys generated from the results of running * each element of `collection` thru `iteratee`. The corresponding value of * each key is the number of times the key was returned by `iteratee`. The * iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 0.5.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The iteratee to transform keys. * @returns {Object} Returns the composed aggregate object. * @example * * _.countBy([6.1, 4.2, 6.3], Math.floor); * // => { '4': 1, '6': 2 } * * // The `_.property` iteratee shorthand. * _.countBy(['one', 'two', 'three'], 'length'); * // => { '3': 2, '5': 1 } */ var countBy = createAggregator(function(result, value, key) { if (hasOwnProperty.call(result, key)) { ++result[key]; } else { baseAssignValue(result, key, 1); } }); /** * Checks if `predicate` returns truthy for **all** elements of `collection`. * Iteration is stopped once `predicate` returns falsey. The predicate is * invoked with three arguments: (value, index|key, collection). * * **Note:** This method returns `true` for * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of * elements of empty collections. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {boolean} Returns `true` if all elements pass the predicate check, * else `false`. * @example * * _.every([true, 1, null, 'yes'], Boolean); * // => false * * var users = [ * { 'user': 'barney', 'age': 36, 'active': false }, * { 'user': 'fred', 'age': 40, 'active': false } * ]; * * // The `_.matches` iteratee shorthand. * _.every(users, { 'user': 'barney', 'active': false }); * // => false * * // The `_.matchesProperty` iteratee shorthand. * _.every(users, ['active', false]); * // => true * * // The `_.property` iteratee shorthand. * _.every(users, 'active'); * // => false */ function every(collection, predicate, guard) { var func = isArray(collection) ? arrayEvery : baseEvery; if (guard && isIterateeCall(collection, predicate, guard)) { predicate = undefined; } return func(collection, getIteratee(predicate, 3)); } /** * Iterates over elements of `collection`, returning an array of all elements * `predicate` returns truthy for. The predicate is invoked with three * arguments: (value, index|key, collection). * * **Note:** Unlike `_.remove`, this method returns a new array. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the new filtered array. * @see _.reject * @example * * var users = [ * { 'user': 'barney', 'age': 36, 'active': true }, * { 'user': 'fred', 'age': 40, 'active': false } * ]; * * _.filter(users, function(o) { return !o.active; }); * // => objects for ['fred'] * * // The `_.matches` iteratee shorthand. * _.filter(users, { 'age': 36, 'active': true }); * // => objects for ['barney'] * * // The `_.matchesProperty` iteratee shorthand. * _.filter(users, ['active', false]); * // => objects for ['fred'] * * // The `_.property` iteratee shorthand. * _.filter(users, 'active'); * // => objects for ['barney'] */ function filter(collection, predicate) { var func = isArray(collection) ? arrayFilter : baseFilter; return func(collection, getIteratee(predicate, 3)); } /** * Iterates over elements of `collection`, returning the first element * `predicate` returns truthy for. The predicate is invoked with three * arguments: (value, index|key, collection). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param {number} [fromIndex=0] The index to search from. * @returns {*} Returns the matched element, else `undefined`. * @example * * var users = [ * { 'user': 'barney', 'age': 36, 'active': true }, * { 'user': 'fred', 'age': 40, 'active': false }, * { 'user': 'pebbles', 'age': 1, 'active': true } * ]; * * _.find(users, function(o) { return o.age < 40; }); * // => object for 'barney' * * // The `_.matches` iteratee shorthand. * _.find(users, { 'age': 1, 'active': true }); * // => object for 'pebbles' * * // The `_.matchesProperty` iteratee shorthand. * _.find(users, ['active', false]); * // => object for 'fred' * * // The `_.property` iteratee shorthand. * _.find(users, 'active'); * // => object for 'barney' */ var find = createFind(findIndex); /** * This method is like `_.find` except that it iterates over elements of * `collection` from right to left. * * @static * @memberOf _ * @since 2.0.0 * @category Collection * @param {Array|Object} collection The collection to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param {number} [fromIndex=collection.length-1] The index to search from. * @returns {*} Returns the matched element, else `undefined`. * @example * * _.findLast([1, 2, 3, 4], function(n) { * return n % 2 == 1; * }); * // => 3 */ var findLast = createFind(findLastIndex); /** * Creates a flattened array of values by running each element in `collection` * thru `iteratee` and flattening the mapped results. The iteratee is invoked * with three arguments: (value, index|key, collection). * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array} Returns the new flattened array. * @example * * function duplicate(n) { * return [n, n]; * } * * _.flatMap([1, 2], duplicate); * // => [1, 1, 2, 2] */ function flatMap(collection, iteratee) { return baseFlatten(map(collection, iteratee), 1); } /** * This method is like `_.flatMap` except that it recursively flattens the * mapped results. * * @static * @memberOf _ * @since 4.7.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array} Returns the new flattened array. * @example * * function duplicate(n) { * return [[[n, n]]]; * } * * _.flatMapDeep([1, 2], duplicate); * // => [1, 1, 2, 2] */ function flatMapDeep(collection, iteratee) { return baseFlatten(map(collection, iteratee), INFINITY); } /** * This method is like `_.flatMap` except that it recursively flattens the * mapped results up to `depth` times. * * @static * @memberOf _ * @since 4.7.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @param {number} [depth=1] The maximum recursion depth. * @returns {Array} Returns the new flattened array. * @example * * function duplicate(n) { * return [[[n, n]]]; * } * * _.flatMapDepth([1, 2], duplicate, 2); * // => [[1, 1], [2, 2]] */ function flatMapDepth(collection, iteratee, depth) { depth = depth === undefined ? 1 : toInteger(depth); return baseFlatten(map(collection, iteratee), depth); } /** * Iterates over elements of `collection` and invokes `iteratee` for each element. * The iteratee is invoked with three arguments: (value, index|key, collection). * Iteratee functions may exit iteration early by explicitly returning `false`. * * **Note:** As with other "Collections" methods, objects with a "length" * property are iterated like arrays. To avoid this behavior use `_.forIn` * or `_.forOwn` for object iteration. * * @static * @memberOf _ * @since 0.1.0 * @alias each * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array|Object} Returns `collection`. * @see _.forEachRight * @example * * _.forEach([1, 2], function(value) { * console.log(value); * }); * // => Logs `1` then `2`. * * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) { * console.log(key); * }); * // => Logs 'a' then 'b' (iteration order is not guaranteed). */ function forEach(collection, iteratee) { var func = isArray(collection) ? arrayEach : baseEach; return func(collection, getIteratee(iteratee, 3)); } /** * This method is like `_.forEach` except that it iterates over elements of * `collection` from right to left. * * @static * @memberOf _ * @since 2.0.0 * @alias eachRight * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array|Object} Returns `collection`. * @see _.forEach * @example * * _.forEachRight([1, 2], function(value) { * console.log(value); * }); * // => Logs `2` then `1`. */ function forEachRight(collection, iteratee) { var func = isArray(collection) ? arrayEachRight : baseEachRight; return func(collection, getIteratee(iteratee, 3)); } /** * Creates an object composed of keys generated from the results of running * each element of `collection` thru `iteratee`. The order of grouped values * is determined by the order they occur in `collection`. The corresponding * value of each key is an array of elements responsible for generating the * key. The iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The iteratee to transform keys. * @returns {Object} Returns the composed aggregate object. * @example * * _.groupBy([6.1, 4.2, 6.3], Math.floor); * // => { '4': [4.2], '6': [6.1, 6.3] } * * // The `_.property` iteratee shorthand. * _.groupBy(['one', 'two', 'three'], 'length'); * // => { '3': ['one', 'two'], '5': ['three'] } */ var groupBy = createAggregator(function(result, value, key) { if (hasOwnProperty.call(result, key)) { result[key].push(value); } else { baseAssignValue(result, key, [value]); } }); /** * Checks if `value` is in `collection`. If `collection` is a string, it's * checked for a substring of `value`, otherwise * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * is used for equality comparisons. If `fromIndex` is negative, it's used as * the offset from the end of `collection`. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object|string} collection The collection to inspect. * @param {*} value The value to search for. * @param {number} [fromIndex=0] The index to search from. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. * @returns {boolean} Returns `true` if `value` is found, else `false`. * @example * * _.includes([1, 2, 3], 1); * // => true * * _.includes([1, 2, 3], 1, 2); * // => false * * _.includes({ 'a': 1, 'b': 2 }, 1); * // => true * * _.includes('abcd', 'bc'); * // => true */ function includes(collection, value, fromIndex, guard) { collection = isArrayLike(collection) ? collection : values(collection); fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0; var length = collection.length; if (fromIndex < 0) { fromIndex = nativeMax(length + fromIndex, 0); } return isString(collection) ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1) : (!!length && baseIndexOf(collection, value, fromIndex) > -1); } /** * Invokes the method at `path` of each element in `collection`, returning * an array of the results of each invoked method. Any additional arguments * are provided to each invoked method. If `path` is a function, it's invoked * for, and `this` bound to, each element in `collection`. * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Array|Function|string} path The path of the method to invoke or * the function invoked per iteration. * @param {...*} [args] The arguments to invoke each method with. * @returns {Array} Returns the array of results. * @example * * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort'); * // => [[1, 5, 7], [1, 2, 3]] * * _.invokeMap([123, 456], String.prototype.split, ''); * // => [['1', '2', '3'], ['4', '5', '6']] */ var invokeMap = baseRest(function(collection, path, args) { var index = -1, isFunc = typeof path == 'function', result = isArrayLike(collection) ? Array(collection.length) : []; baseEach(collection, function(value) { result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args); }); return result; }); /** * Creates an object composed of keys generated from the results of running * each element of `collection` thru `iteratee`. The corresponding value of * each key is the last element responsible for generating the key. The * iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The iteratee to transform keys. * @returns {Object} Returns the composed aggregate object. * @example * * var array = [ * { 'dir': 'left', 'code': 97 }, * { 'dir': 'right', 'code': 100 } * ]; * * _.keyBy(array, function(o) { * return String.fromCharCode(o.code); * }); * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } * * _.keyBy(array, 'dir'); * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } */ var keyBy = createAggregator(function(result, value, key) { baseAssignValue(result, key, value); }); /** * Creates an array of values by running each element in `collection` thru * `iteratee`. The iteratee is invoked with three arguments: * (value, index|key, collection). * * Many lodash methods are guarded to work as iteratees for methods like * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`. * * The guarded methods are: * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`, * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`, * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`, * `template`, `trim`, `trimEnd`, `trimStart`, and `words` * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array} Returns the new mapped array. * @example * * function square(n) { * return n * n; * } * * _.map([4, 8], square); * // => [16, 64] * * _.map({ 'a': 4, 'b': 8 }, square); * // => [16, 64] (iteration order is not guaranteed) * * var users = [ * { 'user': 'barney' }, * { 'user': 'fred' } * ]; * * // The `_.property` iteratee shorthand. * _.map(users, 'user'); * // => ['barney', 'fred'] */ function map(collection, iteratee) { var func = isArray(collection) ? arrayMap : baseMap; return func(collection, getIteratee(iteratee, 3)); } /** * This method is like `_.sortBy` except that it allows specifying the sort * orders of the iteratees to sort by. If `orders` is unspecified, all values * are sorted in ascending order. Otherwise, specify an order of "desc" for * descending or "asc" for ascending sort order of corresponding values. * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]] * The iteratees to sort by. * @param {string[]} [orders] The sort orders of `iteratees`. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. * @returns {Array} Returns the new sorted array. * @example * * var users = [ * { 'user': 'fred', 'age': 48 }, * { 'user': 'barney', 'age': 34 }, * { 'user': 'fred', 'age': 40 }, * { 'user': 'barney', 'age': 36 } * ]; * * // Sort by `user` in ascending order and by `age` in descending order. * _.orderBy(users, ['user', 'age'], ['asc', 'desc']); * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] */ function orderBy(collection, iteratees, orders, guard) { if (collection == null) { return []; } if (!isArray(iteratees)) { iteratees = iteratees == null ? [] : [iteratees]; } orders = guard ? undefined : orders; if (!isArray(orders)) { orders = orders == null ? [] : [orders]; } return baseOrderBy(collection, iteratees, orders); } /** * Creates an array of elements split into two groups, the first of which * contains elements `predicate` returns truthy for, the second of which * contains elements `predicate` returns falsey for. The predicate is * invoked with one argument: (value). * * @static * @memberOf _ * @since 3.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the array of grouped elements. * @example * * var users = [ * { 'user': 'barney', 'age': 36, 'active': false }, * { 'user': 'fred', 'age': 40, 'active': true }, * { 'user': 'pebbles', 'age': 1, 'active': false } * ]; * * _.partition(users, function(o) { return o.active; }); * // => objects for [['fred'], ['barney', 'pebbles']] * * // The `_.matches` iteratee shorthand. * _.partition(users, { 'age': 1, 'active': false }); * // => objects for [['pebbles'], ['barney', 'fred']] * * // The `_.matchesProperty` iteratee shorthand. * _.partition(users, ['active', false]); * // => objects for [['barney', 'pebbles'], ['fred']] * * // The `_.property` iteratee shorthand. * _.partition(users, 'active'); * // => objects for [['fred'], ['barney', 'pebbles']] */ var partition = createAggregator(function(result, value, key) { result[key ? 0 : 1].push(value); }, function() { return [[], []]; }); /** * Reduces `collection` to a value which is the accumulated result of running * each element in `collection` thru `iteratee`, where each successive * invocation is supplied the return value of the previous. If `accumulator` * is not given, the first element of `collection` is used as the initial * value. The iteratee is invoked with four arguments: * (accumulator, value, index|key, collection). * * Many lodash methods are guarded to work as iteratees for methods like * `_.reduce`, `_.reduceRight`, and `_.transform`. * * The guarded methods are: * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`, * and `sortBy` * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @param {*} [accumulator] The initial value. * @returns {*} Returns the accumulated value. * @see _.reduceRight * @example * * _.reduce([1, 2], function(sum, n) { * return sum + n; * }, 0); * // => 3 * * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { * (result[value] || (result[value] = [])).push(key); * return result; * }, {}); * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed) */ function reduce(collection, iteratee, accumulator) { var func = isArray(collection) ? arrayReduce : baseReduce, initAccum = arguments.length < 3; return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach); } /** * This method is like `_.reduce` except that it iterates over elements of * `collection` from right to left. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @param {*} [accumulator] The initial value. * @returns {*} Returns the accumulated value. * @see _.reduce * @example * * var array = [[0, 1], [2, 3], [4, 5]]; * * _.reduceRight(array, function(flattened, other) { * return flattened.concat(other); * }, []); * // => [4, 5, 2, 3, 0, 1] */ function reduceRight(collection, iteratee, accumulator) { var func = isArray(collection) ? arrayReduceRight : baseReduce, initAccum = arguments.length < 3; return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight); } /** * The opposite of `_.filter`; this method returns the elements of `collection` * that `predicate` does **not** return truthy for. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the new filtered array. * @see _.filter * @example * * var users = [ * { 'user': 'barney', 'age': 36, 'active': false }, * { 'user': 'fred', 'age': 40, 'active': true } * ]; * * _.reject(users, function(o) { return !o.active; }); * // => objects for ['fred'] * * // The `_.matches` iteratee shorthand. * _.reject(users, { 'age': 40, 'active': true }); * // => objects for ['barney'] * * // The `_.matchesProperty` iteratee shorthand. * _.reject(users, ['active', false]); * // => objects for ['fred'] * * // The `_.property` iteratee shorthand. * _.reject(users, 'active'); * // => objects for ['barney'] */ function reject(collection, predicate) { var func = isArray(collection) ? arrayFilter : baseFilter; return func(collection, negate(getIteratee(predicate, 3))); } /** * Gets a random element from `collection`. * * @static * @memberOf _ * @since 2.0.0 * @category Collection * @param {Array|Object} collection The collection to sample. * @returns {*} Returns the random element. * @example * * _.sample([1, 2, 3, 4]); * // => 2 */ function sample(collection) { var func = isArray(collection) ? arraySample : baseSample; return func(collection); } /** * Gets `n` random elements at unique keys from `collection` up to the * size of `collection`. * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to sample. * @param {number} [n=1] The number of elements to sample. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the random elements. * @example * * _.sampleSize([1, 2, 3], 2); * // => [3, 1] * * _.sampleSize([1, 2, 3], 4); * // => [2, 3, 1] */ function sampleSize(collection, n, guard) { if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) { n = 1; } else { n = toInteger(n); } var func = isArray(collection) ? arraySampleSize : baseSampleSize; return func(collection, n); } /** * Creates an array of shuffled values, using a version of the * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to shuffle. * @returns {Array} Returns the new shuffled array. * @example * * _.shuffle([1, 2, 3, 4]); * // => [4, 1, 3, 2] */ function shuffle(collection) { var func = isArray(collection) ? arrayShuffle : baseShuffle; return func(collection); } /** * Gets the size of `collection` by returning its length for array-like * values or the number of own enumerable string keyed properties for objects. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object|string} collection The collection to inspect. * @returns {number} Returns the collection size. * @example * * _.size([1, 2, 3]); * // => 3 * * _.size({ 'a': 1, 'b': 2 }); * // => 2 * * _.size('pebbles'); * // => 7 */ function size(collection) { if (collection == null) { return 0; } if (isArrayLike(collection)) { return isString(collection) ? stringSize(collection) : collection.length; } var tag = getTag(collection); if (tag == mapTag || tag == setTag) { return collection.size; } return baseKeys(collection).length; } /** * Checks if `predicate` returns truthy for **any** element of `collection`. * Iteration is stopped once `predicate` returns truthy. The predicate is * invoked with three arguments: (value, index|key, collection). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {boolean} Returns `true` if any element passes the predicate check, * else `false`. * @example * * _.some([null, 0, 'yes', false], Boolean); * // => true * * var users = [ * { 'user': 'barney', 'active': true }, * { 'user': 'fred', 'active': false } * ]; * * // The `_.matches` iteratee shorthand. * _.some(users, { 'user': 'barney', 'active': false }); * // => false * * // The `_.matchesProperty` iteratee shorthand. * _.some(users, ['active', false]); * // => true * * // The `_.property` iteratee shorthand. * _.some(users, 'active'); * // => true */ function some(collection, predicate, guard) { var func = isArray(collection) ? arraySome : baseSome; if (guard && isIterateeCall(collection, predicate, guard)) { predicate = undefined; } return func(collection, getIteratee(predicate, 3)); } /** * Creates an array of elements, sorted in ascending order by the results of * running each element in a collection thru each iteratee. This method * performs a stable sort, that is, it preserves the original sort order of * equal elements. The iteratees are invoked with one argument: (value). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {...(Function|Function[])} [iteratees=[_.identity]] * The iteratees to sort by. * @returns {Array} Returns the new sorted array. * @example * * var users = [ * { 'user': 'fred', 'age': 48 }, * { 'user': 'barney', 'age': 36 }, * { 'user': 'fred', 'age': 40 }, * { 'user': 'barney', 'age': 34 } * ]; * * _.sortBy(users, [function(o) { return o.user; }]); * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] * * _.sortBy(users, ['user', 'age']); * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]] */ var sortBy = baseRest(function(collection, iteratees) { if (collection == null) { return []; } var length = iteratees.length; if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) { iteratees = []; } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) { iteratees = [iteratees[0]]; } return baseOrderBy(collection, baseFlatten(iteratees, 1), []); }); /*------------------------------------------------------------------------*/ /** * Gets the timestamp of the number of milliseconds that have elapsed since * the Unix epoch (1 January 1970 00:00:00 UTC). * * @static * @memberOf _ * @since 2.4.0 * @category Date * @returns {number} Returns the timestamp. * @example * * _.defer(function(stamp) { * console.log(_.now() - stamp); * }, _.now()); * // => Logs the number of milliseconds it took for the deferred invocation. */ var now = ctxNow || function() { return root.Date.now(); }; /*------------------------------------------------------------------------*/ /** * The opposite of `_.before`; this method creates a function that invokes * `func` once it's called `n` or more times. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {number} n The number of calls before `func` is invoked. * @param {Function} func The function to restrict. * @returns {Function} Returns the new restricted function. * @example * * var saves = ['profile', 'settings']; * * var done = _.after(saves.length, function() { * console.log('done saving!'); * }); * * _.forEach(saves, function(type) { * asyncSave({ 'type': type, 'complete': done }); * }); * // => Logs 'done saving!' after the two async saves have completed. */ function after(n, func) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } n = toInteger(n); return function() { if (--n < 1) { return func.apply(this, arguments); } }; } /** * Creates a function that invokes `func`, with up to `n` arguments, * ignoring any additional arguments. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {Function} func The function to cap arguments for. * @param {number} [n=func.length] The arity cap. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Function} Returns the new capped function. * @example * * _.map(['6', '8', '10'], _.ary(parseInt, 1)); * // => [6, 8, 10] */ function ary(func, n, guard) { n = guard ? undefined : n; n = (func && n == null) ? func.length : n; return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n); } /** * Creates a function that invokes `func`, with the `this` binding and arguments * of the created function, while it's called less than `n` times. Subsequent * calls to the created function return the result of the last `func` invocation. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {number} n The number of calls at which `func` is no longer invoked. * @param {Function} func The function to restrict. * @returns {Function} Returns the new restricted function. * @example * * jQuery(element).on('click', _.before(5, addContactToList)); * // => Allows adding up to 4 contacts to the list. */ function before(n, func) { var result; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } n = toInteger(n); return function() { if (--n > 0) { result = func.apply(this, arguments); } if (n <= 1) { func = undefined; } return result; }; } /** * Creates a function that invokes `func` with the `this` binding of `thisArg` * and `partials` prepended to the arguments it receives. * * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, * may be used as a placeholder for partially applied arguments. * * **Note:** Unlike native `Function#bind`, this method doesn't set the "length" * property of bound functions. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to bind. * @param {*} thisArg The `this` binding of `func`. * @param {...*} [partials] The arguments to be partially applied. * @returns {Function} Returns the new bound function. * @example * * function greet(greeting, punctuation) { * return greeting + ' ' + this.user + punctuation; * } * * var object = { 'user': 'fred' }; * * var bound = _.bind(greet, object, 'hi'); * bound('!'); * // => 'hi fred!' * * // Bound with placeholders. * var bound = _.bind(greet, object, _, '!'); * bound('hi'); * // => 'hi fred!' */ var bind = baseRest(function(func, thisArg, partials) { var bitmask = WRAP_BIND_FLAG; if (partials.length) { var holders = replaceHolders(partials, getHolder(bind)); bitmask |= WRAP_PARTIAL_FLAG; } return createWrap(func, bitmask, thisArg, partials, holders); }); /** * Creates a function that invokes the method at `object[key]` with `partials` * prepended to the arguments it receives. * * This method differs from `_.bind` by allowing bound functions to reference * methods that may be redefined or don't yet exist. See * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern) * for more details. * * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic * builds, may be used as a placeholder for partially applied arguments. * * @static * @memberOf _ * @since 0.10.0 * @category Function * @param {Object} object The object to invoke the method on. * @param {string} key The key of the method. * @param {...*} [partials] The arguments to be partially applied. * @returns {Function} Returns the new bound function. * @example * * var object = { * 'user': 'fred', * 'greet': function(greeting, punctuation) { * return greeting + ' ' + this.user + punctuation; * } * }; * * var bound = _.bindKey(object, 'greet', 'hi'); * bound('!'); * // => 'hi fred!' * * object.greet = function(greeting, punctuation) { * return greeting + 'ya ' + this.user + punctuation; * }; * * bound('!'); * // => 'hiya fred!' * * // Bound with placeholders. * var bound = _.bindKey(object, 'greet', _, '!'); * bound('hi'); * // => 'hiya fred!' */ var bindKey = baseRest(function(object, key, partials) { var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; if (partials.length) { var holders = replaceHolders(partials, getHolder(bindKey)); bitmask |= WRAP_PARTIAL_FLAG; } return createWrap(key, bitmask, object, partials, holders); }); /** * Creates a function that accepts arguments of `func` and either invokes * `func` returning its result, if at least `arity` number of arguments have * been provided, or returns a function that accepts the remaining `func` * arguments, and so on. The arity of `func` may be specified if `func.length` * is not sufficient. * * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, * may be used as a placeholder for provided arguments. * * **Note:** This method doesn't set the "length" property of curried functions. * * @static * @memberOf _ * @since 2.0.0 * @category Function * @param {Function} func The function to curry. * @param {number} [arity=func.length] The arity of `func`. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Function} Returns the new curried function. * @example * * var abc = function(a, b, c) { * return [a, b, c]; * }; * * var curried = _.curry(abc); * * curried(1)(2)(3); * // => [1, 2, 3] * * curried(1, 2)(3); * // => [1, 2, 3] * * curried(1, 2, 3); * // => [1, 2, 3] * * // Curried with placeholders. * curried(1)(_, 3)(2); * // => [1, 2, 3] */ function curry(func, arity, guard) { arity = guard ? undefined : arity; var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity); result.placeholder = curry.placeholder; return result; } /** * This method is like `_.curry` except that arguments are applied to `func` * in the manner of `_.partialRight` instead of `_.partial`. * * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic * builds, may be used as a placeholder for provided arguments. * * **Note:** This method doesn't set the "length" property of curried functions. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {Function} func The function to curry. * @param {number} [arity=func.length] The arity of `func`. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Function} Returns the new curried function. * @example * * var abc = function(a, b, c) { * return [a, b, c]; * }; * * var curried = _.curryRight(abc); * * curried(3)(2)(1); * // => [1, 2, 3] * * curried(2, 3)(1); * // => [1, 2, 3] * * curried(1, 2, 3); * // => [1, 2, 3] * * // Curried with placeholders. * curried(3)(1, _)(2); * // => [1, 2, 3] */ function curryRight(func, arity, guard) { arity = guard ? undefined : arity; var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity); result.placeholder = curryRight.placeholder; return result; } /** * Creates a debounced function that delays invoking `func` until after `wait` * milliseconds have elapsed since the last time the debounced function was * invoked. The debounced function comes with a `cancel` method to cancel * delayed `func` invocations and a `flush` method to immediately invoke them. * Provide `options` to indicate whether `func` should be invoked on the * leading and/or trailing edge of the `wait` timeout. The `func` is invoked * with the last arguments provided to the debounced function. Subsequent * calls to the debounced function return the result of the last `func` * invocation. * * **Note:** If `leading` and `trailing` options are `true`, `func` is * invoked on the trailing edge of the timeout only if the debounced function * is invoked more than once during the `wait` timeout. * * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred * until to the next tick, similar to `setTimeout` with a timeout of `0`. * * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) * for details over the differences between `_.debounce` and `_.throttle`. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to debounce. * @param {number} [wait=0] The number of milliseconds to delay. * @param {Object} [options={}] The options object. * @param {boolean} [options.leading=false] * Specify invoking on the leading edge of the timeout. * @param {number} [options.maxWait] * The maximum time `func` is allowed to be delayed before it's invoked. * @param {boolean} [options.trailing=true] * Specify invoking on the trailing edge of the timeout. * @returns {Function} Returns the new debounced function. * @example * * // Avoid costly calculations while the window size is in flux. * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); * * // Invoke `sendMail` when clicked, debouncing subsequent calls. * jQuery(element).on('click', _.debounce(sendMail, 300, { * 'leading': true, * 'trailing': false * })); * * // Ensure `batchLog` is invoked once after 1 second of debounced calls. * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); * var source = new EventSource('/stream'); * jQuery(source).on('message', debounced); * * // Cancel the trailing debounced invocation. * jQuery(window).on('popstate', debounced.cancel); */ function debounce(func, wait, options) { var lastArgs, lastThis, maxWait, result, timerId, lastCallTime, lastInvokeTime = 0, leading = false, maxing = false, trailing = true; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } wait = toNumber(wait) || 0; if (isObject(options)) { leading = !!options.leading; maxing = 'maxWait' in options; maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; trailing = 'trailing' in options ? !!options.trailing : trailing; } function invokeFunc(time) { var args = lastArgs, thisArg = lastThis; lastArgs = lastThis = undefined; lastInvokeTime = time; result = func.apply(thisArg, args); return result; } function leadingEdge(time) { // Reset any `maxWait` timer. lastInvokeTime = time; // Start the timer for the trailing edge. timerId = setTimeout(timerExpired, wait); // Invoke the leading edge. return leading ? invokeFunc(time) : result; } function remainingWait(time) { var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime, timeWaiting = wait - timeSinceLastCall; return maxing ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) : timeWaiting; } function shouldInvoke(time) { var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime; // Either this is the first call, activity has stopped and we're at the // trailing edge, the system time has gone backwards and we're treating // it as the trailing edge, or we've hit the `maxWait` limit. return (lastCallTime === undefined || (timeSinceLastCall >= wait) || (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); } function timerExpired() { var time = now(); if (shouldInvoke(time)) { return trailingEdge(time); } // Restart the timer. timerId = setTimeout(timerExpired, remainingWait(time)); } function trailingEdge(time) { timerId = undefined; // Only invoke if we have `lastArgs` which means `func` has been // debounced at least once. if (trailing && lastArgs) { return invokeFunc(time); } lastArgs = lastThis = undefined; return result; } function cancel() { if (timerId !== undefined) { clearTimeout(timerId); } lastInvokeTime = 0; lastArgs = lastCallTime = lastThis = timerId = undefined; } function flush() { return timerId === undefined ? result : trailingEdge(now()); } function debounced() { var time = now(), isInvoking = shouldInvoke(time); lastArgs = arguments; lastThis = this; lastCallTime = time; if (isInvoking) { if (timerId === undefined) { return leadingEdge(lastCallTime); } if (maxing) { // Handle invocations in a tight loop. timerId = setTimeout(timerExpired, wait); return invokeFunc(lastCallTime); } } if (timerId === undefined) { timerId = setTimeout(timerExpired, wait); } return result; } debounced.cancel = cancel; debounced.flush = flush; return debounced; } /** * Defers invoking the `func` until the current call stack has cleared. Any * additional arguments are provided to `func` when it's invoked. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to defer. * @param {...*} [args] The arguments to invoke `func` with. * @returns {number} Returns the timer id. * @example * * _.defer(function(text) { * console.log(text); * }, 'deferred'); * // => Logs 'deferred' after one millisecond. */ var defer = baseRest(function(func, args) { return baseDelay(func, 1, args); }); /** * Invokes `func` after `wait` milliseconds. Any additional arguments are * provided to `func` when it's invoked. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to delay. * @param {number} wait The number of milliseconds to delay invocation. * @param {...*} [args] The arguments to invoke `func` with. * @returns {number} Returns the timer id. * @example * * _.delay(function(text) { * console.log(text); * }, 1000, 'later'); * // => Logs 'later' after one second. */ var delay = baseRest(function(func, wait, args) { return baseDelay(func, toNumber(wait) || 0, args); }); /** * Creates a function that invokes `func` with arguments reversed. * * @static * @memberOf _ * @since 4.0.0 * @category Function * @param {Function} func The function to flip arguments for. * @returns {Function} Returns the new flipped function. * @example * * var flipped = _.flip(function() { * return _.toArray(arguments); * }); * * flipped('a', 'b', 'c', 'd'); * // => ['d', 'c', 'b', 'a'] */ function flip(func) { return createWrap(func, WRAP_FLIP_FLAG); } /** * Creates a function that memoizes the result of `func`. If `resolver` is * provided, it determines the cache key for storing the result based on the * arguments provided to the memoized function. By default, the first argument * provided to the memoized function is used as the map cache key. The `func` * is invoked with the `this` binding of the memoized function. * * **Note:** The cache is exposed as the `cache` property on the memoized * function. Its creation may be customized by replacing the `_.memoize.Cache` * constructor with one whose instances implement the * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object) * method interface of `clear`, `delete`, `get`, `has`, and `set`. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to have its output memoized. * @param {Function} [resolver] The function to resolve the cache key. * @returns {Function} Returns the new memoized function. * @example * * var object = { 'a': 1, 'b': 2 }; * var other = { 'c': 3, 'd': 4 }; * * var values = _.memoize(_.values); * values(object); * // => [1, 2] * * values(other); * // => [3, 4] * * object.a = 2; * values(object); * // => [1, 2] * * // Modify the result cache. * values.cache.set(object, ['a', 'b']); * values(object); * // => ['a', 'b'] * * // Replace `_.memoize.Cache`. * _.memoize.Cache = WeakMap; */ function memoize(func, resolver) { if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) { throw new TypeError(FUNC_ERROR_TEXT); } var memoized = function() { var args = arguments, key = resolver ? resolver.apply(this, args) : args[0], cache = memoized.cache; if (cache.has(key)) { return cache.get(key); } var result = func.apply(this, args); memoized.cache = cache.set(key, result) || cache; return result; }; memoized.cache = new (memoize.Cache || MapCache); return memoized; } // Expose `MapCache`. memoize.Cache = MapCache; /** * Creates a function that negates the result of the predicate `func`. The * `func` predicate is invoked with the `this` binding and arguments of the * created function. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {Function} predicate The predicate to negate. * @returns {Function} Returns the new negated function. * @example * * function isEven(n) { * return n % 2 == 0; * } * * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); * // => [1, 3, 5] */ function negate(predicate) { if (typeof predicate != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } return function() { var args = arguments; switch (args.length) { case 0: return !predicate.call(this); case 1: return !predicate.call(this, args[0]); case 2: return !predicate.call(this, args[0], args[1]); case 3: return !predicate.call(this, args[0], args[1], args[2]); } return !predicate.apply(this, args); }; } /** * Creates a function that is restricted to invoking `func` once. Repeat calls * to the function return the value of the first invocation. The `func` is * invoked with the `this` binding and arguments of the created function. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to restrict. * @returns {Function} Returns the new restricted function. * @example * * var initialize = _.once(createApplication); * initialize(); * initialize(); * // => `createApplication` is invoked once */ function once(func) { return before(2, func); } /** * Creates a function that invokes `func` with its arguments transformed. * * @static * @since 4.0.0 * @memberOf _ * @category Function * @param {Function} func The function to wrap. * @param {...(Function|Function[])} [transforms=[_.identity]] * The argument transforms. * @returns {Function} Returns the new function. * @example * * function doubled(n) { * return n * 2; * } * * function square(n) { * return n * n; * } * * var func = _.overArgs(function(x, y) { * return [x, y]; * }, [square, doubled]); * * func(9, 3); * // => [81, 6] * * func(10, 5); * // => [100, 10] */ var overArgs = castRest(function(func, transforms) { transforms = (transforms.length == 1 && isArray(transforms[0])) ? arrayMap(transforms[0], baseUnary(getIteratee())) : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee())); var funcsLength = transforms.length; return baseRest(function(args) { var index = -1, length = nativeMin(args.length, funcsLength); while (++index < length) { args[index] = transforms[index].call(this, args[index]); } return apply(func, this, args); }); }); /** * Creates a function that invokes `func` with `partials` prepended to the * arguments it receives. This method is like `_.bind` except it does **not** * alter the `this` binding. * * The `_.partial.placeholder` value, which defaults to `_` in monolithic * builds, may be used as a placeholder for partially applied arguments. * * **Note:** This method doesn't set the "length" property of partially * applied functions. * * @static * @memberOf _ * @since 0.2.0 * @category Function * @param {Function} func The function to partially apply arguments to. * @param {...*} [partials] The arguments to be partially applied. * @returns {Function} Returns the new partially applied function. * @example * * function greet(greeting, name) { * return greeting + ' ' + name; * } * * var sayHelloTo = _.partial(greet, 'hello'); * sayHelloTo('fred'); * // => 'hello fred' * * // Partially applied with placeholders. * var greetFred = _.partial(greet, _, 'fred'); * greetFred('hi'); * // => 'hi fred' */ var partial = baseRest(function(func, partials) { var holders = replaceHolders(partials, getHolder(partial)); return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders); }); /** * This method is like `_.partial` except that partially applied arguments * are appended to the arguments it receives. * * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic * builds, may be used as a placeholder for partially applied arguments. * * **Note:** This method doesn't set the "length" property of partially * applied functions. * * @static * @memberOf _ * @since 1.0.0 * @category Function * @param {Function} func The function to partially apply arguments to. * @param {...*} [partials] The arguments to be partially applied. * @returns {Function} Returns the new partially applied function. * @example * * function greet(greeting, name) { * return greeting + ' ' + name; * } * * var greetFred = _.partialRight(greet, 'fred'); * greetFred('hi'); * // => 'hi fred' * * // Partially applied with placeholders. * var sayHelloTo = _.partialRight(greet, 'hello', _); * sayHelloTo('fred'); * // => 'hello fred' */ var partialRight = baseRest(function(func, partials) { var holders = replaceHolders(partials, getHolder(partialRight)); return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders); }); /** * Creates a function that invokes `func` with arguments arranged according * to the specified `indexes` where the argument value at the first index is * provided as the first argument, the argument value at the second index is * provided as the second argument, and so on. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {Function} func The function to rearrange arguments for. * @param {...(number|number[])} indexes The arranged argument indexes. * @returns {Function} Returns the new function. * @example * * var rearged = _.rearg(function(a, b, c) { * return [a, b, c]; * }, [2, 0, 1]); * * rearged('b', 'c', 'a') * // => ['a', 'b', 'c'] */ var rearg = flatRest(function(func, indexes) { return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes); }); /** * Creates a function that invokes `func` with the `this` binding of the * created function and arguments from `start` and beyond provided as * an array. * * **Note:** This method is based on the * [rest parameter](https://mdn.io/rest_parameters). * * @static * @memberOf _ * @since 4.0.0 * @category Function * @param {Function} func The function to apply a rest parameter to. * @param {number} [start=func.length-1] The start position of the rest parameter. * @returns {Function} Returns the new function. * @example * * var say = _.rest(function(what, names) { * return what + ' ' + _.initial(names).join(', ') + * (_.size(names) > 1 ? ', & ' : '') + _.last(names); * }); * * say('hello', 'fred', 'barney', 'pebbles'); * // => 'hello fred, barney, & pebbles' */ function rest(func, start) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } start = start === undefined ? start : toInteger(start); return baseRest(func, start); } /** * Creates a function that invokes `func` with the `this` binding of the * create function and an array of arguments much like * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply). * * **Note:** This method is based on the * [spread operator](https://mdn.io/spread_operator). * * @static * @memberOf _ * @since 3.2.0 * @category Function * @param {Function} func The function to spread arguments over. * @param {number} [start=0] The start position of the spread. * @returns {Function} Returns the new function. * @example * * var say = _.spread(function(who, what) { * return who + ' says ' + what; * }); * * say(['fred', 'hello']); * // => 'fred says hello' * * var numbers = Promise.all([ * Promise.resolve(40), * Promise.resolve(36) * ]); * * numbers.then(_.spread(function(x, y) { * return x + y; * })); * // => a Promise of 76 */ function spread(func, start) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } start = start == null ? 0 : nativeMax(toInteger(start), 0); return baseRest(function(args) { var array = args[start], otherArgs = castSlice(args, 0, start); if (array) { arrayPush(otherArgs, array); } return apply(func, this, otherArgs); }); } /** * Creates a throttled function that only invokes `func` at most once per * every `wait` milliseconds. The throttled function comes with a `cancel` * method to cancel delayed `func` invocations and a `flush` method to * immediately invoke them. Provide `options` to indicate whether `func` * should be invoked on the leading and/or trailing edge of the `wait` * timeout. The `func` is invoked with the last arguments provided to the * throttled function. Subsequent calls to the throttled function return the * result of the last `func` invocation. * * **Note:** If `leading` and `trailing` options are `true`, `func` is * invoked on the trailing edge of the timeout only if the throttled function * is invoked more than once during the `wait` timeout. * * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred * until to the next tick, similar to `setTimeout` with a timeout of `0`. * * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) * for details over the differences between `_.throttle` and `_.debounce`. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to throttle. * @param {number} [wait=0] The number of milliseconds to throttle invocations to. * @param {Object} [options={}] The options object. * @param {boolean} [options.leading=true] * Specify invoking on the leading edge of the timeout. * @param {boolean} [options.trailing=true] * Specify invoking on the trailing edge of the timeout. * @returns {Function} Returns the new throttled function. * @example * * // Avoid excessively updating the position while scrolling. * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); * * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); * jQuery(element).on('click', throttled); * * // Cancel the trailing throttled invocation. * jQuery(window).on('popstate', throttled.cancel); */ function throttle(func, wait, options) { var leading = true, trailing = true; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } if (isObject(options)) { leading = 'leading' in options ? !!options.leading : leading; trailing = 'trailing' in options ? !!options.trailing : trailing; } return debounce(func, wait, { 'leading': leading, 'maxWait': wait, 'trailing': trailing }); } /** * Creates a function that accepts up to one argument, ignoring any * additional arguments. * * @static * @memberOf _ * @since 4.0.0 * @category Function * @param {Function} func The function to cap arguments for. * @returns {Function} Returns the new capped function. * @example * * _.map(['6', '8', '10'], _.unary(parseInt)); * // => [6, 8, 10] */ function unary(func) { return ary(func, 1); } /** * Creates a function that provides `value` to `wrapper` as its first * argument. Any additional arguments provided to the function are appended * to those provided to the `wrapper`. The wrapper is invoked with the `this` * binding of the created function. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {*} value The value to wrap. * @param {Function} [wrapper=identity] The wrapper function. * @returns {Function} Returns the new function. * @example * * var p = _.wrap(_.escape, function(func, text) { * return '
' + func(text) + '
'; * }); * * p('fred, barney, & pebbles'); * // => '
fred, barney, & pebbles
' */ function wrap(value, wrapper) { return partial(castFunction(wrapper), value); } /*------------------------------------------------------------------------*/ /** * Casts `value` as an array if it's not one. * * @static * @memberOf _ * @since 4.4.0 * @category Lang * @param {*} value The value to inspect. * @returns {Array} Returns the cast array. * @example * * _.castArray(1); * // => [1] * * _.castArray({ 'a': 1 }); * // => [{ 'a': 1 }] * * _.castArray('abc'); * // => ['abc'] * * _.castArray(null); * // => [null] * * _.castArray(undefined); * // => [undefined] * * _.castArray(); * // => [] * * var array = [1, 2, 3]; * console.log(_.castArray(array) === array); * // => true */ function castArray() { if (!arguments.length) { return []; } var value = arguments[0]; return isArray(value) ? value : [value]; } /** * Creates a shallow clone of `value`. * * **Note:** This method is loosely based on the * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm) * and supports cloning arrays, array buffers, booleans, date objects, maps, * numbers, `Object` objects, regexes, sets, strings, symbols, and typed * arrays. The own enumerable properties of `arguments` objects are cloned * as plain objects. An empty object is returned for uncloneable values such * as error objects, functions, DOM nodes, and WeakMaps. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to clone. * @returns {*} Returns the cloned value. * @see _.cloneDeep * @example * * var objects = [{ 'a': 1 }, { 'b': 2 }]; * * var shallow = _.clone(objects); * console.log(shallow[0] === objects[0]); * // => true */ function clone(value) { return baseClone(value, CLONE_SYMBOLS_FLAG); } /** * This method is like `_.clone` except that it accepts `customizer` which * is invoked to produce the cloned value. If `customizer` returns `undefined`, * cloning is handled by the method instead. The `customizer` is invoked with * up to four arguments; (value [, index|key, object, stack]). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to clone. * @param {Function} [customizer] The function to customize cloning. * @returns {*} Returns the cloned value. * @see _.cloneDeepWith * @example * * function customizer(value) { * if (_.isElement(value)) { * return value.cloneNode(false); * } * } * * var el = _.cloneWith(document.body, customizer); * * console.log(el === document.body); * // => false * console.log(el.nodeName); * // => 'BODY' * console.log(el.childNodes.length); * // => 0 */ function cloneWith(value, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); } /** * This method is like `_.clone` except that it recursively clones `value`. * * @static * @memberOf _ * @since 1.0.0 * @category Lang * @param {*} value The value to recursively clone. * @returns {*} Returns the deep cloned value. * @see _.clone * @example * * var objects = [{ 'a': 1 }, { 'b': 2 }]; * * var deep = _.cloneDeep(objects); * console.log(deep[0] === objects[0]); * // => false */ function cloneDeep(value) { return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); } /** * This method is like `_.cloneWith` except that it recursively clones `value`. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to recursively clone. * @param {Function} [customizer] The function to customize cloning. * @returns {*} Returns the deep cloned value. * @see _.cloneWith * @example * * function customizer(value) { * if (_.isElement(value)) { * return value.cloneNode(true); * } * } * * var el = _.cloneDeepWith(document.body, customizer); * * console.log(el === document.body); * // => false * console.log(el.nodeName); * // => 'BODY' * console.log(el.childNodes.length); * // => 20 */ function cloneDeepWith(value, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer); } /** * Checks if `object` conforms to `source` by invoking the predicate * properties of `source` with the corresponding property values of `object`. * * **Note:** This method is equivalent to `_.conforms` when `source` is * partially applied. * * @static * @memberOf _ * @since 4.14.0 * @category Lang * @param {Object} object The object to inspect. * @param {Object} source The object of property predicates to conform to. * @returns {boolean} Returns `true` if `object` conforms, else `false`. * @example * * var object = { 'a': 1, 'b': 2 }; * * _.conformsTo(object, { 'b': function(n) { return n > 1; } }); * // => true * * _.conformsTo(object, { 'b': function(n) { return n > 2; } }); * // => false */ function conformsTo(object, source) { return source == null || baseConformsTo(object, source, keys(source)); } /** * Performs a * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * comparison between two values to determine if they are equivalent. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if the values are equivalent, else `false`. * @example * * var object = { 'a': 1 }; * var other = { 'a': 1 }; * * _.eq(object, object); * // => true * * _.eq(object, other); * // => false * * _.eq('a', 'a'); * // => true * * _.eq('a', Object('a')); * // => false * * _.eq(NaN, NaN); * // => true */ function eq(value, other) { return value === other || (value !== value && other !== other); } /** * Checks if `value` is greater than `other`. * * @static * @memberOf _ * @since 3.9.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is greater than `other`, * else `false`. * @see _.lt * @example * * _.gt(3, 1); * // => true * * _.gt(3, 3); * // => false * * _.gt(1, 3); * // => false */ var gt = createRelationalOperation(baseGt); /** * Checks if `value` is greater than or equal to `other`. * * @static * @memberOf _ * @since 3.9.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is greater than or equal to * `other`, else `false`. * @see _.lte * @example * * _.gte(3, 1); * // => true * * _.gte(3, 3); * // => true * * _.gte(1, 3); * // => false */ var gte = createRelationalOperation(function(value, other) { return value >= other; }); /** * Checks if `value` is likely an `arguments` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an `arguments` object, * else `false`. * @example * * _.isArguments(function() { return arguments; }()); * // => true * * _.isArguments([1, 2, 3]); * // => false */ var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) { return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && !propertyIsEnumerable.call(value, 'callee'); }; /** * Checks if `value` is classified as an `Array` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an array, else `false`. * @example * * _.isArray([1, 2, 3]); * // => true * * _.isArray(document.body.children); * // => false * * _.isArray('abc'); * // => false * * _.isArray(_.noop); * // => false */ var isArray = Array.isArray; /** * Checks if `value` is classified as an `ArrayBuffer` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. * @example * * _.isArrayBuffer(new ArrayBuffer(2)); * // => true * * _.isArrayBuffer(new Array(2)); * // => false */ var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer; /** * Checks if `value` is array-like. A value is considered array-like if it's * not a function and has a `value.length` that's an integer greater than or * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is array-like, else `false`. * @example * * _.isArrayLike([1, 2, 3]); * // => true * * _.isArrayLike(document.body.children); * // => true * * _.isArrayLike('abc'); * // => true * * _.isArrayLike(_.noop); * // => false */ function isArrayLike(value) { return value != null && isLength(value.length) && !isFunction(value); } /** * This method is like `_.isArrayLike` except that it also checks if `value` * is an object. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an array-like object, * else `false`. * @example * * _.isArrayLikeObject([1, 2, 3]); * // => true * * _.isArrayLikeObject(document.body.children); * // => true * * _.isArrayLikeObject('abc'); * // => false * * _.isArrayLikeObject(_.noop); * // => false */ function isArrayLikeObject(value) { return isObjectLike(value) && isArrayLike(value); } /** * Checks if `value` is classified as a boolean primitive or object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a boolean, else `false`. * @example * * _.isBoolean(false); * // => true * * _.isBoolean(null); * // => false */ function isBoolean(value) { return value === true || value === false || (isObjectLike(value) && baseGetTag(value) == boolTag); } /** * Checks if `value` is a buffer. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. * @example * * _.isBuffer(new Buffer(2)); * // => true * * _.isBuffer(new Uint8Array(2)); * // => false */ var isBuffer = nativeIsBuffer || stubFalse; /** * Checks if `value` is classified as a `Date` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a date object, else `false`. * @example * * _.isDate(new Date); * // => true * * _.isDate('Mon April 23 2012'); * // => false */ var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; /** * Checks if `value` is likely a DOM element. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. * @example * * _.isElement(document.body); * // => true * * _.isElement(''); * // => false */ function isElement(value) { return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value); } /** * Checks if `value` is an empty object, collection, map, or set. * * Objects are considered empty if they have no own enumerable string keyed * properties. * * Array-like values such as `arguments` objects, arrays, buffers, strings, or * jQuery-like collections are considered empty if they have a `length` of `0`. * Similarly, maps and sets are considered empty if they have a `size` of `0`. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is empty, else `false`. * @example * * _.isEmpty(null); * // => true * * _.isEmpty(true); * // => true * * _.isEmpty(1); * // => true * * _.isEmpty([1, 2, 3]); * // => false * * _.isEmpty({ 'a': 1 }); * // => false */ function isEmpty(value) { if (value == null) { return true; } if (isArrayLike(value) && (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' || isBuffer(value) || isTypedArray(value) || isArguments(value))) { return !value.length; } var tag = getTag(value); if (tag == mapTag || tag == setTag) { return !value.size; } if (isPrototype(value)) { return !baseKeys(value).length; } for (var key in value) { if (hasOwnProperty.call(value, key)) { return false; } } return true; } /** * Performs a deep comparison between two values to determine if they are * equivalent. * * **Note:** This method supports comparing arrays, array buffers, booleans, * date objects, error objects, maps, numbers, `Object` objects, regexes, * sets, strings, symbols, and typed arrays. `Object` objects are compared * by their own, not inherited, enumerable properties. Functions and DOM * nodes are compared by strict equality, i.e. `===`. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if the values are equivalent, else `false`. * @example * * var object = { 'a': 1 }; * var other = { 'a': 1 }; * * _.isEqual(object, other); * // => true * * object === other; * // => false */ function isEqual(value, other) { return baseIsEqual(value, other); } /** * This method is like `_.isEqual` except that it accepts `customizer` which * is invoked to compare values. If `customizer` returns `undefined`, comparisons * are handled by the method instead. The `customizer` is invoked with up to * six arguments: (objValue, othValue [, index|key, object, other, stack]). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @param {Function} [customizer] The function to customize comparisons. * @returns {boolean} Returns `true` if the values are equivalent, else `false`. * @example * * function isGreeting(value) { * return /^h(?:i|ello)$/.test(value); * } * * function customizer(objValue, othValue) { * if (isGreeting(objValue) && isGreeting(othValue)) { * return true; * } * } * * var array = ['hello', 'goodbye']; * var other = ['hi', 'goodbye']; * * _.isEqualWith(array, other, customizer); * // => true */ function isEqualWith(value, other, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; var result = customizer ? customizer(value, other) : undefined; return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result; } /** * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`, * `SyntaxError`, `TypeError`, or `URIError` object. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an error object, else `false`. * @example * * _.isError(new Error); * // => true * * _.isError(Error); * // => false */ function isError(value) { if (!isObjectLike(value)) { return false; } var tag = baseGetTag(value); return tag == errorTag || tag == domExcTag || (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value)); } /** * Checks if `value` is a finite primitive number. * * **Note:** This method is based on * [`Number.isFinite`](https://mdn.io/Number/isFinite). * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a finite number, else `false`. * @example * * _.isFinite(3); * // => true * * _.isFinite(Number.MIN_VALUE); * // => true * * _.isFinite(Infinity); * // => false * * _.isFinite('3'); * // => false */ function isFinite(value) { return typeof value == 'number' && nativeIsFinite(value); } /** * Checks if `value` is classified as a `Function` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a function, else `false`. * @example * * _.isFunction(_); * // => true * * _.isFunction(/abc/); * // => false */ function isFunction(value) { if (!isObject(value)) { return false; } // The use of `Object#toString` avoids issues with the `typeof` operator // in Safari 9 which returns 'object' for typed arrays and other constructors. var tag = baseGetTag(value); return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag; } /** * Checks if `value` is an integer. * * **Note:** This method is based on * [`Number.isInteger`](https://mdn.io/Number/isInteger). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an integer, else `false`. * @example * * _.isInteger(3); * // => true * * _.isInteger(Number.MIN_VALUE); * // => false * * _.isInteger(Infinity); * // => false * * _.isInteger('3'); * // => false */ function isInteger(value) { return typeof value == 'number' && value == toInteger(value); } /** * Checks if `value` is a valid array-like length. * * **Note:** This method is loosely based on * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. * @example * * _.isLength(3); * // => true * * _.isLength(Number.MIN_VALUE); * // => false * * _.isLength(Infinity); * // => false * * _.isLength('3'); * // => false */ function isLength(value) { return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; } /** * Checks if `value` is the * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an object, else `false`. * @example * * _.isObject({}); * // => true * * _.isObject([1, 2, 3]); * // => true * * _.isObject(_.noop); * // => true * * _.isObject(null); * // => false */ function isObject(value) { var type = typeof value; return value != null && (type == 'object' || type == 'function'); } /** * Checks if `value` is object-like. A value is object-like if it's not `null` * and has a `typeof` result of "object". * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is object-like, else `false`. * @example * * _.isObjectLike({}); * // => true * * _.isObjectLike([1, 2, 3]); * // => true * * _.isObjectLike(_.noop); * // => false * * _.isObjectLike(null); * // => false */ function isObjectLike(value) { return value != null && typeof value == 'object'; } /** * Checks if `value` is classified as a `Map` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a map, else `false`. * @example * * _.isMap(new Map); * // => true * * _.isMap(new WeakMap); * // => false */ var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap; /** * Performs a partial deep comparison between `object` and `source` to * determine if `object` contains equivalent property values. * * **Note:** This method is equivalent to `_.matches` when `source` is * partially applied. * * Partial comparisons will match empty array and empty object `source` * values against any array or object value, respectively. See `_.isEqual` * for a list of supported value comparisons. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {Object} object The object to inspect. * @param {Object} source The object of property values to match. * @returns {boolean} Returns `true` if `object` is a match, else `false`. * @example * * var object = { 'a': 1, 'b': 2 }; * * _.isMatch(object, { 'b': 2 }); * // => true * * _.isMatch(object, { 'b': 1 }); * // => false */ function isMatch(object, source) { return object === source || baseIsMatch(object, source, getMatchData(source)); } /** * This method is like `_.isMatch` except that it accepts `customizer` which * is invoked to compare values. If `customizer` returns `undefined`, comparisons * are handled by the method instead. The `customizer` is invoked with five * arguments: (objValue, srcValue, index|key, object, source). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {Object} object The object to inspect. * @param {Object} source The object of property values to match. * @param {Function} [customizer] The function to customize comparisons. * @returns {boolean} Returns `true` if `object` is a match, else `false`. * @example * * function isGreeting(value) { * return /^h(?:i|ello)$/.test(value); * } * * function customizer(objValue, srcValue) { * if (isGreeting(objValue) && isGreeting(srcValue)) { * return true; * } * } * * var object = { 'greeting': 'hello' }; * var source = { 'greeting': 'hi' }; * * _.isMatchWith(object, source, customizer); * // => true */ function isMatchWith(object, source, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return baseIsMatch(object, source, getMatchData(source), customizer); } /** * Checks if `value` is `NaN`. * * **Note:** This method is based on * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for * `undefined` and other non-number values. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. * @example * * _.isNaN(NaN); * // => true * * _.isNaN(new Number(NaN)); * // => true * * isNaN(undefined); * // => true * * _.isNaN(undefined); * // => false */ function isNaN(value) { // An `NaN` primitive is the only value that is not equal to itself. // Perform the `toStringTag` check first to avoid errors with some // ActiveX objects in IE. return isNumber(value) && value != +value; } /** * Checks if `value` is a pristine native function. * * **Note:** This method can't reliably detect native functions in the presence * of the core-js package because core-js circumvents this kind of detection. * Despite multiple requests, the core-js maintainer has made it clear: any * attempt to fix the detection will be obstructed. As a result, we're left * with little choice but to throw an error. Unfortunately, this also affects * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill), * which rely on core-js. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a native function, * else `false`. * @example * * _.isNative(Array.prototype.push); * // => true * * _.isNative(_); * // => false */ function isNative(value) { if (isMaskable(value)) { throw new Error(CORE_ERROR_TEXT); } return baseIsNative(value); } /** * Checks if `value` is `null`. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is `null`, else `false`. * @example * * _.isNull(null); * // => true * * _.isNull(void 0); * // => false */ function isNull(value) { return value === null; } /** * Checks if `value` is `null` or `undefined`. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is nullish, else `false`. * @example * * _.isNil(null); * // => true * * _.isNil(void 0); * // => true * * _.isNil(NaN); * // => false */ function isNil(value) { return value == null; } /** * Checks if `value` is classified as a `Number` primitive or object. * * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are * classified as numbers, use the `_.isFinite` method. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a number, else `false`. * @example * * _.isNumber(3); * // => true * * _.isNumber(Number.MIN_VALUE); * // => true * * _.isNumber(Infinity); * // => true * * _.isNumber('3'); * // => false */ function isNumber(value) { return typeof value == 'number' || (isObjectLike(value) && baseGetTag(value) == numberTag); } /** * Checks if `value` is a plain object, that is, an object created by the * `Object` constructor or one with a `[[Prototype]]` of `null`. * * @static * @memberOf _ * @since 0.8.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. * @example * * function Foo() { * this.a = 1; * } * * _.isPlainObject(new Foo); * // => false * * _.isPlainObject([1, 2, 3]); * // => false * * _.isPlainObject({ 'x': 0, 'y': 0 }); * // => true * * _.isPlainObject(Object.create(null)); * // => true */ function isPlainObject(value) { if (!isObjectLike(value) || baseGetTag(value) != objectTag) { return false; } var proto = getPrototype(value); if (proto === null) { return true; } var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor; return typeof Ctor == 'function' && Ctor instanceof Ctor && funcToString.call(Ctor) == objectCtorString; } /** * Checks if `value` is classified as a `RegExp` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. * @example * * _.isRegExp(/abc/); * // => true * * _.isRegExp('/abc/'); * // => false */ var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp; /** * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754 * double precision number which isn't the result of a rounded unsafe integer. * * **Note:** This method is based on * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`. * @example * * _.isSafeInteger(3); * // => true * * _.isSafeInteger(Number.MIN_VALUE); * // => false * * _.isSafeInteger(Infinity); * // => false * * _.isSafeInteger('3'); * // => false */ function isSafeInteger(value) { return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER; } /** * Checks if `value` is classified as a `Set` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a set, else `false`. * @example * * _.isSet(new Set); * // => true * * _.isSet(new WeakSet); * // => false */ var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet; /** * Checks if `value` is classified as a `String` primitive or object. * * @static * @since 0.1.0 * @memberOf _ * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a string, else `false`. * @example * * _.isString('abc'); * // => true * * _.isString(1); * // => false */ function isString(value) { return typeof value == 'string' || (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag); } /** * Checks if `value` is classified as a `Symbol` primitive or object. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. * @example * * _.isSymbol(Symbol.iterator); * // => true * * _.isSymbol('abc'); * // => false */ function isSymbol(value) { return typeof value == 'symbol' || (isObjectLike(value) && baseGetTag(value) == symbolTag); } /** * Checks if `value` is classified as a typed array. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. * @example * * _.isTypedArray(new Uint8Array); * // => true * * _.isTypedArray([]); * // => false */ var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray; /** * Checks if `value` is `undefined`. * * @static * @since 0.1.0 * @memberOf _ * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`. * @example * * _.isUndefined(void 0); * // => true * * _.isUndefined(null); * // => false */ function isUndefined(value) { return value === undefined; } /** * Checks if `value` is classified as a `WeakMap` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a weak map, else `false`. * @example * * _.isWeakMap(new WeakMap); * // => true * * _.isWeakMap(new Map); * // => false */ function isWeakMap(value) { return isObjectLike(value) && getTag(value) == weakMapTag; } /** * Checks if `value` is classified as a `WeakSet` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a weak set, else `false`. * @example * * _.isWeakSet(new WeakSet); * // => true * * _.isWeakSet(new Set); * // => false */ function isWeakSet(value) { return isObjectLike(value) && baseGetTag(value) == weakSetTag; } /** * Checks if `value` is less than `other`. * * @static * @memberOf _ * @since 3.9.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is less than `other`, * else `false`. * @see _.gt * @example * * _.lt(1, 3); * // => true * * _.lt(3, 3); * // => false * * _.lt(3, 1); * // => false */ var lt = createRelationalOperation(baseLt); /** * Checks if `value` is less than or equal to `other`. * * @static * @memberOf _ * @since 3.9.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is less than or equal to * `other`, else `false`. * @see _.gte * @example * * _.lte(1, 3); * // => true * * _.lte(3, 3); * // => true * * _.lte(3, 1); * // => false */ var lte = createRelationalOperation(function(value, other) { return value <= other; }); /** * Converts `value` to an array. * * @static * @since 0.1.0 * @memberOf _ * @category Lang * @param {*} value The value to convert. * @returns {Array} Returns the converted array. * @example * * _.toArray({ 'a': 1, 'b': 2 }); * // => [1, 2] * * _.toArray('abc'); * // => ['a', 'b', 'c'] * * _.toArray(1); * // => [] * * _.toArray(null); * // => [] */ function toArray(value) { if (!value) { return []; } if (isArrayLike(value)) { return isString(value) ? stringToArray(value) : copyArray(value); } if (symIterator && value[symIterator]) { return iteratorToArray(value[symIterator]()); } var tag = getTag(value), func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values); return func(value); } /** * Converts `value` to a finite number. * * @static * @memberOf _ * @since 4.12.0 * @category Lang * @param {*} value The value to convert. * @returns {number} Returns the converted number. * @example * * _.toFinite(3.2); * // => 3.2 * * _.toFinite(Number.MIN_VALUE); * // => 5e-324 * * _.toFinite(Infinity); * // => 1.7976931348623157e+308 * * _.toFinite('3.2'); * // => 3.2 */ function toFinite(value) { if (!value) { return value === 0 ? value : 0; } value = toNumber(value); if (value === INFINITY || value === -INFINITY) { var sign = (value < 0 ? -1 : 1); return sign * MAX_INTEGER; } return value === value ? value : 0; } /** * Converts `value` to an integer. * * **Note:** This method is loosely based on * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to convert. * @returns {number} Returns the converted integer. * @example * * _.toInteger(3.2); * // => 3 * * _.toInteger(Number.MIN_VALUE); * // => 0 * * _.toInteger(Infinity); * // => 1.7976931348623157e+308 * * _.toInteger('3.2'); * // => 3 */ function toInteger(value) { var result = toFinite(value), remainder = result % 1; return result === result ? (remainder ? result - remainder : result) : 0; } /** * Converts `value` to an integer suitable for use as the length of an * array-like object. * * **Note:** This method is based on * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to convert. * @returns {number} Returns the converted integer. * @example * * _.toLength(3.2); * // => 3 * * _.toLength(Number.MIN_VALUE); * // => 0 * * _.toLength(Infinity); * // => 4294967295 * * _.toLength('3.2'); * // => 3 */ function toLength(value) { return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0; } /** * Converts `value` to a number. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to process. * @returns {number} Returns the number. * @example * * _.toNumber(3.2); * // => 3.2 * * _.toNumber(Number.MIN_VALUE); * // => 5e-324 * * _.toNumber(Infinity); * // => Infinity * * _.toNumber('3.2'); * // => 3.2 */ function toNumber(value) { if (typeof value == 'number') { return value; } if (isSymbol(value)) { return NAN; } if (isObject(value)) { var other = typeof value.valueOf == 'function' ? value.valueOf() : value; value = isObject(other) ? (other + '') : other; } if (typeof value != 'string') { return value === 0 ? value : +value; } value = value.replace(reTrim, ''); var isBinary = reIsBinary.test(value); return (isBinary || reIsOctal.test(value)) ? freeParseInt(value.slice(2), isBinary ? 2 : 8) : (reIsBadHex.test(value) ? NAN : +value); } /** * Converts `value` to a plain object flattening inherited enumerable string * keyed properties of `value` to own properties of the plain object. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {*} value The value to convert. * @returns {Object} Returns the converted plain object. * @example * * function Foo() { * this.b = 2; * } * * Foo.prototype.c = 3; * * _.assign({ 'a': 1 }, new Foo); * // => { 'a': 1, 'b': 2 } * * _.assign({ 'a': 1 }, _.toPlainObject(new Foo)); * // => { 'a': 1, 'b': 2, 'c': 3 } */ function toPlainObject(value) { return copyObject(value, keysIn(value)); } /** * Converts `value` to a safe integer. A safe integer can be compared and * represented correctly. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to convert. * @returns {number} Returns the converted integer. * @example * * _.toSafeInteger(3.2); * // => 3 * * _.toSafeInteger(Number.MIN_VALUE); * // => 0 * * _.toSafeInteger(Infinity); * // => 9007199254740991 * * _.toSafeInteger('3.2'); * // => 3 */ function toSafeInteger(value) { return value ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER) : (value === 0 ? value : 0); } /** * Converts `value` to a string. An empty string is returned for `null` * and `undefined` values. The sign of `-0` is preserved. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to convert. * @returns {string} Returns the converted string. * @example * * _.toString(null); * // => '' * * _.toString(-0); * // => '-0' * * _.toString([1, 2, 3]); * // => '1,2,3' */ function toString(value) { return value == null ? '' : baseToString(value); } /*------------------------------------------------------------------------*/ /** * Assigns own enumerable string keyed properties of source objects to the * destination object. Source objects are applied from left to right. * Subsequent sources overwrite property assignments of previous sources. * * **Note:** This method mutates `object` and is loosely based on * [`Object.assign`](https://mdn.io/Object/assign). * * @static * @memberOf _ * @since 0.10.0 * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @see _.assignIn * @example * * function Foo() { * this.a = 1; * } * * function Bar() { * this.c = 3; * } * * Foo.prototype.b = 2; * Bar.prototype.d = 4; * * _.assign({ 'a': 0 }, new Foo, new Bar); * // => { 'a': 1, 'c': 3 } */ var assign = createAssigner(function(object, source) { if (isPrototype(source) || isArrayLike(source)) { copyObject(source, keys(source), object); return; } for (var key in source) { if (hasOwnProperty.call(source, key)) { assignValue(object, key, source[key]); } } }); /** * This method is like `_.assign` except that it iterates over own and * inherited source properties. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @alias extend * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @see _.assign * @example * * function Foo() { * this.a = 1; * } * * function Bar() { * this.c = 3; * } * * Foo.prototype.b = 2; * Bar.prototype.d = 4; * * _.assignIn({ 'a': 0 }, new Foo, new Bar); * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 } */ var assignIn = createAssigner(function(object, source) { copyObject(source, keysIn(source), object); }); /** * This method is like `_.assignIn` except that it accepts `customizer` * which is invoked to produce the assigned values. If `customizer` returns * `undefined`, assignment is handled by the method instead. The `customizer` * is invoked with five arguments: (objValue, srcValue, key, object, source). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @alias extendWith * @category Object * @param {Object} object The destination object. * @param {...Object} sources The source objects. * @param {Function} [customizer] The function to customize assigned values. * @returns {Object} Returns `object`. * @see _.assignWith * @example * * function customizer(objValue, srcValue) { * return _.isUndefined(objValue) ? srcValue : objValue; * } * * var defaults = _.partialRight(_.assignInWith, customizer); * * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); * // => { 'a': 1, 'b': 2 } */ var assignInWith = createAssigner(function(object, source, srcIndex, customizer) { copyObject(source, keysIn(source), object, customizer); }); /** * This method is like `_.assign` except that it accepts `customizer` * which is invoked to produce the assigned values. If `customizer` returns * `undefined`, assignment is handled by the method instead. The `customizer` * is invoked with five arguments: (objValue, srcValue, key, object, source). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The destination object. * @param {...Object} sources The source objects. * @param {Function} [customizer] The function to customize assigned values. * @returns {Object} Returns `object`. * @see _.assignInWith * @example * * function customizer(objValue, srcValue) { * return _.isUndefined(objValue) ? srcValue : objValue; * } * * var defaults = _.partialRight(_.assignWith, customizer); * * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); * // => { 'a': 1, 'b': 2 } */ var assignWith = createAssigner(function(object, source, srcIndex, customizer) { copyObject(source, keys(source), object, customizer); }); /** * Creates an array of values corresponding to `paths` of `object`. * * @static * @memberOf _ * @since 1.0.0 * @category Object * @param {Object} object The object to iterate over. * @param {...(string|string[])} [paths] The property paths to pick. * @returns {Array} Returns the picked values. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; * * _.at(object, ['a[0].b.c', 'a[1]']); * // => [3, 4] */ var at = flatRest(baseAt); /** * Creates an object that inherits from the `prototype` object. If a * `properties` object is given, its own enumerable string keyed properties * are assigned to the created object. * * @static * @memberOf _ * @since 2.3.0 * @category Object * @param {Object} prototype The object to inherit from. * @param {Object} [properties] The properties to assign to the object. * @returns {Object} Returns the new object. * @example * * function Shape() { * this.x = 0; * this.y = 0; * } * * function Circle() { * Shape.call(this); * } * * Circle.prototype = _.create(Shape.prototype, { * 'constructor': Circle * }); * * var circle = new Circle; * circle instanceof Circle; * // => true * * circle instanceof Shape; * // => true */ function create(prototype, properties) { var result = baseCreate(prototype); return properties == null ? result : baseAssign(result, properties); } /** * Assigns own and inherited enumerable string keyed properties of source * objects to the destination object for all destination properties that * resolve to `undefined`. Source objects are applied from left to right. * Once a property is set, additional values of the same property are ignored. * * **Note:** This method mutates `object`. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @see _.defaultsDeep * @example * * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); * // => { 'a': 1, 'b': 2 } */ var defaults = baseRest(function(object, sources) { object = Object(object); var index = -1; var length = sources.length; var guard = length > 2 ? sources[2] : undefined; if (guard && isIterateeCall(sources[0], sources[1], guard)) { length = 1; } while (++index < length) { var source = sources[index]; var props = keysIn(source); var propsIndex = -1; var propsLength = props.length; while (++propsIndex < propsLength) { var key = props[propsIndex]; var value = object[key]; if (value === undefined || (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) { object[key] = source[key]; } } } return object; }); /** * This method is like `_.defaults` except that it recursively assigns * default properties. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 3.10.0 * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @see _.defaults * @example * * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } }); * // => { 'a': { 'b': 2, 'c': 3 } } */ var defaultsDeep = baseRest(function(args) { args.push(undefined, customDefaultsMerge); return apply(mergeWith, undefined, args); }); /** * This method is like `_.find` except that it returns the key of the first * element `predicate` returns truthy for instead of the element itself. * * @static * @memberOf _ * @since 1.1.0 * @category Object * @param {Object} object The object to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {string|undefined} Returns the key of the matched element, * else `undefined`. * @example * * var users = { * 'barney': { 'age': 36, 'active': true }, * 'fred': { 'age': 40, 'active': false }, * 'pebbles': { 'age': 1, 'active': true } * }; * * _.findKey(users, function(o) { return o.age < 40; }); * // => 'barney' (iteration order is not guaranteed) * * // The `_.matches` iteratee shorthand. * _.findKey(users, { 'age': 1, 'active': true }); * // => 'pebbles' * * // The `_.matchesProperty` iteratee shorthand. * _.findKey(users, ['active', false]); * // => 'fred' * * // The `_.property` iteratee shorthand. * _.findKey(users, 'active'); * // => 'barney' */ function findKey(object, predicate) { return baseFindKey(object, getIteratee(predicate, 3), baseForOwn); } /** * This method is like `_.findKey` except that it iterates over elements of * a collection in the opposite order. * * @static * @memberOf _ * @since 2.0.0 * @category Object * @param {Object} object The object to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {string|undefined} Returns the key of the matched element, * else `undefined`. * @example * * var users = { * 'barney': { 'age': 36, 'active': true }, * 'fred': { 'age': 40, 'active': false }, * 'pebbles': { 'age': 1, 'active': true } * }; * * _.findLastKey(users, function(o) { return o.age < 40; }); * // => returns 'pebbles' assuming `_.findKey` returns 'barney' * * // The `_.matches` iteratee shorthand. * _.findLastKey(users, { 'age': 36, 'active': true }); * // => 'barney' * * // The `_.matchesProperty` iteratee shorthand. * _.findLastKey(users, ['active', false]); * // => 'fred' * * // The `_.property` iteratee shorthand. * _.findLastKey(users, 'active'); * // => 'pebbles' */ function findLastKey(object, predicate) { return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight); } /** * Iterates over own and inherited enumerable string keyed properties of an * object and invokes `iteratee` for each property. The iteratee is invoked * with three arguments: (value, key, object). Iteratee functions may exit * iteration early by explicitly returning `false`. * * @static * @memberOf _ * @since 0.3.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns `object`. * @see _.forInRight * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.forIn(new Foo, function(value, key) { * console.log(key); * }); * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed). */ function forIn(object, iteratee) { return object == null ? object : baseFor(object, getIteratee(iteratee, 3), keysIn); } /** * This method is like `_.forIn` except that it iterates over properties of * `object` in the opposite order. * * @static * @memberOf _ * @since 2.0.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns `object`. * @see _.forIn * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.forInRight(new Foo, function(value, key) { * console.log(key); * }); * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'. */ function forInRight(object, iteratee) { return object == null ? object : baseForRight(object, getIteratee(iteratee, 3), keysIn); } /** * Iterates over own enumerable string keyed properties of an object and * invokes `iteratee` for each property. The iteratee is invoked with three * arguments: (value, key, object). Iteratee functions may exit iteration * early by explicitly returning `false`. * * @static * @memberOf _ * @since 0.3.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns `object`. * @see _.forOwnRight * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.forOwn(new Foo, function(value, key) { * console.log(key); * }); * // => Logs 'a' then 'b' (iteration order is not guaranteed). */ function forOwn(object, iteratee) { return object && baseForOwn(object, getIteratee(iteratee, 3)); } /** * This method is like `_.forOwn` except that it iterates over properties of * `object` in the opposite order. * * @static * @memberOf _ * @since 2.0.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns `object`. * @see _.forOwn * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.forOwnRight(new Foo, function(value, key) { * console.log(key); * }); * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'. */ function forOwnRight(object, iteratee) { return object && baseForOwnRight(object, getIteratee(iteratee, 3)); } /** * Creates an array of function property names from own enumerable properties * of `object`. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to inspect. * @returns {Array} Returns the function names. * @see _.functionsIn * @example * * function Foo() { * this.a = _.constant('a'); * this.b = _.constant('b'); * } * * Foo.prototype.c = _.constant('c'); * * _.functions(new Foo); * // => ['a', 'b'] */ function functions(object) { return object == null ? [] : baseFunctions(object, keys(object)); } /** * Creates an array of function property names from own and inherited * enumerable properties of `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to inspect. * @returns {Array} Returns the function names. * @see _.functions * @example * * function Foo() { * this.a = _.constant('a'); * this.b = _.constant('b'); * } * * Foo.prototype.c = _.constant('c'); * * _.functionsIn(new Foo); * // => ['a', 'b', 'c'] */ function functionsIn(object) { return object == null ? [] : baseFunctions(object, keysIn(object)); } /** * Gets the value at `path` of `object`. If the resolved value is * `undefined`, the `defaultValue` is returned in its place. * * @static * @memberOf _ * @since 3.7.0 * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path of the property to get. * @param {*} [defaultValue] The value returned for `undefined` resolved values. * @returns {*} Returns the resolved value. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }] }; * * _.get(object, 'a[0].b.c'); * // => 3 * * _.get(object, ['a', '0', 'b', 'c']); * // => 3 * * _.get(object, 'a.b.c', 'default'); * // => 'default' */ function get(object, path, defaultValue) { var result = object == null ? undefined : baseGet(object, path); return result === undefined ? defaultValue : result; } /** * Checks if `path` is a direct property of `object`. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path to check. * @returns {boolean} Returns `true` if `path` exists, else `false`. * @example * * var object = { 'a': { 'b': 2 } }; * var other = _.create({ 'a': _.create({ 'b': 2 }) }); * * _.has(object, 'a'); * // => true * * _.has(object, 'a.b'); * // => true * * _.has(object, ['a', 'b']); * // => true * * _.has(other, 'a'); * // => false */ function has(object, path) { return object != null && hasPath(object, path, baseHas); } /** * Checks if `path` is a direct or inherited property of `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path to check. * @returns {boolean} Returns `true` if `path` exists, else `false`. * @example * * var object = _.create({ 'a': _.create({ 'b': 2 }) }); * * _.hasIn(object, 'a'); * // => true * * _.hasIn(object, 'a.b'); * // => true * * _.hasIn(object, ['a', 'b']); * // => true * * _.hasIn(object, 'b'); * // => false */ function hasIn(object, path) { return object != null && hasPath(object, path, baseHasIn); } /** * Creates an object composed of the inverted keys and values of `object`. * If `object` contains duplicate values, subsequent values overwrite * property assignments of previous values. * * @static * @memberOf _ * @since 0.7.0 * @category Object * @param {Object} object The object to invert. * @returns {Object} Returns the new inverted object. * @example * * var object = { 'a': 1, 'b': 2, 'c': 1 }; * * _.invert(object); * // => { '1': 'c', '2': 'b' } */ var invert = createInverter(function(result, value, key) { if (value != null && typeof value.toString != 'function') { value = nativeObjectToString.call(value); } result[value] = key; }, constant(identity)); /** * This method is like `_.invert` except that the inverted object is generated * from the results of running each element of `object` thru `iteratee`. The * corresponding inverted value of each inverted key is an array of keys * responsible for generating the inverted value. The iteratee is invoked * with one argument: (value). * * @static * @memberOf _ * @since 4.1.0 * @category Object * @param {Object} object The object to invert. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Object} Returns the new inverted object. * @example * * var object = { 'a': 1, 'b': 2, 'c': 1 }; * * _.invertBy(object); * // => { '1': ['a', 'c'], '2': ['b'] } * * _.invertBy(object, function(value) { * return 'group' + value; * }); * // => { 'group1': ['a', 'c'], 'group2': ['b'] } */ var invertBy = createInverter(function(result, value, key) { if (value != null && typeof value.toString != 'function') { value = nativeObjectToString.call(value); } if (hasOwnProperty.call(result, value)) { result[value].push(key); } else { result[value] = [key]; } }, getIteratee); /** * Invokes the method at `path` of `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path of the method to invoke. * @param {...*} [args] The arguments to invoke the method with. * @returns {*} Returns the result of the invoked method. * @example * * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] }; * * _.invoke(object, 'a[0].b.c.slice', 1, 3); * // => [2, 3] */ var invoke = baseRest(baseInvoke); /** * Creates an array of the own enumerable property names of `object`. * * **Note:** Non-object values are coerced to objects. See the * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) * for more details. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.keys(new Foo); * // => ['a', 'b'] (iteration order is not guaranteed) * * _.keys('hi'); * // => ['0', '1'] */ function keys(object) { return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); } /** * Creates an array of the own and inherited enumerable property names of `object`. * * **Note:** Non-object values are coerced to objects. * * @static * @memberOf _ * @since 3.0.0 * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.keysIn(new Foo); * // => ['a', 'b', 'c'] (iteration order is not guaranteed) */ function keysIn(object) { return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object); } /** * The opposite of `_.mapValues`; this method creates an object with the * same values as `object` and keys generated by running each own enumerable * string keyed property of `object` thru `iteratee`. The iteratee is invoked * with three arguments: (value, key, object). * * @static * @memberOf _ * @since 3.8.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns the new mapped object. * @see _.mapValues * @example * * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) { * return key + value; * }); * // => { 'a1': 1, 'b2': 2 } */ function mapKeys(object, iteratee) { var result = {}; iteratee = getIteratee(iteratee, 3); baseForOwn(object, function(value, key, object) { baseAssignValue(result, iteratee(value, key, object), value); }); return result; } /** * Creates an object with the same keys as `object` and values generated * by running each own enumerable string keyed property of `object` thru * `iteratee`. The iteratee is invoked with three arguments: * (value, key, object). * * @static * @memberOf _ * @since 2.4.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns the new mapped object. * @see _.mapKeys * @example * * var users = { * 'fred': { 'user': 'fred', 'age': 40 }, * 'pebbles': { 'user': 'pebbles', 'age': 1 } * }; * * _.mapValues(users, function(o) { return o.age; }); * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) * * // The `_.property` iteratee shorthand. * _.mapValues(users, 'age'); * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) */ function mapValues(object, iteratee) { var result = {}; iteratee = getIteratee(iteratee, 3); baseForOwn(object, function(value, key, object) { baseAssignValue(result, key, iteratee(value, key, object)); }); return result; } /** * This method is like `_.assign` except that it recursively merges own and * inherited enumerable string keyed properties of source objects into the * destination object. Source properties that resolve to `undefined` are * skipped if a destination value exists. Array and plain object properties * are merged recursively. Other objects and value types are overridden by * assignment. Source objects are applied from left to right. Subsequent * sources overwrite property assignments of previous sources. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 0.5.0 * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @example * * var object = { * 'a': [{ 'b': 2 }, { 'd': 4 }] * }; * * var other = { * 'a': [{ 'c': 3 }, { 'e': 5 }] * }; * * _.merge(object, other); * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] } */ var merge = createAssigner(function(object, source, srcIndex) { baseMerge(object, source, srcIndex); }); /** * This method is like `_.merge` except that it accepts `customizer` which * is invoked to produce the merged values of the destination and source * properties. If `customizer` returns `undefined`, merging is handled by the * method instead. The `customizer` is invoked with six arguments: * (objValue, srcValue, key, object, source, stack). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The destination object. * @param {...Object} sources The source objects. * @param {Function} customizer The function to customize assigned values. * @returns {Object} Returns `object`. * @example * * function customizer(objValue, srcValue) { * if (_.isArray(objValue)) { * return objValue.concat(srcValue); * } * } * * var object = { 'a': [1], 'b': [2] }; * var other = { 'a': [3], 'b': [4] }; * * _.mergeWith(object, other, customizer); * // => { 'a': [1, 3], 'b': [2, 4] } */ var mergeWith = createAssigner(function(object, source, srcIndex, customizer) { baseMerge(object, source, srcIndex, customizer); }); /** * The opposite of `_.pick`; this method creates an object composed of the * own and inherited enumerable property paths of `object` that are not omitted. * * **Note:** This method is considerably slower than `_.pick`. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The source object. * @param {...(string|string[])} [paths] The property paths to omit. * @returns {Object} Returns the new object. * @example * * var object = { 'a': 1, 'b': '2', 'c': 3 }; * * _.omit(object, ['a', 'c']); * // => { 'b': '2' } */ var omit = flatRest(function(object, paths) { var result = {}; if (object == null) { return result; } var isDeep = false; paths = arrayMap(paths, function(path) { path = castPath(path, object); isDeep || (isDeep = path.length > 1); return path; }); copyObject(object, getAllKeysIn(object), result); if (isDeep) { result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone); } var length = paths.length; while (length--) { baseUnset(result, paths[length]); } return result; }); /** * The opposite of `_.pickBy`; this method creates an object composed of * the own and inherited enumerable string keyed properties of `object` that * `predicate` doesn't return truthy for. The predicate is invoked with two * arguments: (value, key). * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The source object. * @param {Function} [predicate=_.identity] The function invoked per property. * @returns {Object} Returns the new object. * @example * * var object = { 'a': 1, 'b': '2', 'c': 3 }; * * _.omitBy(object, _.isNumber); * // => { 'b': '2' } */ function omitBy(object, predicate) { return pickBy(object, negate(getIteratee(predicate))); } /** * Creates an object composed of the picked `object` properties. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The source object. * @param {...(string|string[])} [paths] The property paths to pick. * @returns {Object} Returns the new object. * @example * * var object = { 'a': 1, 'b': '2', 'c': 3 }; * * _.pick(object, ['a', 'c']); * // => { 'a': 1, 'c': 3 } */ var pick = flatRest(function(object, paths) { return object == null ? {} : basePick(object, paths); }); /** * Creates an object composed of the `object` properties `predicate` returns * truthy for. The predicate is invoked with two arguments: (value, key). * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The source object. * @param {Function} [predicate=_.identity] The function invoked per property. * @returns {Object} Returns the new object. * @example * * var object = { 'a': 1, 'b': '2', 'c': 3 }; * * _.pickBy(object, _.isNumber); * // => { 'a': 1, 'c': 3 } */ function pickBy(object, predicate) { if (object == null) { return {}; } var props = arrayMap(getAllKeysIn(object), function(prop) { return [prop]; }); predicate = getIteratee(predicate); return basePickBy(object, props, function(value, path) { return predicate(value, path[0]); }); } /** * This method is like `_.get` except that if the resolved value is a * function it's invoked with the `this` binding of its parent object and * its result is returned. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path of the property to resolve. * @param {*} [defaultValue] The value returned for `undefined` resolved values. * @returns {*} Returns the resolved value. * @example * * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] }; * * _.result(object, 'a[0].b.c1'); * // => 3 * * _.result(object, 'a[0].b.c2'); * // => 4 * * _.result(object, 'a[0].b.c3', 'default'); * // => 'default' * * _.result(object, 'a[0].b.c3', _.constant('default')); * // => 'default' */ function result(object, path, defaultValue) { path = castPath(path, object); var index = -1, length = path.length; // Ensure the loop is entered when path is empty. if (!length) { length = 1; object = undefined; } while (++index < length) { var value = object == null ? undefined : object[toKey(path[index])]; if (value === undefined) { index = length; value = defaultValue; } object = isFunction(value) ? value.call(object) : value; } return object; } /** * Sets the value at `path` of `object`. If a portion of `path` doesn't exist, * it's created. Arrays are created for missing index properties while objects * are created for all other missing properties. Use `_.setWith` to customize * `path` creation. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 3.7.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {*} value The value to set. * @returns {Object} Returns `object`. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }] }; * * _.set(object, 'a[0].b.c', 4); * console.log(object.a[0].b.c); * // => 4 * * _.set(object, ['x', '0', 'y', 'z'], 5); * console.log(object.x[0].y.z); * // => 5 */ function set(object, path, value) { return object == null ? object : baseSet(object, path, value); } /** * This method is like `_.set` except that it accepts `customizer` which is * invoked to produce the objects of `path`. If `customizer` returns `undefined` * path creation is handled by the method instead. The `customizer` is invoked * with three arguments: (nsValue, key, nsObject). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {*} value The value to set. * @param {Function} [customizer] The function to customize assigned values. * @returns {Object} Returns `object`. * @example * * var object = {}; * * _.setWith(object, '[0][1]', 'a', Object); * // => { '0': { '1': 'a' } } */ function setWith(object, path, value, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return object == null ? object : baseSet(object, path, value, customizer); } /** * Creates an array of own enumerable string keyed-value pairs for `object` * which can be consumed by `_.fromPairs`. If `object` is a map or set, its * entries are returned. * * @static * @memberOf _ * @since 4.0.0 * @alias entries * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the key-value pairs. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.toPairs(new Foo); * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed) */ var toPairs = createToPairs(keys); /** * Creates an array of own and inherited enumerable string keyed-value pairs * for `object` which can be consumed by `_.fromPairs`. If `object` is a map * or set, its entries are returned. * * @static * @memberOf _ * @since 4.0.0 * @alias entriesIn * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the key-value pairs. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.toPairsIn(new Foo); * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed) */ var toPairsIn = createToPairs(keysIn); /** * An alternative to `_.reduce`; this method transforms `object` to a new * `accumulator` object which is the result of running each of its own * enumerable string keyed properties thru `iteratee`, with each invocation * potentially mutating the `accumulator` object. If `accumulator` is not * provided, a new object with the same `[[Prototype]]` will be used. The * iteratee is invoked with four arguments: (accumulator, value, key, object). * Iteratee functions may exit iteration early by explicitly returning `false`. * * @static * @memberOf _ * @since 1.3.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @param {*} [accumulator] The custom accumulator value. * @returns {*} Returns the accumulated value. * @example * * _.transform([2, 3, 4], function(result, n) { * result.push(n *= n); * return n % 2 == 0; * }, []); * // => [4, 9] * * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { * (result[value] || (result[value] = [])).push(key); * }, {}); * // => { '1': ['a', 'c'], '2': ['b'] } */ function transform(object, iteratee, accumulator) { var isArr = isArray(object), isArrLike = isArr || isBuffer(object) || isTypedArray(object); iteratee = getIteratee(iteratee, 4); if (accumulator == null) { var Ctor = object && object.constructor; if (isArrLike) { accumulator = isArr ? new Ctor : []; } else if (isObject(object)) { accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {}; } else { accumulator = {}; } } (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) { return iteratee(accumulator, value, index, object); }); return accumulator; } /** * Removes the property at `path` of `object`. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to unset. * @returns {boolean} Returns `true` if the property is deleted, else `false`. * @example * * var object = { 'a': [{ 'b': { 'c': 7 } }] }; * _.unset(object, 'a[0].b.c'); * // => true * * console.log(object); * // => { 'a': [{ 'b': {} }] }; * * _.unset(object, ['a', '0', 'b', 'c']); * // => true * * console.log(object); * // => { 'a': [{ 'b': {} }] }; */ function unset(object, path) { return object == null ? true : baseUnset(object, path); } /** * This method is like `_.set` except that accepts `updater` to produce the * value to set. Use `_.updateWith` to customize `path` creation. The `updater` * is invoked with one argument: (value). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.6.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {Function} updater The function to produce the updated value. * @returns {Object} Returns `object`. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }] }; * * _.update(object, 'a[0].b.c', function(n) { return n * n; }); * console.log(object.a[0].b.c); * // => 9 * * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; }); * console.log(object.x[0].y.z); * // => 0 */ function update(object, path, updater) { return object == null ? object : baseUpdate(object, path, castFunction(updater)); } /** * This method is like `_.update` except that it accepts `customizer` which is * invoked to produce the objects of `path`. If `customizer` returns `undefined` * path creation is handled by the method instead. The `customizer` is invoked * with three arguments: (nsValue, key, nsObject). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.6.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {Function} updater The function to produce the updated value. * @param {Function} [customizer] The function to customize assigned values. * @returns {Object} Returns `object`. * @example * * var object = {}; * * _.updateWith(object, '[0][1]', _.constant('a'), Object); * // => { '0': { '1': 'a' } } */ function updateWith(object, path, updater, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer); } /** * Creates an array of the own enumerable string keyed property values of `object`. * * **Note:** Non-object values are coerced to objects. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the array of property values. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.values(new Foo); * // => [1, 2] (iteration order is not guaranteed) * * _.values('hi'); * // => ['h', 'i'] */ function values(object) { return object == null ? [] : baseValues(object, keys(object)); } /** * Creates an array of the own and inherited enumerable string keyed property * values of `object`. * * **Note:** Non-object values are coerced to objects. * * @static * @memberOf _ * @since 3.0.0 * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the array of property values. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.valuesIn(new Foo); * // => [1, 2, 3] (iteration order is not guaranteed) */ function valuesIn(object) { return object == null ? [] : baseValues(object, keysIn(object)); } /*------------------------------------------------------------------------*/ /** * Clamps `number` within the inclusive `lower` and `upper` bounds. * * @static * @memberOf _ * @since 4.0.0 * @category Number * @param {number} number The number to clamp. * @param {number} [lower] The lower bound. * @param {number} upper The upper bound. * @returns {number} Returns the clamped number. * @example * * _.clamp(-10, -5, 5); * // => -5 * * _.clamp(10, -5, 5); * // => 5 */ function clamp(number, lower, upper) { if (upper === undefined) { upper = lower; lower = undefined; } if (upper !== undefined) { upper = toNumber(upper); upper = upper === upper ? upper : 0; } if (lower !== undefined) { lower = toNumber(lower); lower = lower === lower ? lower : 0; } return baseClamp(toNumber(number), lower, upper); } /** * Checks if `n` is between `start` and up to, but not including, `end`. If * `end` is not specified, it's set to `start` with `start` then set to `0`. * If `start` is greater than `end` the params are swapped to support * negative ranges. * * @static * @memberOf _ * @since 3.3.0 * @category Number * @param {number} number The number to check. * @param {number} [start=0] The start of the range. * @param {number} end The end of the range. * @returns {boolean} Returns `true` if `number` is in the range, else `false`. * @see _.range, _.rangeRight * @example * * _.inRange(3, 2, 4); * // => true * * _.inRange(4, 8); * // => true * * _.inRange(4, 2); * // => false * * _.inRange(2, 2); * // => false * * _.inRange(1.2, 2); * // => true * * _.inRange(5.2, 4); * // => false * * _.inRange(-3, -2, -6); * // => true */ function inRange(number, start, end) { start = toFinite(start); if (end === undefined) { end = start; start = 0; } else { end = toFinite(end); } number = toNumber(number); return baseInRange(number, start, end); } /** * Produces a random number between the inclusive `lower` and `upper` bounds. * If only one argument is provided a number between `0` and the given number * is returned. If `floating` is `true`, or either `lower` or `upper` are * floats, a floating-point number is returned instead of an integer. * * **Note:** JavaScript follows the IEEE-754 standard for resolving * floating-point values which can produce unexpected results. * * @static * @memberOf _ * @since 0.7.0 * @category Number * @param {number} [lower=0] The lower bound. * @param {number} [upper=1] The upper bound. * @param {boolean} [floating] Specify returning a floating-point number. * @returns {number} Returns the random number. * @example * * _.random(0, 5); * // => an integer between 0 and 5 * * _.random(5); * // => also an integer between 0 and 5 * * _.random(5, true); * // => a floating-point number between 0 and 5 * * _.random(1.2, 5.2); * // => a floating-point number between 1.2 and 5.2 */ function random(lower, upper, floating) { if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) { upper = floating = undefined; } if (floating === undefined) { if (typeof upper == 'boolean') { floating = upper; upper = undefined; } else if (typeof lower == 'boolean') { floating = lower; lower = undefined; } } if (lower === undefined && upper === undefined) { lower = 0; upper = 1; } else { lower = toFinite(lower); if (upper === undefined) { upper = lower; lower = 0; } else { upper = toFinite(upper); } } if (lower > upper) { var temp = lower; lower = upper; upper = temp; } if (floating || lower % 1 || upper % 1) { var rand = nativeRandom(); return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper); } return baseRandom(lower, upper); } /*------------------------------------------------------------------------*/ /** * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase). * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the camel cased string. * @example * * _.camelCase('Foo Bar'); * // => 'fooBar' * * _.camelCase('--foo-bar--'); * // => 'fooBar' * * _.camelCase('__FOO_BAR__'); * // => 'fooBar' */ var camelCase = createCompounder(function(result, word, index) { word = word.toLowerCase(); return result + (index ? capitalize(word) : word); }); /** * Converts the first character of `string` to upper case and the remaining * to lower case. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to capitalize. * @returns {string} Returns the capitalized string. * @example * * _.capitalize('FRED'); * // => 'Fred' */ function capitalize(string) { return upperFirst(toString(string).toLowerCase()); } /** * Deburrs `string` by converting * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table) * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A) * letters to basic Latin letters and removing * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks). * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to deburr. * @returns {string} Returns the deburred string. * @example * * _.deburr('déjà vu'); * // => 'deja vu' */ function deburr(string) { string = toString(string); return string && string.replace(reLatin, deburrLetter).replace(reComboMark, ''); } /** * Checks if `string` ends with the given target string. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to inspect. * @param {string} [target] The string to search for. * @param {number} [position=string.length] The position to search up to. * @returns {boolean} Returns `true` if `string` ends with `target`, * else `false`. * @example * * _.endsWith('abc', 'c'); * // => true * * _.endsWith('abc', 'b'); * // => false * * _.endsWith('abc', 'b', 2); * // => true */ function endsWith(string, target, position) { string = toString(string); target = baseToString(target); var length = string.length; position = position === undefined ? length : baseClamp(toInteger(position), 0, length); var end = position; position -= target.length; return position >= 0 && string.slice(position, end) == target; } /** * Converts the characters "&", "<", ">", '"', and "'" in `string` to their * corresponding HTML entities. * * **Note:** No other characters are escaped. To escape additional * characters use a third-party library like [_he_](https://mths.be/he). * * Though the ">" character is escaped for symmetry, characters like * ">" and "/" don't need escaping in HTML and have no special meaning * unless they're part of a tag or unquoted attribute value. See * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands) * (under "semi-related fun fact") for more details. * * When working with HTML you should always * [quote attribute values](http://wonko.com/post/html-escaping) to reduce * XSS vectors. * * @static * @since 0.1.0 * @memberOf _ * @category String * @param {string} [string=''] The string to escape. * @returns {string} Returns the escaped string. * @example * * _.escape('fred, barney, & pebbles'); * // => 'fred, barney, & pebbles' */ function escape(string) { string = toString(string); return (string && reHasUnescapedHtml.test(string)) ? string.replace(reUnescapedHtml, escapeHtmlChar) : string; } /** * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+", * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to escape. * @returns {string} Returns the escaped string. * @example * * _.escapeRegExp('[lodash](https://lodash.com/)'); * // => '\[lodash\]\(https://lodash\.com/\)' */ function escapeRegExp(string) { string = toString(string); return (string && reHasRegExpChar.test(string)) ? string.replace(reRegExpChar, '\\$&') : string; } /** * Converts `string` to * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles). * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the kebab cased string. * @example * * _.kebabCase('Foo Bar'); * // => 'foo-bar' * * _.kebabCase('fooBar'); * // => 'foo-bar' * * _.kebabCase('__FOO_BAR__'); * // => 'foo-bar' */ var kebabCase = createCompounder(function(result, word, index) { return result + (index ? '-' : '') + word.toLowerCase(); }); /** * Converts `string`, as space separated words, to lower case. * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the lower cased string. * @example * * _.lowerCase('--Foo-Bar--'); * // => 'foo bar' * * _.lowerCase('fooBar'); * // => 'foo bar' * * _.lowerCase('__FOO_BAR__'); * // => 'foo bar' */ var lowerCase = createCompounder(function(result, word, index) { return result + (index ? ' ' : '') + word.toLowerCase(); }); /** * Converts the first character of `string` to lower case. * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the converted string. * @example * * _.lowerFirst('Fred'); * // => 'fred' * * _.lowerFirst('FRED'); * // => 'fRED' */ var lowerFirst = createCaseFirst('toLowerCase'); /** * Pads `string` on the left and right sides if it's shorter than `length`. * Padding characters are truncated if they can't be evenly divided by `length`. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to pad. * @param {number} [length=0] The padding length. * @param {string} [chars=' '] The string used as padding. * @returns {string} Returns the padded string. * @example * * _.pad('abc', 8); * // => ' abc ' * * _.pad('abc', 8, '_-'); * // => '_-abc_-_' * * _.pad('abc', 3); * // => 'abc' */ function pad(string, length, chars) { string = toString(string); length = toInteger(length); var strLength = length ? stringSize(string) : 0; if (!length || strLength >= length) { return string; } var mid = (length - strLength) / 2; return ( createPadding(nativeFloor(mid), chars) + string + createPadding(nativeCeil(mid), chars) ); } /** * Pads `string` on the right side if it's shorter than `length`. Padding * characters are truncated if they exceed `length`. * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to pad. * @param {number} [length=0] The padding length. * @param {string} [chars=' '] The string used as padding. * @returns {string} Returns the padded string. * @example * * _.padEnd('abc', 6); * // => 'abc ' * * _.padEnd('abc', 6, '_-'); * // => 'abc_-_' * * _.padEnd('abc', 3); * // => 'abc' */ function padEnd(string, length, chars) { string = toString(string); length = toInteger(length); var strLength = length ? stringSize(string) : 0; return (length && strLength < length) ? (string + createPadding(length - strLength, chars)) : string; } /** * Pads `string` on the left side if it's shorter than `length`. Padding * characters are truncated if they exceed `length`. * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to pad. * @param {number} [length=0] The padding length. * @param {string} [chars=' '] The string used as padding. * @returns {string} Returns the padded string. * @example * * _.padStart('abc', 6); * // => ' abc' * * _.padStart('abc', 6, '_-'); * // => '_-_abc' * * _.padStart('abc', 3); * // => 'abc' */ function padStart(string, length, chars) { string = toString(string); length = toInteger(length); var strLength = length ? stringSize(string) : 0; return (length && strLength < length) ? (createPadding(length - strLength, chars) + string) : string; } /** * Converts `string` to an integer of the specified radix. If `radix` is * `undefined` or `0`, a `radix` of `10` is used unless `value` is a * hexadecimal, in which case a `radix` of `16` is used. * * **Note:** This method aligns with the * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`. * * @static * @memberOf _ * @since 1.1.0 * @category String * @param {string} string The string to convert. * @param {number} [radix=10] The radix to interpret `value` by. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {number} Returns the converted integer. * @example * * _.parseInt('08'); * // => 8 * * _.map(['6', '08', '10'], _.parseInt); * // => [6, 8, 10] */ function parseInt(string, radix, guard) { if (guard || radix == null) { radix = 0; } else if (radix) { radix = +radix; } return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0); } /** * Repeats the given string `n` times. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to repeat. * @param {number} [n=1] The number of times to repeat the string. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {string} Returns the repeated string. * @example * * _.repeat('*', 3); * // => '***' * * _.repeat('abc', 2); * // => 'abcabc' * * _.repeat('abc', 0); * // => '' */ function repeat(string, n, guard) { if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) { n = 1; } else { n = toInteger(n); } return baseRepeat(toString(string), n); } /** * Replaces matches for `pattern` in `string` with `replacement`. * * **Note:** This method is based on * [`String#replace`](https://mdn.io/String/replace). * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to modify. * @param {RegExp|string} pattern The pattern to replace. * @param {Function|string} replacement The match replacement. * @returns {string} Returns the modified string. * @example * * _.replace('Hi Fred', 'Fred', 'Barney'); * // => 'Hi Barney' */ function replace() { var args = arguments, string = toString(args[0]); return args.length < 3 ? string : string.replace(args[1], args[2]); } /** * Converts `string` to * [snake case](https://en.wikipedia.org/wiki/Snake_case). * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the snake cased string. * @example * * _.snakeCase('Foo Bar'); * // => 'foo_bar' * * _.snakeCase('fooBar'); * // => 'foo_bar' * * _.snakeCase('--FOO-BAR--'); * // => 'foo_bar' */ var snakeCase = createCompounder(function(result, word, index) { return result + (index ? '_' : '') + word.toLowerCase(); }); /** * Splits `string` by `separator`. * * **Note:** This method is based on * [`String#split`](https://mdn.io/String/split). * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to split. * @param {RegExp|string} separator The separator pattern to split by. * @param {number} [limit] The length to truncate results to. * @returns {Array} Returns the string segments. * @example * * _.split('a-b-c', '-', 2); * // => ['a', 'b'] */ function split(string, separator, limit) { if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) { separator = limit = undefined; } limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0; if (!limit) { return []; } string = toString(string); if (string && ( typeof separator == 'string' || (separator != null && !isRegExp(separator)) )) { separator = baseToString(separator); if (!separator && hasUnicode(string)) { return castSlice(stringToArray(string), 0, limit); } } return string.split(separator, limit); } /** * Converts `string` to * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage). * * @static * @memberOf _ * @since 3.1.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the start cased string. * @example * * _.startCase('--foo-bar--'); * // => 'Foo Bar' * * _.startCase('fooBar'); * // => 'Foo Bar' * * _.startCase('__FOO_BAR__'); * // => 'FOO BAR' */ var startCase = createCompounder(function(result, word, index) { return result + (index ? ' ' : '') + upperFirst(word); }); /** * Checks if `string` starts with the given target string. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to inspect. * @param {string} [target] The string to search for. * @param {number} [position=0] The position to search from. * @returns {boolean} Returns `true` if `string` starts with `target`, * else `false`. * @example * * _.startsWith('abc', 'a'); * // => true * * _.startsWith('abc', 'b'); * // => false * * _.startsWith('abc', 'b', 1); * // => true */ function startsWith(string, target, position) { string = toString(string); position = position == null ? 0 : baseClamp(toInteger(position), 0, string.length); target = baseToString(target); return string.slice(position, position + target.length) == target; } /** * Creates a compiled template function that can interpolate data properties * in "interpolate" delimiters, HTML-escape interpolated data properties in * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data * properties may be accessed as free variables in the template. If a setting * object is given, it takes precedence over `_.templateSettings` values. * * **Note:** In the development build `_.template` utilizes * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl) * for easier debugging. * * For more information on precompiling templates see * [lodash's custom builds documentation](https://lodash.com/custom-builds). * * For more information on Chrome extension sandboxes see * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval). * * @static * @since 0.1.0 * @memberOf _ * @category String * @param {string} [string=''] The template string. * @param {Object} [options={}] The options object. * @param {RegExp} [options.escape=_.templateSettings.escape] * The HTML "escape" delimiter. * @param {RegExp} [options.evaluate=_.templateSettings.evaluate] * The "evaluate" delimiter. * @param {Object} [options.imports=_.templateSettings.imports] * An object to import into the template as free variables. * @param {RegExp} [options.interpolate=_.templateSettings.interpolate] * The "interpolate" delimiter. * @param {string} [options.sourceURL='lodash.templateSources[n]'] * The sourceURL of the compiled template. * @param {string} [options.variable='obj'] * The data object variable name. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Function} Returns the compiled template function. * @example * * // Use the "interpolate" delimiter to create a compiled template. * var compiled = _.template('hello <%= user %>!'); * compiled({ 'user': 'fred' }); * // => 'hello fred!' * * // Use the HTML "escape" delimiter to escape data property values. * var compiled = _.template('
<%- value %>
'); * compiled({ 'value': '